Notes :
musk enhancer - aldehyde C-14 and musk gx.
waxy floral fruity accord:
0.05 - leerall
0.01 - aldehyde C-14
0.05 - aldehyde C18 10%
0.01 - musk gx
0.01 - raspberry ketone 10%
0.01 - aldehyde C-16 10%
rose accord:
0.01 - dihydromyrcenol
0.05 - benzyl propionate
0.05 - linalyl acetate
0.05 - phenethyl alcohol
0.01 - aldehyde C-14 10%
0.20 - amyl cinnamaldehyde
0.01 - ma/hy shiff
0.05 - naphthyl ethyl ether
0.01 - aldehyde C-16 10%
0.05 - geraniol
new car accord:
0.01 - dimethyl benzyl carbinyl acetate
0.01 - alpha-ionone
0.05 - heptyl cyclopentanone
0.01 - musk gx
0.05 - aldehyde C-14
0.01 - dihydroisojasmonate
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 5-heptyloxolan-2-one | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | PHXATPHONSXBIL-UHFFFAOYAL | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCCCCCC1CCC(=O)O1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| IUPAC name : | (5S)-5-heptyloxolan-2-one | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3/t10-/m0/s1 | |||||||||||||||||||||||||||||||||||
| InChIKey : | PHXATPHONSXBIL-JTQLQIEIBD | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCCCCC[C@H]1CCC(=O)O1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2932.29.6000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | creamy fatty fruity sweet peach oily apricot fresh | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 30.00 ppm. Fatty, coconut, creamy, vanilla, nutty, macadamia and peach | |||||||||||||||||||||||||||||||||||
| substantivity : | 338 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear oily liquid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.94100 - 0.94700 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.830 to 7.880 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.94200 - 0.94800 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.848 to 7.898 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.44900 - 1.45400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 164.00 - 166.00 °C. @ 13.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 297.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 3.06 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Gavage-Rat [sex: M,F] 18500.00 mg/kg (Jenner et al., 1964) | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 1200.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 200.00 °F. TCC ( 93.33 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for gamma-undecalactone (aldehyde C-14) usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for gamma-undecalactone (aldehyde C-14) usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 90.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-225-4 | |||||||||||||||||||||||||||||||||||
| rtecs : | YQ2485000 for 104-67-6 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000104676 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 104-67-6 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 46118 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 104-67-6 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 104-67-6 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 233 | |||||||||||||||||||||||||||||||||||
| fl. number : | 10.002 | |||||||||||||||||||||||||||||||||||
| pubchem : | 150805 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 758888965 | |||||||||||||||||||||||||||||||||||
| pubchem : | 36885377 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 23, No. 2, 43, (1998)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| abriceine | |
| aldehyde C-14 | |
| 1,4- | hendecanolide |
| hendecylene methyl lactone | |
| gamma- | heptyl butyrolactone |
| gamma-N- | heptyl butyrolactone |
| 5- | heptyl dihydro-2(3H)-furanone |
| 4- | heptyl-4-hydroxybutanoic acid lactone |
| 4-N- | heptyl-4-hydroxybutanoic acid lactone |
| gamma- | heptyl-gamma-butyrolactone |
| 4- | hydroxyundecanoic acid gamma-lactone |
| 4- | hydroxyundecanoic acid lactone |
| peach aldehyde | |
| peach lactone | |
| gamma- | undecalactone |
| undecan-4-olide | |
| gamma- | undecanolactone |
| 1,4- | undecanolide |
| 4- | undecanolide |
| gamma- | undecanolide |
| gamma- | undecyl lactone |
| undecylene methyl lactone | |
| soluble in : | |
| alkali | |
| benzyl alcohol | |
| benzyl benzoate | |
| dipropylene glycol | |
| ethyl alcohol, 1:2 in 70% alcohol | |
| ethyl alcohol, 4.5 vol. 60% alcohol | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| cream | |
| detergent powder | |
| hair spray | |
| lotion | |
| non-discoloring in most media | |
| powder | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| allyl cyclohexyl propionate | |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| beeswax absolute | |
| benzophenone | |
| benzyl salicylate | |
| caramel furanone | |
| cassia bark oil | |
| coriander seed oil | |
| costus valerolactone | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| floral pyranol | |
| green acetate | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| lavender absolute | |
| leerall | |
| lilyall | |
| laevo- | linalool |
| linalool oxide | |
| madescol | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| 2- | methyl undecanal |
| musks | |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| oakmoss absolute | |
| ocean propanal | |
| peru balsam oil | |
| raspberry ketone methyl ether | |
| rose absolute | |
| rose butanoate | |
| sandalwood oil | |
| santall | |
| strawberry glycidate 1 | |
| tonka bean absolute | |
| vanilla absolute | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| watermelon ketone | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| apple | |
| apple green apple | |
| apple red apple | |
| apricot | |
| arpege | |
| blue grass | |
| blue mist | |
| bluebell | |
| blueberry | |
| bouquet | |
| bubblegum | |
| butterscotch | |
| cabochard | |
| calyx | |
| cedar | |
| chamade | |
| cherry | |
| cherry blossom | |
| chloe | |
| citrus | |
| coconut | |
| coconut tropical coconut | |
| cream | |
| cucumber | |
| currant | |
| date | |
| diorella | |
| femme | |
| fetes | |
| fig | |
| floral | |
| fracas | |
| fruit | |
| fruit juicy fruit | |
| gardenia | |
| gooseberry | |
| grape | |
| green | |
| grenadine | |
| habuba | |
| herbal | |
| hibiscus | |
| jasmin | |
| joy | |
| kiwi | |
| leather russian leather | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| lotus | |
| magnolia | |
| mango | |
| maple | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| mitsouko | |
| muguet lily of the valley | |
| mulberry | |
| my sin | |
| nahema | |
| neroli | |
| nut | |
| nut pistachio | |
| ocean sea breeze | |
| papaya | |
| passion blossom | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pina colada | |
| plum | |
| poison | |
| powder | |
| raspberry | |
| rose | |
| shalimar | |
| spice | |
| strawberry | |
| tabu | |
| tide | |
| tropical | |
| tutti frutti | |
| vanilla | |
| violet | |
| wintergreen | |
| woody | |
| natural occurrence in : | |
| apple juice | |
| apricot | |
| butter | |
| meat | |
| milk products | |
| data page | osmanthus absolute @ trace% |
| passion fruit | |
| peach | |