Notes :
Adds a floral fresh note to floral fragrances.
new car accord:
0.01 - dimethyl benzyl carbinyl acetate
0.01 - alpha-ionone
0.05 - heptyl cyclopentanone
0.01 - musk gx
0.05 - aldehyde C-14
0.01 - dihydroisojasmonate
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | (2-methyl-1-phenylpropan-2-yl) acetate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H16O2/c1-10(13)14-12(2,3)9-11-7-5-4-6-8-11/h4-8H,9H2,1-3H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | FLUWAIIVLCVEKF-UHFFFAOYAP | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(=O)OC(C)(C)CC1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.39.9050 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet floral fruity rose jasmin green | |||||||||||||||||||||||||||||||||||
| substantivity : | 44 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | white to pale yellow crystalline solid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.99500 - 1.00300 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.279 to 8.346 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.49000 - 1.49500 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 29.50 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 250.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.91 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3300.00 mg/kg FCTXAV 12,533,1974 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 205.00 °F. TCC ( 96.11 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for dimethyl benzyl carbinyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for dimethyl benzyl carbinyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 20.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 205-781-3 | |||||||||||||||||||||||||||||||||||
| rtecs : | SG8100000 for 151-05-3 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000151053 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 151-05-3 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 46123 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 152205 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2871196901 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| benzyl dimethyl carbinol acetate | |
| benzyl dimethyl carbinyl acetate | |
| benzyl propyl acetate | |
| 2- | benzyl-2-propyl acetate |
| alpha,alpha- | dimethyl benzene ethyl acetate |
| dimethyl benzyl carbinol acetate | |
| dimethyl benzyl carbinyl acetate | |
| alpha,alpha- | dimethyl phenethyl acetate |
| alpha,alpha- | dimethyl phenethyl alcohol acetate |
| alpha,alpha- | dimethyl phenyl ethyl acetate |
| soluble in : | |
| alcohol | |
| fixed oils | |
| isopropyl myristate | |
| insoluble in : | |
| water | |
| stability : | |
| acid cleaner | |
| alcoholic lotion | |
| antiperspirant | |
| bleach | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| liquid detergent | |
| non-discoloring in most media | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzophenone | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| iso | bornyl acetate |
| iso | butyl cinnamate |
| cassia bark oil | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cortex pyridine | |
| costus valerolactone | |
| para- | cresyl caprylate |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| davana oil | |
| gamma- | decalactone |
| decanal | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl benzyl carbinyl isobutyrate | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| eugenol | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| fir needle oil | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| geranyl acetate | |
| grapefruit oil | |
| green acetate | |
| heliotropin | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl isovalerate | |
| hexyl tiglate | |
| hyacinth ether | |
| ionones | |
| labdanum resinoid | |
| leaf acetal | |
| leerall | |
| lilyall | |
| linalool | |
| linalool oxide | |
| linalyl acetate | |
| maltol | |
| methyl anthranilate | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| mimosa absolute | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| neryl acetate | |
| nonanal | |
| nonanol | |
| nutmeg oil | |
| ocean propanal | |
| orange oil | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| pepper oil black | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| tobacco dodecane | |
| para- | tolyl aldehyde |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| violet leaf absolute | |
| violet methyl carbonate | |
| watermelon ketone | |
| woody amylene | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| agrumen | |
| almond blossom | |
| amber | |
| apple blossom | |
| apple crabapple | |
| apple green apple | |
| apple red apple | |
| balsam | |
| blossom | |
| blossom tropical blossom | |
| boronia | |
| brandy | |
| butterscotch | |
| carrot seed | |
| cedar forest | |
| cherry blossom | |
| chestnut blossom | |
| clematis | |
| clove blossom | |
| clover trefle le'trefle incarnat | |
| crabapple blossom | |
| cranberry | |
| cyclamen | |
| daffodil narcissus | |
| dahlia | |
| daisy | |
| daphne | |
| davana | |
| dillenia | |
| fagonia | |
| fetes | |
| fig | |
| floral | |
| flouve blossom | |
| freesia | |
| fruit dried fruit | |
| fruit jam | |
| fruit tropical fruit | |
| gardenia | |
| green | |
| herbal | |
| hibiscus | |
| honey miel | |
| hugonia | |
| hyacinth jacinthe | |
| hydrangea | |
| immortelle helichrysum everlasting | |
| ivy leaf | |
| jasmin | |
| jonquil narcissus jonquilla | |
| kewda | |
| kiwi blossom | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| lotus | |
| mango blossom | |
| marigold tagete | |
| millefleurs | |
| muguet lily of the valley | |
| mulberry | |
| myrtle | |
| new car | |
| orange blossom fleur d'oranger | |
| orchid | |
| oriental | |
| pansy | |
| passion blossom | |
| peach | |
| peach blossom | |
| pear blossom | |
| peony | |
| petunia | |
| phlox | |
| plum blossom | |
| plum mirabille blossom | |
| poison | |
| poppy | |
| poppy red poppy | |
| powder | |
| privet blossom | |
| rain | |
| raspberry | |
| rhubarb | |
| rose | |
| rose tea rose | |
| rose wild rose | |
| rue | |
| spice | |
| stock evening scented stock | |
| sweet pea pois de senteur | |
| tea | |
| tide | |
| tropical | |
| tuberose tubereuse | |
| tulip | |
| vanilla | |
| violet | |
| wistaria wisteria glycine | |
| natural occurrence in : | |
| not found in nature | |