| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | 1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone | |||||||||||||||||||||||||||
| InChI : | InChI=1/C18H26O/c1-11-8-16-15(9-14(11)13(3)19)17(4,5)10-12(2)18(16,6)7/h8-9,12H,10H2,1-7H3 | |||||||||||||||||||||||||||
| InChIKey : | DNRJTBAOUJJKDY-UHFFFAOYAK | |||||||||||||||||||||||||||
| SMILES : | CC1CC(C2=C(C1(C)C)C=C(C(=C2)C(=O)C)C)(C)C | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| IUPAC name : | 1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone | |||||||||||||||||||||||||||
| InChI : | InChI=1/C18H26O/c1-11-8-16-15(9-14(11)13(3)19)17(4,5)10-12(2)18(16,6)7/h8-9,12H,10H2,1-7H3 | |||||||||||||||||||||||||||
| InChIKey : | DNRJTBAOUJJKDY-UHFFFAOYAK | |||||||||||||||||||||||||||
| SMILES : | CC1CC(C2=C(C1(C)C)C=C(C(=C2)C(=O)C)C)(C)C | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | 2914.39.0000 | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| Berje : | Tonalid™ | |||||||||||||||||||||||||||
| John D. Walsh : | Tetralide | |||||||||||||||||||||||||||
| Moellhausen : | fixolide
98% min. nature identical kosher | |||||||||||||||||||||||||||
| PFW : | TONALID® II
≥97% | |||||||||||||||||||||||||||
| Vigon : | Fixolide
Odor: MUSKY, WARM, POWDERY | |||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor type : | musk | |||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||
| odor description :¹ at 10.00 % in isopropyl myristate. | strong sweet amber fruity musk powdery | |||||||||||||||||||||||||||
| odor sample from : | Givaudan Corporation | |||||||||||||||||||||||||||
| substantivity : | > 400 hour(s) at 10.00 % in dipropylene glycol | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | white crystalline solid | |||||||||||||||||||||||||||
| assay : | 97.00 to 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| melting point : | 53.00 to 54.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 393.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| vapor pressure : | 0.06800 mm/Hg @ 25.00 °C. | |||||||||||||||||||||||||||
| flash point : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||
| logP (o/w) : | 6.37 | |||||||||||||||||||||||||||
| shelf life : | 36.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xn N - Harmful, Dangerous for the environment. | |||||||||||||||||||||||||||
|
R 22 - Harmful if swallowed. R 50/53 - Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet. | ||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||
|
Oral-Rat 964.00 mg/kg | ||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||
|
Skin-Rabbit 7940.00 mg/kg | ||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||
| recommendation for musk tetralin usage levels up to : | ||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| recommendation for musk tetralin usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||
| Chemical Carcinogenesis Research Information System : | Search | |||||||||||||||||||||||||||
| Env. Mutagen Info. Center : | Search | |||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | Search | |||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||
| SCCNFP : | opinion | |||||||||||||||||||||||||||
| WGK Germany : | 3 | |||||||||||||||||||||||||||
| 1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone | ||||||||||||||||||||||||||||
| (EINECS) number : | 216-133-4 | |||||||||||||||||||||||||||
| chemidplus : | 001506021 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 1506-02-1 | |||||||||||||||||||||||||||
| dtp/nci : | 19550 | |||||||||||||||||||||||||||
| 1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone | ||||||||||||||||||||||||||||
| (EINECS) number : | 244-240-6 | |||||||||||||||||||||||||||
| chemidplus : | 021145777 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 21145-77-7 | |||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| 1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone | ||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1248632648 | |||||||||||||||||||||||||||
| pubchem : | 668261 | |||||||||||||||||||||||||||
| 1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone | ||||||||||||||||||||||||||||
| pubchem : | 666216 | |||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||
| Cosmetic uses : |
masking agents | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1985)¹ | |||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||
| synonyms : | |
| acetyl hexamethyl tetralin | |
| 6- | acetyl-1,1,2,4,4,7-hexamethyl tetralin |
| 7- | acetyl-1,1,3,4,4,6-hexamethyl tetrahydronaphthalene |
| 7- | acetyl-1,1,3,4,4,6-hexamethyl tetralin |
| 6- | acetyl-1,2,3,4-tetrahydro-1,1,2,4,4,7-hexamethyl naphthalene |
| fixolide | |
| 1-(3,5,5,6,8,8- | hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone |
| INCI acetyl hexamethyl tetralin | |
| musk tonalid | |
| 1-(5,6,7,8- | tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthyl) ethan-1-one |
| 5',6',7',8'- | tetrahydro-3',5',5',6' 8' 8'-hexamethyl-2'-acetonaphthone |
| tetralide | |
| tonalid | |
| tonalide | |
soluble in : | |
| alcohol | |
| dipropylene glycol | |
| water, 1.25 mg/L @ 25C | |
insoluble in : | |
| water | |
stability : | |
| detergent | |
| soap | |
(odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| amber carbinol | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | butyl cinnamate |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| para- | cresyl phenyl acetate |
| cyclamen aldehyde | |
| decanol | |
| 9- | decen-1-ol |
| decyl acetate | |
| dimethyl benzyl carbinol | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl maltol | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| ho leaf oil | |
| hyacinth ether | |
| hydroxycitronellal | |
| indole | |
| ionones | |
| labdanum resinoid | |
| laevo- | linalool |
| linalool oxide | |
| marine pyridine | |
| methyl acetophenone | |
| methyl cedryl ketone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| musks | |
| myrrh oil | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| pepper oil black | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| santall | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| undecanol | |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
(odor and/or flavor) used in : | |
| acacia | |
| allspice | |
| ambergris | |
| ambrette | |
| amyris | |
| angelica | |
| animal | |
| burberry | |
| cabreuva | |
| cassia | |
| cassia blossom | |
| cassie acacia farnesiana | |
| cedar forest | |
| christmas blends | |
| cloth clean cloths | |
| clove blossom | |
| cyclamen | |
| dusty | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| fir needle | |
| flouve blossom | |
| foliage | |
| forest | |
| frangipanni plumeria | |
| ginger white ginger | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hawthorn | |
| heather | |
| heliotrope | |
| hollyberry | |
| hugonia | |
| incense | |
| iris blossom | |
| kewda | |
| lavender | |
| leather | |
| lemon | |
| lily | |
| magnolia | |
| maja | |
| meadow | |
| moss | |
| muguet lily of the valley | |
| musk | |
| new car | |
| oakwood | |
| ocean sea | |
| petunia | |
| phlox | |
| powder | |
| rain | |
| rose white rose | |
| sandalwood | |
| spice | |
| spicewood | |
| tobacco tabac tabaco | |
| tonka | |
| vanilla | |
| verbena verveine | |
| woodruff asperula | |
| woody | |
natural occurrence in : | |
| not found in nature | |