| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | (E)-4-methyldec-3-en-5-ol | |||||||||||||||||||||||
| InChI : | InChI=1/C11H22O/c1-4-6-7-9-11(12)10(3)8-5-2/h8,11-12H,4-7,9H2,1-3H3/b10-8+ | |||||||||||||||||||||||
| InChIKey : | WSTQLNQRVZNEDV-CSKARUKUBK | |||||||||||||||||||||||
| SMILES : | CCCCCC(/C(=C/CC)/C)O | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||
| Givaudan : | Undecavertol | |||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||
| odor description :¹ : at 100.00 % in dipropylene glycol. | green oily violet lily seedy fruity kiwi | |||||||||||||||||||||||
| substantivity : | 31 hour(s) at 100.00 % | |||||||||||||||||||||||
properties : | ||||||||||||||||||||||||
| appearence : | pale yellow to yellow clear liquid | |||||||||||||||||||||||
| assay : | 97.00 to 100.00 % sum of isomers | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 0.84200 to 0.84700 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 7.006 to 7.048 | |||||||||||||||||||||||
| refractive index : | 1.45200 to 1.45900 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 255.00 to 256.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| logp : | 3.90 | |||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||
safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 5000.00 mg/kg | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | 208.00 °F. TCC ( 97.78 °C. ) | |||||||||||||||||||||||
| recommendation for violet decenol usage levels up to : | ||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for violet decenol usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||
| (E)-4-methyldec-3-en-5-ol | ||||||||||||||||||||||||
| (EINECS) number : | 279-815-0 | |||||||||||||||||||||||
| chemidplus : | 081782776 | |||||||||||||||||||||||
| EPA Substance Registry Services : | 81782-77-6 | |||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 81782-77-6 | |||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 81782-77-6 | |||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 81782-77-6 | |||||||||||||||||||||||
| NLM GENetic TOXicology : | 81782-77-6 | |||||||||||||||||||||||
references : | ||||||||||||||||||||||||
| (E)-4-methyldec-3-en-5-ol | ||||||||||||||||||||||||
| pubchem : | 740844 | |||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1995)¹ | |||||||||||||||||||||||
other : | ||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||
| synonyms : | |
| 4- | methyl-3-decen-5-ol |
| undecavertol | |
| violet decenol | |
soluble in : | |
| alcohol | |
| water, 92 mg/L @ 20C | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| algae absolute | |
| allyl amyl glycolate | |
| iso | amyl acetate |
| iso | amyl benzoate |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisaldehyde |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| carrot seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| cortex pyridine | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| davana oil | |
| decanal | |
| diethyl malonate | |
| dimethyl anthranilate | |
| dodecanal | |
| ethyl acetoacetate | |
| ethyl heptanoate | |
| ethyl phenyl acetate | |
| fir needle oil | |
| floral pyranol | |
| freesia heptanol | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| geranyl acetate | |
| (E)- | geranyl acetone |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| (Z)-3- | hexen-1-yl formate |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| ho leaf oil | |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| 2,4- | ivy carbaldehyde |
| lavender absolute | |
| leaf acetal | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl 2-methyl valerate | |
| methyl anthranilate | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl octine carbonate | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| musks | |
| nerol | |
| neryl acetate | |
| (E,Z)-2,6- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanal | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| (Z)-5- | octen-1-ol |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose carboxylate | |
| rose oxides | |
| santall | |
| strawberry furanone | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tuberose absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| verbena oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody amylene | |
| ylang ylang oil | |
(odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| alpine bouquet | |
| amaryllis | |
| apple | |
| apple blossom | |
| apple crabapple | |
| artichoke | |
| balsam | |
| banana | |
| bark | |
| bean locust bean | |
| blossom tropical blossom | |
| blueberry | |
| boronia | |
| bouquet | |
| boxwood blossom | |
| boysenberry | |
| briar sweet briar eglantine | |
| carrot seed | |
| cassis black currant bud | |
| cedar forest | |
| chocolate cacao | |
| cilantro | |
| citrus | |
| cloudberry bakeapple | |
| clover trefle le'trefle incarnat | |
| crabapple blossom | |
| cucumber | |
| currant | |
| cyclamen | |
| daffodil narcissus | |
| dillenia | |
| earth humus | |
| elder blossom | |
| evergreen | |
| fantasy blends | |
| fern fougere | |
| fig | |
| fir needle | |
| floral | |
| foliage | |
| frangipanni plumeria | |
| freesia | |
| fresh | |
| gardenia | |
| gooseberry | |
| grapefruit | |
| green | |
| guava | |
| hyacinth jacinthe | |
| hydrangea | |
| iris blossom | |
| ivy leaf | |
| jackfruit | |
| jasmin | |
| jonquil narcissus jonquilla | |
| kewda | |
| kiwi | |
| kiwi blossom | |
| kumquat | |
| leaf | |
| lily | |
| lime | |
| linden blossom limeflower tilleul | |
| liverwort | |
| loganberry dewberry | |
| lychee soapberry | |
| magnolia | |
| mango | |
| mango blossom | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| millefleurs | |
| mimosa wattle | |
| moss | |
| muguet lily of the valley | |
| mulberry | |
| natural | |
| nut | |
| ocean sea | |
| orchid | |
| orris iris | |
| osmanthus | |
| outdoors fresh outdoors | |
| pansy | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pear blossom | |
| pear prickly pear | |
| peony | |
| petunia | |
| pine | |
| pinon cone | |
| plum | |
| plum blossom | |
| privet | |
| privet blossom | |
| quince | |
| rain spring rain | |
| reseda mignonette | |
| rose tea rose | |
| rose wild rose | |
| spearmint | |
| starfruit | |
| stock evening scented stock | |
| sweet pea pois de senteur | |
| tea | |
| tomato | |
| tomato leaf | |
| tropical | |
| truffle | |
| tuberose tubereuse | |
| violet | |
| violet leaf | |
| wet fields | |
| wintergreen | |
| yew | |
natural occurrence in : | |
| not found in nature | |