| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | ethyl butanoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C6H12O2/c1-3-5-6(7)8-4-2/h3-5H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | OBNCKNCVKJNDBV-UHFFFAOYAO | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCC(=O)OCC | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 182.60 | h. number : | 2915.60.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 1.00 % in propylene glycol. | fruity juicy fruit pineapple cognac | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 20.00 ppm. Fruity, sweet, tutti frutti, apple, fresh and lifting, ethereal | |||||||||||||||||||||||||||||||||||
| substantivity : | 4 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.87400 - 0.88200 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.273 to 7.339 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.87500 - 0.88300 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.289 to 7.356 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.39000 - 1.39400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | -101.00 - -93.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 120.00 - 121.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 47.00 - 48.00 °C. @ 50.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 1.85 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| Storage : | refrigerate in tightly sealed containers. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 13050.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >2.00 gm/kg FCTXAV 12,719,1974 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 77.00 °F. TCC ( 25.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for ethyl butyrate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for ethyl butyrate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 1400.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-306-4 | |||||||||||||||||||||||||||||||||||
| rtecs : | ET1660000 for 105-54-4 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000105544 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 105-54-4 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 8857 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150853 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 5050493 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 19, No. 4, 45, (1994)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| butanoic acid ethyl ester | |
| butyric acid ethyl ester | |
| butyric ester | |
| butyric ether | |
| ethyl butanoate | |
| ethyl butyrate | |
| ethyl N-butyrate | |
| soluble in : | |
| fixed oils | |
| kerosene | |
| paraffin oil | |
| propylene glycol | |
| water, 4900 mg/L @ 20C | |
| insoluble in : | |
| glycerin | |
| (odor and/or flavor) blends with : | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| benzaldehyde | |
| benzyl acetate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| camphor oil | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| diethyl malonate | |
| ethyl acetate | |
| ethyl acetoacetate | |
| ethyl heptanoate | |
| geranyl acetate | |
| grapefruit oil | |
| green acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| (Z)-3- | hexen-1-yl acetate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| hexyl isovalerate | |
| 2,4- | ivy carbaldehyde |
| leaf acetal | |
| lime oil | |
| linalool | |
| linalyl acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl 2-methyl valerate | |
| methyl heptenone | |
| neryl acetate | |
| octanal | |
| orange oil | |
| petitgrain oil | |
| phenethyl acetate | |
| spearmint oil | |
| strawberry furanone | |
| styralyl acetate | |
| alpha- | terpinyl acetate |
| para- | tolyl aldehyde |
| (odor and/or flavor) used in : | |
| apple | |
| apricot | |
| banana | |
| berry | |
| blueberry | |
| bubblegum | |
| butter | |
| butterscotch | |
| caramel | |
| cheese cheddar cheese | |
| cheese swiss cheese | |
| cherry | |
| currant | |
| dairy | |
| eggnog | |
| floral | |
| fruit | |
| fruit juicy fruit | |
| gooseberry | |
| grape | |
| grenadine | |
| herbal | |
| honey miel | |
| kiwi | |
| lemon | |
| mango | |
| melon watermelon muskmelon cantaloupe | |
| mulberry | |
| nut pistachio | |
| olive | |
| orange | |
| passion fruit | |
| peach | |
| pear | |
| pineapple | |
| plum | |
| plum greengage plum | |
| plum mirabelle plum | |
| quince | |
| raspberry | |
| rose | |
| rum | |
| strawberry | |
| tutti frutti | |
| natural occurrence in : | |
| apple | |
| apple juice | |
| banana | |
| beer | |
| brandy | |
| butter | |
| data page | champaca concrete @ 0.01% |
| cheese cheddar cheese | |
| cheese gorgonzola cheese | |
| cheese swiss cheese | |
| cider | |
| coffee | |
| grape concord grape | |
| grapefruit | |
| data page | guava fruit headspace reunion @ 0.50% |
| data page | guava fruit oil reunion @ 0.10% |
| kiwi | |
| mango | |
| melon | |
| orange juice | |
| papaya | |
| passion fruit | |
| pineapple | |
| rum | |
| data page | star fruit oil cuba @ trace% |
| strawberry | |
| data page | tagete oil rwanda @ 0.12% |
| whiskey | |
| wine white wine | |