Notes :
Gives good body.
waxy floral fruity accord:
0.05 - leerall
0.01 - aldehyde C-14
0.05 - aldehyde C18 10%
0.01 - musk gx
0.01 - raspberry ketone 10%
0.01 - aldehyde C-16 10%
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | 4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde | |||||||||||||||||||||||||
| InChI : | InChI=1/C13H22O2/c1-13(2,15)9-3-4-11-5-7-12(10-14)8-6-11/h5,10,12,15H,3-4,6-9H2,1-2H3 | |||||||||||||||||||||||||
| InChIKey : | ORMHZBNNECIKOH-UHFFFAOYAY | |||||||||||||||||||||||||
| SMILES : | CC(C)(CCCC1=CCC(CC1)C=O)O | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2912.30.0000 | |||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||
| odor description : at 100.00 %. | floral muguet cyclamen rhubarb woody | |||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear viscous liquid | |||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.98900 - 0.99700 @ 25.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.229 to 8.296 | |||||||||||||||||||||||||
| refractive index : | 1.48600 - 1.49300 @ 20.00 °C. | |||||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||||
| logp : | 2.53 | |||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. store under nitrogen. | |||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3250.00 ul/kg | |||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 11300.00 ul/kg | |||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 200.00 °F. TCC ( 93.33 °C. ) | |||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||
| limits in the finished product for - "leave on the skin contact" : | ||||||||||||||||||||||||||
| 1.5000 % Restriction. | ||||||||||||||||||||||||||
| limits in the finished product for - "wash off the skin contact" : | ||||||||||||||||||||||||||
| 1.5000 % Restriction. | ||||||||||||||||||||||||||
| limits in the finished product for - "no skin contact" : | ||||||||||||||||||||||||||
| 15.0000 % Restriction. | ||||||||||||||||||||||||||
| recommendation for leerall usage levels up to : | ||||||||||||||||||||||||||
| 20.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for leerall usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||
| (EINECS) number : | 250-863-4 | |||||||||||||||||||||||||
| chemidplus : | 031906044 | |||||||||||||||||||||||||
| epa-srs : | 31906-04-4 | |||||||||||||||||||||||||
| ifra : | ifra - ( Found under : HMPCC ) | |||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||
| pubchem : | 668391 | |||||||||||||||||||||||||
| synonyms : | |
| 4-(4- | hydroxy-4-methyl pentyl) cyclohex-3-ene carbaldehyde |
| 3-(4- | hydroxy-4-methyl pentyl) cyclohex-3-ene-1-carbaldehyde |
| 3 and 4-(4- | hydroxy-4-methyl pentyl)-3-cyclohexene-1-carboxaldehyde |
| 4-(4- | hydroxy-4-methyl pentyl)-3-cyclohexene-1-carboxaldehyde |
| hydroxyisohexyl 3-cyclohexene carboxaldehyde | |
| 4,4- | hydroxymethyl pentyl cyclohexene carbaldehyde |
| kovanol | |
| landolal | |
| leerall | |
| lyral | |
| mugonal | |
| soluble in : | |
| alcohol | |
| water, very slightly | |
| insoluble in : | |
| paraffin oil | |
| water | |
| stability : | |
| alcoholic fine fragrance, good | |
| alcoholic lotion | |
| antiperspirant, good | |
| deo stick | |
| detergent perborate | |
| fabric softener, good | |
| hard surface cleaner | |
| liquid detergent | |
| shampoo | |
| soap, good | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| acetoin | |
| algae absolute | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| amber carbinol | |
| ambroxan | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| armoise oil | |
| bay leaf oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzophenone | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| caraway seed oil | |
| cardamom seed oil | |
| carnation absolute | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| para- | cresyl caprylate |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanal | |
| decanol | |
| 9- | decen-1-ol |
| decyl acetate | |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl benzyl carbinyl isobutyrate | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl vanillin | |
| eugenol | |
| iso | eugenyl acetate |
| fennel seed oil | |
| fir balsam absolute | |
| fir needle oil | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| geranium oil | |
| geranyl acetate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| ho leaf oil | |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| juniper berry oil | |
| labdanum resinoid | |
| lavender absolute | |
| leaf acetal | |
| lilyall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl acetophenone | |
| methyl anthranilate | |
| methyl cedryl ketone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| methyl isoeugenol | |
| methyl octine carbonate | |
| methyl phenyl acetate | |
| 2- | methyl undecanal |
| mimosa absolute | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| neryl acetate | |
| gamma- | nonalactone |
| nonanal | |
| nonanol | |
| nopyl acetate | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| (Z)-5- | octen-1-ol |
| orange oil | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| pepper oil black | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenethyl isovalerate | |
| phenethyl phenyl acetate | |
| phenethyl propionate | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| spearmint oil | |
| spruce oil | |
| strawberry furanone | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| tangerine oil | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| undecanol | |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| agrumen | |
| aldehydic | |
| almond | |
| almond blossom | |
| alpine bouquet | |
| amber | |
| ambergris | |
| ambrette | |
| angel | |
| angelica | |
| animal | |
| apple | |
| apple blossom | |
| apple crabapple | |
| apple green apple | |
| apple red apple | |
| ash mountain ash berry | |
| balsam | |
| banana | |
| bark | |
| bay rum | |
| bayberry | |
| bergamot | |
| blackberry | |
| blueberry | |
| blueberry whortleberry red whortleberry | |
| bois de rose rosewood | |
| botanical | |
| bouquet | |
| boxwood blossom | |
| boysenberry | |
| bramble arctic bramble blackberry | |
| briar sweet briar eglantine | |
| broom genet genista | |
| bubblegum | |
| burberry | |
| butterscotch | |
| calamus | |
| caramel | |
| carnation dianthus oeillet | |
| cassia blossom | |
| cassie acacia farnesiana | |
| cedar forest | |
| cedarleaf | |
| cherry | |
| cherry blossom | |
| chypre | |
| citrus | |
| civet | |
| clematis | |
| cloth clean cloths | |
| cloudberry bakeapple | |
| clove blossom | |
| clover trefle le'trefle incarnat | |
| colonia | |
| costus | |
| crabapple blossom | |
| cranberry | |
| cucumber | |
| curacao | |
| currant | |
| cyclamen | |
| daffodil narcissus | |
| dillenia | |
| elder blossom | |
| elderberry | |
| fagonia | |
| fantasy blends | |
| fern fougere | |
| fetes | |
| fidji | |
| fig | |
| fir balsam | |
| fir needle | |
| floral | |
| florida breeze | |
| foliage | |
| forest | |
| frangipanni plumeria | |
| freesia | |
| galbanum | |
| gardenia | |
| geranium | |
| ginger | |
| ginger white ginger | |
| gingergrass | |
| gooseberry | |
| grape | |
| grapefruit | |
| greenhouse | |
| guaiacwood | |
| guava | |
| heather | |
| herbal | |
| hibiscus | |
| hollyberry | |
| honeysuckle chevrefeuille | |
| huckleberry bilberry | |
| hyacinth jacinthe | |
| hydrangea | |
| iris blossom | |
| ivy leaf | |
| jackfruit | |
| jasmin | |
| jonquil narcissus jonquilla | |
| joop | |
| juniperberry | |
| kewda | |
| kiwi | |
| kiwi blossom | |
| kumquat | |
| lavandin | |
| lavender | |
| leather | |
| lemon | |
| lemongrass | |
| lilac lilas syringa | |
| lily | |
| lime | |
| linaloe wood | |
| linden blossom limeflower tilleul | |
| loganberry dewberry | |
| lotus | |
| lychee soapberry | |
| magnolia | |
| mango | |
| mango blossom | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| millefleurs | |
| mimosa wattle | |
| mint | |
| muguet lily of the valley | |
| mulberry | |
| musk | |
| narcissus narcisse | |
| neroli | |
| new car | |
| ocean sea | |
| orange | |
| orange blossom fleur d'oranger | |
| orchid | |
| outdoors fresh outdoors | |
| pansy | |
| papaya | |
| passion blossom | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pear blossom | |
| pear prickly pear | |
| peony | |
| pert plus | |
| petal flower petal | |
| petitgrain bergamot petitgrain | |
| petitgrain lime petitgrain | |
| petunia | |
| phlox | |
| pina colada | |
| pineapple | |
| plum | |
| plum blossom | |
| plum mirabille blossom | |
| pomegranate | |
| poppy | |
| potpourri | |
| praline | |
| privet | |
| privet blossom | |
| quince | |
| raspberry | |
| rhubarb | |
| rose | |
| rose tea rose | |
| rose white rose | |
| rose wild rose | |
| saffron | |
| sandalwood | |
| spice | |
| starfruit | |
| stock evening scented stock | |
| strawberry | |
| sweet pea pois de senteur | |
| tangerine | |
| tea | |
| tide | |
| toffee | |
| tropical | |
| tuberose tubereuse | |
| tulip | |
| vanilla | |
| violet | |
| violet leaf | |
| wallflower giroflee | |
| wintergreen | |
| wistaria wisteria glycine | |
| woody | |
| yew | |
| ylang ylang cananga | |
| natural occurrence in : | |
| data page | not found in nature |