Notes :
Mellows green and herbal fragrances.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | (2-methoxy-4-prop-2-enylphenyl) acetate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4,6-8H,1,5H2,2-3H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | SCCDQYPEOIRVGX-UHFFFAOYAM | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(=O)OC1=C(C=C(C=C1)CC=C)OC | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.35.1500 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | spicy | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fresh woody clove floral carnation malt spice | |||||||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid to solid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.07700 - 1.08200 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.962 to 9.003 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.07500 - 1.08300 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.956 to 9.022 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.51600 - 1.52000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 29.00 - 30.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 281.00 - 286.00 °C. @ 752.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.40 | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1670.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 12,877,1974 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 230.00 °F. TCC ( > 110.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for eugenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for eugenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 100.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-235-6 | |||||||||||||||||||||||||||||||||||
| rtecs : | SJ4550000 for 93-28-7 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000093287 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 93-28-7 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 1242 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 1531 | |||||||||||||||||||||||||||||||||||
| fl. number : | 09.020 | |||||||||||||||||||||||||||||||||||
| pubchem : | 150172 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4141638663 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| 1- | acetoxy-2-methoxy-4-allyl benzene |
| acetyl eugenol | |
| 4- | allyl-2-methoxyphenol acetate |
| 4- | allyl-2-methoxyphenyl acetate |
| eugenol acetate | |
| 1,3,4- | eugenol acetate |
| eugenyl acetate | |
| 2- | methoxy-4-(2-propen-1-yl) phenyl acetate |
| 2- | methoxy-4-(2-propenyl) phenyl acetate |
| 2- | methoxy-4,2-propen-1-yl phenyl acetate |
| 4-(2- | propenyl)-2-methoxyphenyl ethanoate |
| soluble in : | |
| alcohol | |
| essential oils | |
| paraffin oil | |
| water, 98 mg/L @ 25C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| 2- | acetyl furan |
| allspice oil | |
| amber carbinol | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| iso | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl salicylate |
| caramel furanone | |
| carnation absolute | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coconut absolute | |
| coriander seed oil | |
| coumarin | |
| para- | cresyl phenyl acetate |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| dihydrojasmone | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanol | |
| ethyl cinnamate | |
| 4- | ethyl guaiacol |
| ethyl maltol | |
| ethyl vanillin | |
| eugenol | |
| fir balsam absolute | |
| floral pyranol | |
| guaiacol | |
| guaiacwood oil | |
| guaiacyl phenyl acetate | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| labdanum resinoid | |
| lavender absolute | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| maltol | |
| methyl acetophenone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl ionones | |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| pepper oil black | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| santall | |
| tetrahydrojasmone | |
| timber propanol | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| 10- | undecen-1-yl acetate |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| absinthe | |
| acacia | |
| acorn | |
| allspice | |
| amber | |
| ambreine | |
| ambrette | |
| animal | |
| arnica | |
| azalea | |
| balsam | |
| bay rum | |
| bayberry | |
| benzoin | |
| blossom tropical blossom | |
| bread baked bread | |
| broom genet genista | |
| cabreuva | |
| cake | |
| calamus | |
| cappuccino | |
| capsicum | |
| caramel | |
| carnation dianthus oeillet | |
| cascarilla | |
| cassia | |
| cassia blossom | |
| cassie acacia farnesiana | |
| castoreum | |
| chamomile | |
| champaca champak | |
| cherry black cherry | |
| chestnut blossom | |
| chicory root | |
| chocolate cacao | |
| cinnamon | |
| citrus | |
| clove | |
| clove blossom | |
| coconut | |
| coconut tropical coconut | |
| coffee | |
| cookie | |
| copaiba | |
| coronilla | |
| currant | |
| cypress | |
| dahlia | |
| daisy | |
| daphne | |
| date | |
| deertongue | |
| dogwood | |
| elder blossom | |
| fagonia | |
| fantasy blends | |
| fenugreek | |
| fern fougere | |
| fig | |
| fir balsam | |
| fixer | |
| floral | |
| flouve | |
| flouve blossom | |
| forest | |
| gingerbread | |
| graham cracker | |
| grass green grass | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heather | |
| hollyberry | |
| hugonia | |
| immortelle helichrysum everlasting | |
| incense | |
| iris blossom | |
| jasmin | |
| juniperberry | |
| kewda | |
| labdanum | |
| leaf autumn leaf | |
| leather | |
| liverwort | |
| lovage | |
| maja | |
| malt | |
| mate | |
| milk malted milk | |
| moss | |
| mulberry | |
| musk | |
| narcissus narcisse | |
| nutmeg | |
| oakmoss mousse de chene | |
| oakwood | |
| opoponax | |
| oriental | |
| osmanthus | |
| patchouli | |
| petunia | |
| pimento | |
| plum | |
| powder | |
| pumpkin | |
| rose | |
| rose d'orient | |
| rose moss rose | |
| rose white rose | |
| saffron | |
| sandalwood | |
| spice | |
| spicewood | |
| stock evening scented stock | |
| straw | |
| strawberry | |
| timber | |
| tobacco tabac tabaco | |
| tonka | |
| tulip | |
| valerian | |
| vanilla | |
| weedy | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| data page | alpinia galanga oil @ 1.50% |
| data page | bay leaf oil @ 0.00-0.51% |
| carnation | |
| data page | cassia bark oil china @ 0.30% |
| data page | cassia leaf oil china @ 0.30% |
| data page | cinnamon bark oil ceylon @ 0.30% |
| data page | cinnamon leaf oil ceylon @ 1.07% |
| data page | cinnamon oil CO2 extract @ 1.51-2.02% |
| clove bud | |
| data page | clove bud oil @ 5.04% |
| clove leaf | |
| data page | clove leaf oil @ trace% |
| data page | clove stem oil india @ 0.44% |
| data page | herniaria incana lam. oil greece @ 0.50% |
| laurus nobilis | |
| data page | tagete oil CO2 extract @ 0.15% |
| data page | tejpat oil @ 1.20% |
| data page | valerian root oil CO2 extract china @ 2.45% |