| |
| Right Click Jmol Molecule For More Options. (Safari 1.2 (v125) Compatible). Jmol is a free download found Here. |
| |
|
|
| IUPAC name : | 1-(2,3,4,5-tetrahydropyridin-6-yl)ethanone |
| InChI : | InChI=1/C7H11NO/c1-6(9)7-4-2-3-5-8-7/h2-5H2,1H3 |
| InChIKey : | GNZWXNKZMHJXNU-UHFFFAOYAY |
| SMILES : | CC(=O)C1=NCCCC1 |
| cas number : | 27300-27-2 |
| fl. number : | 14.079 |
| molar refractivity : | 35.97 ± 0.5 cm3 |
| parachor : | 287.7 ± 8.0 cm3 |
| index of refraction : | 1.524 ± 0.05 |
| surface tension : | 35.8 ± 7.0 dyne/cm |
| density : | 1.06 ± 0.1 g/cm3 |
| polarizability : | 14.26 ± 0.5 10-24cm3 |
| XlogP : | 0.30 |
| XlogP3-AA : | -0.10 |
| molecular weight : | 125.1683400 (IUPAC) |
| formula : | C7 H11 N O |
| NMR Predictor : | Predict |
|
|
| |
| |
| export tariff code : | unspecified |
| fda reg : | unspecified |
Suppliers :
|
| Nanjing : | 1-(3,4,5,6-tetrahydro-pyridin-2-yl)-ethanone
orders in chinese. |
organoleptics :
|
| odor strength : | high ,
recommend smelling in a 0.10 % solution or less |
odor description:
at 0.10 % in propylene glycol. | roasted caramel bready |
properties :
|
| assay : | 95.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| boiling point : | 200.00 to 203.00 °C. @ 760.00 mm Hg
|
| flash point : | 171.00 °F. TCC ( 77.22 °C. )
|
| logP (o/w) : | -0.71 |
safety :
|
| Oral Toxicity(LD50) : | | | |
Not determined
|
| Dermal Toxicity(LD50) : | | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | | |
Not determined
|
| |
safety in use :
|
| Category : | flavoring agents |
| |
| recommendation for 2-acetyl-3,4,5,6-tetrahydropyridine fragrance usage levels up to : | | | not for fragrance use.
|
safety references :
|
| EPI System : | view |
| |
| | | |
| |
1-(2,3,4,5-tetrahydropyridin-6-yl)ethanone |
| chemidplus : | 27300-27-2 |
| EPA Substance Registry Services : | 27300-27-2 |
references :
|
| |
1-(2,3,4,5-tetrahydropyridin-6-yl)ethanone |
| fl. number : | 14.079 |
| NIST Chemistry WebBook : | 175904866 |
| pubchem : | 10516535 |
| Flavornet : | 27300-27-2 |
other :
|
| VCF-Online: | VCF Volatile Compounds in Food |
|
synonyms :
|
| 1-(3,4,5,6- | tetrahydro-2-pyridinyl) ethanone | | 1-(3,4,5,6- | tetrahydropyridin-2-yl)ethanone | | 1-(2,3,4,5- | tetrahydropyridin-6-yl)ethanone |
soluble in :
|
| | alcohol |
insoluble in :
|
| | water |
potential blenders : note
|
| | acetoin | FL/FR |
| 2- | acetyl furan | FL/FR |
| | acetyl propionyl | FL/FR |
| 3- | acetyl-2,5-dimethyl furan | FL/FR |
| 2- | acetyl-3,5(or 6)-dimethyl pyrazine | FL/FR |
| | allyl 2-furoate | FL |
| iso | amyl 3-(2-furan) propionate | FL/FR |
| | benzyl disulfide | FL |
| | butyl levulinate | FL/FR |
| 2-oxo | butyric acid | FL |
| gamma- | butyrolactone | FL/FR |
| | caramel dione | FL |
| | caramel furanone | FL |
| | caramel pentadione | FL/FR |
| | cyclohexyl acetic acid | FL |
| | diacetyl | FL |
| 2,5- | diethyl tetrahydrofuran | FL |
| alpha,alpha- | dimethyl anisyl acetone | FL/FR |
| 2,3- | dimethyl pyrazine | FL/FR |
| | ethyl (E)-crotonate | FL/FR |
| | ethyl 2-hydroxy-2-methyl butyrate | FL/FR |
| | ethyl 4-pentenoate | FL/FR |
| | ethyl cyclopentenolone | FL/FR |
| | ethyl maltol | FL/FR |
| | ethyl pyruvate | FL/FR |
| (E)- | ethyl tiglate | FL/FR |
| | ethyl vanillin | FL/FR |
| 5- | ethyl-2,3,4,5-tetramethyl-2-cyclohexen-1-one | FL/FR |
| 5- | ethyl-3,4,5,6-tetramethyl cyclohexen-2-one | FL |
| | fenugreek absolute | FL/FR |
| | furfuryl acetone | FL |
| | furfuryl alcohol | FL |
| | furfuryl octanoate | FL |
| | furfuryl valerate | FL |
| | geranyl crotonate | FR |
| gamma- | heptalactone | FL/FR |
| 3,4- | hexane dione | FL/FR |
| 5- | hydroxymethyl furfural | FL |
| | immortelle absolute | FL/FR |
| | levulinic acid | FL |
| | maltol | FL/FR |
| | maltyl propionate | FL/FR |
| | mango furanone | FL |
| | maple furanone | FL/FR |
| | maple lactone | FL/FR |
| | menthone lactone | FL/FR |
| | mesitene lactone | FR |
| 3- | methyl butyl 2-furyl butyrate | FL |
| | methyl cyclopentenolone | FL/FR |
| 5- | methyl furfural | FL/FR |
| 4- | methyl-2,6-dimethoxyphenol | FL/FR |
| | nutty cyclohexenone | FL/FR |
| | peanut oxazole | FL |
| 2- | pentanoyl furan | FL |
| | rosefuran | FL/FR |
| | shoyu furanone | FL/FR |
| dextro- | sorbitol | CS |
| | strawberry furanone | FL/FR |
| | strawberry furanone acetate | FL/FR |
| | tetrahydrofurfuryl acetate | FL/FR |
| | tetrahydrofurfuryl alcohol | FL/FR |
| 2- | thiophene thiol | FL |
| (E)- | tiglic acid | FL/FR |
| | toffee furanone | FL/FR |
| | tonka bean absolute | FR |
| | tonka bean resinoid | FR |
| (E,E)-2,4- | undecadien-1-al | FL |
| 2,4- | undecadien-1-al | FL |
| | vanilla oleoresin | FL/FR |
| | vanillyl isobutyrate | FL/FR |
potential uses :
|
| | bread |
natural occurrence in : note
|
| | bread
| |
|