| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | butane-1,2-dithiol |
| InChI : | InChI=1/C4H10S2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3 |
| InChIKey : | LFTMJBWNOFFSRW-UHFFFAOYAK |
| SMILES : | CCC(CS)S |
| cas number : | 16128-68-0 |
| (EINECS) number : | 240-290-8 |
| fema number : | 3528 |
| coe number : | 11909 |
| jecfa number : | 537 |
| fl. number : | 12.072 |
| molar refractivity : | 36.33 ± 0.3 cm3 |
| parachor : | 292.3 ± 4.0 cm3 |
| index of refraction : | 1.502 ± 0.02 |
| surface tension : | 31.8 ± 3.0 dyne/cm |
| density : | 0.993 ± 0.06 g/cm3 |
| polarizability : | 14.40 ± 0.5 10-24cm3 |
| XlogP : | 2.20 |
| XlogP3-AA : | 1.80 |
| molecular weight : | 122.2522000 (IUPAC) |
| formula : | C4 H10 S2 |
| NMR Predictor : | Predict |
|
|
| |
| |
| export tariff code : | unspecified |
| fda reg : | unspecified |
Suppliers :
|
| Nanjing : | 1,2-butanedithiol
|
| Penta : | 1,2-butanedithiol
|
| Pfaltz & Bauer : | 1,2-Butanedithiol
95% |
organoleptics :
|
| odor type : | sulfurous |
| odor strength : | high ,
recommend smelling in a 0.10 % solution or less |
odor description :
at 0.10 % in propylene glycol. | sulfur roasted meat |
properties :
|
| appearence : | colorless to pale yellow clear liquid |
| assay : | 98.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 1.03900 @ 20.00 °C.
|
| refractive index : | 1.52100 to 1.53100 @ 20.00 °C.
|
| boiling point : | 77.00 °C. @ 28.00 mm Hg
|
| flash point : | 142.00 °F. TCC ( 61.11 °C. )
|
| logP (o/w) : | 2.19 |
safety :
|
| Oral Toxicity(LD50) : | | |
Not determined
|
| Dermal Toxicity(LD50) : | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | |
Not determined
|
| |
safety in use :
|
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | ND (μg/capita/day) |
| |
| recommendation for 1,2-butane dithiol usage levels up to : | | | not for fragrance use.
|
| recommendation for 1,2-butane dithiol usage levels up to : | | | 1.0000 ppm in the flavor.
|
safety references :
|
| European Food Safety Athority(efsa) : | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
| EPI System : | view |
| Env. Mutagen Info. Center : | Search |
| Canada Domestic Sub. List : | Yes |
| EPA Chem. Sub. Inventory : | Yes |
| |
| | | |
| | butane-1,2-dithiol
|
| (EINECS) number : | 240-290-8 |
| chemidplus : | 016128680 |
| EPA Substance Registry Services : | 16128-68-0 |
references :
|
| | butane-1,2-dithiol
|
| fl. number : | 12.072 |
| jecfa number : | 537 |
| NIST Chemistry WebBook : | 585304368 |
| pubchem : | 198222 |
other :
|
|
synonyms :
|
| | butane-1,2-dithiol | | 1,2- | butanedithiol | | 1,2- | dimercaptobutane | | 1,2- | dithiolbutane | | 1- | ethyl-1,2-ethane dithiol |
soluble in :
|
| | fats |
insoluble in :
|
| | water |
(odor and/or flavor) blends with :
|
| 4- | acetyl-2-methyl pyrimidine |
| 4- | allyl-2,6-dimethoxyphenol |
| | amyl mercaptan |
| | bacon dithiazine |
| | benzothiazole |
| 1,3- | butane dithiol |
| 2,3- | butane dithiol |
| 2-(2- | butyl)-4,5-dimethyl-3-thiazoline |
| | coffee difuran |
| | cyclopropyl (E,Z)-2,6-nonadienamide |
| (E,E)-2,4- | decadien-1-al |
| 2,5- | diethyl thiazole |
| 3,5- | diethyl-2-methyl pyrazine |
| 2,5- | diethyl-3-methyl pyrazine |
| | difurfuryl sulfide |
| 2,5- | dihydroxy-1,4-dithiane |
| N-(2,4- | dimethoxybenzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N-(2-(3,4- | dimethoxyphenyl)ethyl)-3,4-dimethoxycinnamic acid amide |
| 2,5- | dimethyl furan |
| | dimethyl tetrasulfide |
| 2,6- | dimethyl thiophenol |
| | dimethyl trisulfide |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 3,7- | dimethyl-2,6-octadien-1-yl cyclopropyl carboxamide |
| 2,6- | dimethyl-3-((2-methyl-3-furyl)thio)-4-heptanone |
| 2,5- | dimethyl-3-furan thiol |
| bis(2,5- | dimethyl-3-furyl) disulfide |
| (Z+E)-2,5- | dimethyl-3-tetrahydrofuran thiol |
| (Z+E)-2,5- | dimethyl-3-thioacetoxytetrahydrofuran |
| 2,5- | dimethyl-3-thiofuroyl furan |
| 1,1- | ethane dithiol 1% in ethanol |
| 2- | ethoxythiazole |
| | ethyl (E,Z)-2,6-nonadienamide |
| S- | ethyl 2-acetyl aminoethane thioate |
| | ethyl 3-mercaptopropionate |
| | ethyl 4-(acetyl thio) butyrate |
| S- | ethyl thioacetate |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline |
| | furfuryl isopropyl sulfide |
| 4- | furfuryl thio-2-pentanone |
| N-( | heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide |
| 1,6- | hexane dithiol |
| | hexyl mercaptan |
| | massoia bark oil |
| | massoia lactone |
| | meaty dithiane |
| 4- | mercapto-2-pentanone 1% in acetoin |
| (R*,S*)-2- | mercapto-3-butanol |
| 2- | mercapto-3-pentanone |
| 2- | mercaptomethyl pyrazine |
| 2- | mercaptopropionic acid |
| N1-(2- | methoxy-4-methyl benzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N1-(2- | methoxy-4-methyl benzyl)-N2-2(2-(5-methyl pyridin-2-yl)ethyl) oxalamide |
| | methyl 2-methyl-3-furyl disulfide |
| 2- | methyl 3-(methyl thio) furan 10% in triacetin |
| 4- | methyl 4-mercaptopentan-2-one 1% in pg |
| | methyl dihydrofuran thiol |
| 4- | methyl nonanoic acid |
| 2- | methyl pyrazine |
| 2- | methyl thiazolidine |
| 2-( | methyl thio) ethanol |
| 3-( | methyl thio) propanol |
| 12- | methyl tridecanal |
| 2- | methyl-1-methyl thio-2-butene |
| 3- | methyl-2-butane thiol |
| 2- | methyl-3-,5 or 6-(furfuryl thio) pyrazine |
| 2- | methyl-3-(methyl thio) pyrazine |
| 2- | methyl-3-furyl tetrasulfide |
| bis(2- | methyl-3-furyl) disulfide |
| S-(2- | methyl-3-furyl) ethane thioate |
| 3-((2- | methyl-3-furyl)thio)-4-heptanone |
| 4-((2- | methyl-3-furyl)thio)-5-nonanone |
| 2- | methyl-3-tetrahydrofuran thiol |
| 2- | naphthyl mercaptan |
| 1,9- | nonane dithiol |
| | nutty thiazole |
| 1,8- | octane dithiol |
| | peanut dithiazine |
| 4- | penten-1-yl acetate |
| 1- | phenethyl mercaptan |
| 1,3- | propane dithiol |
| 2- | propionyl-2-thiazoline |
| | propyl 2-mercaptopropionate |
| | propyl 2-methyl-3-furyl disulfide |
| iso | propyl disulfide |
| iso | propyl mercaptan |
| | pyrazinyl ethane thiol |
| 2- | pyridinyl methane thiol |
| | pyrrolidino-(1,2E)-4H-2,4-dimethyl-1,3,5-dithiazine |
| | roasted butanol |
| | rum ether |
| | sulfuryl acetate |
| 3- | tetrahydrothiophenone |
| | thialdine |
| 3- | thienyl mercaptan |
| 1-(2- | thienyl) butanone |
| ortho- | thiocresol |
| | thioguaiacol |
| | tyramine |
(odor and/or flavor) used in :
|
| | meat |
natural occurrence in :
|
| not found in nature |
|