Notes :
For waxy-oily green notes in florals.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | ethyl dodecanoate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C14H28O2/c1-3-5-6-7-8-9-10-11-12-13-14(15)16-4-2/h3-13H2,1-2H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | MMXKVMNBHPAILY-UHFFFAOYAE | |||||||||||||||||||||||||||||||||
| SMILES : | CCCCCCCCCCCC(=O)OCC | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | unspecified | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | waxy | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet waxy floral soapy | |||||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Waxy, soapy and floral with a creamy, dairy and fruity nuance | |||||||||||||||||||||||||||||||||
| substantivity : | 216 Hour(s) | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless clear oily liquid | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.85800 - 0.86200 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.139 to 7.173 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.43000 - 1.43400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| melting point : | -12.00 - -10.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 269.00 - 271.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 141.00 - 142.00 °C. @ 8.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 5.71 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 212.00 °F. TCC ( 100.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for ethyl laurate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for ethyl laurate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 50.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-386-0 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000106332 | |||||||||||||||||||||||||||||||||
| epa-srs : | 106-33-2 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 8912 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 150894 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2475389498 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 20, No. 4, 23, (1995)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| dodecanoic acid ethyl ester | |
| ethyl dodecanoate | |
| ethyl dodecylate | |
| ethyl laurate | |
| ethyl laurinate | |
| lauric acid ethyl este | |
| soluble in : | |
| alcohol | |
| water, 0.4 mg/L @ 25C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| algae absolute | |
| allyl amyl glycolate | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl alcohol |
| bay leaf oil | |
| benzoin resinoid | |
| benzophenone | |
| benzyl acetate | |
| benzyl benzoate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl salicylate |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarleaf oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cortex pyridine | |
| costus root oil | |
| costus valerolactone | |
| para- | cresyl caprylate |
| cuminaldehyde | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| davana oil | |
| decanal | |
| decanol | |
| 9- | decen-1-al |
| 9- | decen-1-ol |
| decyl acetate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl isobutyrate | |
| dimethyl hydroquinone | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| immortelle absolute | |
| indole | |
| ionones | |
| labdanum resinoid | |
| leerall | |
| lilyall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| marine pyridine | |
| melon nonenoate | |
| methyl benzoate | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl phenyl acetate | |
| mimosa absolute | |
| musks | |
| nerolidol | |
| neryl acetate | |
| gamma- | nonalactone |
| nonanal | |
| nonanol | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| octanal | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propyl alcohol |
| raspberry ketone methyl ether | |
| rose butanoate | |
| rose oxides | |
| santall | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco dodecane | |
| tonka bean absolute | |
| undecanol | |
| 10- | undecen-1-al |
| 10- | undecen-1-yl acetate |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| alpine bouquet | |
| amaryllis | |
| amber | |
| ambrette | |
| animal | |
| apple | |
| apple crabapple | |
| ash mountain ash blossom | |
| azalea | |
| bark | |
| bayberry | |
| beeswax cire d'abeille | |
| berry | |
| bouquet | |
| boxwood | |
| boxwood blossom | |
| brandy | |
| bread | |
| broom genet genista | |
| burberry | |
| burnt | |
| caramel | |
| carrot seed | |
| cassia blossom | |
| castoreum | |
| cedar forest | |
| cedarwood | |
| cheese | |
| cherry blossom | |
| chypre | |
| cilantro | |
| clean | |
| clematis | |
| cloth clean cloths | |
| clove blossom | |
| coconut | |
| cognac | |
| cortex | |
| costus | |
| crabapple blossom | |
| cream | |
| cumin | |
| custard | |
| cyclamen | |
| cypress | |
| daffodil narcissus | |
| dairy | |
| daisy | |
| date | |
| earth humus | |
| elder blossom | |
| elderberry | |
| fenugreek | |
| fern fougere | |
| fig | |
| fir balsam | |
| fixer | |
| floral | |
| flouve blossom | |
| foliage | |
| fruit dried fruit | |
| fungus | |
| galanga | |
| ginger white ginger | |
| gingergrass | |
| grape | |
| guaiacwood | |
| hair | |
| heather | |
| hollyberry | |
| incense | |
| ivy leaf | |
| leaf autumn leaf | |
| leaf green leaf | |
| leather | |
| lettuce | |
| liverwort | |
| lychee soapberry | |
| maja | |
| malt | |
| marjoram | |
| meadow | |
| milk malted milk | |
| mushroom | |
| musk | |
| new car | |
| oakmoss mousse de chene | |
| orchid | |
| orris iris | |
| osmanthus | |
| outdoors fresh outdoors | |
| pansy | |
| patchouli | |
| peach | |
| peach blossom | |
| pear | |
| petal waxy petal | |
| petunia | |
| pineapple | |
| plum blossom | |
| pork | |
| powder | |
| privet | |
| privet blossom | |
| rain | |
| raisin | |
| redwood | |
| reseda mignonette | |
| rose | |
| rose geranium | |
| rose tea rose | |
| rose white rose | |
| saffron | |
| seaweed | |
| soapy | |
| starfruit | |
| stephanotis | |
| strawberry | |
| tobacco tabac tabaco | |
| tonka | |
| tuberose tubereuse | |
| tulip | |
| vetiver | |
| vine | |
| waxy | |
| whiskey | |
| wine | |
| wintergreen | |
| wool fat | |
| natural occurrence in : | |
| apple juice | |
| beer | |
| brandy | |
| bread | |
| caninha | |
| capsicum | |
| cheese | |
| coconut | |
| cognac | |
| grape | |
| data page | mangrove bark red oil cuba @ 0.10% |
| pear | |
| data page | petitgrain mandarin oil @ 0.06% |
| pork | |
| rum | |
| strawberry | |
| whiskey | |
| wine white wine | |