| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | N-(heptan-4-yl)-1,3-benzodioxole-5-carboxamide |
| InChI : | InChI=1/C15H21NO3/c1-3-5-12(6-4-2)16-15(17)11-7-8-13-14(9-11)19-10-18-13/h7-9,12H,3-6,10H2,1-2H3,(H,16,17) |
| InChIKey : | YOBNUUGTIXQSPD-UHFFFAOYAX |
| SMILES : | CCCC(CCC)NC(=O)c1ccc2OCOc2c1 |
| cas number : | 745047-51-2 |
| fema number : | 4232 |
| jecfa number : | 1767 |
| molar refractivity : | 72.89 ± 0.5 cm3 |
| parachor : | 572.6 ± 8.0 cm3 |
| index of refraction : | 1.545 ± 0.05 |
| surface tension : | 38.2 ± 7.0 dyne/cm |
| density : | 1.14 ± 0.1 g/cm3 |
| polarizability : | 28.89 ± 0.5 10-24cm3 |
| molecular weight : | 263.3321400 |
| formula : | C15 H21 N O3 |
| NMR Predictor : | Predict |
|
|
| |
| |
| export tariff code : | unspecified |
| fda reg : | unspecified |
organoleptics :
|
odor description :
| savory meaty |
properties :
|
| appearence : | white powder |
| assay : | 99.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| melting point : | 116.00 to 117.00 °C. @ 760.00 mm Hg
|
| boiling point : | 378.00 to 379.00 °C. @ 760.00 mm Hg
|
| flash point : | 361.00 °F. TCC ( 182.78 °C. )
|
| logP (o/w) : | 3.28 |
safety :
|
| Oral Toxicity(LD50) : | | |
Not determined
|
| Dermal Toxicity(LD50) : | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | |
Not determined
|
| |
safety in use :
|
| |
| recommendation for N-(heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide usage levels up to : | | | not for fragrance use.
|
| |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA on the "LIBRARY" link. |
| publication number : 22 |
| | average usual ppm | average maximum ppm |
| baked goods : | 1.00000 | 2.00000 |
| beverages(nonalcoholic) : | - | - |
| beverages(alcoholic) : | - | - |
| breakfast cereal : | - | - |
| cheese : | 1.00000 | 3.00000 |
| chewing gum : | - | - |
| condiments / relishes : | 2.00000 | 4.00000 |
| confectionery froastings : | - | - |
| egg products : | - | - |
| fats / oils : | 2.00000 | 4.00000 |
| fish products : | 1.00000 | 3.00000 |
| frozen dairy : | - | - |
| fruit ices : | - | - |
| gelatins / puddings : | - | - |
| granulated sugar : | - | - |
| gravies : | 2.00000 | 4.00000 |
| hard candy : | - | - |
| imitation dairy : | - | - |
| instant coffee / tea : | - | - |
| jams / jellies : | - | - |
| meat products : | 1.00000 | 3.00000 |
| milk products : | - | - |
| nut products : | - | - |
| other grains : | - | - |
| poultry : | 1.00000 | 3.00000 |
| processed fruits : | - | - |
| processed vegetables : | 1.00000 | 3.00000 |
| reconstituted vegetables : | - | - |
| seasonings / flavors : | 5.00000 | 10.00000 |
| snack foods : | 5.00000 | 10.00000 |
| soft candy : | - | - |
| soups : | 2.00000 | 4.00000 |
| sugar substitutes : | - | - |
| sweet sauces : | - | - |
safety references :
|
| EPI System : | view |
| |
| | | |
| | N-(heptan-4-yl)-1,3-benzodioxole-5-carboxamide
|
| chemidplus : | 745047-51-2 |
| EPA Substance Registry Services : | 745047-51-2 |
references :
|
| | N-(heptan-4-yl)-1,3-benzodioxole-5-carboxamide
|
| jecfa number : | 1767 |
| pubchem : | 745047-51-2 |
other :
|
|
synonyms :
|
| N-( | heptan-4-yl)-1,3-benzodioxole-5-carboxamide | | N-( | heptan-4-yl)benzo[d][1,3]dioxole-5-carboxamide | | N-(1- | propyl butyl)-N-(1-propyl butyl)-1,3-benzodioxole-5-carboxamide |
soluble in :
|
| | alcohol, slightly |
insoluble in :
|
| | water |
(odor and/or flavor) blends with :
|
| 4- | acetyl-2-methyl pyrimidine |
| 4- | allyl-2,6-dimethoxyphenol |
| 4- | aminobutyric acid |
| | amyl mercaptan |
| | bacon dithiazine |
| 1,3- | butane dithiol |
| 2,3- | butane dithiol |
| 2-(2- | butyl)-4,5-dimethyl-3-thiazoline |
| | butyraldehyde |
| | coffee difuran |
| | cyclopropyl (E,Z)-2,6-nonadienamide |
| 2,5- | diethyl thiazole |
| 3,5- | diethyl-2-methyl pyrazine |
| 2,5- | diethyl-3-methyl pyrazine |
| | difurfuryl sulfide |
| 2,5- | dihydroxy-1,4-dithiane |
| N-(2,4- | dimethoxybenzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N-(2-(3,4- | dimethoxyphenyl)ethyl)-3,4-dimethoxycinnamic acid amide |
| 2,5- | dimethyl furan |
| | dimethyl tetrasulfide |
| 2,6- | dimethyl thiophenol |
| | dimethyl trisulfide |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 3,7- | dimethyl-2,6-octadien-1-yl cyclopropyl carboxamide |
| 2,6- | dimethyl-3-((2-methyl-3-furyl)thio)-4-heptanone |
| 2,5- | dimethyl-3-furan thiol |
| bis(2,5- | dimethyl-3-furyl) disulfide |
| 2,5- | dimethyl-3-thiofuroyl furan |
| 1,1- | ethane dithiol 1% in ethanol |
| | ethyl (E,Z)-2,6-nonadienamide |
| S- | ethyl 2-acetyl aminoethane thioate |
| | ethyl 3-mercaptopropionate |
| | ethyl 4-(acetyl thio) butyrate |
| S- | ethyl thioacetate |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline |
| | fish thiol |
| | furfuryl isopropyl sulfide |
| 4- | furfuryl thio-2-pentanone |
| | hazelnut pyrazine |
| 1,6- | hexane dithiol |
| | hexyl mercaptan |
| | meaty dithiane |
| 4- | mercapto-2-pentanone 1% in acetoin |
| 2- | mercapto-3-pentanone |
| 2- | mercaptomethyl pyrazine |
| 2- | mercaptopropionic acid |
| N1-(2- | methoxy-4-methyl benzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N1-(2- | methoxy-4-methyl benzyl)-N2-2(2-(5-methyl pyridin-2-yl)ethyl) oxalamide |
| | methyl 2-methyl-3-furyl disulfide |
| 2- | methyl 3-(methyl thio) furan 10% in triacetin |
| 4- | methyl 4-mercaptopentan-2-one 1% in pg |
| | methyl dihydrofuran thiol |
| 4- | methyl nonanoic acid |
| 2- | methyl pyrazine |
| 2- | methyl thiazolidine |
| 2-( | methyl thio) ethanol |
| 12- | methyl tridecanal |
| 2- | methyl-1-methyl thio-2-butene |
| 3- | methyl-2-butane thiol |
| 2- | methyl-3-(methyl thio) pyrazine |
| 2- | methyl-3-furyl tetrasulfide |
| bis(2- | methyl-3-furyl) disulfide |
| S-(2- | methyl-3-furyl) ethane thioate |
| 3-((2- | methyl-3-furyl)thio)-4-heptanone |
| 4-((2- | methyl-3-furyl)thio)-5-nonanone |
| 2- | methyl-3-tetrahydrofuran thiol |
| 2- | naphthyl mercaptan |
| 1,9- | nonane dithiol |
| | nutty thiazole |
| 1,8- | octane dithiol |
| | peanut dithiazine |
| 1- | phenethyl mercaptan |
| 1,3- | propane dithiol |
| 2- | propionyl-2-thiazoline |
| | propyl 2-mercaptopropionate |
| | propyl 2-methyl-3-furyl disulfide |
| iso | propyl disulfide |
| iso | propyl mercaptan |
| | pyrazinyl ethane thiol |
| 2- | pyridinyl methane thiol |
| | pyrrolidino-(1,2E)-4H-2,4-dimethyl-1,3,5-dithiazine |
| | roasted butanol |
| | rum ether |
| | sulfuryl acetate |
| 3- | tetrahydrothiophenone |
| | thialdine |
| | thiazole |
| 3- | thienyl mercaptan |
| 1-(2- | thienyl) butanone |
| ortho- | thiocresol |
| | thioguaiacol |
| | tyramine |
(odor and/or flavor) used in :
|
| | meat |
natural occurrence in :
|
| not found in nature |
|