| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 3-methylbutanoic acid | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7) | |||||||||||||||||||||||||||||||||
| InChIKey : | GWYFCOCPABKNJV-UHFFFAOYAV | |||||||||||||||||||||||||||||||||
| SMILES : | CC(C)CC(=O)O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2915.60.0000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | cheesy | |||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description : at 1.00 % in propylene glycol. | sour stinky feet sweaty | |||||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Cheesey, dairy, creamy, fermented, sweet, waxy and berry | |||||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.92300 - 0.92800 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.680 to 7.722 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.40100 - 1.40500 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| melting point : | -29.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 175.00 - 177.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 1.16 | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | T - Toxic. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2.00 ml/kg | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 310.00 ul/kg | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 159.00 °F. TCC ( 70.56 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for isovaleric acid usage levels up to : | ||||||||||||||||||||||||||||||||||
| not for fragrance use. | ||||||||||||||||||||||||||||||||||
| recommendation for isovaleric acid usage levels up to : | ||||||||||||||||||||||||||||||||||
| 80.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| (EINECS) number : | 207-975-3 | |||||||||||||||||||||||||||||||||
| rtecs : | NY1400000 for 503-74-2 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000503742 | |||||||||||||||||||||||||||||||||
| epa-srs : | 503-74-2 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 62783 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| jecfa number : | 259 | |||||||||||||||||||||||||||||||||
| fl. number : | 08.008 | |||||||||||||||||||||||||||||||||
| pubchem : | 153713 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1848049450 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 18, No. 5, 39, (1993)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| iso | butyl formic acid |
| delphinic acid | |
| dephinic acid | |
| 3- | methyl butanoic acid |
| 3- | methyl butyric acid |
| beta- | methyl butyric acid |
| iso | pentanoic acid |
| iso | propyl acetic acid |
| iso | valerianic acid |
| iso | valeric acid |
| soluble in : | |
| alcohol | |
| chloroform | |
| ether | |
| water, 40700 mg/L @ 20C | |
| water, 1 part to 25 parts water | |
| (odor and/or flavor) used in : | |
| apple | |
| banana | |
| blackberry | |
| butter | |
| cheese blue cheese | |
| cream | |
| dairy | |
| fruit | |
| nut | |
| passion fruit | |
| pear | |
| sherry | |
| strawberry | |
| natural occurrence in : | |
| apple | |
| arctic bramble | |
| artemisia frigida | |
| banana | |
| barley roasted barley | |
| beer | |
| blackberry | |
| brandy | |
| cajeput | |
| cheese | |
| cider | |
| cinnamon | |
| citronella | |
| citrus fruits | |
| cocoa | |
| coffee | |
| currant | |
| cymbopogon javanensis | |
| cypress | |
| dolphin fat | |
| eucalyptus goniocalyx | |
| fish | |
| geranium | |
| grape | |
| honey | |
| hop | |
| laurel leaves | |
| lavender | |
| data page | lavender oil spike spain @ 0.106% |
| lemongrass | |
| marjoram sweet | |
| milk | |
| monarda fistulosa | |
| mushroom | |
| niaouli | |
| data page | osmanthus absolute @ trace% |
| papaya | |
| passion fruit | |
| peach | |
| peanut roasted peanut | |
| pear | |
| peas | |
| peppermint american | |
| persea pubescens | |
| petitgrain lemon petitgrain | |
| pilot whale | |
| potato chip | |
| raspberry fruit | |
| rosemary | |
| rue leaf | |
| rum | |
| seal fat | |
| sherry | |
| soya bean | |
| spearmint | |
| strawberry | |
| tea | |
| thymus mastichina | |
| tobacco | |
| tomato | |
| trassi cooked trassi | |
| valerian root | |
| data page | valerian root oil CO2 extract china @ 0.21% |
| vinegar | |
| whiskey | |