| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | (2Z)-2-(6,6-dimethyl-5-bicyclo[2.2.1]heptanylidene)ethanol | |||||||||||||||||||||||||
| InChI : | InChI=1/C11H18O/c1-11(2)9-4-3-8(7-9)10(11)5-6-12/h5,8-9,12H,3-4,6-7H2,1-2H3 | |||||||||||||||||||||||||
| InChIKey : | JGDHOHFQJJATNG-UHFFFAOYAO | |||||||||||||||||||||||||
| SMILES : | CC\1(C2CCC(C2)/C1=C/CO)C | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||
| odor type : | woody | |||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||
| odor description :¹ at 100.00 %. | dry sawdust woody patchouli camphor mint | |||||||||||||||||||||||||
| odor sample from : | International Flavors & Fragrances Inc. | |||||||||||||||||||||||||
| substantivity : | 156 Hour(s) | |||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||
| appearence : | colorless clear slightly viscous liquid | |||||||||||||||||||||||||
| assay : | 75.00 to 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.98100 to 0.98800 @ 25.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.163 to 8.221 | |||||||||||||||||||||||||
| specific gravity : | 0.98200 to 0.98900 @ 20.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.181 to 8.239 | |||||||||||||||||||||||||
| refractive index : | 1.50100 to 1.50500 @ 20.00 °C. | |||||||||||||||||||||||||
| boiling point : | 241.00 to 242.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| flash point : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||
| logP (o/w) : | 3.22 | |||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||
| recommendation for patchouli ethanol usage levels up to : | ||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for patchouli ethanol usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||
| (2Z)-2-(6,6-dimethyl-5-bicyclo[2.2.1]heptanylidene)ethanol | ||||||||||||||||||||||||||
| (EINECS) number : | 218-755-1 | |||||||||||||||||||||||||
| chemidplus : | 002226053 | |||||||||||||||||||||||||
| EPA Substance Registry Services : | 2226-05-3 | |||||||||||||||||||||||||
| dtp/nci : | 18920 | |||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||
| (2Z)-2-(6,6-dimethyl-5-bicyclo[2.2.1]heptanylidene)ethanol | ||||||||||||||||||||||||||
| pubchem : | 672257 | |||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1990)¹ | |||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||
| synonyms : | |
| 2-(3,3- | dimethyl bicyclo(2.2.1)hept-2-ylidene) ethanol |
| 2- | dimethyl bicyclohept-2-ylidene ethanol |
| 2,2- | dimethyl-1-norbornylidene ethanol |
| 3,3- | dimethyl-2-norbornane-2-ethanol |
| (2Z)-2-(6,6- | dimethyl-5-bicyclo[2.2.1]heptanylidene)ethanol |
| 3,3- | dimethyl-delta-2,beta-norbornane ethanol |
| 3,3- | dimethyl-delta(2,beta)-norbornane ethanol |
| patchomint | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| 1- | allyl-2,2,7,7-tetramethyl cycloheptanol |
| borneol | |
| laevo- | borneol |
| iso | bornyl methyl ether |
| iso | bornyl propionate |
| buchu leaf oil | |
| 2-tert- | butyl cyclohexanone |
| para-tert- | butyl cyclohexanone |
| carvacrol | |
| cedarleaf oil terpeneless | |
| alpha- | cedrene epoxide |
| herbal dioxane | |
| herbal norbornane | |
| hinoki root oil | |
| lavandin concrete | |
| methyl cyclogeranate | |
| methyl delta-ionone | |
| ocimene quintoxide | |
| origanum oil | |
| origanum oil turkey | |
| patchouli hexanol | |
| patchouli indene | |
| patchouli oil china | |
| peppermint cyclohexanone | |
| pinacol | |
| pine hexanol | |
| pinocarveol | |
| rosemary absolute | |
| rosemary oil | |
| rosemary oil morocco | |
| sassafras oil | |
| woody dodecane | |
| woody epoxide | |
| woody ether | |
(odor and/or flavor) used in : | |
| amber | |
| ambergris | |
| ambreine | |
| amyris | |
| angelica | |
| ash mountain ash | |
| bark | |
| bayberry | |
| beech wood tar | |
| benzoin | |
| bergamot | |
| birch tar | |
| bois de rose rosewood | |
| boronia | |
| boxwood | |
| buchu | |
| cabreuva | |
| cade | |
| calamus | |
| cardamom | |
| cascarilla | |
| cassie acacia farnesiana | |
| cedar | |
| cedar forest | |
| cedarwood | |
| cedarwood atlas | |
| celery | |
| cigar box | |
| cistus | |
| citronella | |
| clary sage | |
| costus | |
| cypress | |
| dogwood | |
| elemi | |
| estragon | |
| fern fougere | |
| forest | |
| forest pine forest | |
| galanga | |
| galbanum | |
| ginger | |
| gingergrass | |
| grass sweet grass | |
| guaiacwood | |
| gurjun | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hinoki | |
| hyssop | |
| iris blossom | |
| juniper | |
| juniperberry | |
| labdanum | |
| mace | |
| maja | |
| mimosa wattle | |
| mint | |
| oakwood | |
| olibanum frankincense | |
| opoponax | |
| orange bitter orange | |
| oregano | |
| oriental | |
| orris iris | |
| osmanthus | |
| patchouli | |
| pine dwarf pine | |
| pine needle | |
| pine scotch pine | |
| pinon cone | |
| redwood | |
| sandalwood | |
| spice | |
| spikenard | |
| spruce | |
| tansy tanaisie | |
| tarragon | |
| timber | |
| tolu balsam | |
| valerian | |
| vetiver | |
| woody | |
| wormseed chenopodium | |
natural occurrence in : | |
| not found in nature | |