Notes :
Enrichens the quality of fragrances.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | (4-tert-butylcyclohexyl) acetate | |||||||||||||||||||||||||
| InChI : | InChI=1/C12H22O2/c1-9(13)14-11-7-5-10(6-8-11)12(2,3)4/h10-11H,5-8H2,1-4H3 | |||||||||||||||||||||||||
| InChIKey : | MBZRJSQZCBXRGK-UHFFFAOYAF | |||||||||||||||||||||||||
| SMILES : | CC(=O)OC1CCC(CC1)C(C)(C)C | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2916.35.1500 | |||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||
| odor type : | woody | |||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||
| odor description : at 100.00 %. | woody cedar floral oily herbal balsam green fruity | |||||||||||||||||||||||||
| substantivity : | 8 hour(s) at 100.00 % | |||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||
| appearence : | colorless clear oily liquid | |||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.93400 - 0.93900 @ 25.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.772 to 7.813 | |||||||||||||||||||||||||
| specific gravity : | 0.93300 - 0.93700 @ 20.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.773 to 7.806 | |||||||||||||||||||||||||
| refractive index : | 1.45000 - 1.45400 @ 20.00 °C. | |||||||||||||||||||||||||
| boiling point : | 228.00 - 230.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||
| logp : | 3.96 | |||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 5.00 gm/kg FCTXAV 16,657,1978 | |||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5000.00 mg/kg | |||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 206.00 °F. TCC ( 96.67 °C. ) | |||||||||||||||||||||||||
| recommendation for woody acetate usage levels up to : | ||||||||||||||||||||||||||
| 20.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for woody acetate usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||
| (EINECS) number : | 250-954-9 | |||||||||||||||||||||||||
| rtecs : | AF7117000 for 32210-23-4 | |||||||||||||||||||||||||
| chemidplus : | 032210234 | |||||||||||||||||||||||||
| epa-srs : | 32210-23-4 | |||||||||||||||||||||||||
| dtp/nci : | 163103 | |||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||
| pubchem : | 177634 | |||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1421766050 | |||||||||||||||||||||||||
| synonyms : | |
| 4-tert- | butyl cyclohexyl acetate |
| para-tert- | butyl cyclohexyl acetate |
| 4-tert- | butyl hexahydrophenyl acetate |
| 4-(1,1- | dimethyl ethyl) cyclohexyl ethanoate |
| lorysia | |
| oryclon | |
| 4-tert- | pentyl cyclohexanyl acetate |
| vertenex | |
| woody acetate | |
| soluble in : | |
| ethyl alcohol, 4 vol. of 70% alcohol | |
| kerosene | |
| paraffin oil | |
| water, very slightly | |
| insoluble in : | |
| water | |
| stability : | |
| antiperspirant | |
| bleach | |
| deo stick | |
| deodorant | |
| detergent perborate | |
| fabric softener | |
| liquid detergent | |
| non-discoloring | |
| scouring powder | |
| shampoo | |
| soap | |
| very stable | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| amber carbinol | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| armoise oil | |
| bay leaf oil | |
| benzoin resinoid | |
| benzophenone | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| blood orange oil | |
| bois de rose oil | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl quinoline |
| iso | butyl salicylate |
| camphor oil | |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| para- | cresyl caprylate |
| cyclamen aldehyde | |
| decanal | |
| decanol | |
| decyl acetate | |
| dihydromyrcenol | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl benzyl carbinyl isobutyrate | |
| dimethyl hydroquinone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fennel seed oil | |
| fir balsam absolute | |
| fir needle oil | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| geraniol | |
| ginger root oil | |
| green acetate | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| labdanum resinoid | |
| lavender absolute | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| methyl acetophenone | |
| methyl cedryl ketone | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| 2- | methyl undecanal |
| muguet carboxaldehyde | |
| musks | |
| nerol | |
| nerolidol | |
| nonanal | |
| nonanol | |
| nopyl acetate | |
| oakmoss absolute | |
| ocean propanal | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| pepper oil black | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| rhodinol | |
| rose oxides | |
| santall | |
| spruce oil | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco dodecane | |
| tonka bean absolute | |
| undecanol | |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| acorn | |
| agrumen | |
| alpine bouquet | |
| amaryllis | |
| amber | |
| amour-amour | |
| animal | |
| armoise | |
| ash mountain ash | |
| ash mountain ash blossom | |
| azalea | |
| balsam | |
| bark | |
| bayberry | |
| bouquet | |
| cabreuva | |
| calamus | |
| cascarilla | |
| cassie acacia farnesiana | |
| castoreum | |
| cedar | |
| cedar forest | |
| cedarleaf | |
| cedarwood | |
| celery | |
| chestnut blossom | |
| christmas blends | |
| chypre | |
| citronella | |
| clary sage | |
| clean | |
| clover trefle le'trefle incarnat | |
| coconut | |
| coronilla | |
| cyclamen | |
| cypress | |
| dahlia | |
| daisy | |
| daphne | |
| fantasy blends | |
| fern fougere | |
| fig | |
| fir balsam | |
| floral | |
| florida breeze | |
| flouve blossom | |
| foliage | |
| forest | |
| forest pine forest | |
| fresh | |
| fruit | |
| galanga | |
| galbanum | |
| ginger | |
| gingergrass | |
| grapefruit | |
| grass sweet grass | |
| guaiacwood | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hinoki | |
| hollyberry | |
| hugonia | |
| hyssop | |
| immortelle helichrysum everlasting | |
| incense | |
| iris blossom | |
| ivy leaf | |
| jasmin | |
| labdanum | |
| lavender | |
| leather | |
| liverwort | |
| maja | |
| mastic | |
| meadow | |
| mimosa wattle | |
| mint | |
| moss | |
| musk | |
| oakwood | |
| orange bitter orange | |
| oregano | |
| oriental | |
| orris iris | |
| osmanthus | |
| patchouli | |
| petunia | |
| pine | |
| pinon cone | |
| potpourri | |
| privet blossom | |
| rose | |
| rose d'orient | |
| rose dog rose | |
| rose moss rose | |
| sage | |
| sandalwood | |
| sassafras | |
| spicewood | |
| spruce | |
| timber | |
| valerian | |
| vetiver | |
| weedy | |
| woodruff asperula | |
| woody | |
| wormwood absinthium | |
| natural occurrence in : | |
| not found in nature | |