Notes :
Fruit topnotes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | ethyl 2-(2,4-dimethyl-1,3-dioxolan-2-yl)acetate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H16O4/c1-4-11-8(10)5-9(3)12-6-7(2)13-9/h7H,4-6H2,1-3H3 | |||||||||||||||||||||||||||||||
| InChIKey : | GSIXJEIRJVOUFB-UHFFFAOYAQ | |||||||||||||||||||||||||||||||
| SMILES : | CCOC(=O)CC1(OCC(O1)C)C | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2915.39.9050 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fresh tart fruity apple strawberry | |||||||||||||||||||||||||||||||
| substantivity : | 12 Hour(s) | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| specific gravity : | 1.03800 - 1.04600 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.637 to 8.704 | |||||||||||||||||||||||||||||||
| specific gravity : | 1.03900 - 1.04700 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.656 to 8.722 | |||||||||||||||||||||||||||||||
| refractive index : | 1.42500 - 1.43000 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| melting point : | -68.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 110.00 °C. @ 27.00 mm Hg | |||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||
| logp : | 1.17 | |||||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 195.00 °F. TCC ( 90.56 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for fruity ketal usage levels up to : | ||||||||||||||||||||||||||||||||
| 30.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | ||||||||||||||||||||||||||||||||
| publication number : 23. | ||||||||||||||||||||||||||||||||
| 4294 | average usual ppm | average maximum ppm | ||||||||||||||||||||||||||||||
| baked goods : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||
| beverages(nonalcoholic) : | - | - | ||||||||||||||||||||||||||||||
| beverages(alcoholic) : | - | - | ||||||||||||||||||||||||||||||
| breakfast cereal : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||
| cheese : | 7.00000 | 35.00000 | ||||||||||||||||||||||||||||||
| chewing gum : | - | - | ||||||||||||||||||||||||||||||
| condiments / relishes : | 5.00000 | 10.00000 | ||||||||||||||||||||||||||||||
| confectionery froastings : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||
| egg products : | - | - | ||||||||||||||||||||||||||||||
| fats / oils : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||
| fish products : | 2.00000 | 10.00000 | ||||||||||||||||||||||||||||||
| frozen dairy : | 7.00000 | 35.00000 | ||||||||||||||||||||||||||||||
| fruit ices : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||
| gelatins / puddings : | - | - | ||||||||||||||||||||||||||||||
| granulated sugar : | - | - | ||||||||||||||||||||||||||||||
| gravies : | 20.00000 | 100.00000 | ||||||||||||||||||||||||||||||
| hard candy : | - | - | ||||||||||||||||||||||||||||||
| imitation dairy : | 7.00000 | 35.00000 | ||||||||||||||||||||||||||||||
| instant coffee / tea : | - | - | ||||||||||||||||||||||||||||||
| jams / jellies : | - | - | ||||||||||||||||||||||||||||||
| meat products : | 2.00000 | 10.00000 | ||||||||||||||||||||||||||||||
| milk products : | 7.00000 | 35.00000 | ||||||||||||||||||||||||||||||
| nut products : | - | - | ||||||||||||||||||||||||||||||
| other grains : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||
| poultry : | 2.00000 | 10.00000 | ||||||||||||||||||||||||||||||
| processed fruits : | 7.00000 | 35.00000 | ||||||||||||||||||||||||||||||
| processed vegetables : | - | - | ||||||||||||||||||||||||||||||
| reconstituted vegetables : | - | - | ||||||||||||||||||||||||||||||
| seasonings / flavors : | 5.00000 | 10.00000 | ||||||||||||||||||||||||||||||
| snack foods : | - | - | ||||||||||||||||||||||||||||||
| soft candy : | - | - | ||||||||||||||||||||||||||||||
| soups : | 5.00000 | 10.00000 | ||||||||||||||||||||||||||||||
| sugar substitutes : | - | - | ||||||||||||||||||||||||||||||
| sweet sauces : | 5.00000 | 10.00000 | ||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| (EINECS) number : | 228-536-2 | |||||||||||||||||||||||||||||||
| chemidplus : | 006290171 | |||||||||||||||||||||||||||||||
| epa-srs : | 6290-17-1 | |||||||||||||||||||||||||||||||
| dtp/nci : | 6547 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 672544 | |||||||||||||||||||||||||||||||
| synonyms : | |
| dimethyl dioxolane | |
| 2,4- | dimethyl-1,3-dioxolane-2-ethyl acetate |
| ethyl 2,4-dimethyl-1,3-dioxolane-2-acetate | |
| ethyl acetoacetate propylene glycol ketal | |
| ethyl dimethyl dioxolane-2-acetate | |
| ethyl-2,4-dimethyl-1,3-dioxolane-2-acetate | |
| (Z+E)- | ethyl-2,4-dimethyl-1,3-dioxolane-2-acetate |
| fragolane | |
| fraistone | |
| fruity ketal | |
| propyl fruitat | |
| strawberry ketal | |
| soluble in : | |
| alcohol | |
| water, 72 mg/L @ 20C | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl benzoate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl acetate |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| cassia bark oil | |
| cinnamyl alcohol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| coriander seed oil | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| ethyl (E,Z)-2,4-decadienoate | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| eucalyptus oil | |
| fir needle oil | |
| floral pyranol | |
| galbanum oil | |
| gardenia oxide | |
| geranyl acetate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| hexyl isovalerate | |
| hexyl tiglate | |
| leaf acetal | |
| lemon oil | |
| lime oil | |
| linalool | |
| linalool oxide | |
| linalyl acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| methyl heptenone | |
| neryl acetate | |
| ocean propanal | |
| (Z)-5- | octen-1-ol |
| orange oil | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| spearmint oil | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| gamma- | undecalactone |
| verbena oil | |
| violet methyl carbonate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| apple | |
| apple blossom | |
| apple crabapple | |
| apple green apple | |
| apple red apple | |
| apricot | |
| arrack | |
| banana | |
| bark | |
| berry jam | |
| blossom tropical blossom | |
| bramble arctic bramble blackberry | |
| brandy | |
| briar sweet briar eglantine | |
| cassis black currant bud | |
| cheese romano cheese | |
| cheese swiss cheese | |
| cherry black cherry | |
| cherry blossom | |
| cider | |
| citronella | |
| cloudberry bakeapple | |
| crabapple blossom | |
| date | |
| elderberry | |
| foliage | |
| gingergrass | |
| gooseberry | |
| grape | |
| grape white grape | |
| grapefruit | |
| grass green grass | |
| hibiscus | |
| iris blossom | |
| jackfruit | |
| kiwi | |
| kiwi blossom | |
| kumquat | |
| licorice | |
| lychee soapberry | |
| mandarin | |
| mango | |
| marigold tagete | |
| mate | |
| melon watermelon muskmelon cantaloupe | |
| myrtle | |
| nectarine | |
| orange | |
| osmanthus | |
| papaya | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pear bartlett pear | |
| pear blossom | |
| pear emperor pear | |
| pineapple | |
| plum | |
| plum blossom | |
| plum greengage plum | |
| plum mirabelle plum | |
| plum mirabille blossom | |
| pomegranate | |
| rose wild rose | |
| rue | |
| rum butter rum | |
| sarsaparilla | |
| spearmint | |
| starfruit | |
| tangerine | |
| tarragon | |
| tea | |
| tropical | |
| tutti frutti | |
| wine | |
| wintergreen | |
| natural occurrence in : | |
| not found in nature | |