| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 2,6-dimethyl-3-(2-methylfuran-3-yl)sulfanylheptan-4-one |
| InChI : | InChI=1/C14H22O2S/c1-9(2)8-12(15)14(10(3)4)17-13-6-7-16-11(13)5/h6-7,9-10,14H,8H2,1-5H3 |
| InChIKey : | PFFLSEMCPNTWOY-UHFFFAOYAO |
| SMILES : | CC1=C(C=CO1)SC(C(C)C)C(=O)CC(C)C |
| cas number : | 61295-51-0 |
| (EINECS) number : | 262-692-2 |
| fema number : | 3538 |
| coe number : | 11915 |
| jecfa number : | 1086 |
| fl. number : | 13.075 |
| molar refractivity : | 73.59 ± 0.4 cm3 |
| parachor : | 609.1 ± 6.0 cm3 |
| index of refraction : | 1.503 ± 0.03 |
| surface tension : | 35.8 ± 5.0 dyne/cm |
| density : | 1.02 ± 0.1 g/cm3 |
| polarizability : | 29.17 ± 0.5 10-24cm3 |
| XlogP : | 3.30 |
| molecular weight : | 254.3882800 |
| formula : | C14 H22 O2 S |
| NMR Predictor : | Predict |
|
|
| |
| |
| export tariff code : | unspecified |
| fda reg : | unspecified |
organoleptics :
|
| odor type : | meaty |
| odor strength : | high ,
recommend smelling in a 0.10 % solution or less |
odor description :
at 0.10 % in propylene glycol. | meaty |
properties :
|
| appearence : | colorless clear liquid |
| assay : | 95.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 1.00600 to 1.02200 @ 25.00 °C.
|
| pounds per gallon - calc. : | 8.371 to 8.504
|
| refractive index : | 1.48800 to 1.49400 @ 20.00 °C.
|
| boiling point : | 90.00 to 92.00 °C. @ 0.20 mm Hg
|
| flash point : | 293.00 °F. TCC ( 145.00 °C. )
|
| logP (o/w) : | 4.29 |
safety :
|
| Oral Toxicity(LD50) : | | |
Not determined
|
| Dermal Toxicity(LD50) : | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | |
Not determined
|
| |
safety in use :
|
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | ND (μg/capita/day) |
| |
| recommendation for 2,6-dimethyl-3-((2-methyl-3-furyl)thio)-4-heptanone usage levels up to : | | | not for fragrance use.
|
safety references :
|
| European Food Safety Athority(efsa) : | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
| EPI System : | view |
| Canada Domestic Sub. List : | Yes |
| |
| | | |
| | 2,6-dimethyl-3-(2-methylfuran-3-yl)sulfanylheptan-4-one
|
| (EINECS) number : | 262-692-2 |
| chemidplus : | 061295510 |
| EPA Substance Registry Services : | 61295-51-0 |
references :
|
| | 2,6-dimethyl-3-(2-methylfuran-3-yl)sulfanylheptan-4-one
|
| fl. number : | 13.075 |
| jecfa number : | 1086 |
| pubchem : | 198719 |
other :
|
|
synonyms :
|
| 1,3- | diisopropyl acetonyl 2-methyl-3-furyl sulfide | | 2,6- | dimethyl-3-((2-methyl-3-furyl)sulfanyl) heptan-4-one | | 2,6- | dimethyl-3-((2-methyl-3-furyl)thio) heptan-4-one | | 2,6- | dimethyl-3-(2-methylfuran-3-yl)sulfanylheptan-4-one | | 3-2- | methyl-3-furyl thio-2,6-dimethyl-1,4-heptanone | | 3-((2- | methyl-3-furyl)thio)-2,6-dimethyl-4-heptanone |
soluble in :
|
| | alcohol |
insoluble in :
|
| | water |
(odor and/or flavor) blends with :
|
| 4- | acetyl-2-methyl pyrimidine |
| 4- | allyl-2,6-dimethoxyphenol |
| 4- | aminobutyric acid |
| | amyl mercaptan |
| | bacon dithiazine |
| | benzothiazole |
| 1,2- | butane dithiol |
| 1,3- | butane dithiol |
| 2,3- | butane dithiol |
| 2-(2- | butyl)-4,5-dimethyl-3-thiazoline |
| | butyraldehyde |
| | coffee difuran |
| | cyclopropyl (E,Z)-2,6-nonadienamide |
| (E,E)-2,4- | decadien-1-al |
| 2,5- | diethyl thiazole |
| 3,5- | diethyl-2-methyl pyrazine |
| 2,5- | diethyl-3-methyl pyrazine |
| | difurfuryl sulfide |
| 2,5- | dihydroxy-1,4-dithiane |
| N-(2,4- | dimethoxybenzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N-(2-(3,4- | dimethoxyphenyl)ethyl)-3,4-dimethoxycinnamic acid amide |
| 2,5- | dimethyl furan |
| | dimethyl tetrasulfide |
| 2,6- | dimethyl thiophenol |
| | dimethyl trisulfide |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 3,7- | dimethyl-2,6-octadien-1-yl cyclopropyl carboxamide |
| 2,5- | dimethyl-3-furan thiol |
| bis(2,5- | dimethyl-3-furyl) disulfide |
| (Z+E)-2,5- | dimethyl-3-tetrahydrofuran thiol |
| (Z+E)-2,5- | dimethyl-3-thioacetoxytetrahydrofuran |
| 2,5- | dimethyl-3-thiofuroyl furan |
| 1,1- | ethane dithiol 1% in ethanol |
| 2- | ethoxythiazole |
| | ethyl (E,Z)-2,6-nonadienamide |
| S- | ethyl 2-acetyl aminoethane thioate |
| | ethyl 3-mercaptopropionate |
| | ethyl 4-(acetyl thio) butyrate |
| S- | ethyl thioacetate |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline |
| | fish thiol |
| | furfuryl isopropyl sulfide |
| 4- | furfuryl thio-2-pentanone |
| | hazelnut pyrazine |
| N-( | heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide |
| 1,6- | hexane dithiol |
| | hexyl mercaptan |
| | massoia bark oil |
| | meaty dithiane |
| 4- | mercapto-2-pentanone 1% in acetoin |
| (R*,S*)-2- | mercapto-3-butanol |
| 2- | mercapto-3-pentanone |
| 2- | mercaptomethyl pyrazine |
| 2- | mercaptopropionic acid |
| N1-(2- | methoxy-4-methyl benzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N1-(2- | methoxy-4-methyl benzyl)-N2-2(2-(5-methyl pyridin-2-yl)ethyl) oxalamide |
| | methyl 2-methyl-3-furyl disulfide |
| 2- | methyl 3-(methyl thio) furan 10% in triacetin |
| 4- | methyl 4-mercaptopentan-2-one 1% in pg |
| | methyl benzoxole |
| | methyl dihydrofuran thiol |
| 4- | methyl nonanoic acid |
| 2- | methyl pyrazine |
| 2- | methyl thiazolidine |
| 2-( | methyl thio) ethanol |
| 3-( | methyl thio) propanol |
| 12- | methyl tridecanal |
| 2- | methyl-1-methyl thio-2-butene |
| 3- | methyl-2-butane thiol |
| 2- | methyl-3-,5 or 6-(furfuryl thio) pyrazine |
| 2- | methyl-3-(methyl thio) pyrazine |
| 2- | methyl-3-furyl tetrasulfide |
| bis(2- | methyl-3-furyl) disulfide |
| S-(2- | methyl-3-furyl) ethane thioate |
| 3-((2- | methyl-3-furyl)thio)-4-heptanone |
| 4-((2- | methyl-3-furyl)thio)-5-nonanone |
| 2- | methyl-3-tetrahydrofuran thiol |
| 2- | naphthyl mercaptan |
| 1,9- | nonane dithiol |
| | nutty thiazole |
| 1,8- | octane dithiol |
| | peanut dithiazine |
| 4- | penten-1-yl acetate |
| 1- | phenethyl mercaptan |
| 1,3- | propane dithiol |
| 2- | propionyl-2-thiazoline |
| | propyl 2-mercaptopropionate |
| | propyl 2-methyl-3-furyl disulfide |
| iso | propyl disulfide |
| iso | propyl mercaptan |
| | pyrazinyl ethane thiol |
| 2- | pyridinyl methane thiol |
| | pyrrolidino-(1,2E)-4H-2,4-dimethyl-1,3,5-dithiazine |
| | roasted butanol |
| | rum ether |
| | sulfuryl acetate |
| 3- | tetrahydrothiophenone |
| | thialdine |
| 3- | thienyl mercaptan |
| 1-(2- | thienyl) butanone |
| ortho- | thiocresol |
| | thioguaiacol |
| 2,4,6- | trithiaheptane 10% in triacetin |
| | tyramine |
(odor and/or flavor) used in :
|
| | meat |
natural occurrence in :
|
| not found in nature |
|