Notes :
natural oakmoss accord - verymoss and olibanum resinoid.
mossy accord - isoeugenol, verymoss 10% and benzyl salicylate.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | methyl 2,4-dihydroxy-3,6-dimethylbenzoate | |||||||||||||||||||||||||
| InChI : | InChI=1/C10H12O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h4,11-12H,1-3H3 | |||||||||||||||||||||||||
| InChIKey : | UUQHKWMIDYRWHH-UHFFFAOYAK | |||||||||||||||||||||||||
| SMILES : | CC1=CC(=C(C(=C1C(=O)OC)O)C)O | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2918.29.7500 | |||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||
| odor type : | mossy | |||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | mossy oakmoss woody phenolic earthy | |||||||||||||||||||||||||
| substantivity : | 280 hour(s) at 10.00 % in dipropylene glycol | |||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||
| appearence : | white to pinkish yellow crystalline powder | |||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| melting point : | 142.00 - 145.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| logp : | 2.84 | |||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >8000.00 mg/kg | |||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5000.00 mg/kg | |||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 361.00 °F. TCC ( 182.78 °C. ) | |||||||||||||||||||||||||
| recommendation for verymoss usage levels up to : | ||||||||||||||||||||||||||
| 7.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for verymoss usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||
| (EINECS) number : | 225-193-0 | |||||||||||||||||||||||||
| chemidplus : | 004707475 | |||||||||||||||||||||||||
| epa-srs : | 4707-47-5 | |||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||
| fl. number : | 09.623 | |||||||||||||||||||||||||
| pubchem : | 655468 | |||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2674390347 | |||||||||||||||||||||||||
| synonyms : | |
| 3,6- | dimethyl-beta-resorcyclic acid methyl ester |
| 3,6- | dimethyl-beta-resorcylic acid methyl ester |
| evernyl | |
| methyl 2,4-dihydroxy-3,6-dimethyl benzoate | |
| methyl 3,6-dimethyl resorcylate | |
| methyl atratate | |
| methyl beta-orcinol carboxylate | |
| methyl dihydroxydimethyl benzoate | |
| oakmoss #1 | |
| beta- | resorcyclic acid 3,6-dimethyl methyl ester |
| veramoss | |
| verymoss | |
| soluble in : | |
| alcohol | |
| isopropyl myristate | |
| insoluble in : | |
| water | |
| stability : | |
| soap | |
| (odor and/or flavor) blends with : | |
| allspice oil | |
| amber carbinol | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| armoise oil | |
| bay leaf oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzophenone | |
| benzyl isoeugenol | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl quinoline |
| iso | butyl salicylate |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| para- | cresyl caprylate |
| para- | cresyl phenyl acetate |
| cuminaldehyde | |
| currant bud absolute black | |
| davana oil | |
| decanol | |
| 9- | decen-1-ol |
| decyl acetate | |
| dihydrojasmone | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl benzyl carbinyl isobutyrate | |
| dimethyl hydroquinone | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl vanillin | |
| eugenol | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| geraniol | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| immortelle absolute | |
| ionones | |
| labdanum resinoid | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| marine pyridine | |
| melon heptenal | |
| melon nonenoate | |
| methyl acetophenone | |
| methyl cedryl ketone | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| 2- | methyl undecanal |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| gamma- | nonalactone |
| nopyl acetate | |
| oakmoss absolute | |
| ocean propanal | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone methyl ether | |
| rhodinol | |
| santall | |
| alpha- | terpineol |
| tobacco dodecane | |
| tonka bean absolute | |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| vetiver oil | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| allspice | |
| alpine bouquet | |
| amber | |
| angel | |
| animal | |
| armoise | |
| ash mountain ash blossom | |
| azalea | |
| balsam | |
| bayberry | |
| beeswax cire d'abeille | |
| bouquet | |
| cabreuva | |
| calamus | |
| calandre | |
| carnation dianthus oeillet | |
| castoreum | |
| cedar forest | |
| chanel #5 | |
| charlie | |
| christmas blends | |
| chypre | |
| clove blossom | |
| clover trefle le'trefle incarnat | |
| coconut | |
| coronilla | |
| daisy | |
| daphne | |
| deertongue | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| florida breeze | |
| flouve | |
| flouve blossom | |
| foliage | |
| forest | |
| ginger white ginger | |
| grass sweet grass | |
| guaiacwood | |
| hair | |
| hay new mown hay foin coupe | |
| heather | |
| heliotrope | |
| hollyberry | |
| incense | |
| iris blossom | |
| labdanum | |
| leaf autumn leaf | |
| leather | |
| lovage | |
| maja | |
| meadow | |
| moss | |
| musk | |
| myrrh | |
| new car | |
| nut | |
| oakmoss mousse de chene | |
| ocean sea | |
| ocean sea breeze | |
| ocean sea shell | |
| patchouli | |
| petunia | |
| phlox | |
| pine | |
| pinon cone | |
| polo | |
| potpourri | |
| rain | |
| redwood | |
| rose | |
| rose d'orient | |
| rose moss rose | |
| sage | |
| sandalwood | |
| soapy | |
| spice | |
| spicewood | |
| stephanotis | |
| straw | |
| tobacco tabac tabaco | |
| tonka | |
| valerian | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| oakmoss extract | |