| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | phenylmethyl acetate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | QUKGYYKBILRGFE-UHFFFAOYAD | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(=O)OCC1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.39.1000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet floral fruity jasmin fresh | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 30.00 ppm. Fruity, sweet, with balsamic and jasmine floral undernotes | |||||||||||||||||||||||||||||||||||
| substantivity : | 4 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.05200 - 1.05600 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.754 to 8.787 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.05900 - 1.06200 @ 15.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.830 to 8.855 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.50100 - 1.50400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | -51.00 - -50.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 206.00 - 210.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 128.00 - 129.00 °C. @ 50.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 1.96 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2490.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 11,875,1973 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 216.00 °F. TCC ( 102.22 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for benzyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 30.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for benzyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 760.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 205-399-7 | |||||||||||||||||||||||||||||||||||
| rtecs : | AF5075000 for 140-11-4 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000140114 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 140-11-4 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 4550 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 151938 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3377885186 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 15, No. 4, 59, (1990)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| acetic acid benzyl ester | |
| acetic acid phenyl methyl ester | |
| alpha- | acetoxytoluene |
| benteine | |
| benzyl acetate | |
| benzyl ethanoate | |
| phenyl methyl acetate | |
| phenyl methyl ethanoate | |
| soluble in : | |
| ethyl alcohol, 5 vol. of 60% alcohol | |
| fixed oils | |
| kerosene | |
| paraffin oil | |
| propylene glycol | |
| water-alcohol mixtures: 30% 1:200, 35% 1:120 40% 1:70 50% 1:20 60% 1:5 | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| allyl cyclohexyl propionate | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl acetate |
| atractylis absolute | |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl alcohol | |
| benzyl butyrate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl isovalerate | |
| benzyl propionate | |
| bois de rose oil | |
| caraway seed oil | |
| cassia bark oil | |
| citronellol | |
| clove bud oil | |
| coriander seed oil | |
| cyclamen aldehyde | |
| dihydrojasmone | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| ginger root oil | |
| green acetate | |
| heliotropin | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| jasmin absolute | |
| lavender absolute | |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| mimosa absolute | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| nonanol | |
| ocean propanal | |
| palmarosa oil | |
| phenethyl acetate | |
| phenethyl isobutyrate | |
| phenethyl propionate | |
| raspberry ketone | |
| rose absolute | |
| rose butanoate | |
| santall | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tuberose absolute | |
| gamma- | undecalactone |
| vanillin | |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| a suma | |
| acacia | |
| aldehydic | |
| almond | |
| amber | |
| ambrene | |
| angel | |
| apple | |
| apricot | |
| balsam | |
| banana | |
| bayberry | |
| bellodgia | |
| bergamot | |
| blackberry | |
| blue grass | |
| blue mist | |
| bluebell | |
| blueberry | |
| bouquet | |
| broom genet genista | |
| bubblegum | |
| butter | |
| carnation dianthus oeillet | |
| cassie acacia farnesiana | |
| cedar | |
| chanel #5 | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| cinq fleurs forvil | |
| citrus | |
| coconut | |
| coffee | |
| cologne | |
| crabapple blossom | |
| cranberry | |
| decumaria | |
| elder blossom | |
| fern fougere | |
| floral | |
| florida breeze | |
| fresh | |
| gardenia | |
| ginger white ginger | |
| grape | |
| heather | |
| heliotrope | |
| herbal | |
| hibiscus | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jasmin | |
| jicky | |
| jonquil narcissus jonquilla | |
| joy | |
| lemon | |
| licorice | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| lumiere | |
| lux beauty shower soap | |
| magnolia | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| mint | |
| muguet lily of the valley | |
| mulberry | |
| musk | |
| my sin | |
| narcissus narcisse | |
| neroli | |
| new car | |
| olive | |
| orange blossom fleur d'oranger | |
| orchid | |
| oriental | |
| outdoors fresh outdoors | |
| passion fruit | |
| peach | |
| pear | |
| petunia | |
| pina colada | |
| pineapple | |
| plum | |
| plum greengage plum | |
| potpourri | |
| powder | |
| presence | |
| quince | |
| rain | |
| raspberry | |
| rose | |
| rose d'orient | |
| rose tea rose | |
| rose white rose | |
| sandalwood | |
| scandal | |
| shalimar | |
| spice | |
| strawberry | |
| sweet pea pois de senteur | |
| tabu | |
| tea | |
| tide | |
| tuberose tubereuse | |
| tutti frutti | |
| violet | |
| wallflower giroflee | |
| woodruff asperula | |
| woody | |
| ylang ylang cananga | |
| zibeline | |
| natural occurrence in : | |
| data page | cananga oil china @ 24.14% |
| data page | cassie absolute @ 0.75% |
| data page | champaca absolute (michelia alba dc.) @ 0.33% |
| data page | champaca absolute @ 4.00% |
| data page | champaca concrete @ 0.60% |
| gardenia | |
| hyacinth | |
| jasmin | |
| data page | jasmin absolute china @ 23.92% |
| data page | jasmin absolute concrete egypt @ 26.08% |
| data page | jasmin absolute concrete india @ 24.15-29.65% |
| data page | jasmin absolute concrete italy @ 26.84% |
| data page | jasmin sambac absolute egypt @ 21.20% |
| loiseleuria procumbens desv. (azalea) | |
| data page | narcissus absolute @ 24.14% |
| data page | narcissus absolute @ 9.53% |
| data page | narcissus absolute @ 9.58% |
| neroli | |
| data page | osmanthus absolute @ 0.08% |
| strawberry | |
| tuberose | |
| ylang ylang | |
| data page | ylang ylang oil @ 11.63% |
| data page | ylang ylang oil CO2 extract @ 6.15% |
| data page | ylang ylang oil I (cananga odorata hook. f. and thomas.) @ 7.68% |
| data page | ylang ylang oil II (cananga odorata hook. f. and thomas.) @ 1.68% |
| data page | ylang ylang oil III @ 0.69% |