Notes :
tobacco note - coumarin and myrrh resinoid.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | chromen-2-one | |||||||||||||||||||||||||||
| InChI : | InChI=1/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H | |||||||||||||||||||||||||||
| InChIKey : | ZYGHJZDHTFUPRJ-UHFFFAOYAC | |||||||||||||||||||||||||||
| SMILES : | C1=CC=C2C(=C1)C=CC(=O)O2 | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| fda reg : | 189.130 | h. number : | 2932.21.0000 | |||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||
| odor type : | tonka | |||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet hay tonka new mown hay | |||||||||||||||||||||||||||
| substantivity : | 364 hour(s) at 10.00 % in dipropylene glycol | |||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||
| appearence : | white crystals | |||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| melting point : | 68.00 - 73.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 297.00 - 301.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 161.00 - 162.00 °C. @ 14.00 mm Hg | |||||||||||||||||||||||||||
| logp : | 1.39 | |||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 293.00 mg/kg FCTXAV 12,385,1974 | |||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 230.00 °F. TCC ( > 110.00 °C. ) | |||||||||||||||||||||||||||
| recommendation for coumarin usage levels up to : | ||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| recommendation for coumarin usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||
| (EINECS) number : | 202-086-7 | |||||||||||||||||||||||||||
| rtecs : | GN4200000 for 91-64-5 | |||||||||||||||||||||||||||
| chemidplus : | 000091645 | |||||||||||||||||||||||||||
| epa-srs : | 91-64-5 | |||||||||||||||||||||||||||
| dtp/nci : | 8774 | |||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||
| pubchem : | 150090 | |||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1597822399 | |||||||||||||||||||||||||||
| synonyms : | |
| benzo-alpha-pyrone | |
| 2-oxo-2H-1- | benzopyran |
| ortho-oxo-1,2- | benzopyran |
| 2H-1- | benzopyran-2-one |
| 1,2- | benzopyrone |
| coumarin | |
| (Z)-ortho- | coumarinic acid lactone |
| coumarinic anhydride | |
| coumarinic lactone | |
| cumarin | |
| ortho- | hydroxycinnamic acid delta-lactone |
| ortho- | hydroxycinnamic acid lactone |
| ortho- | hydroxycinnamic lactone |
| 3-(2- | hydroxyphenyl)-delta-lactone |
| tonka bean camphor | |
| soluble in : | |
| alcohol | |
| kerosene | |
| paraffin oil | |
| water, 1900 mg/L @ 25C | |
| insoluble in : | |
| water | |
| isopropyl myristate | |
| stability : | |
| non-discoloring | |
| (odor and/or flavor) blends with : | |
| abies alba mill oil | |
| abies sibirica oil | |
| acetoin | |
| acetophenone | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| armoise oil | |
| benzaldehyde | |
| benzoin resinoid | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| benzylidene acetone | |
| iso | butyl cinnamate |
| iso | butyl salicylate |
| cananga oil | |
| caramel furanone | |
| cascarilla bark oil | |
| cedarwood oils | |
| celery seed oil | |
| civet absolute | |
| copaiba balsam oil | |
| costus valerolactone | |
| cubeb oil | |
| dihydrojasmone | |
| diphenyl methane | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| galbanum oil | |
| ginger root oil | |
| guaiacwood oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| heptyl geranate | |
| heptyl heptanoate | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| immortelle absolute | |
| indole | |
| ionones | |
| kiou-nouk resin | |
| labdanum resinoid | |
| lavandin oil | |
| lavender oil | |
| linalyl acetate | |
| lovage root oil | |
| machilus oil | |
| methyl acetophenone | |
| methyl cedryl ketone | |
| methyl cinnamate | |
| 6- | methyl coumarin |
| methyl ionones | |
| methyl naphthyl ketone | |
| musks | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| nerolidol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| olibanum oil | |
| origanum oil | |
| orris absolute | |
| palmarosa oil | |
| patchouli ethanone | |
| patchouli oil | |
| peru balsam oil | |
| phenethyl phenyl acetate | |
| 3- | phenyl propionaldehyde |
| raspberry ketone | |
| rosemary oil | |
| sandalwood oil | |
| santall | |
| spruce oil | |
| storax resinoid | |
| tobacco dodecane | |
| tolu balsam | |
| tonka bean absolute | |
| treemoss absolute | |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| vetiverol | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| a suma | |
| acacia | |
| aimant | |
| aldehydic | |
| allspice | |
| almond | |
| amber | |
| ambrene | |
| ambrosia | |
| angel | |
| apricot | |
| azalea | |
| baby powder | |
| balsam | |
| banana | |
| bay rum | |
| bayberry | |
| beeswax cire d'abeille | |
| benzoinett | |
| blue grass | |
| blue mist | |
| bluebell | |
| bubblegum | |
| carnation dianthus oeillet | |
| cassia | |
| cassie acacia farnesiana | |
| cedar | |
| chanel #5 | |
| cherry | |
| cherry blossom | |
| chocolate cocoa | |
| christmas blends | |
| chypre | |
| clover trefle le'trefle incarnat | |
| coconut | |
| coconut tropical coconut | |
| cologne | |
| coronilla | |
| crabapple blossom | |
| deertongue | |
| elder blossom | |
| emeraude | |
| erica | |
| evergreen | |
| fern fougere | |
| fetes | |
| fir needle | |
| fixer | |
| floral | |
| forest pine forest | |
| frangipanni plumeria | |
| gardenia | |
| gingerbread | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| honeysuckle chevrefeuille | |
| immortelle helichrysum everlasting | |
| jasmin | |
| je reviens | |
| jicky | |
| juniperberry | |
| lavender | |
| leather russian leather | |
| lemon | |
| lime | |
| maja | |
| meadow | |
| melon | |
| mimosa wattle | |
| mint | |
| musk | |
| my sin | |
| nemesia | |
| nut | |
| ophira | |
| opoponax | |
| orange blossom fleur d'oranger | |
| orchid | |
| oriental | |
| origan | |
| outdoors fresh outdoors | |
| papaya | |
| passion blossom | |
| pennyroyal | |
| pina colada | |
| pine needle | |
| poppy red poppy | |
| powder | |
| presence | |
| pumpkin | |
| rain | |
| sandalwood | |
| sassafras | |
| scandal | |
| shalimar | |
| softener | |
| sweet pea pois de senteur | |
| tabu | |
| tide | |
| tobacco tabac tabaco | |
| tonka | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| vol de nuit | |
| wallflower giroflee | |
| windsor soap | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| woody | |
| ylang ylang cananga | |
| zibeline | |
| natural occurrence in : | |
| data page | champaca concrete @ 0.01% |
| data page | cinnamon bark oil (cinnamomum zeylanicum blume) india @ 0.41% |
| data page | cinnamon twig oil @ 0.32% |
| data page | lavandin absolute grosso @ 7.70% |
| data page | lavandin water (lavandula hydrida) @ 0.08% |
| data page | lavender spike water @ 0.06% |
| data page | lavender water bulgaria @ 0.19% |
| melilot | |
| data page | thyme oil spain @ 0.20% |
| tonka bean | |