Notes :
Blends well with aldehydes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | 6-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one | |||||||||||||||||||||||||
| InChI : | InChI=1/C13H22O/c1-9(2)10-3-4-12-8-13(14)6-5-11(12)7-10/h9-12H,3-8H2,1-2H3 | |||||||||||||||||||||||||
| InChIKey : | HEKJOMVJRYMUDB-UHFFFAOYAM | |||||||||||||||||||||||||
| SMILES : | CC(C)C1CCC2CC(=O)CCC2C1 | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||
| Givaudan : | Decatone
Odor: Citrus, Woody, Fresh, Fruity | |||||||||||||||||||||||||
| Penta : | decatone | |||||||||||||||||||||||||
| Vigon : | Decatone | |||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||
| odor description :¹ at 100.00 %. | gardenia green grapefruit rhubarb vetiver woody | |||||||||||||||||||||||||
| odor sample from : | Givaudan Corporation | |||||||||||||||||||||||||
| substantivity : | 140 Hour(s) | |||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||
| appearence : | pale yellow clear liquid | |||||||||||||||||||||||||
| assay : | 95.00 to 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.96000 @ 25.00 °C. | |||||||||||||||||||||||||
| refractive index : | 1.48600 @ 20.00 °C. | |||||||||||||||||||||||||
| boiling point : | 273.00 to 274.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| flash point : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||||
| logP (o/w) : | 3.68 | |||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | None - None found. | |||||||||||||||||||||||||
|
S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||
|
Oral-Rat 5000.00 mg/kg | ||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||
|
Skin-Rabbit 5000.00 mg/kg | ||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||
| recommendation for gardenia decalone usage levels up to : | ||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for gardenia decalone usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||
| 6-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one | ||||||||||||||||||||||||||
| (EINECS) number : | 251-840-1 | |||||||||||||||||||||||||
| chemidplus : | 034131981 | |||||||||||||||||||||||||
| EPA Substance Registry Services : | 34131-98-1 | |||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||
| 6-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one | ||||||||||||||||||||||||||
| pubchem : | 694846 | |||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1986)¹ | |||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||
| synonyms : | |
| decatone | |
| 3,4,4a,5,6,7,8,8a- | octahydro-6-isopropyl naphthalene-2(1H)-one |
| 6- | propan-2-yl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
| 6-iso | propyl decalone |
| iso | propyl octahydonaphthalenone |
| 6-iso | propyl-2(1H)-octahydronaphthalenone |
| 6-iso | propyl-3,4,4a,5,6,7,8,8a-octahydro-2(1H)-naphthalenone |
soluble in : | |
| alcohol | |
| water, 32 mg/L @ 20C | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| acetyl cedrene | |
| aldehydes | |
| algae absolute | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| basil oil | |
| bay leaf oil | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl isobutyrate | |
| benzyl propionate | |
| benzyl salicylate | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl salicylate |
| caraway seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| coriander seed oil | |
| cortex pyridine | |
| para- | cresyl caprylate |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl hydroquinone | |
| diphenyl oxide | |
| ethyl cinnamate | |
| ethyl laurate | |
| fennel seed oil | |
| floral pyranol | |
| fruity cyclopentanone | |
| galbanum oil | |
| geraniol | |
| geranyl acetate | |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl formate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| hyacinth ether | |
| ionones | |
| 2,4- | ivy carbaldehyde |
| leaf acetal | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| mandarin oil | |
| melon heptenal | |
| melon nonenoate | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptenone | |
| methyl jasmonate | |
| mimosa absolute | |
| muguet octadienol | |
| nerol | |
| nerolidol | |
| neryl acetate | |
| (E,Z)-2,6- | nonadien-1-ol |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| (Z)-5- | octen-1-ol |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl propionate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propyl alcohol |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| para- | tolyl acetate |
| para- | tolyl isobutyrate |
| para- | tolyl methyl ether |
| para- | tolyl phenyl acetate |
| tuberose absolute | |
| gamma- | undecalactone |
| verbena oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody amylene | |
| ylang ylang oil | |
(odor and/or flavor) used in : | |
| aldehydic | |
| algae | |
| angel | |
| apple crabapple | |
| apple green apple | |
| arrack | |
| artichoke | |
| avocado | |
| banana | |
| bark | |
| basil | |
| bergamot | |
| blossom tropical blossom | |
| blue mist | |
| bouquet | |
| broccoli | |
| carrot seed | |
| celery | |
| cherry blossom | |
| christmas blends | |
| citronella | |
| citrus | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cucumber | |
| curacao | |
| daffodil narcissus | |
| dill | |
| dillenia | |
| durian | |
| earth humus | |
| evergreen | |
| fennel | |
| fern fougere | |
| fig | |
| fir balsam | |
| fir needle | |
| fixer | |
| floral | |
| foliage | |
| frangipanni plumeria | |
| freesia | |
| fruit tropical fruit | |
| galbanum | |
| gardenia | |
| gooseberry | |
| grapefruit | |
| green | |
| hibiscus | |
| hyacinth jacinthe | |
| iris blossom | |
| ivy leaf | |
| jackfruit | |
| jasmin | |
| juniperberry | |
| kiwi | |
| kumquat | |
| leaf autumn leaf | |
| leaf green leaf | |
| lilac lilas syringa | |
| lily | |
| lily water lily | |
| lotus | |
| magnolia | |
| mango blossom | |
| marigold tagete | |
| mimosa wattle | |
| mulberry | |
| narcissus narcisse | |
| nectarine | |
| orange | |
| orange blossom fleur d'oranger | |
| orchid | |
| osmanthus | |
| pansy | |
| passion blossom | |
| passion fruit | |
| peach | |
| pear prickly pear | |
| petal flower petal | |
| petunia | |
| pina colada | |
| pine | |
| powder | |
| redwood | |
| rose wild rose | |
| sherry | |
| spearmint | |
| stock evening scented stock | |
| tea | |
| tobasco | |
| tomato | |
| tropical | |
| tulip | |
| vegetable | |
| vetiver | |
| vine | |
| wallflower giroflee | |
| wasabi | |
| weedy | |
| woody | |
| wormwood absinthium | |
| ylang ylang cananga | |
natural occurrence in : | |
| not found in nature | |