| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | (6E)-8-methyl-5-propan-2-ylnona-6,8-dien-2-one |
| InChI : | InChI=1/C13H22O/c1-10(2)6-8-13(11(3)4)9-7-12(5)14/h6,8,11,13H,1,7,9H2,2-5H3/b8-6+ |
| InChIKey : | PQDRXUSSKFWCFA-SOFGYWHQBG |
| SMILES : | CC(C)C(CCC(=O)C)\C=C\C(=C)C |
| (EINECS) number : | 218-907-7 |
| cas number : | 2278-53-7 |
| fema number : | 4331 |
| jecfa number : | 1840 |
| fl. number : | 07.239 |
| molar refractivity : | 61.84 ± 0.3 cm3 |
| parachor : | 521.5 ± 4.0 cm3 |
| index of refraction : | 1.451 ± 0.02 |
| surface tension : | 26.6 ± 3.0 dyne/cm |
| density : | 0.846 ± 0.06 g/cm3 |
| polarizability : | 24.51 ± 0.5 10-24cm3 |
| xlogp : | 4.40 |
| molecular weight : | 194.3131800 |
| formula : | C13 H22 O |
|
|
| |
| |
| export tariff code : | unspecified |
| fda reg : | unspecified |
| |
| |
organoleptics :
|
odor description :
| fruity melon |
properties :
|
| appearence : | pale yellow to yellow clear liquid |
| assay : | 95.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 0.84600 - 0.85200 @ 25.00 °C.
|
| pounds per gallon - calc. : | 7.040 to 7.089
|
| refractive index : | 1.47100 - 1.47700 @ 20.00 °C.
|
| boiling point : | 237.00 - 238.00 °C. @ 760.00 mm Hg
|
| logp : | 3.90 |
safety :
|
| Oral Toxicity(LD50) : |
Not determined
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 205.00 °F. TCC ( 96.11 °C. )
|
| | |
| recommendation for virginione usage levels up to : | | | 0.0200 % in the fragrance concentrate.
|
| | |
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
| publication number : 23. |
| 4331 | average usual ppm | average maximum ppm |
| baked goods : | 0.10000 | 0.50000 |
| beverages(nonalcoholic) : | 1.00000 | 5.00000 |
| beverages(alcoholic) : | 1.00000 | 5.00000 |
| breakfast cereal : | - | - |
| cheese : | 0.01000 | 0.05000 |
| chewing gum : | - | - |
| condiments / relishes : | 0.01000 | 0.05000 |
| confectionery froastings : | 1.00000 | 5.00000 |
| egg products : | - | - |
| fats / oils : | - | - |
| fish products : | 0.01000 | 0.05000 |
| frozen dairy : | 0.01000 | 0.05000 |
| fruit ices : | 0.10000 | 0.50000 |
| gelatins / puddings : | 0.01000 | 0.05000 |
| granulated sugar : | - | - |
| gravies : | 0.01000 | 0.05000 |
| hard candy : | - | - |
| imitation dairy : | 0.01000 | 0.05000 |
| instant coffee / tea : | - | - |
| jams / jellies : | - | - |
| meat products : | 0.01000 | 0.05000 |
| milk products : | 0.01000 | 0.05000 |
| nut products : | - | - |
| other grains : | - | - |
| poultry : | 0.01000 | 0.05000 |
| processed fruits : | 0.01000 | 0.05000 |
| processed vegetables : | 0.01000 | 0.05000 |
| reconstituted vegetables : | - | - |
| seasonings / flavors : | 0.01000 | 0.05000 |
| snack foods : | 0.01000 | 0.05000 |
| soft candy : | - | - |
| soups : | 0.01000 | 0.05000 |
| sugar substitutes : | - | - |
| sweet sauces : | 0.01000 | 0.05000 |
safety links :
|
| (EINECS) number : | 218-907-7 |
| chemidplus : | 002278537 |
| epa-srs : | 2278-53-7 |
| | |
other :
|
| |
|
references :
|
| jecfa number : | 1840 |
| fl. number : | 07.239 |
| pubchem : | 680264 |
| | |
|
| synonyms : |
| (theta-(E))-8- | methyl-5-(1-methyl ethyl)-6,8-nonadien-2-one | | (theta-(E))-8- | methyl-5-(1-methylethyl)-6,8-nonadien-2-one | | (R-(E))-5-iso | propyl-8-methyl nona-6,8-dien-2-one | | (+/-)-[R-(E)]-5-iso | propyl-8-methylnona-6,8-dien-2-one | | (R-(E))-5-iso | propyl-8-methylnona-6,8-dien-2-one | | | virginione |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| | butyl isobutyrate |
| | cinnamyl isovalerate |
| | costus root absolute |
| | costus root oil |
| | costus root resinoid |
| (E,E)-2,4- | decadien-1-al |
| 2,4- | decadien-1-ol |
| | diethyl sebacate |
| 2,4- | dimethyl-3-cyclohexene-1-methanyl acetate |
| (E,Z)-2,6- | dodecadien-1-al |
| | green heptenal |
| (Z)-3- | hepten-1-ol |
| 3- | hexen-1-al |
| (Z)-3- | hexen-1-yl (Z)-3-hexenoate |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl lactate |
| (Z)-3- | hexen-1-yl phenyl acetate |
| (Z)-3- | hexen-1-yl pyruvate |
| | hexyl 2-methyl-3-pentenoate |
| 2'- | hydroxyacetophenone |
| | melon acetal |
| | melon carboxaldehyde |
| | melon heptenal |
| | melon nonenoate |
| | melon valerate |
| | methoxycitronellal |
| | methoxymelonal |
| | methyl (E)-3-nonenoate |
| | methyl (E)-3-nonenoate |
| | methyl octine carbonate |
| para- | methyl phenoxyacetaldehyde |
| 1- | methyl thio-2-propanone |
| | muguet carbaldehyde |
| (E,E)-2,6- | nonadien-1-al |
| (E,Z)-3,6- | nonadien-1-ol |
| (Z,Z)-3,6- | nonadien-1-ol |
| 2,4- | nonadien-1-ol |
| (E,Z)-3,6- | nonadien-1-yl acetate |
| 3,6- | nonadien-1-yl acetate |
| (Z)-6- | nonen-1-al |
| (E)-2- | nonen-1-ol |
| (Z)-2- | nonen-1-ol |
| (Z)-3- | nonen-1-ol |
| (Z)-6- | nonen-1-ol |
| (Z)-6- | nonen-1-yl acetate |
| (E,E)-2,4- | octadien-1-al |
| 3- | octanol |
| (Z)-3- | octen-1-ol |
| (Z)-5- | octen-1-ol |
| (Z)-3- | octen-1-yl propionate |
| (Z)-5- | octen-1-yl propionate |
| 3- | octen-2-ol |
| | propyl 2,4-decadienoate |
| | propyl isobutyrate |
| | propyl nonanoate |
| | tropical indene |
| | watermelon ketone |
| (odor and/or flavor) used in : |
| | melon |
| natural occurrence in : |
| not found in nature |
|