| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | 3-[(2S)-6-methylhept-5-en-2-yl]-6-methylidenecyclohexene | |||||||||||||||||||||||
| InChI : | InChI=1/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,10,14-15H,3,5,7,9,11H2,1-2,4H3/t14-,15u/m0/s1 | |||||||||||||||||||||||
| InChIKey : | PHWISBHSBNDZDX-MLCCFXAWBV | |||||||||||||||||||||||
| SMILES : | C[C@@H](CCC=C(C)C)C1CCC(=C)C=C1 | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||
| odor description : at 100.00 %. | herbal fruity woody | |||||||||||||||||||||||
properties : | ||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||
| assay : | 96.00 to 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| boiling point : | 270.00 to 272.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| flash point : | 226.00 °F. TCC ( 107.78 °C. ) | |||||||||||||||||||||||
| logP (o/w) : | 6.52 | |||||||||||||||||||||||
safety : | ||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||
| recommendation for beta-sesquiphellandrene usage levels up to : | ||||||||||||||||||||||||
| 3.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||
| 3-[(2S)-6-methylhept-5-en-2-yl]-6-methylidenecyclohexene | ||||||||||||||||||||||||
| chemidplus : | 020307839 | |||||||||||||||||||||||
| EPA Substance Registry Services : | 20307-83-9 | |||||||||||||||||||||||
references : | ||||||||||||||||||||||||
| 3-[(2S)-6-methylhept-5-en-2-yl]-6-methylidenecyclohexene | ||||||||||||||||||||||||
| NIST Chemistry WebBook : | 20307839 | |||||||||||||||||||||||
| pubchem : | 39294549 | |||||||||||||||||||||||
other : | ||||||||||||||||||||||||
| VCF-Online: | VCF Volatile Compounds in Food | |||||||||||||||||||||||
| synonyms : | |
| (S-(R*,S*))-3-(1,5- | dimethyl-4-hexenyl)-6-methylene cyclohexene |
| (R)-3- | methylene-6-((S)-6-methyl hept-5-en-2-yl) cyclohex-1-ene |
| 3-[(2S)-6- | methylhept-5-en-2-yl]-6-methylidenecyclohexene |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| alpha- | amyl cinnamaldehyde |
| amyl furoate | |
| iso | amyl heptanoate |
| iso | amyl salicylate |
| anise indene | |
| para- | anisyl propionate |
| benzyl acetone | |
| benzyl methyl tiglate | |
| 3- | benzyl-4-heptanone |
| iso | borneol |
| bornyl 2-methyl butyrate | |
| iso | bornyl acetate |
| bornyl butyrate | |
| boronia absolute | |
| beta- | bourbonene |
| butyl heptanoate | |
| iso | butyl heptanoate |
| butyl levulinate | |
| iso | butyl methyl ketone |
| butyl tiglate | |
| delta- | cadinene |
| gamma- | cadinene |
| alpha- | cadinol |
| camphene | |
| (+)- | camphene |
| dextro- | camphor |
| cassis methanol | |
| chamomile propionate | |
| chamomile valerate | |
| cinnamon acrolein | |
| cistus oil | |
| clove bud oil | |
| coriander oleoresin | |
| cuminyl acetate | |
| currant bud absolute black | |
| iso | cyclocitral |
| 2- | decalinyl acetate |
| 8,9- | dehydrotheaspirone |
| diethyl malate | |
| N,N- | diethyl octanamide |
| dihydroactinidolide | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl 4-pentenoate | |
| fir carboxylate | |
| fusel oil | |
| geranyl tiglate | |
| green acetate | |
| herbal undecanone | |
| (E)-2- | hexenoic acid |
| hexyl pivalate | |
| hexyl tiglate | |
| immortelle flower oil | |
| beta- | ionone |
| jasmin absolute | |
| (Z)- | jasmone |
| karo karounde absolute | |
| lavender oil france | |
| lavender oil greece | |
| linalool oxide acetates | |
| linalyl octanoate | |
| marine formate | |
| para- | menth-1-ene-9-ol |
| menthadienyl formate | |
| 1-para- | menthen-9-yl acetate |
| menthone-8-thioacetate | |
| methyl benzyl acetate (mixed ortho-,meta-,para-) | |
| 2- | methyl butyl isovalerate |
| 2- | methyl butyl salicylate |
| methyl cyclogeranate | |
| methyl hexyl ether | |
| methyl hexyl ketone | |
| para- | methyl hydratropaldehyde |
| N- | methyl ionone |
| alpha-iso | methyl ionone (90% min.) |
| 1- | methyl pyrrole |
| 2- | methyl-2-pentenoic acid |
| gamma- | muurolene |
| myrtenyl acetate | |
| myrtenyl isobutyrate | |
| nonan-3-yl acetate | |
| 3- | nonanone |
| nonisyl acetate | |
| nonisyl propionate | |
| 3- | octanon-1-ol |
| orris capronate | |
| parsley leaf oil | |
| patchouli absolute | |
| patchouli indene | |
| pennyroyal oil | |
| petitgrain bigarade oil | |
| petitgrain lemon oil | |
| polylimonene | |
| prenyl salicylate | |
| 4-iso | propyl-2-cyclohexenone |
| rose undecene | |
| rue flower oil colombia | |
| rue oil | |
| spathulenol | |
| spruce oil | |
| tagete flower oil rwanda | |
| tagete oil | |
| tagete oil CO2 extract | |
| tagete oil turkey | |
| tagete oil zambia | |
| tansy leaf oil dutch | |
| tea leaf absolute | |
| thyme oil wild or creeping | |
| tricyclodecenyl propionate | |
| viridiflorol | |
| woody ketone | |
(odor and/or flavor) used in : | |
| amber | |
| ambergris | |
| ambreine | |
| amyris | |
| angelica | |
| apple | |
| apple crabapple | |
| apple green apple | |
| apple red apple | |
| apricot | |
| apricot brandy | |
| arnica | |
| arrack | |
| ash mountain ash | |
| ash mountain ash berry | |
| banana | |
| banana quana banana | |
| bark | |
| basil | |
| bay | |
| bayberry | |
| beech wood tar | |
| benzoin | |
| bergamot | |
| berry | |
| berry jam | |
| birch tar | |
| blackberry | |
| blue grass | |
| blueberry | |
| blueberry whortleberry red whortleberry | |
| bois de rose rosewood | |
| boronia | |
| boxwood | |
| boxwoodberry | |
| boysenberry | |
| bramble arctic bramble blackberry | |
| briar sweet briar eglantine | |
| broom genet genista | |
| bubblegum | |
| buchu | |
| cabreuva | |
| cade | |
| cajuput | |
| calamus | |
| camphor | |
| capsicum | |
| caraway | |
| cardamom | |
| carrot | |
| carrot seed | |
| cascarilla | |
| cassie acacia farnesiana | |
| cassis black currant bud | |
| cedar | |
| cedar forest | |
| cedarwood | |
| cedarwood atlas | |
| celery | |
| chamomile | |
| cherry | |
| cherry black cherry | |
| cherry maraschino cherry | |
| cherry wild cherry | |
| chervil | |
| chrysanthemum chrysantheme | |
| cider | |
| cigar box | |
| cilantro | |
| cistus | |
| citronella | |
| clary sage | |
| cloudberry bakeapple | |
| coriander | |
| costus | |
| cranberry | |
| cubeb | |
| currant | |
| currant black currant | |
| currant red currant | |
| cypress | |
| date | |
| davana | |
| deertongue | |
| dill | |
| dogwood | |
| durian | |
| elder blossom | |
| elderberry | |
| elemi | |
| estragon | |
| eucalyptus | |
| fennel | |
| fern fougere | |
| fig | |
| flouve | |
| forest | |
| forest pine forest | |
| fruit | |
| fruit dried fruit | |
| fruit jam | |
| fruit juicy fruit | |
| fruit punch | |
| fruit tropical fruit | |
| galanga | |
| galbanum | |
| gin | |
| ginger | |
| ginger white ginger | |
| gingergrass | |
| gooseberry | |
| grape | |
| grape concord grape | |
| grape white grape | |
| grass sweet grass | |
| guaiacwood | |
| guava | |
| gurjun | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hibiscus | |
| hinoki | |
| hollyberry | |
| hops houblon | |
| huckleberry bilberry | |
| hyssop | |
| immortelle helichrysum everlasting | |
| iris blossom | |
| ivy leaf | |
| jackfruit | |
| jam | |
| juniper | |
| juniperberry | |
| kiwi | |
| labdanum | |
| lavandin | |
| lavender | |
| lavender spike lavender | |
| lavender water | |
| loganberry dewberry | |
| lovage | |
| lychee soapberry | |
| mace | |
| maja | |
| mango | |
| marigold tagete | |
| marjoram | |
| mate | |
| meadow | |
| melissa balm | |
| melon | |
| melon honeydew | |
| melon watermelon | |
| melon watermelon muskmelon cantaloupe | |
| mimosa wattle | |
| mulberry | |
| myrtle | |
| niaouli | |
| oakwood | |
| olibanum frankincense | |
| opoponax | |
| orange bitter orange | |
| oregano | |
| orris iris | |
| osmanthus | |
| papaya | |
| parsley | |
| parsnip | |
| passion blossom | |
| passion fruit | |
| patchouli | |
| peach | |
| pear | |
| pear bartlett pear | |
| pear emperor pear | |
| pine dwarf pine | |
| pine needle | |
| pine scotch pine | |
| pineapple | |
| pinon cone | |
| plum | |
| plum greengage plum | |
| plum jam | |
| plum mirabelle plum | |
| pomegranate | |
| prune | |
| quince | |
| raisin | |
| raspberry | |
| raspberry black raspberry | |
| raspberry green raspberry | |
| raspberry jam | |
| raspberry red raspberry | |
| redwood | |
| reseda mignonette | |
| ripe | |
| rose wild rose | |
| rosemary | |
| rue | |
| saffron | |
| sandalwood | |
| savin | |
| spikenard | |
| spruce | |
| starfruit | |
| strawberry | |
| strawberry jam | |
| tamarind | |
| tansy tanaisie | |
| tarragon | |
| tea | |
| tea black tea | |
| tea china tea | |
| tea green tea | |
| tea herbal tea | |
| tea lemon tea | |
| thyme | |
| timber | |
| tolu balsam | |
| tutti frutti | |
| valerian | |
| vetiver | |
| witch hazel | |
| woodruff asperula | |
| woody | |
| wormseed chenopodium | |
| wormwood absinthium | |
| yew | |
natural occurrence in : | |
| data page | alpinia galanga oil @ 1.60% |
| data page | boronia absolute @ 0.02% |
| data page | cajuput oil vietnam @ trace% |
| data page | carrot seed oil @ 0.25% |
| data page | ginger root oil brazil @ 7.00% |
| data page | ginger root oil CO2 extract @ 6.81% |
| data page | ginger root oil CO2 extract australia @ 8.18% |
| data page | jambu flower oil brazil @ 0.10% |
| data page | lime oil expressed florida @ trace% |
| data page | mayur pankh fruit oil himalaya @ 0.70% |
| data page | parsley leaf oil @ 8.51% |
| data page | parsley leaf oil cuba @ 1.04% |
| data page | thymus richardii pers. subsp. nitidus (guss.) jalas oil italy @ 0.70% |
| data page | turmeric root oil CO2 extract @ 3.17% |
| data page | turmeric root oil vietnam @ 3.00% |