Notes :
Oriental lifter.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | pentyl acetate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C7H14O2/c1-3-4-5-6-9-7(2)8/h3-6H2,1-2H3 | |||||||||||||||||||||||||||||||
| InChIKey : | PGMYKACGEOXYJE-UHFFFAOYAQ | |||||||||||||||||||||||||||||||
| SMILES : | CCCCCOC(=O)C | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2915.39.9050 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | fruity banana ether | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| specific gravity : | 0.87600 - 0.88100 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.289 to 7.331 | |||||||||||||||||||||||||||||||
| refractive index : | 1.40000 - 1.40400 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| melting point : | -100.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 149.00 - 150.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| logp : | 2.30 | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >1600.00 mg/kg | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 75.00 °F. TCC ( 23.89 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for amyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 211-047-3 | |||||||||||||||||||||||||||||||
| rtecs : | AJ1925000 for 628-63-7 | |||||||||||||||||||||||||||||||
| chemidplus : | 000628637 | |||||||||||||||||||||||||||||||
| epa-srs : | 628-63-7 | |||||||||||||||||||||||||||||||
| dtp/nci : | 7923 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 155671 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1868969868 | |||||||||||||||||||||||||||||||
| synonyms : | |
| acetate C-5 | |
| acetic acid amyl ester | |
| acetic acid pentyl ester | |
| amyl acetate | |
| N- | amyl acetate |
| amyl acetate primary | |
| amyl acetic ester | |
| birnenoel | |
| 1- | pentanol acetate |
| pentyl acetate | |
| 1- | pentyl acetate |
| N- | pentyl acetate |
| pentyl ethanoate | |
| primary amyl acetate | |
| soluble in : | |
| alcohol | |
| water, 1700 mg/L @ 20C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| allyl cyclohexyl propionate | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| para- | anisaldehyde |
| anise seed oil | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| blood orange oil | |
| cassia bark oil | |
| citronella oil | |
| citronellyl acetate | |
| coriander seed oil | |
| diethyl malonate | |
| dihydromyrcenol | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl heptanoate | |
| floral pyranol | |
| geranyl acetate | |
| green acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| lavender absolute | |
| litsea cubeba oil | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| neryl acetate | |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| (Z)-5- | octen-1-ol |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpinyl acetate |
| gamma- | undecalactone |
| vanilla absolute | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| almond bitter almond | |
| apple | |
| apple red apple | |
| apricot | |
| banana | |
| blackberry | |
| blueberry | |
| blueberry whortleberry red whortleberry | |
| brandy | |
| bubblegum | |
| butterscotch | |
| carnation dianthus oeillet | |
| cherry | |
| chocolate cocoa | |
| coconut | |
| coffee | |
| crabapple blossom | |
| cranberry | |
| currant | |
| date | |
| floral | |
| fruit | |
| fruit juicy fruit | |
| gooseberry | |
| grape | |
| grenadine | |
| hibiscus | |
| honey miel | |
| hops houblon | |
| huckleberry bilberry | |
| hyacinth jacinthe | |
| lemon | |
| lime | |
| melon watermelon muskmelon cantaloupe | |
| mint | |
| muguet lily of the valley | |
| mulberry | |
| nut pistachio | |
| orange | |
| oriental | |
| passion fruit | |
| peach | |
| pear | |
| pina colada | |
| pineapple | |
| plum | |
| quince | |
| raspberry | |
| rose | |
| strawberry | |
| tangerine | |
| tutti frutti | |
| vanilla | |
| violet | |
| natural occurrence in : | |
| apple | |
| apple juice | |
| banana | |
| beer | |
| butter | |
| cocoa bean | |
| strawberry | |