| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 2-methyl-3-methylsulfanylfuran |
| InChI : | InChI=1/C6H8OS/c1-5-6(8-2)3-4-7-5/h3-4H,1-2H3 |
| InChIKey : | OQVAOEIMSKZGAL-UHFFFAOYAK |
| SMILES : | CC1=C(C=CO1)SC |
| cas number : | 63012-97-5 |
| fema number : | 3949 |
| jecfa number : | 1061 |
| fl. number : | 13.152 |
| molar refractivity : | 36.49 ± 0.4 cm3 |
| parachor : | 289.5 ± 6.0 cm3 |
| index of refraction : | 1.528 ± 0.03 |
| surface tension : | 35.8 ± 5.0 dyne/cm |
| density : | 1.08 ± 0.1 g/cm3 |
| polarizability : | 14.46 ± 0.5 10-24cm3 |
| xlogp : | 1.60 |
| molecular weight : | 128.1921200 |
| formula : | C6 H8 O S |
|
|
| |
| |
| export tariff code : | unspecified |
| fda reg : | unspecified |
| |
Suppliers :
|
| Sigma-Aldrich-SAFC : | 2-Methyl-3-methylthiofuran |
| | ≥98%, Kosher |
| |
| |
organoleptics :
|
| odor type : | sulfurous |
| odor strength : | high , recommend smelling in a 10.00 % solution or less |
odor description : at 10.00 % in triacetin. | beefy cheese coffee minty spicy |
properties :
|
| appearence : | colorless to pale yellow clear liquid |
| assay : | 10.00 - 15.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 1.14300 - 1.15000 @ 20.00 °C.
|
| pounds per gallon - calc. : | 9.522 to 9.580
|
| refractive index : | 1.43700 - 1.44400 @ 20.00 °C.
|
| logp : | 2.33 |
safety :
|
| most important hazard(s) : |
Xi - Irritant |
| | |
| Oral Toxicity(LD50) : |
Not determined
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 100.00 °F. TCC ( 37.78 °C. )
|
| | |
| recommendation for 2-methyl 3-(methyl thio) furan usage levels up to : | | | not for fragrance use.
|
| | |
safety links :
|
| chemidplus : | 63012-97-5 |
| epa-srs : | 63012-97-5 |
| | |
other :
|
| |
|
references :
|
| jecfa number : | 1061 |
| fl. number : | 13.152 |
| pubchem : | 11077778 |
| NIST Chemistry WebBook : | 2594154694 |
| | |
|
| synonyms : |
| | dimethyl thiofurane | | 2- | methyl 3-(methyl thio) furan | | 2- | methyl-3-(methyl thio) furan | | 2- | methyl-3-methyl thiofuran | | 2- | methyl-3-methylthiofuran |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| 4- | acetyl-2-methyl pyrimidine |
| 4- | allyl-2,6-dimethoxyphenol |
| 4- | aminobutyric acid |
| | amyl mercaptan |
| | bacon dithiazine |
| 1,3- | butane dithiol |
| 2,3- | butane dithiol |
| 2-(2- | butyl)-4,5-dimethyl-3-thiazoline |
| | butyraldehyde |
| | coffee difuran |
| | cyclopropyl (E,Z)-2,6-nonadienamide |
| 2,5- | diethyl thiazole |
| 3,5- | diethyl-2-methyl pyrazine |
| 2,5- | diethyl-3-methyl pyrazine |
| | difurfuryl sulfide |
| 2,5- | dihydroxy-1,4-dithiane |
| N-(2,4- | dimethoxybenzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N-(2-(3,4- | dimethoxyphenyl)ethyl)-3,4-dimethoxycinnamic acid amide |
| 2,5- | dimethyl furan |
| | dimethyl tetrasulfide |
| 2,4- | dimethyl thiazole |
| 2,6- | dimethyl thiophenol |
| | dimethyl trisulfide |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 3,7- | dimethyl-2,6-octadien-1-yl cyclopropyl carboxamide |
| 2,6- | dimethyl-3-((2-methyl-3-furyl)thio)-4-heptanone |
| 2,5- | dimethyl-3-furan thiol |
| bis(2,5- | dimethyl-3-furyl) disulfide |
| 2,5- | dimethyl-3-thiofuroyl furan |
| 1,1- | ethane dithiol 1% in ethanol |
| | ethyl (E,Z)-2,6-nonadienamide |
| S- | ethyl 2-acetyl aminoethane thioate |
| | ethyl 3-mercaptopropionate |
| | ethyl 4-(acetyl thio) butyrate |
| S- | ethyl thioacetate |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline |
| | fish thiol |
| | furfuryl isopropyl sulfide |
| | furfuryl propionate |
| 4- | furfuryl thio-2-pentanone |
| | hazelnut pyrazine |
| N-( | heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide |
| 1,6- | hexane dithiol |
| | hexyl mercaptan |
| | meaty dithiane |
| 3- | mercapto-2-butanone |
| 4- | mercapto-2-pentanone 1% in acetoin |
| 2- | mercapto-3-pentanone |
| 2- | mercaptomethyl pyrazine |
| 2- | mercaptopropionic acid |
| N1-(2- | methoxy-4-methyl benzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N1-(2- | methoxy-4-methyl benzyl)-N2-2(2-(5-methyl pyridin-2-yl)ethyl) oxalamide |
| | methyl 2-methyl-3-furyl disulfide |
| 4- | methyl 4-mercaptopentan-2-one 1% in pg |
| | methyl dihydrofuran thiol |
| 4- | methyl nonanoic acid |
| 2- | methyl pyrazine |
| 2- | methyl thiazolidine |
| 2-( | methyl thio) ethanol |
| 12- | methyl tridecanal |
| 2- | methyl-1-methyl thio-2-butene |
| 3- | methyl-2-butane thiol |
| 2- | methyl-3-(methyl thio) pyrazine |
| 2- | methyl-3-furyl tetrasulfide |
| bis(2- | methyl-3-furyl) disulfide |
| S-(2- | methyl-3-furyl) ethane thioate |
| 3-((2- | methyl-3-furyl)thio)-4-heptanone |
| 4-((2- | methyl-3-furyl)thio)-5-nonanone |
| 2- | methyl-3-tetrahydrofuran thiol |
| 2- | naphthyl mercaptan |
| 1,9- | nonane dithiol |
| | nutty thiazole |
| 1,8- | octane dithiol |
| | peanut dithiazine |
| 1- | phenethyl mercaptan |
| 1,3- | propane dithiol |
| 2- | propionyl-2-thiazoline |
| | propyl 2-mercaptopropionate |
| | propyl 2-methyl-3-furyl disulfide |
| iso | propyl disulfide |
| iso | propyl mercaptan |
| | pyrazinyl ethane thiol |
| 2- | pyridinyl methane thiol |
| | pyrrolidino-(1,2E)-4H-2,4-dimethyl-1,3,5-dithiazine |
| | roasted butanol |
| | rum ether |
| | sulfuryl acetate |
| 3- | tetrahydrothiophenone |
| | thialdine |
| | thiazole |
| 3- | thienyl mercaptan |
| 1-(2- | thienyl) butanone |
| ortho- | thiocresol |
| | thioguaiacol |
| | tyramine |
| (odor and/or flavor) used in : |
| | chocolate cocoa | | | coffee | | | meat | | | nut | | | wasabi |
| natural occurrence in : |
| beef cooked beef |
| coffee |
| tea |
|