Notes :
Blends well with acetals, aldehydes and alcohols to give fresh top notes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||||
| IUPAC name : | 3,7-dimethylocta-2,6-dienal | |||||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3 | |||||||||||||||||||||||||||||||||||||
| InChIKey : | WTEVQBCEXWBHNA-UHFFFAOYAM | |||||||||||||||||||||||||||||||||||||
| SMILES : | CC(=CCCC(=CC=O)C)C | |||||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||||
| IUPAC name : | (2E)-3,7-dimethylocta-2,6-dienal | |||||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+ | |||||||||||||||||||||||||||||||||||||
| InChIKey : | WTEVQBCEXWBHNA-JXMROGBWBB | |||||||||||||||||||||||||||||||||||||
| SMILES : | CC(=CCC/C(=C/C=O)/C)C | |||||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||||
| IUPAC name : | (2Z)-3,7-dimethylocta-2,6-dienal | |||||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7- | |||||||||||||||||||||||||||||||||||||
| InChIKey : | WTEVQBCEXWBHNA-YFHOEESVBQ | |||||||||||||||||||||||||||||||||||||
| SMILES : | CC(=CCC/C(=C\C=O)/C)C | |||||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||||
| fda reg : | 182.60 | h. number : | 2912.19.1000 | |||||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||||
| odor type : | citrus | |||||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sharp lemon sweet | |||||||||||||||||||||||||||||||||||||
| taste description³ : | at 40.00 ppm. Lemon peel, citrus, juicy, green, lime, woody and herbal | |||||||||||||||||||||||||||||||||||||
| substantivity : | 12 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||||
| specific gravity : | 0.88500 - 0.89100 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.364 to 7.414 | |||||||||||||||||||||||||||||||||||||
| refractive index : | 1.48600 - 1.49000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||||
| boiling point : | 228.00 - 229.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||||
| boiling point : | 103.00 - 104.00 °C. @ 12.00 mm Hg | |||||||||||||||||||||||||||||||||||||
| acid value : | 3.00 max. KOH/g | |||||||||||||||||||||||||||||||||||||
| logp : | 3.45 | |||||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 4960.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 2250.00 mg/kg FCTOD7 25,505,1987 | |||||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 195.00 °F. TCC ( 90.56 °C. ) | |||||||||||||||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||||||||||||||
| Fragrance usage is RESTRICTED to : | ||||||||||||||||||||||||||||||||||||||
| Please review all IFRA documents for complete information. (QRA) | ||||||||||||||||||||||||||||||||||||||
| IFRA categories : limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) | ||||||||||||||||||||||||||||||||||||||
| Category 1 : | 0.04 % (1) | Category 2 : | 0.05 % | |||||||||||||||||||||||||||||||||||
| Category 3 : | 0.20 % | Category 4 : | 0.60 % | |||||||||||||||||||||||||||||||||||
| Category 5 : | 0.30 % | Category 6 : | 1.00 % (1) | |||||||||||||||||||||||||||||||||||
| Category 7 : | 0.10 % | Category 8 : | 1.40 % | |||||||||||||||||||||||||||||||||||
| Category 9 : | 5.00 % | Category 10 : | 2.50 % | |||||||||||||||||||||||||||||||||||
| Category 11 : | See Note | |||||||||||||||||||||||||||||||||||||
(1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). | ||||||||||||||||||||||||||||||||||||||
Note : Category 11 includes all non-skin contact or incidental skin contact products. Due to negligible skin contact, the concentration of a fragrance ingredient should not exceed the usual concentration of the fragrance compound in the finished product. For example, hypothetically if the usual concentration of a fragrance compound in the final product, for example a candle, is at 5%, then any individual fragrance ingredient (in this case citral) must not exceed 5% in the candle. | ||||||||||||||||||||||||||||||||||||||
| recommendation for citral usage levels up to : | ||||||||||||||||||||||||||||||||||||||
| 170.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 226-394-6 | |||||||||||||||||||||||||||||||||||||
| rtecs : | RG5075000 for 5392-40-5 | |||||||||||||||||||||||||||||||||||||
| chemidplus : | 005392405 | |||||||||||||||||||||||||||||||||||||
| epa-srs : | 5392-40-5 | |||||||||||||||||||||||||||||||||||||
| dtp/nci : | 6170 | |||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 205-476-5 | |||||||||||||||||||||||||||||||||||||
| chemidplus : | 000141275 | |||||||||||||||||||||||||||||||||||||
| epa-srs : | 141-27-5 | |||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-379-2 | |||||||||||||||||||||||||||||||||||||
| chemidplus : | 000106263 | |||||||||||||||||||||||||||||||||||||
| epa-srs : | 106-26-3 | |||||||||||||||||||||||||||||||||||||
| ifra : | ifra - ( Found under : Citral ) | |||||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||||
| pubchem : | 164234 | |||||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4038823584 | |||||||||||||||||||||||||||||||||||||
| pubchem : | 151991 | |||||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4294798961 | |||||||||||||||||||||||||||||||||||||
| pubchem : | 209040 | |||||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1440290370 | |||||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 18, No. 2, 38, (1993)³ | |||||||||||||||||||||||||||||||||||||
| synonyms : | |
| citral | |
| (Z)/(E) | citral |
| (Z+E) | citral |
| citralia | |
| 2,6- | dimethyl octadien-2,6-al-8 |
| 3,7- | dimethyl-1,2,6-octadienal |
| (Z+E)-3,7- | dimethyl-2,6-octadien-1-al |
| cis+trans-3,7- | dimethyl-2,6-octadien-1-al |
| 3,7- | dimethyl-2,6-octadienal |
| hesperitraal | |
| lemarome n | |
| lemsyn | |
| soluble in : | |
| dipropylene glycol | |
| fixed oils | |
| paraffin oil | |
| propylene glycol | |
| water, 1340 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| fabric softener | |
| shampoo | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| alpha- | amyl cinnamaldehyde |
| benzylidene acetone | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| cinnamaldehyde | |
| citronella oil | |
| citronellal | |
| citronellol | |
| citronellyl acetate | |
| citronellyl nitrile | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanal | |
| decanol | |
| (E)-4- | decen-1-al |
| dihydromyrcenol | |
| dihydroterpineol | |
| dimethyl anthranilate | |
| diphenyl oxide | |
| dodecanal | |
| elemi resin | |
| iso | eugenol |
| geraniol | |
| geranyl acetate | |
| geranyl nitrile | |
| grapefruit oil | |
| grapefruit pentanol | |
| green dioxolane | |
| heliotropin | |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| ionones | |
| 2,4- | ivy carbaldehyde |
| lavender absolute | |
| leerall | |
| lemon oil | |
| lemongrass oil | |
| lime oil | |
| laevo- | limonene |
| linalool | |
| laevo- | linalool |
| linalyl acetate | |
| litsea cubeba oil | |
| mandarin oil | |
| methyl heptenone | |
| muguet octadienol | |
| nerol | |
| octanal | |
| olibanum oil | |
| orange oil | |
| orange oil bitter | |
| petitgrain oil | |
| phellandrene | |
| phenethyl alcohol | |
| tangerine oil | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| gamma- | undecalactone |
| verbena oil | |
| (odor and/or flavor) used in : | |
| abronia | |
| agrumen | |
| aldehydic | |
| apple | |
| apple green apple | |
| apricot | |
| basil | |
| bay | |
| bergamot | |
| blackberry | |
| blueberry | |
| butterscotch | |
| cassie acacia farnesiana | |
| cedrat | |
| cherry | |
| citronella | |
| citrus | |
| coconut tropical coconut | |
| coffee | |
| cologne | |
| colonia | |
| curacao | |
| eucalyptus | |
| fern fougere | |
| fir needle | |
| floral | |
| fresh | |
| geranium | |
| ginger | |
| grapefruit | |
| lemon | |
| lemongrass | |
| lime | |
| linden blossom limeflower tilleul | |
| litsea cubeba | |
| mace | |
| magnolia | |
| mandarin | |
| melon watermelon muskmelon cantaloupe | |
| my sin | |
| neroli | |
| orange | |
| orange blossom fleur d'oranger | |
| passion fruit | |
| peach | |
| petitgrain | |
| petitgrain lemon petitgrain | |
| pineapple | |
| plum | |
| raspberry | |
| rhubarb | |
| rose | |
| rose red rose | |
| rose white rose | |
| sassafras | |
| strawberry | |
| topnotes | |
| vanilla | |
| verbena verveine | |
| zibeline | |
| natural occurrence in : | |
| data page | artemisia vestita wall. flower oil @ 9.80% |
| data page | artemisia vestita wall. leaf oil @ 13.30% |
| bergamot | |
| cardamom | |
| citronella | |
| geranium | |
| ginger | |
| grapefruit | |
| lemon | |
| lemongrass | |
| lime | |
| litsea cubeba | |
| neroli | |
| orange | |
| petitgrain | |
| petitgrain bergamot | |
| petitgrain lemon | |
| rose | |
| verbena | |