| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 4,6-dimethylpyran-2-one |
| InChI : | InChI=1/C7H8O2/c1-5-3-6(2)9-7(8)4-5/h3-4H,1-2H3 |
| InChIKey : | IXYLIUKQQQXXON-UHFFFAOYAS |
| SMILES : | CC1=CC(=O)OC(=C1)C |
| (EINECS) number : | 211-618-7 |
| cas number : | 675-09-2 |
| beilstein number : | 0002468 |
| molar refractivity : | 33.40 ± 0.3 cm3 |
| parachor : | 274.0 ± 6.0 cm3 |
| index of refraction : | 1.485 ± 0.02 |
| surface tension : | 30.5 ± 3.0 dyne/cm |
| density : | 1.065 ± 0.06 g/cm3 |
| polarizability : | 13.24 ± 0.5 10-24cm3 |
| xlogp : | 1.00 |
| molecular weight : | 124.1372200 |
| formula : | C7 H8 O2 |
|
|
| |
| |
| export tariff code : | 2932.29.5050 |
| fda reg : | unspecified |
| |
Suppliers :
|
| Givaudan : | Levistamel 30%/TEC |
| |
| |
organoleptics :
|
| odor type : | caramellic |
| odor strength : | medium , recommend smelling in a 10.00 % solution or less |
odor description : at 10.00 % in dipropylene glycol. | sweet caramel sugar green balsam |
properties :
|
| assay : | 98.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| melting point : | 48.00 - 50.00 °C. @ 760.00 mm Hg
|
| boiling point : | 245.00 - 246.00 °C. @ 760.00 mm Hg
|
| logp : | 0.85 |
safety :
|
| Oral Toxicity(LD50) : |
Not determined
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 235.00 °F. TCC ( 112.78 °C. )
|
| | |
| recommendation for mesitene lactone usage levels up to : | | | 1.0000 % in the fragrance concentrate.
|
| | |
| recommendation for mesitene lactone usage levels up to : | | | not for flavor use.
|
| | |
safety links :
|
| (EINECS) number : | 211-618-7 |
| rtecs : | UQ0700000 for 675-09-2 |
| chemidplus : | 000675092 |
| epa-srs : | 675-09-2 |
| dtp/nci : | 402790 |
| | |
other :
|
| |
|
references :
|
| pubchem : | 155996 |
| NIST Chemistry WebBook : | 774553284 |
| | |
|
| synonyms : |
| 4,6- | dimethyl coumalin | | 4,6- | dimethyl pyran-2-one | | 4,6- | dimethyl-2H-pyran-2-one | | 4,6- | dimethyl-alpha-pyrone | | | levistamel | | | mesitene lactone |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| | acetoin |
| 2- | acetyl furan |
| | acetyl propionyl |
| 3- | acetyl-2,5-dimethyl furan |
| 2- | acetyl-3,4,5,6-tetrahydropyridine |
| 2- | acetyl-3,5(or 6)-dimethyl pyrazine |
| | allyl 2-furoate |
| | amber dodecane |
| iso | amyl 3-(2-furan) propionate |
| | angelica root oil |
| | benzyl disulfide |
| | birch bud oil |
| iso | butyl angelate |
| iso | butyl benzyl carbinol |
| | butyl levulinate |
| 3- | butyl phthalide |
| 3- | butylidene phthalide |
| 2-oxo | butyric acid |
| gamma- | butyrolactone |
| | caramel dione |
| | caramel furanone |
| | caramel pentadione |
| | celery ketone |
| | celery leaf oil |
| | celery seed oil |
| | celery seed oil CO2 extract |
| | celery seed oleoresin |
| | celery undecene |
| | cyclohexyl acetic acid |
| | cyclopentyl mercaptan |
| | diacetyl |
| 2,5- | diethyl tetrahydrofuran |
| alpha,alpha- | dimethyl anisyl acetone |
| 2,3- | dimethyl pyrazine |
| | ethyl (E)-crotonate |
| | ethyl 2-hydroxy-2-methyl butyrate |
| | ethyl 4-pentenoate |
| | ethyl cyclopentenolone |
| | ethyl maltol |
| | ethyl pyruvate |
| (E)- | ethyl tiglate |
| | ethyl vanillin |
| 5- | ethyl-2,3,4,5-tetramethyl-2-cyclohexen-1-one |
| 5- | ethyl-3,4,5,6-tetramethyl cyclohexen-2-one |
| | fenugreek absolute |
| | furfuryl acetone |
| | furfuryl alcohol |
| | furfuryl octanoate |
| | furfuryl valerate |
| | galbanum absolute |
| | geranyl crotonate |
| gamma- | heptalactone |
| | hexahydrofarnesyl acetone |
| 3,4- | hexane dione |
| 5- | hydroxymethyl furfural |
| | immortelle absolute |
| (Z)- | jasmone |
| iso | jasmone |
| | levulinic acid |
| | lovage herb oil |
| | lovage oleoresin |
| | lovage root absolute |
| | lovage root oil |
| | maltol |
| | maltyl propionate |
| | mango furanone |
| | maple furanone |
| | maple lactone |
| | menthone lactone |
| | mesitene lactone |
| 3- | methyl butyl 2-furyl butyrate |
| | methyl cyclopentenolone |
| 5- | methyl furfural |
| 4- | methyl-2,6-dimethoxyphenol |
| | nutty cyclohexenone |
| | peanut oxazole |
| 2- | pentadecanone |
| 2- | pentanoyl furan |
| 3- | propylidene phthalide |
| | rosefuran |
| | shoyu furanone |
| dextro- | sorbitol |
| | strawberry furanone |
| | strawberry furanone acetate |
| | sweet pea absolute |
| dextro,laevo- | tartaric acid |
| | tetrahydrofurfuryl acetate |
| | tetrahydrofurfuryl alcohol |
| 2- | thiophene thiol |
| (E)- | tiglic acid |
| | toffee furanone |
| | tonka bean absolute |
| | tonka bean resinoid |
| (E,E)-2,4- | undecadien-1-al |
| 2,4- | undecadien-1-al |
| | vanilla oleoresin |
| | vanillyl isobutyrate |
| | verbenone |
| | whiskey lactone |
| (odor and/or flavor) used in : |
| | balsam | | | caramel | | | coffee | | | fir | | | herbal | | | pine | | | spice | | | sugar | | | vanilla |
| natural occurrence in : |
| not found in nature |
|