Notes :
Sandalwood replacer.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| InChI : | InChI=1/C17H28O2/c1-11-6-7-13-15(3,4)14-10-17(11,13)9-8-16(14,5)19-12(2)18/h11,13-14H,6-10H2,1-5H3/t11-,13+,14?,16u,17u/m1/s1 | |||||||||||||||||||||||||||
| InChIKey : | HQKQRXZEXPXXIG-GXTNNVKYBD | |||||||||||||||||||||||||||
| SMILES : | C[C@@H]1CC[C@@H]2C13CCC(C(C3)C2(C)C)(C)OC(=O)C | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2915.39.9050 | |||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||
| odor type : | woody | |||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||
| odor description : at 100.00 %. | sharp dry woody cedar | |||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||
| appearence : | pale yellow viscous liquid | |||||||||||||||||||||||||||
| assay : | 50.00 - 65.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| specific gravity : | 0.97600 - 0.98600 @ 25.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.121 to 8.205 | |||||||||||||||||||||||||||
| specific gravity : | 0.97700 - 0.98700 @ 20.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.139 to 8.222 | |||||||||||||||||||||||||||
| refractive index : | 1.49700 - 1.50300 @ 20.00 °C. | |||||||||||||||||||||||||||
| melting point : | 40.00 - 42.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 200.00 - 203.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| logp : | 5.67 | |||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 44750.00 mg/kg | |||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||
| recommendation for cedryl acetate usage levels up to : | ||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| recommendation for cedryl acetate usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||
| (EINECS) number : | 201-036-1 | |||||||||||||||||||||||||||
| chemidplus : | 000077543 | |||||||||||||||||||||||||||
| epa-srs : | 77-54-3 | |||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||
| fl. number : | 09.171 | |||||||||||||||||||||||||||
| pubchem : | 149445 | |||||||||||||||||||||||||||
| synonyms : | |
| acetic acid cedrol ester | |
| 8-beta-H- | cedran-8-ol acetate |
| 8beta-H- | cedran-8-ol acetate |
| cedran-8-yl acetate | |
| cedranyl acetate | |
| cedrol acetate | |
| cedryl acetate | |
| (3R-(3alpha,3abeta,6alpha,7beta,8aalpha))- | octahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-5-yl acetate |
| (3R,3aS,6R,7R,8aS)- | octahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-6-ol acetate |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| bath foam | |
| cream | |
| detergent | |
| hair spray | |
| lipstick | |
| non-discoloring | |
| (odor and/or flavor) blends with : | |
| acetyl thujopsene | |
| agarwood oil | |
| amber furan | |
| ambergris | |
| ambra oxide | |
| ambrarome | |
| ambreine | |
| ambrettolide | |
| alpha- | ambrinol |
| ambrinol epoxide | |
| ambroxan | |
| ambroxide | |
| iso | amyl salicylate |
| angelica root oil | |
| animal carbolactone | |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| calamus oil | |
| calarene epoxide | |
| carrot seed oil | |
| castoreum absolute | |
| cedarwood oil | |
| chaulmooga oil | |
| cistus oil | |
| citronellone | |
| civet absolute | |
| civettone | |
| clary sage oil | |
| costus root oil | |
| costus valerolactone | |
| cypress oil | |
| decahydro-beta-naphthaldehyde | |
| dihydro-gamma-ionone | |
| dihydrocoumarin | |
| dihydrolinalool | |
| dodecanal | |
| grisambrene | |
| grisambria | |
| grisambrol | |
| heptalactones | |
| hexalactones | |
| indole | |
| ionones | |
| juniper lactone | |
| labdanum resinoid | |
| lilyall | |
| linalool oxide | |
| marjoram oil | |
| methyl ionones | |
| 2- | methyl undecanal |
| musks | |
| nonadienal acetate | |
| oakmoss absolute | |
| olibanum oil | |
| patchouli ethanone | |
| patchouli oil | |
| peru balsam oil | |
| rhodinol | |
| rose absolute | |
| rose carboxylate | |
| rosewood oil | |
| sandalwood oil | |
| santall | |
| sclareol | |
| 5,6,7,8- | tetrahydro-1-naphthyl acetaldehyde |
| tetrahydromethyl quinoleine | |
| tolu balsam | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillin | |
| versalide | |
| vetiver acetate | |
| vetiver oil | |
| (odor and/or flavor) used in : | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blue grass | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar | |
| cedar forest | |
| cedarwood | |
| chypre | |
| cigar box | |
| clary sage | |
| cloth clean cloths | |
| coronilla | |
| deertongue | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| musk | |
| nut peanut | |
| ocean sea | |
| oriental | |
| orris iris | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| sandalwood | |
| spice | |
| tobacco tabac tabaco | |
| tonka | |
| vanilla | |
| vetiver | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| data page | cedarwood oil china @ 0.10% |