| |
| Right Click Jmol Molecule For More Options. (Safari 1.2 (v125) Compatible). Jmol is a free download found Here. |
| |
|
|
| IUPAC name : | 2-[(3S,5R,8S)-3,8-dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-yl butanoate |
| InChI : | InChI=1/C19H32O2/c1-6-7-18(20)21-19(4,5)15-10-8-13(2)16-11-9-14(3)17(16)12-15/h13-15H,6-12H2,1-5H3/t13-,14-,15+/m0/s1 |
| InChIKey : | FZRQHSNXHSRRMX-SOUVJXGZBQ |
| SMILES : | CCCC(=O)OC(C)(C)[C@@H]1CC[C@@H](C2=C(C1)[C@H](CC2)C)C |
| cas number : | 73003-91-5 |
| (EINECS) number : | 277-213-2 |
| molar refractivity : | 87.18 ± 0.4 cm3 |
| parachor : | 727.9 ± 6.0 cm3 |
| index of refraction : | 1.488 ± 0.03 |
| surface tension : | 33.7 ± 5.0 dyne/cm |
| density : | 0.96 ± 0.1 g/cm3 |
| polarizability : | 34.56 ± 0.5 10-24cm3 |
| XlogP : | 5.60 |
| molecular weight : | 292.4561800 (IUPAC) |
| formula : | C19 H32 O2 |
| NMR Predictor : | Predict |
|
|
| |
| |
| export tariff code : | 2915.60.0000 |
| fda reg : | unspecified |
organoleptics :
|
| odor type : | balsamic |
| odor strength : | medium |
odor description: at 100.00 %. | rose plum animal balsamic woody |
taste description:
| plum |
properties :
|
| appearence : | colorless to pale yellow clear liquid |
| assay : | 95.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 0.99000 @ 25.00 °C.
|
| refractive index : | 1.49500 @ 25.00 °C.
|
| boiling point : | 315.00 °C. @ 760.00 mm Hg
|
| flash point : | 219.00 °F. TCC ( 103.89 °C. )
|
| logP (o/w) : | 6.71 |
safety :
|
| Oral Toxicity(LD50) : | | | |
Not determined
|
| Dermal Toxicity(LD50) : | | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | | |
Not determined
|
| |
safety in use :
|
| Category : | fragrance agents |
| |
| recommendation for guaiyl butyrate fragrance usage levels up to : | | | 8.0000 % in the fragrance concentrate.
|
| recommendation for guaiyl butyrate flavor usage levels up to : | | | not for flavor use.
|
safety references :
|
| EPI System : | view |
| EPA Chem. Sub. Inventory : | Yes |
| |
| | | |
| | 2-[(3S,5R,8S)-3,8-dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-yl butanoate |
| (EINECS) number : | 277-213-2 |
| chemidplus : | 073003915 |
| EPA Substance Registry Services : | 73003-91-5 |
references :
|
| | 2-[(3S,5R,8S)-3,8-dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-yl butanoate |
| pubchem : | 752608 |
other :
|
|
synonyms :
|
| | butanoic acid 1-methyl-1-((3S,5R,8S)-1,2,3,4,5,6,7,8-octahydro-3,8-dimethyl-5-azulenyl) ethyl ester | | 2-((3S,5R,8S)-3,8- | dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl) propan-2-yl butanoate | | 2-[(3S,5R,8S)-3,8- | dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-yl butanoate | | | guaiol butyrate | | (3S-(3alpha,5alpha,8alpha))-1- | methyl-1-(1,2,3,4,5,6,7,8-octahydro-3,8-dimethyl azulen-5-yl) ethyl butyrate |
soluble in :
|
| | alcohol |
insoluble in :
|
| | water |
potential blenders : note
|
| iso | amyl formate | FL/FR |
| iso | amyl undecylenate | FL/FR |
| para- | anisyl acetate | FL/FR |
| para- | anisyl butyrate | FL/FR |
| para- | anisyl phenyl acetate | FL/FR |
| | apple crotonate | FR |
| | apricot isobutyrate | FR |
| | benzoin absolute siam | FL/FR |
| | benzoin resinoid siam | FL/FR |
| 1- | benzoyl acetone | FL/FR |
| | benzyl alcohol | FL/FR |
| 3- | benzyl-4-heptanone | FL/FR |
| laevo- | bornyl acetate | FL/FR |
| | butyl anthranilate | FL/FR |
| | butyl benzyl ether | FL/FR |
| | butyl formate | FL/FR |
| | cananga oil | FL/FR |
| | cananga oil china | FL/FR |
| | cardamom seed oil | FL/FR |
| | citronellyl formate | FL/FR |
| | citronellyl propionate | FL/FR |
| | conifer acetate | FL/FR |
| | copaiba balsam | FL/FR |
| beta- | damascenone | FL/FR |
| (E)-alpha- | damascone | FL/FR |
| (E)-beta- | damascone | FL/FR |
| (Z)-alpha- | damascone | FL/FR |
| (Z)-beta- | damascone | FL/FR |
| beta- | damascone | FL/FR |
| gamma- | damascone | FR |
| iso | decanal | FL/FR |
| (Z)-4- | decen-1-yl acetate | FL/FR |
| | dihydrocarvyl acetate | FL/FR |
| | dimethyl anthranilate | FL/FR |
| | dimethyl benzyl carbinyl butyrate | FL/FR |
| alpha,alpha- | dimethyl benzyl isobutyrate | FL/FR |
| | elemi resinoid | FL/FR |
| | ethyl 4-phenyl butyrate | FL/FR |
| | ethyl cinnamate | FL/FR |
| | farnesyl acetate | FL/FR |
| | fir needle oil canada | FL/FR |
| | fir needle oil terpeneless | FL/FR |
| | floral pyran | FR |
| | galangal root oleoresin | FL |
| | galbanum absolute | FL/FR |
| | galbanum resinoid | FR |
| | geranium rose-scented oil (pelargonium spp.) cuba | FR |
| | geranyl acetate | FL/FR |
| (E)- | geranyl linalool | FL/FR |
| | globulol | |
| | guaiacwood oil 20% in gurjun balsam oil | FR |
| alpha- | guaiene | FR |
| | gurjun balsam oil | FR |
| alpha- | gurjunene | CS |
| | hawthorn ethanol | FR |
| | hemlock western oil | FR |
| | heptyl formate | FL/FR |
| 2- | hexen-1-al | FL |
| | hexyl formate | FL/FR |
| 4- | hydroxybenzaldehyde | FL/FR |
| | juniper berry absolute | FL/FR |
| | methyl formate | FL |
| | methyl hydrogenated rosinate | CS |
| 2- | methyl octanal | FL/FR |
| | muhuhu wood oil | FR |
| | musk acetate | FR |
| | myrrh absolute | FL/FR |
| | myrrh resinoid | FR |
| | neryl acetate | FL/FR |
| | neryl isovalerate | FL/FR |
| | nonanal diethyl acetal | FL/FR |
| | nonanol | FL/FR |
| | nutmeg absolute | FL/FR |
| | patchouli oil | FL/FR |
| | petitgrain mandarin oil | FL/FR |
| | phenethyl acetate | FL/FR |
| | phenethyl anthranilate | FL/FR |
| | phenethyl phenyl acetate | FL/FR |
| | phenethyl salicylate | FL/FR |
| | phenyl acetaldehyde | FL/FR |
| | phenyl acetaldehyde digeranyl acetal | FR |
| 1- | phenyl propyl butyrate | FL/FR |
| 3- | phenyl propyl isovalerate | FL/FR |
| | pine needle oil dwarf | FL/FR |
| | plum crotonate | FR |
| | propyl salicylate | FR |
| | rose absolute morocco | FL/FR |
| | rose butanoate | FL/FR |
| laevo- | rose oxide | FL/FR |
| (E)- | sabinene hydrate | FL/FR |
| | sandalwood oil | FL/FR |
| | sandalwood oil west australia | FR |
| | santalyl butyrate | FL/FR |
| | strawberry glycidate 2 | FL/FR |
| | styralyl propionate | FL/FR |
| | tolu balsam absolute | FL/FR |
| | tolu balsam resinoid | FR |
| 4-(para- | tolyl)-2-butanone | FL/FR |
| (E)-2- | undecen-1-ol | FL/FR |
| 2- | undecen-1-ol | FL/FR |
| | valerian root oil | FL/FR |
| | valerian root oil china | FL/FR |
| | valerian root oil CO2 extract china | FL/FR |
| | vetiverol | FL/FR |
potential uses :
|
| | animal | | | birch tar | | | castoreum | | | civet | | | date | | | heather | | | leather | | | plum | | | tobacco tabac tabaco leaf |
natural occurrence in : note
|
| | not found in nature
| |
|