| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 5-ethyl-3-hydroxy-4-methyl-5H-furan-2-one | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C7H10O3/c1-3-5-4(2)6(8)7(9)10-5/h5,8H,3H2,1-2H3 | |||||||||||||||||||||||||||||||
| InChIKey : | IUFQZPBIRYFPFD-UHFFFAOYAM | |||||||||||||||||||||||||||||||
| SMILES : | CCC1C(=C(C(=O)O1)O)C | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2932.19.0000 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | caramellic | |||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description : at 1.00 % in dipropylene glycol. | sweet maple caramel | |||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Sweet, fruity, with a brown maple note | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | pale yellow to yellow solid or liquid | |||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| specific gravity : | 1.12800 - 1.14500 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.386 to 9.528 | |||||||||||||||||||||||||||||||
| refractive index : | 1.48800 - 1.49300 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| melting point : | 31.00 - 35.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 102.00 - 103.00 °C. @ 0.50 mm Hg | |||||||||||||||||||||||||||||||
| logp : | 0.09 | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 11.00 (μg/capita/day) | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 201.00 °F. TCC ( 93.89 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for maple furanone usage levels up to : | ||||||||||||||||||||||||||||||||
| 0.5000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for maple furanone usage levels up to : | ||||||||||||||||||||||||||||||||
| 10.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 211-811-6 | |||||||||||||||||||||||||||||||
| chemidplus : | 000698102 | |||||||||||||||||||||||||||||||
| epa-srs : | 698-10-2 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 197460 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 495219262 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 16, No. 4, 45, (1991)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| 2,4- | dihydroxy-3-methyl-2-hexenoic acid gamma-lactone |
| emoxyfurone | |
| ethyl fenugreek lactone | |
| 5- | ethyl-3-hydroxy-4-methyl furan-2-one |
| 5- | ethyl-3-hydroxy-4-methyl-2(5H)-furanone |
| 5- | ethyl-3-methyl-3-hydroxy-2(5H)-furanone |
| 2- | ethyl-3-methyl-4-hydroxydihydro-2,5-furan-5-one |
| 2- | hydroxy-3-methyl-gamma-2-hexenolactone |
| maple furanone | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| 2- | acetyl pyrazine |
| 2- | acetyl pyridine |
| 2- | acetyl-2-thiazoline |
| ambroxan | |
| para- | anisyl acetate |
| beeswax absolute | |
| benzyl salicylate | |
| blood orange oil | |
| cassia bark oil | |
| coffee furanone | |
| currant bud absolute black | |
| gamma- | decalactone |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fenugreek absolute | |
| fir balsam absolute | |
| floral pyranol | |
| heliotropin | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| ionones | |
| maltol | |
| maple notes | |
| melon heptenal | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl octine carbonate | |
| methyl phenyl acetate | |
| mimosa absolute | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| osmanthus absolute | |
| 3- | phenyl propyl alcohol |
| pineapple ketone | |
| raspberry ketone | |
| rose oxides | |
| santall | |
| strawberry furanone | |
| sugar notes | |
| tonka bean absolute | |
| 2,4,5- | trimethyl thiazole |
| gamma- | undecalactone |
| vanillin | |
| verymoss | |
| violet leaf absolute | |
| (odor and/or flavor) used in : | |
| allspice | |
| banana | |
| bay rum | |
| blackberry | |
| broth | |
| butterscotch | |
| candy cotton candy | |
| caramel | |
| chicken | |
| cinnamon | |
| coconut | |
| coffee | |
| cranberry | |
| fenugreek | |
| fig | |
| fir | |
| fir balsam | |
| gingerbread | |
| honeysuckle chevrefeuille | |
| mango | |
| maple | |
| meat | |
| melon | |
| mulberry | |
| mushroom | |
| musk | |
| nut | |
| onion | |
| papaya | |
| passion fruit | |
| peach | |
| pina colada | |
| pineapple | |
| pomegranate | |
| pumpkin | |
| smoke | |
| sugar brown sugar | |
| tobacco tabac tabaco | |
| toffee | |
| tonka | |
| vanilla | |
| natural occurrence in : | |
| soy sauce | |