| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] acetate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4-8H,1-3H3/b5-4+ | |||||||||||||||||||||||||||||||||
| InChIKey : | IUSBVFZKQJGVEP-SNAWJCMRBS | |||||||||||||||||||||||||||||||||
| SMILES : | C\C=C\C1=CC(=C(C=C1)OC(=O)C)OC | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.35.1500 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | spicy | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet spicy floral carnation balsam | |||||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | white crystalline powder | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| melting point : | 79.00 - 81.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 282.00 - 283.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 2.54 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3450.00 mg/kg | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 300.00 °F. TCC ( > 148.89 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for isoeugenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for isoeugenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 100.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-236-1 | |||||||||||||||||||||||||||||||||
| rtecs : | SL7940000 for 93-29-8 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000093298 | |||||||||||||||||||||||||||||||||
| epa-srs : | 93-29-8 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 46121 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 150173 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3715792752 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| acetisoeugenol | |
| 4- | acetoxy-3-methoxy-1-propen-1-yl benzene |
| 4- | acetoxy-3-methoxy-1-propenyl benzene |
| acetyl isoeugenol | |
| iso | eugenol acetate |
| iso | eugenyl acetate |
| 2- | methoxy-4-(propenyl-1) phenyl acetate |
| 2- | methoxy-4-propenyl phenyl acetate |
| soluble in : | |
| alcohol | |
| fixed oils | |
| water, 40 mg/L @ 20C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| 2- | acetyl furan |
| allspice oil | |
| amber carbinol | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| iso | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl salicylate |
| caramel furanone | |
| carnation absolute | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coconut absolute | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| para- | cresyl phenyl acetate |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| dihydrojasmone | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanol | |
| ethyl cinnamate | |
| 4- | ethyl guaiacol |
| ethyl maltol | |
| ethyl vanillin | |
| eugenol | |
| fir balsam absolute | |
| floral pyranol | |
| guaiacol | |
| guaiacwood oil | |
| guaiacyl phenyl acetate | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| labdanum resinoid | |
| lavender absolute | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| maltol | |
| methyl acetophenone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl ionones | |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| pepper oil black | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| santall | |
| tetrahydrojasmone | |
| timber propanol | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| 10- | undecen-1-yl acetate |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| absinthe | |
| acacia | |
| acorn | |
| allspice | |
| amber | |
| ambreine | |
| ambrette | |
| animal | |
| arnica | |
| azalea | |
| balsam | |
| bay rum | |
| bayberry | |
| benzoin | |
| blossom tropical blossom | |
| bread baked bread | |
| broom genet genista | |
| cabreuva | |
| cake | |
| calamus | |
| cappuccino | |
| capsicum | |
| caramel | |
| carnation dianthus oeillet | |
| cascarilla | |
| cassia | |
| cassia blossom | |
| cassie acacia farnesiana | |
| castoreum | |
| chamomile | |
| champaca champak | |
| cherry black cherry | |
| chestnut blossom | |
| chicory root | |
| chocolate cacao | |
| cinnamon | |
| clove | |
| clove blossom | |
| coconut | |
| coconut tropical coconut | |
| coffee | |
| cookie | |
| copaiba | |
| coronilla | |
| currant | |
| cypress | |
| dahlia | |
| daisy | |
| daphne | |
| date | |
| deertongue | |
| dogwood | |
| elder blossom | |
| fagonia | |
| fantasy blends | |
| fenugreek | |
| fern fougere | |
| fig | |
| fir balsam | |
| floral | |
| flouve | |
| flouve blossom | |
| forest | |
| gingerbread | |
| graham cracker | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heather | |
| hollyberry | |
| hugonia | |
| immortelle helichrysum everlasting | |
| incense | |
| iris blossom | |
| jasmin | |
| kewda | |
| labdanum | |
| leaf autumn leaf | |
| leather | |
| liverwort | |
| lovage | |
| maja | |
| malt | |
| mate | |
| milk malted milk | |
| moss | |
| mulberry | |
| musk | |
| narcissus narcisse | |
| nutmeg | |
| oakmoss mousse de chene | |
| oakwood | |
| opoponax | |
| oriental | |
| osmanthus | |
| patchouli | |
| petunia | |
| pimento | |
| plum | |
| powder | |
| pumpkin | |
| rose | |
| rose d'orient | |
| rose moss rose | |
| rose white rose | |
| saffron | |
| sandalwood | |
| spice | |
| spicewood | |
| stock evening scented stock | |
| straw | |
| timber | |
| tobacco tabac tabaco | |
| tonka | |
| tulip | |
| valerian | |
| vanilla | |
| weedy | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| not found in nature | |