Fragrance Demo Formulas |
1,1,2,3,3-pentamethyl-2,5,6,7-tetrahydroinden-4-one (Click)
IUPAC Name: 1,1,2,3,3-pentamethyl-2,5,6,7-tetrahydroinden-4-one
Std.InChI: InChI=1S/C14H22O/c1-9-13(2,3)10-7-6-8-11(15)12(10)14(9,4)5/h9H,6-8H2,1-5H3
InChI: InChI=1/C14H22O/c1-9-13(2,3)10-7-6-8-11(15)12(10)14(9,4)5/h9H,6-8H2,1-5H3
Std.InChIKey: MIZGSAALSYARKU-UHFFFAOYSA-N
InChIKey: MIZGSAALSYARKU-UHFFFAOYAK
SMILES: CC1C(C2=C(C1(C)C)C(=O)CCC2)(C)C
|
CAS Number: | 33704-61-9 |
|
Other: | 155667-06-4 |
ECHA EINECS - REACH Pre-Reg: | 251-649-3 |
FDA UNII: | BZR4438MY4 |
Nikkaji Web: | J308.527I |
XlogP3-AA: | 3.30 (est) |
Molecular Weight: | 206.32854000 |
Formula: | C14 H22 O |
NMR Predictor: | Predict (works with chrome or firefox) |
Category: fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | colorless to pale yellow semi-solid to solid (est) |
Assay: | 90.00 to 100.00 % sum of isomers
|
Food Chemicals Codex Listed: | No |
Specific Gravity: | 0.95400 to 0.96200 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 7.938 to 8.005
|
Specific Gravity: | 0.95500 to 0.96300 @ 20.00 °C.
|
Pounds per Gallon - est.: | 7.956 to 8.022
|
Refractive Index: | 1.49700 to 1.50200 @ 20.00 °C.
|
Boiling Point: | 285.00 to 286.00 °C. @ 760.00 mm Hg
|
Vapor Pressure: | 0.003000 mm/Hg @ 25.00 °C. (est) |
Flash Point: | 201.00 °F. TCC ( 93.89 °C. )
|
logP (o/w): | 4.500 |
Shelf Life: | 36.00 month(s) or longer if stored properly. |
Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. |
Soluble in: |
| alcohol | | dipropylene glycol | | water, 5.937 mg/L @ 25 °C (est) |
Stability: |
| acid cleaner | | alcoholic lotion | | antiperspirant | | deo stick | | detergent | | fabric softener | | hard surface cleaner | | shampoo | | soap |
Organoleptic Properties:
Odor Type: | musk |
Odor Strength: | medium , recommend smelling in a 10.00 % solution or less |
Odor Description: at 10.00 % in dipropylene glycol. | rich spicy musk woody clean |
Substantivity: | 48 hour(s) at 100.00 % |
| |
Cosmetic Information:
Safety Information:
Most important hazard(s): | Xi - Irritant |
|
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
Oral/Parenteral Toxicity: | |
oral-rat LD50 2901 mg/kg
|
Dermal Toxicity: | |
Not determined
|
Inhalation Toxicity: | |
Not determined
|
Safety in Use Information:
Category: | fragrance agents |
Recommendation for musk indanone usage levels up to: | | 2.0000 % in the fragrance concentrate.
|
|
Recommendation for musk indanone flavor usage levels up to: |
| not for flavor use.
|
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
aldehydic |
| decanal (aldehyde C-10) | FL/FR |
9- | decenal | FL/FR |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
amber |
| amber carane | FR |
| amber naphthofuran | FL/FR |
| amber oxepin | FR |
| amber powdery floral fragrance | FR |
| ambrette seed absolute | FL/FR |
| ambroxan | FL/FR |
| ambroxide | FL/FR |
| angelica root oil | FL/FR |
| cistus ladaniferus resinoid | FR |
(cis+trans)-6,6a,7,8,9,9a- | hexahydro-7,7,8,9,9-pentamethyl-5H-cyclopenta[H]quinazoline | FR |
animal |
iso | butyl quinoline | FR |
para- | cresyl caprylate | FL/FR |
| musk indenofuran | FR |
anise |
| estragon absolute | FR |
anisic |
| ambrette seed oil | FL/FR |
para- | anisaldehyde | FL/FR |
balsamic |
2- | acetyl furan | FL/FR |
| amyris wood oil | FL/FR |
siam | benzoin resinoid | FL/FR |
| benzophenone | FL/FR |
| benzyl cinnamate | FL/FR |
| benzyl salicylate | FL/FR |
alpha- | bisabolene | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | bornyl acetate | FL/FR |
iso | butyl cinnamate | FL/FR |
| cinnamyl alcohol | FL/FR |
| clover nitrile | FR |
| croton glabellus bark extract | FL/FR |
| ethyl cinnamate | FL/FR |
| fir balsam absolute | FR |
| fir needle oil siberia | FL/FR |
| guaiacyl phenyl acetate | FL/FR |
| guaiyl acetate | FL/FR |
| khella oil | FR |
| methyl (E)-cinnamate | FL/FR |
alpha- | methyl cinnamyl alcohol | FR |
| myrrh oil | FL/FR |
| myrrh resinoid | FR |
| opoponax absolute (balsamodendron kafal) | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| valeriana wallichii root oil | FR |
berry |
| raspberry ketone | FL/FR |
| raspberry ketone acetate | FL/FR |
| raspberry ketone methyl ether | FL/FR |
caramellic |
| ethyl maltol | FL/FR |
citrus |
| bergamot oil bergaptene reduced italy | FL/FR |
iso | decyl acetate | FR |
| grapefruit oil c.p. california | FL/FR |
| grapefruit pentanol | FR |
| waxy nitrile | FR |
fatty |
| decanol | FL/FR |
floral |
alpha- | amyl cinnamaldehyde | FL/FR |
iso | amyl salicylate | FL/FR |
| benzyl acetate | FL/FR |
| benzyl alcohol | FL/FR |
| bois de rose oil brazil | FL/FR |
iso | butyl salicylate | FL/FR |
| cardamom absolute | FL/FR |
| carnation concrete | FR |
| cassis specialty | FR |
| cestrum nocturnum flower oil | FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| coffee flower absolute | FR |
| coriander seed oil | FL/FR |
| cyclamen aldehyde | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| daffodil fragrance | FR |
9- | decen-1-ol | FL/FR |
| dimethyl anthranilate | FL/FR |
| dimethyl benzyl carbinol | FL/FR |
| dimethyl benzyl carbinyl acetate | FL/FR |
| ethyl phenyl acetate | FL/FR |
iso | eugenyl ethyl acetal | FR |
| floral pyranol | FR |
| gardenia oxide | FR |
| geraniol | FL/FR |
| geranium oil bourbon | FL/FR |
| geranyl acetate | FL/FR |
| ginger lily fragrance | FR |
| hawthorn specialty | FR |
| heliotropin | FL/FR |
| heliotropyl diethyl acetal | FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| ho leaf oil | FR |
| hyacinth ether | FR |
(E)-beta- | ionone | FL/FR |
| jasmin absolute italy (from concrete) | FL/FR |
| jonquil absolute replacer | FR |
| leerall | FR |
| lilyall | FR |
| linalool | FL/FR |
laevo- | linalool | FL/FR |
| linalool oxide | FL/FR |
ortho- | methoxybenzyl ethyl ether | FR |
para- | methyl acetophenone | FL/FR |
| methyl dihydrojasmonate | FL/FR |
alpha-iso | methyl ionone (50% min.) | FL/FR |
| mimosa absolute | FL/FR |
| mimosa absolute france | FL/FR |
| mimosa absolute india | FL/FR |
| mimosa absolute replacer | FR |
| muguet carboxaldehyde | FR |
| nerol | FL/FR |
| ocean propanal | FL/FR |
| orris pyridine 25% IPM | FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| petitgrain mandarin oil terpeneless | FL/FR |
| phenethyl acetate | FL/FR |
| phenethyl alcohol | FL/FR |
| phenethyl phenyl acetate | FL/FR |
| phenethyl salicylate | FL/FR |
| rhodinol | FL/FR |
| rhodinyl acetate | FL/FR |
| rose absolute (rosa centifolia) | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose butanoate | FL/FR |
| rose concrete (rosa centifolia) | FR |
| rose oil (rosa centifolia) egypt | FL/FR |
| rose oil (rosa damascena) bulgaria | FL/FR |
| rose oil (rosa damascena) iran | FL/FR |
| rose oil (rosa damascena) turkey | FL/FR |
| rose oil replacer | FR |
| tetrahydrolinalool | FL/FR |
| tuberose absolute chassis | FL/FR |
| tuberose absolute replacer | FR |
| ylang ylang flower absolute | FL/FR |
fruity |
| allyl amyl glycolate | FR |
| allyl hexanoate | FL/FR |
| benzyl propionate | FL/FR |
(E)-beta- | damascone | FL/FR |
(E)-alpha- | damascone | FL/FR |
| dimethyl benzyl carbinyl isobutyrate | FR |
| ethyl levulinate | FL/FR |
| green acetate | FR |
| marigold absolute (tagetes glandulifera) | FR |
green |
| diphenyl oxide | FL/FR |
| galbanum oil | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
(Z)-3- | hexen-1-yl tiglate | FL/FR |
2,4- | ivy carbaldehyde | FL/FR |
(Z)- | leaf acetal | FL/FR |
| marigold pot absolute | FL/FR |
| melon nonenoate | FL/FR |
| octanal diethyl acetal | FL/FR |
| phenyl acetaldehyde | FL/FR |
hay |
| hay absolute | FR |
herbal |
| acorus calamus rhizome oil | FR |
| agate fragrance | FR |
sweet | basil absolute | FL/FR |
| calamintha clinopodium oil | FR |
| canarium luzonicum oil | FL/FR |
| clary sage oil france | FL/FR |
| coriander seed absolute | FL/FR |
| daucus carota fruit oil | FL/FR |
| dill seed oil | FL/FR |
| dill seed oil CO2 extract | FL/FR |
american | elder flower absolute | FR |
| herbal undecanone | FR |
| lavender absolute bulgaria | FL/FR |
| linalyl acetate | FL/FR |
| methyl nicotinate | FL/FR |
| nonisyl acetate | FR |
| nopyl acetate | FR |
curled | parsley seed oil | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| rose oil (rosa centifolia) morocco | FL/FR |
common | tansy flower oil | FR |
common | tansy flower oil dutch | FR |
| yerba mate absolute | FL/FR |
honey |
| methyl phenyl acetate | FL/FR |
marine |
| marine pyridine | FR |
minty |
| ethyl salicylate | FL/FR |
mossy |
| oakmoss absolute | FL/FR |
| oriental specialty | FR |
| veramoss (IFF) | FR |
musk |
| musk amberol | FR |
| musk decanolide | FR |
| polvolide (Soda) | FR |
6,7,8,9- | tetrahydro-7,7,8,9,9-pentamethyl-5H-cyclopenta[H]quinazoline | FR |
orris |
| eugenyl formate | FL/FR |
para-iso | propyl acetophenone | FL/FR |
peppery |
| asarum europaeum oil | FR |
phenolic |
4- | methyl-2,6-dimethoxyphenol | FL/FR |
powdery |
para- | anisyl acetate | FL/FR |
para- | anisyl alcohol | FL/FR |
saffron |
| saffron stigmates absolute | FR |
spicy |
| acacia fragrance | FR |
| allspice berry absolute | FL/FR |
homo | anisaldehyde | FL/FR |
| anona squamosa leaf oil | FR |
| artemisia dracunculus herb oil | FL/FR |
| ayou wood oil | FR |
| benzyl isoeugenol | FL/FR |
| cananga leaf oil | FR |
| carnation absolute | FR |
| carnation absolute replacer | FR |
beta- | caryophyllene | FL/FR |
| caryophyllene | FL/FR |
alpha- | caryophyllene alcohol | FL/FR |
| cascarilla oil replacer | FL/FR |
| cassia bark oil china | FL/FR |
| cassia leaf oil | FL/FR |
| cinnamaldehyde / methyl anthranilate schiff's base | FR |
| cinnamon bark oil | FL/FR |
| cinnamon bark oil (cinnamomum zeylanicum) india | FL/FR |
| cinnamon bark oil ceylon | FL/FR |
| cinnamon leaf oil ceylon | FL/FR |
| cinnamon oleoresin ceylon | FL/FR |
(E)- | cinnamyl acetate | FL/FR |
(Z)- | cinnamyl acetate | FL/FR |
| cinnamyl acetate | FL/FR |
| cinnamyl propionate | FL/FR |
| clove bud absolute | FL/FR |
| clove bud oil | FL/FR |
| clove bud oil CO2 extract | FL/FR |
| eugenyl acetate | FL/FR |
| floral spice fragrance | FR |
| galangal root oil | FL/FR |
| ginger oleoresin africa | FL/FR |
| ginger root oil brazil | FL/FR |
| grains of paradise oil | FL/FR |
| green oxane | FR |
star | jasmine specialty | FL/FR |
| mace absolute | FL/FR |
| mace oil | FL/FR |
| mace oleoresin | FL/FR |
| machilus kusanoi leaf oil | FR |
| machilus kusanoi wood oil | FR |
| maja fragrance | FR |
para- | methoxy-alpha-methyl cinnamaldehyde | FL/FR |
(E)-para- | methoxycinnamaldehyde | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| methyl isoeugenol | FL/FR |
| myristica fragrans fruit extract | FL/FR |
| myristica fragrans seed tincture | FL/FR |
| nutmeg oil | FL/FR |
black | pepper absolute | FL/FR |
| pepper hexanone | FR |
black | pepper oil | FL/FR |
black | pepper oil CO2 extract | FL/FR |
| pepper tree berry absolute | FL/FR |
| pepper tree berry oil | FL/FR |
| piper longum fruit oil | FL/FR |
| piper longum fruit oil CO2 extract | FL/FR |
| spicy acetoacetate | FL/FR |
| spicy carbonate | FR |
| sugandha kokila berry oil | FR |
(E)- | tiglic acid | FL/FR |
| turmeric root absolute | FL/FR |
| zingiber officinale root extract | FL/FR |
| zingiber officinale root tincture | FL/FR |
sweet |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
terpenic |
para- | cymene | FL/FR |
| frankincense oil | FL/FR |
| juniper branch oil | FR |
| pine needle oil dwarf | FL/FR |
alpha- | terpineol | FL/FR |
thujonic |
| armoise oil | FR |
common | tansy oil canada | FR |
| thuja occidentalis leaf oil | FL/FR |
tonka |
| coumarin | FR |
| tonka bean absolute | FR |
vanilla |
| ethyl vanillin | FL/FR |
| heliotropyl alcohol | FL/FR |
| vanilla cresol | FR |
| vanillyl acetate | FL/FR |
waxy |
| decyl acetate | FL/FR |
1- | dodecanol | FL/FR |
| ethyl laurate | FL/FR |
1- | undecanol | FL/FR |
woody |
| amber carbinol | FR |
| caryophyllene alcohol acetate | FR |
| caryophyllene formate | FL/FR |
beta- | caryophyllene oxide | FL/FR |
| cedarwood oil texas fractions | FR |
| cistus twig/leaf oil | FL/FR |
| curcuma zedoaria bark extract | FL/FR |
| dacrydium franklinii wood oil | FR |
| guaiacwood oil | FL/FR |
| guaiacwood oil 20% in gurjun balsam oil | FR |
| guaiacyl acetate | FL/FR |
| gurjun balsam oil | FR |
| hedychium spicatum root oil | FR |
| jatamansi root oil | FR |
| juniper berry oleoresin | FL/FR |
| longifolene | FL/FR |
| methyl cedryl ketone | FL/FR |
delta- | methyl ionone | FL/FR |
| methyl methylene tricyclodecanol | FR |
| patchouli absolute | FR |
| patchouli ethanone | FR |
| patchouli oil | FL/FR |
4-iso | propyl phenol | FL/FR |
| rhubarb oxirane | FR |
| sabinene | FL/FR |
| sandal pentenol | FL/FR |
| sandal pentenone | FR |
| sandalwood oil | FL/FR |
| santal penten-2-ol | FR |
| santall | FR |
| spikenard oil | FL/FR |
| spikenard oil CO2 extract | FL/FR |
| spruce needle oil canada | FL/FR |
| tobacarol (IFF) | FR |
4,6,11- | trimethyl-5-oxatricyclo(6.2.2.0*4,9*)dodec-6-ene | FR |
| vetiver oil haiti | FL/FR |
| woody acetate | FR |
(Z)- | woody amylene | FR |
| woody propanol | FR |
| zedoary bark oil | FL/FR |
| zedoary root oil | FL/FR |
| zedoary root oil CO2 extract | FL/FR |
|
For Flavor |
|
No flavor group found for these |
| ambrette seed oil | FL/FR |
| ambroxide | FL/FR |
homo | anisaldehyde | FL/FR |
alpha- | bisabolene | FL/FR |
alpha- | caryophyllene alcohol | FL/FR |
| caryophyllene formate | FL/FR |
(Z)- | cinnamyl acetate | FL/FR |
(E)- | cinnamyl acetate | FL/FR |
| cistus twig/leaf oil | FL/FR |
| croton glabellus bark extract | FL/FR |
9- | decenal | FL/FR |
| eugenyl formate | FL/FR |
| grains of paradise oil | FL/FR |
| guaiyl acetate | FL/FR |
| heliotropyl alcohol | FL/FR |
star | jasmine specialty | FL/FR |
para- | methoxy-alpha-methyl cinnamaldehyde | FL/FR |
(E)-para- | methoxycinnamaldehyde | FL/FR |
| methyl (E)-cinnamate | FL/FR |
delta- | methyl ionone | FL/FR |
| methyl nicotinate | FL/FR |
| piper longum fruit oil CO2 extract | FL/FR |
| sandal pentenol | FL/FR |
| spikenard oil | FL/FR |
| spikenard oil CO2 extract | FL/FR |
| thuja occidentalis leaf oil | FL/FR |
aldehydic |
1- | undecanol | FL/FR |
amber |
| amber naphthofuran | FL/FR |
animal |
para- | cresyl caprylate | FL/FR |
balsamic |
siam | benzoin resinoid | FL/FR |
| benzyl salicylate | FL/FR |
laevo- | bornyl acetate | FL/FR |
iso | butyl cinnamate | FL/FR |
| ethyl cinnamate | FL/FR |
| fir needle oil siberia | FL/FR |
| myrrh oil | FL/FR |
| opoponax absolute (balsamodendron kafal) | FL/FR |
berry |
| raspberry ketone | FL/FR |
| raspberry ketone acetate | FL/FR |
| raspberry ketone methyl ether | FL/FR |
brown |
(E)- | tiglic acid | FL/FR |
burnt |
4-iso | propyl phenol | FL/FR |
caramellic |
| ethyl maltol | FL/FR |
cherry |
| heliotropin | FL/FR |
citrus |
| bergamot oil bergaptene reduced italy | FL/FR |
| grapefruit oil c.p. california | FL/FR |
laevo- | linalool | FL/FR |
| linalool | FL/FR |
| nerol | FL/FR |
alpha- | terpineol | FL/FR |
cooling |
iso | butyl salicylate | FL/FR |
creamy |
para- | anisaldehyde | FL/FR |
para- | methyl acetophenone | FL/FR |
fatty |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
floral |
| bois de rose oil brazil | FL/FR |
| cardamom absolute | FL/FR |
| cinnamyl propionate | FL/FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| dimethyl benzyl carbinyl acetate | FL/FR |
| geraniol | FL/FR |
| geranium oil bourbon | FL/FR |
| jasmin absolute italy (from concrete) | FL/FR |
| linalyl acetate | FL/FR |
| methyl dihydrojasmonate | FL/FR |
alpha-iso | methyl ionone (50% min.) | FL/FR |
| methyl phenyl acetate | FL/FR |
| ocean propanal | FL/FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| phenethyl alcohol | FL/FR |
| rhodinol | FL/FR |
| rhodinyl acetate | FL/FR |
| rose absolute (rosa centifolia) | FL/FR |
| rose absolute (rosa centifolia) morocco | FL/FR |
| rose oil (rosa centifolia) egypt | FL/FR |
| rose oil (rosa damascena) bulgaria | FL/FR |
| rose oil (rosa damascena) iran | FL/FR |
| rose oil (rosa damascena) turkey | FL/FR |
| tetrahydrolinalool | FL/FR |
| tuberose absolute chassis | FL/FR |
| ylang ylang flower absolute | FL/FR |
fruity |
| allyl hexanoate | FL/FR |
para- | anisyl acetate | FL/FR |
para- | anisyl alcohol | FL/FR |
| benzyl acetate | FL/FR |
| benzyl alcohol | FL/FR |
| benzyl propionate | FL/FR |
(E)-beta- | damascone | FL/FR |
(E)-alpha- | damascone | FL/FR |
| dimethyl anthranilate | FL/FR |
| ethyl levulinate | FL/FR |
| petitgrain mandarin oil terpeneless | FL/FR |
| rose butanoate | FL/FR |
geranium |
| benzophenone | FL/FR |
green |
iso | amyl salicylate | FL/FR |
| angelica root oil | FL/FR |
| canarium luzonicum oil | FL/FR |
| cinnamyl alcohol | FL/FR |
| cyclamen aldehyde | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| diphenyl oxide | FL/FR |
| galbanum oil | FL/FR |
| geranyl acetate | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
(Z)-3- | hexen-1-yl tiglate | FL/FR |
2,4- | ivy carbaldehyde | FL/FR |
(Z)- | leaf acetal | FL/FR |
| linalool oxide | FL/FR |
| marigold pot absolute | FL/FR |
| melon nonenoate | FL/FR |
| oakmoss absolute | FL/FR |
| octanal diethyl acetal | FL/FR |
herbal |
sweet | basil absolute | FL/FR |
| clary sage oil france | FL/FR |
| coriander seed absolute | FL/FR |
| coriander seed oil | FL/FR |
| daucus carota fruit oil | FL/FR |
| dill seed oil | FL/FR |
| dill seed oil CO2 extract | FL/FR |
| lavender absolute bulgaria | FL/FR |
curled | parsley seed oil | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| rose oil (rosa centifolia) morocco | FL/FR |
| yerba mate absolute | FL/FR |
honey |
| ethyl phenyl acetate | FL/FR |
| phenethyl acetate | FL/FR |
| phenethyl phenyl acetate | FL/FR |
| phenyl acetaldehyde | FL/FR |
medicinal |
| dimethyl benzyl carbinol | FL/FR |
| phenethyl salicylate | FL/FR |
minty |
| ethyl salicylate | FL/FR |
nutty |
2- | acetyl furan | FL/FR |
phenolic |
| guaiacyl phenyl acetate | FL/FR |
4- | methyl-2,6-dimethoxyphenol | FL/FR |
pine |
| pine needle oil dwarf | FL/FR |
soapy |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
1- | dodecanol | FL/FR |
spicy |
| allspice berry absolute | FL/FR |
| artemisia dracunculus herb oil | FL/FR |
| benzyl cinnamate | FL/FR |
| benzyl isoeugenol | FL/FR |
beta- | caryophyllene | FL/FR |
| caryophyllene | FL/FR |
| cascarilla oil replacer | FL/FR |
| cassia bark oil china | FL/FR |
| cassia leaf oil | FL/FR |
| cinnamon bark oil | FL/FR |
| cinnamon bark oil (cinnamomum zeylanicum) india | FL/FR |
| cinnamon bark oil ceylon | FL/FR |
| cinnamon leaf oil ceylon | FL/FR |
| cinnamon oleoresin ceylon | FL/FR |
| cinnamyl acetate | FL/FR |
| clove bud absolute | FL/FR |
| clove bud oil | FL/FR |
| clove bud oil CO2 extract | FL/FR |
| eugenyl acetate | FL/FR |
| galangal root oil | FL/FR |
| ginger oleoresin africa | FL/FR |
| ginger root oil brazil | FL/FR |
| mace absolute | FL/FR |
| mace oil | FL/FR |
| mace oleoresin | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| methyl isoeugenol | FL/FR |
| myristica fragrans fruit extract | FL/FR |
| myristica fragrans seed tincture | FL/FR |
| nutmeg oil | FL/FR |
black | pepper absolute | FL/FR |
black | pepper oil | FL/FR |
black | pepper oil CO2 extract | FL/FR |
| pepper tree berry absolute | FL/FR |
| pepper tree berry oil | FL/FR |
3- | phenyl propyl alcohol | FL/FR |
| piper longum fruit oil | FL/FR |
para-iso | propyl acetophenone | FL/FR |
| spicy acetoacetate | FL/FR |
| turmeric root absolute | FL/FR |
| zingiber officinale root extract | FL/FR |
| zingiber officinale root tincture | FL/FR |
sweet |
| vanilla bean absolute (vanilla planifolia) | FL/FR |
terpenic |
para- | cymene | FL/FR |
tropical |
alpha- | amyl cinnamaldehyde | FL/FR |
vanilla |
| ethyl vanillin | FL/FR |
| vanillyl acetate | FL/FR |
waxy |
| decanal (aldehyde C-10) | FL/FR |
| decanol | FL/FR |
9- | decen-1-ol | FL/FR |
| decyl acetate | FL/FR |
| ethyl laurate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
| mimosa absolute | FL/FR |
| mimosa absolute france | FL/FR |
| mimosa absolute india | FL/FR |
woody |
| ambrette seed absolute | FL/FR |
| ambroxan | FL/FR |
| amyris wood oil | FL/FR |
iso | bornyl acetate | FL/FR |
beta- | caryophyllene oxide | FL/FR |
| curcuma zedoaria bark extract | FL/FR |
| frankincense oil | FL/FR |
| guaiacwood oil | FL/FR |
| guaiacyl acetate | FL/FR |
(E)-beta- | ionone | FL/FR |
| juniper berry oleoresin | FL/FR |
| longifolene | FL/FR |
| methyl cedryl ketone | FL/FR |
| patchouli oil | FL/FR |
| sabinene | FL/FR |
| sandalwood oil | FL/FR |
| spruce needle oil canada | FL/FR |
| vetiver oil haiti | FL/FR |
| zedoary bark oil | FL/FR |
| zedoary root oil | FL/FR |
| zedoary root oil CO2 extract | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| astromeran | | cas musc | | cashmeran (IFF) | | cashmeran velvet (IFF) | 6,7- | dihydro-1,1,2,3,3-pentamethyl-4(5H)-indanone | | dihydropentamethyl indanone | | hexahydro-1,1,2,3,3-pentamethyl inden-4-one | 1,2,3,5,6,7- | hexahydro-1,1,2,3,3-pentamethyl-4H-inden-4-one | 4H- | inden-4-one, 1,2,3,5,6,7-hexahydro-1,1,2,3,3-pentamethyl- | | indomuscone (A.C.S. International) | | lanmeran | | musk indanone | 1,1,2,3,3- | pentamethyl-1,2,3,5,6,7-hexahydro-4H-inden-4-one | 1,1,2,3,3- | pentamethyl-2,5,6,7-tetrahydroinden-4-one |
Articles:
|