| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | 2-methyl-2-(3-methylbutyl)-4,7-dihydro-1,3-dioxepine | |||||||||||||||||||||||
| InChI : | InChI=1/C11H20O2/c1-10(2)6-7-11(3)12-8-4-5-9-13-11/h4-5,10H,6-9H2,1-3H3 | |||||||||||||||||||||||
| InChIKey : | FFANAZFONFVGKZ-UHFFFAOYAQ | |||||||||||||||||||||||
| SMILES : | CC(C)CCC1(OCC=CCO1)C | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| fda reg : | unspecified | h. number : | unspecified | |||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||
| odor type : | herbal | |||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||
| odor description : at 100.00 %. | fresh lavender sweet herbal | |||||||||||||||||||||||
| substantivity : | 20 Hour(s) | |||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||
| appearence : | pale yellow clear liquid | |||||||||||||||||||||||
| assay : | 95.00 - 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 0.93800 @ 25.00 °C. | |||||||||||||||||||||||
| refractive index : | 1.45300 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 228.00 - 229.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| logp : | 2.58 | |||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | 187.00 °F. TCC ( 86.11 °C. ) | |||||||||||||||||||||||
| recommendation for amber dioxepine usage levels up to : | ||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for amber dioxepine usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 258-487-2 | |||||||||||||||||||||||
| chemidplus : | 053338059 | |||||||||||||||||||||||
| epa-srs : | 53338-05-9 | |||||||||||||||||||||||
| other : | ||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||
| pubchem : | 681884 | |||||||||||||||||||||||
| synonyms : | |
| amber dioxepine | |
| ambersage | |
| 4,7- | dihydro-2-isopentyl-2-methyl-1,3-dioxepine |
| 4,7- | dihydro-2-methyl-2-(3-methyl butyl)-1,3-dioxepine |
| iso | pentenone butylene glycol cyclic acetal |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| abies alba mill oil | |
| allyl amyl glycolate | |
| ambrette seed oil | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| armoise oil | |
| basil oil | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| bergamot oil | |
| bitter orange oil | |
| blood orange oil | |
| bois de rose oil | |
| boronia absolute | |
| bruyere root absolute | |
| iso | butyl phenethyl carbinyl acetate |
| iso | butyl salicylate |
| caraway seed oil | |
| cardamom seed oil | |
| carnation absolute | |
| carrot seed oil | |
| cedarwood oil atlas | |
| cedarwood oils | |
| cedrol | |
| cedryl acetate | |
| chamomile oil | |
| cinnamyl alcohol | |
| cistus oil | |
| citral | |
| citronellol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cortex pyridine | |
| costmary oil | |
| cuminaldehyde | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| decanal | |
| 9- | decen-1-al |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl phenyl carbinyl acetate | |
| elemi oil | |
| ethyl cinnamate | |
| ethylene brassylate | |
| iso | eugenyl acetate |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| geranium oil | |
| geranyl acetate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| hay absolute | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| hyssop oil | |
| ionones | |
| 2,4- | ivy carbaldehyde |
| juniperberry oil | |
| labdanum resinoid | |
| lavandin oil | |
| lavender absolute | |
| lime oil | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| linalyl propionate | |
| mace oil | |
| marine pyridine | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| methyl ethyl ketone | |
| methyl ionones | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| musks | |
| myrtle oil | |
| nerol | |
| nerolidol | |
| neryl acetate | |
| nonanal | |
| nonanol | |
| nopyl acetate | |
| ocean propanal | |
| opoponax oil | |
| orris absolute | |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| rhodinol | |
| rosemary oil | |
| santall | |
| spike lavender oil | |
| styralyl acetate | |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| tobacco dodecane | |
| tonka bean absolute | |
| undecanol | |
| vanilla absolute | |
| vanillyl acetate | |
| vetiver oil | |
| violet methyl carbonate | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| alpine bouquet | |
| amber | |
| ambergris | |
| angelica | |
| balsam | |
| bergamot | |
| boxwoodberry | |
| broom genet genista | |
| cabreuva | |
| calamus | |
| carnation dianthus oeillet | |
| cascarilla | |
| cassie acacia farnesiana | |
| cassis black currant bud | |
| champaca champak | |
| chrysanthemum chrysantheme | |
| chypre | |
| cigar box | |
| cistus | |
| citrus | |
| clary sage | |
| clematis | |
| cloth clean cloths | |
| clover trefle le'trefle incarnat | |
| cologne | |
| copaiba | |
| coriander | |
| coronilla | |
| crabapple blossom | |
| cranberry | |
| cucumber | |
| daffodil narcissus | |
| daphne | |
| deertongue | |
| dogwood | |
| earth humus | |
| elder blossom | |
| evergreen | |
| fern fougere | |
| fir needle | |
| flouve | |
| flouve blossom | |
| foliage | |
| forest pine forest | |
| freesia | |
| fungus | |
| galanga | |
| ginger white ginger | |
| grapefruit | |
| grass sweet grass | |
| habuba | |
| hancornia | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| immortelle helichrysum everlasting | |
| incense | |
| ivy leaf | |
| jasmin | |
| jonquil narcissus jonquilla | |
| lavender | |
| leather | |
| mate | |
| meadow | |
| mimosa wattle | |
| musk | |
| neroli | |
| ocean sea | |
| olibanum frankincense | |
| orange bitter orange | |
| orchid | |
| oriental | |
| palmarosa | |
| passion blossom | |
| pear prickly pear | |
| petitgrain | |
| poppy red poppy | |
| powder | |
| privet | |
| privet blossom | |
| rain spring rain | |
| rhubarb | |
| rose tea rose | |
| rose white rose | |
| sandalwood | |
| spikenard | |
| tea black tea | |
| tea green tea | |
| tea herbal tea | |
| timber | |
| tobacco tabac tabaco | |
| tulip | |
| vine | |
| watercress nasturtium | |
| wet fields | |
| wistaria wisteria glycine | |
| witch hazel | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| not found in nature | |