| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 4-methoxybenzaldehyde | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | ZRSNZINYAWTAHE-UHFFFAOYAA | |||||||||||||||||||||||||||||||||
| SMILES : | COC1=CC=C(C=C1)C=O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2912.49.0000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | anisic | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet powdery mimosa floral hawthorn balsam | |||||||||||||||||||||||||||||||||
| taste description³ : | at 15.00 ppm. Creamy, powdery, vanilla and spicy with a typical marshmallow flavor | |||||||||||||||||||||||||||||||||
| substantivity : | 44 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | pale yellow clear oily liquid | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 1.11900 - 1.12600 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.311 to 9.369 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.57000 - 1.57400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| melting point : | -1.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 248.00 - 249.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 121.00 - 122.00 °C. @ 10.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 4.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 1.76 | |||||||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1510.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 12,823,1974 | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 228.00 °F. TCC ( 108.89 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for para-anisaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for para-anisaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||||
| 76.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-602-6 | |||||||||||||||||||||||||||||||||
| rtecs : | BZ26625000 for 123-11-5 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000123115 | |||||||||||||||||||||||||||||||||
| epa-srs : | 123-11-5 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 5590 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 173281 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1388506854 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 23, No. 3, 55, (1998)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| 4- | anisaldehyde |
| para- | anisaldehyde |
| anise aldehyde | |
| anisic aldehyde | |
| para- | anisic aldehyde |
| anisyl aldehyde | |
| aubepine | |
| para- | formyl anisole |
| 4- | methoxybenzaldehyde |
| para- | methoxybenzaldehyde |
| soluble in : | |
| ethyl alcohol, 1:7 in 50% alcohol | |
| ethyl alcohol, 7 vol. of 50% alcohol | |
| fatty oils | |
| kerosene | |
| propylene glycol | |
| sodium bisulfite, 99% soluble in solution | |
| insoluble in : | |
| paraffin oil | |
| water | |
| alcohol | |
| stability : | |
| bath foam | |
| cream | |
| detergent | |
| hair spray | |
| non-discoloring in most media | |
| powder | |
| soap | |
| stable in weak acids and bases | |
| (odor and/or flavor) blends with : | |
| acetanisole | |
| acetoin | |
| acetophenone | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| anethol | |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| iso | bornyl acetate |
| cassia bark oil | |
| celery seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| costus valerolactone | |
| coumarin | |
| cuminaldehyde | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl hydroquinone | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl salicylate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropin | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| ionones | |
| lilyall | |
| alpha- | methyl cinnamaldehyde |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| neroli oil | |
| nerolidol | |
| nonanol | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| petitgrain oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| storax resinoid | |
| alpha- | terpineol |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| woody acetate | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| almond | |
| amber | |
| ambrene | |
| angel | |
| anise | |
| apple | |
| apres l'ondee | |
| apricot | |
| balsam | |
| banana | |
| benzoinett | |
| bluebell | |
| bouquet | |
| broom genet genista | |
| buchu | |
| butterscotch | |
| cassie acacia farnesiana | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chypre | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cologne | |
| crabapple blossom | |
| decumaria | |
| elder blossom | |
| fennel | |
| fern fougere | |
| floral | |
| gardenia | |
| ginger white ginger | |
| gooseberry | |
| grape | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| hibiscus | |
| honey miel | |
| honeysuckle chevrefeuille | |
| hops houblon | |
| jasmin | |
| jonquil narcissus jonquilla | |
| lemon | |
| lilac lilas syringa | |
| lime | |
| linden blossom limeflower tilleul | |
| lux beauty shower soap | |
| magnolia | |
| melon watermelon muskmelon cantaloupe | |
| mimosa wattle | |
| nut walnut | |
| orange | |
| orchid | |
| oriental | |
| pear | |
| peppermint | |
| pineapple | |
| powder | |
| raspberry | |
| sassafras | |
| spearmint | |
| strawberry | |
| sweet pea pois de senteur | |
| tide | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| ylang ylang cananga | |
| natural occurrence in : | |
| acacia farnesiana willd. | |
| anise | |
| data page | anise seed oil colombia @ 0.17% |
| data page | anise seed oil star china @ 0.28% |
| anise star anise | |
| boswelha senata | |
| data page | cassie absolute @ 34.36% |
| erica arborea | |
| fennel | |
| data page | fennel flower oil bitter lithuania @ 0.29% |
| data page | helichrysum arenarium (l.) moench oil hungary @ 0.30% |
| data page | heracleum paphlagonicum czeczott fruit oil turkey @ <0.10% |
| data page | lecythis usitata miers. var. paraensis (ducke) r. kunth. flower oil brazil @ 0.20% |
| magnolia salicifolia maxim. | |
| pirus communis | |
| data page | tagete oil CO2 extract @ 2.10% |
| vanilla | |