| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | phenoxybenzene | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H | |||||||||||||||||||||||||||||||||||
| InChIKey : | USIUVYZYUHIAEV-UHFFFAOYAV | |||||||||||||||||||||||||||||||||||
| SMILES : | C1=CC=C(C=C1)OC2=CC=CC=C2 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2909.30.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | geranium leaf green phenolic | |||||||||||||||||||||||||||||||||||
| substantivity : | 156 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless solid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.06500 - 1.07300 @ 30.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.862 to 8.928 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.58000 - 1.58100 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 27.00 - 30.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 258.00 - 259.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 4.21 | |||||||||||||||||||||||||||||||||||
| shelf life : | 36.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2450.00 mg/kg NTIS** 0TS0518143 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >7940.00 mg/kg NTIS** 0TS0518143 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 240.00 °F. TCC ( 115.56 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for diphenyl oxide usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 1.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-981-2 | |||||||||||||||||||||||||||||||||||
| rtecs : | KN8970000 for 101-84-8 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000101848 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 101-84-8 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 19311 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150663 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 690318354 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| 1,1'-oxybis | benzene |
| oxybis | benzene |
| biphenyl oxide | |
| oxy | diphenyl |
| diphenyl ether | |
| diphenyl oxide | |
| geranium crystals | |
| phenoxybenzene | |
| phenyl ether | |
| phenyl oxide | |
| soluble in : | |
| alcohol | |
| kerosene | |
| paraffin oil | |
| water, 18 mg/L @ 25C | |
| insoluble in : | |
| water | |
| stability : | |
| non-discoloring | |
| (odor and/or flavor) blends with : | |
| abies sibirica oil | |
| acetaldehyde ethyl phenethyl acetal | |
| acetophenone | |
| algae absolute | |
| allyl amyl glycolate | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl alcohol |
| benzophenone | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl salicylate | |
| benzylidene acetone | |
| bois de rose oil | |
| iso | butyl quinoline |
| iso | butyl salicylate |
| caraway seed oil | |
| carrot seed oil | |
| cinnamyl alcohol | |
| citral | |
| citronellol | |
| citrus carbaldehyde | |
| clary sage oil | |
| cortex pyridine | |
| para- | cresyl caprylate |
| cuminaldehyde | |
| cyclamen aldehyde | |
| (E)-4- | decen-1-al |
| dimethyl benzyl carbinol | |
| dimethyl hydroquinone | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| fir balsam absolute | |
| floral pyranol | |
| galbanum oil | |
| geraniol | |
| geranium oil | |
| geranyl acetate | |
| green acetate | |
| hay absolute | |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| ionones | |
| leaf acetal | |
| laevo- | linalool |
| linalool oxide | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl octine carbonate | |
| mimosa absolute | |
| narcissus absolute | |
| nerol | |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanol | |
| oakmoss absolute | |
| ocean propanal | |
| orris pyridine | |
| patchouli ethanone | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| rhodinol | |
| rose oxides | |
| santall | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tonka bean absolute | |
| tricyclodecenyl acetate | |
| vanilla absolute | |
| verymoss | |
| violet methyl carbonate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| agrumen | |
| algae | |
| amaryllis | |
| amber | |
| ambrosia | |
| ash mountain ash | |
| bark | |
| bayberry | |
| blackberry | |
| bluebell | |
| boronia | |
| bouquet | |
| boxwood | |
| boxwood blossom | |
| boxwoodberry | |
| calyx | |
| carrot seed | |
| cassis black currant bud | |
| celery | |
| chamomile | |
| champaca champak | |
| chervil | |
| chrysanthemum chrysantheme | |
| cilantro | |
| citronella | |
| citrus | |
| clematis | |
| clover trefle le'trefle incarnat | |
| cortex | |
| cranberry | |
| cypress | |
| daffodil narcissus | |
| davana | |
| earth humus | |
| erica | |
| evergreen | |
| fern fougere | |
| fig | |
| fir balsam | |
| fixer | |
| floral | |
| flouve blossom | |
| foliage | |
| forest pine forest | |
| fresh | |
| fungus | |
| geranium | |
| ginger white ginger | |
| gooseberry | |
| green | |
| hay new mown hay foin coupe | |
| herbal | |
| hollyberry | |
| hyacinth jacinthe | |
| hydrangea | |
| ivy leaf | |
| jonquil narcissus jonquilla | |
| kewda | |
| leaf | |
| lemon | |
| lily | |
| lotus | |
| marjoram | |
| mimosa wattle | |
| mint | |
| moss | |
| muguet lily of the valley | |
| narcissus narcisse | |
| ocean sea | |
| orchid | |
| palmarosa | |
| pansy | |
| parsley | |
| peach | |
| pear prickly pear | |
| pennyroyal | |
| peppermint | |
| privet | |
| privet blossom | |
| reseda mignonette | |
| rose | |
| rose geranium | |
| rose tea rose | |
| sassafras | |
| seaweed | |
| stem | |
| stephanotis | |
| sweet pea pois de senteur | |
| tea | |
| valerian | |
| vine | |
| weedy | |
| wintergreen | |
| yew | |
| natural occurrence in : | |
| not found in nature | |