| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 2-ethoxy-5-[(E)-prop-1-enyl]phenol | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ | |||||||||||||||||||||||||||||||||||
| InChIKey : | RADIRXJQODWKGQ-HWKANZROBE | |||||||||||||||||||||||||||||||||||
| SMILES : | CCOC1=C(C=C(C=C1)\C=C\C)O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| export tariff code : | 2912.49.5000 | |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||||
| Fleurchem : | isosafro eugenol (propenyl guaethol) | |||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Propenyl guaethol
≥99%, FCC, Kosher | |||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | vanilla | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | vanilla woody tobacco sweet spicy | |||||||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | white crystalline powder | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 to 100.00 % | |||||||||||||||||||||||||||||||||||
| heavey metals : | <10ppm | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| melting point : | 86.00 to 88.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 2.90 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2400.00 mg/kg FAONAU 15,82,1951 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for propenyl guaethol usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for propenyl guaethol usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 25.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||||
| 2-ethoxy-5-[(E)-prop-1-enyl]phenol | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-370-0 | |||||||||||||||||||||||||||||||||||
| RTECS : | SL3850000 for 94-86-0 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000094860 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 94-86-0 | |||||||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 94-86-0 | |||||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 94-86-0 | |||||||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 94-86-0 | |||||||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 94-86-0 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 5194 | |||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||||
| 2-ethoxy-5-[(E)-prop-1-enyl]phenol | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 1264 | |||||||||||||||||||||||||||||||||||
| fl. number : | 04.002 | |||||||||||||||||||||||||||||||||||
| pubchem : | 197200 | |||||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| synonyms : | |
| 1- | ethoxy-2-hydroxy-4-propenyl benzene |
| 2- | ethoxy-5-(1-propenyl) phenol |
| 2- | ethoxy-5-prop-1-enyl phenol |
| 6- | ethoxy-meta-anol |
| 6- | ethoxyprop-3-enyl phenol |
| ethoxypropenyl phenol | |
| hydroxymethyl anethole | |
| propenyl guaethol | |
| 3- | propenyl-6-ethoxyphenol |
| iso | safroeugenol |
| vaniatrope | |
soluble in : | |
| alcohol | |
| fixed oils | |
| propylene glycol | |
| water, very slightly | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| acetophenone | |
| 2- | acetyl furan |
| 2- | acetyl pyrazine |
| 2- | acetyl-2-thiazoline |
| allspice oil | |
| iso | amyl phenyl acetate |
| (E)- | anethol |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| blood orange oil | |
| iso | butyl cinnamate |
| caramel furanone | |
| laevo- | carvone |
| cassia bark oil | |
| cedarwood oils | |
| cedryl methyl ether | |
| cinnamyl alcohol | |
| civet absolute | |
| clove bud oil | |
| coffee furanone | |
| copaiba balsam oil | |
| costus valerolactone | |
| coumarin | |
| para- | cresyl ethyl ether |
| cyclohexyl ethyl alcohol | |
| davana oil | |
| gamma- | decalactone |
| diacetyl | |
| dihydroanethol | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| (Z)-3- | hexen-1-yl propionate |
| hexyl isoeugenol | |
| hyacinth ether | |
| ionones | |
| labdanum resinoid | |
| lilac acetaldehyde | |
| maltol | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| methyl phenyl acetate | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| gamma- | nonalactone |
| (Z)-6- | nonen-1-al |
| gamma- | octalactone |
| octyl methyl ketone | |
| orange oil | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| peru balsam oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenethyl phenyl acetate | |
| phenyl acetic acid | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| sandal pentanol | |
| santall | |
| strawberry furanone | |
| substitutes for vanillin and ethyl vanillin | |
| tobacco dodecane | |
| tonka bean absolute | |
| vanilla absolute | |
| vanillin | |
| vanillyl acetate | |
| veratraldehyde | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| watermelon ketone | |
| woody amylene | |
| zingerone | |
(odor and/or flavor) used in : | |
| abronia | |
| acacia | |
| acorn | |
| allspice | |
| almond bitter almond | |
| almond blossom | |
| amber | |
| ambrene | |
| anise | |
| apple | |
| apple blossom | |
| apple green apple | |
| apricot | |
| arrack | |
| asafoetida | |
| asparagus | |
| azalea | |
| baby powder | |
| balsam | |
| banana | |
| barley | |
| bay rum | |
| bayberry | |
| bean locust bean | |
| benzoin | |
| bergamot | |
| blackberry | |
| bluebell | |
| blueberry | |
| bouquet | |
| brandy | |
| bread baked bread | |
| broom genet genista | |
| bubblegum | |
| butter | |
| butter rum | |
| butterscotch | |
| cabreuva | |
| cake | |
| candy | |
| candy cotton candy | |
| cappuccino | |
| caramel | |
| carnation dianthus oeillet | |
| cassia | |
| cassia blossom | |
| cassie acacia farnesiana | |
| castoreum | |
| cedar | |
| cedarwood | |
| cherry | |
| cherry blossom | |
| cherry brandy | |
| chocolate cocoa | |
| christmas blends | |
| cinnamon | |
| citronella | |
| civet | |
| clove | |
| clove blossom | |
| coconut | |
| coffee | |
| colonia | |
| cookie | |
| crabapple blossom | |
| cranberry | |
| cream | |
| cream ice cream | |
| cream soda | |
| currant | |
| custard | |
| date | |
| decumaria | |
| eggnog | |
| elder blossom | |
| elderberry | |
| fagonia | |
| fenugreek | |
| fern fougere | |
| fig | |
| fir balsam | |
| fixer | |
| floral | |
| flouve | |
| flouve blossom | |
| frangipanni plumeria | |
| fruit dried fruit | |
| gingerbread | |
| gooseberry | |
| graham cracker | |
| grape | |
| grenadine | |
| guaiacwood | |
| gurjun | |
| habuba | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| hibiscus | |
| hollyberry | |
| honeysuckle chevrefeuille | |
| hugonia | |
| hyacinth jacinthe | |
| hydrangea | |
| incense | |
| jackfruit | |
| jasmin | |
| kewda | |
| labdanum | |
| leather | |
| licorice | |
| lilac lilas syringa | |
| lotus | |
| lychee soapberry | |
| malt | |
| mango blossom | |
| maple | |
| marigold tagete | |
| marshmallow | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| milk malted milk | |
| millefleurs | |
| mint | |
| molasses | |
| moss | |
| mulberry | |
| musk | |
| myrrh | |
| myrtle | |
| narcissus narcisse | |
| nut | |
| nut walnut | |
| oakmoss mousse de chene | |
| opoponax | |
| orange blossom fleur d'oranger | |
| orchid | |
| oriental | |
| papaya | |
| passion blossom | |
| passion fruit | |
| patchouli | |
| peach | |
| peach blossom | |
| pear | |
| pear blossom | |
| peru balsam | |
| petunia | |
| pina colada | |
| pineapple | |
| plum | |
| plum blossom | |
| plum greengage plum | |
| popcorn | |
| poppy red poppy | |
| powder | |
| praline | |
| prune | |
| pumpkin | |
| rain | |
| raisin | |
| raspberry | |
| raspberry black raspberry | |
| redwood | |
| rootbeer | |
| rose dog rose | |
| rose moss rose | |
| rose white rose | |
| rum | |
| rum butter rum | |
| sandalwood | |
| sarsaparilla | |
| sassafras | |
| spice | |
| starfruit | |
| straw | |
| strawberry | |
| sweet pea pois de senteur | |
| tea | |
| tobacco tabac tabaco | |
| toffee | |
| tolu balsam | |
| tonka | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| woody | |
| wormseed chenopodium | |
natural occurrence in : | |
| not found in nature | |