| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C15H24O/c1-10(9-16)5-4-6-14(2)11-7-12-13(8-11)15(12,14)3/h5,11-13,16H,4,6-9H2,1-3H3/b10-5+ | |||||||||||||||||||||||||||||||
| InChIKey : | PDEQKAVEYSOLJX-BJMVGYQFBE | |||||||||||||||||||||||||||||||
| SMILES : | C/C(=C\CCC1(C2CC3C1(C3C2)C)C)/CO | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||||||||
| fda reg : | 172.515 | |||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | woody sandalwood | |||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||
| assay : | 96.00 to 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| boiling point : | 299.00 to 302.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 159.00 to 160.00 °C. @ 10.00 mm Hg | |||||||||||||||||||||||||||||||
| flash point : | 281.00 °F. TCC ( 138.33 °C. ) | |||||||||||||||||||||||||||||||
| logP (o/w) : | 4.96 | |||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||||
|
Oral-Rat 3800.00 mg/kg Food and Cosmetics Toxicology. Vol. 12, Pg. 991, 1974. | ||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||||
|
Skin-Rabbit >5000.00 mg/kg Food and Cosmetics Toxicology. Vol. 12, Pg. 991, 1974. | ||||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||||
| recommendation for alpha-santalol usage levels up to : | ||||||||||||||||||||||||||||||||
| 4.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||
| NLM Hazardous Substances Data Bank : | search | |||||||||||||||||||||||||||||||
| Toxicology Citations : | Search | |||||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||||
| (EINECS) number : | 204-102-8 | |||||||||||||||||||||||||||||||
| chemidplus : | 000115719 | |||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 115-71-9 | |||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||
| fl. number : | 02.217 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2771931016 | |||||||||||||||||||||||||||||||
| pubchem : | 151420 | |||||||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||||||
| VCF-Online: | VCF Volatile Compounds in Food | |||||||||||||||||||||||||||||||
| synonyms : | |
| alpha- | argeol |
| arheol | |
| (Z)-alpha-5-(2,3- | dimethyl tricyclo(2.2.1.0(2,6))hept-3-yl)-2-methyl-2-penten-1-ol |
| (Z)-alpha-5-(2,3- | dimethyl tricyclo(2.2.1.02,6)hept-3-yl)-2-methyl-2-penten-1-ol stereoisomer |
| 12-alpha- | santalen-14-ol |
| (Z)-alpha- | santalol |
| cis-alpha- | santalol |
| delta-alpha- | santalol |
| dextro-alpha- | santalol |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| agarwood oil | |
| beta- | amberone |
| ammoniscum | |
| bergamot oil | |
| boronia absolute | |
| bucinal | |
| cassie absolute | |
| castoreum absolute | |
| cedarwood oil | |
| cinnamyl acetate | |
| citronellyl formate | |
| clary sage oil | |
| clove bud oil | |
| copaiba balsam oil | |
| coriander seed oil | |
| costus root oil | |
| coumarin | |
| decalinyl formate | |
| elecampane absolute | |
| epicylene | |
| eugenol | |
| geraniol | |
| geranium oil | |
| ginger root oil | |
| heliotropin | |
| heliotropyl acetone | |
| hydroxycitronellal | |
| ionones | |
| juniper berry oil | |
| labdanum resinoid | |
| lavender absolute | |
| lilac pentanol | |
| linalool | |
| mace oil | |
| machilus oil | |
| methyl benzoate | |
| musk indanone | |
| musks | |
| myrrh oil | |
| nerolidol | |
| novoviols | |
| nutmeg oil | |
| oakmoss absolute | |
| olibanum oil | |
| opoponax oil | |
| orris absolute | |
| patchouli oil | |
| peru balsam oil | |
| phenethyl alcohol | |
| rose absolute | |
| rose carboxylate | |
| tolu balsam | |
| 2,4,6- | trimethyl-3-cyclohexene nitrile |
| tuberose absolute | |
| vetiver oil | |
| watermelon ketone | |
(odor and/or flavor) used in : | |
| amber | |
| ambergris | |
| ambreine | |
| amyris | |
| angelica | |
| ash mountain ash | |
| bark | |
| bayberry | |
| beech wood tar | |
| benzoin | |
| bergamot | |
| birch tar | |
| bois de rose rosewood | |
| boronia | |
| boxwood | |
| buchu | |
| cabreuva | |
| cade | |
| calamus | |
| cardamom | |
| cascarilla | |
| cassie acacia farnesiana | |
| cedar | |
| cedar forest | |
| cedarwood | |
| cedarwood atlas | |
| celery | |
| cigar box | |
| cistus | |
| citronella | |
| clary sage | |
| costus | |
| cypress | |
| dogwood | |
| elemi | |
| estragon | |
| fern fougere | |
| forest | |
| forest pine forest | |
| galanga | |
| galbanum | |
| ginger | |
| gingergrass | |
| grass sweet grass | |
| guaiacwood | |
| gurjun | |
| hay new mown hay foin coupe | |
| heather | |
| hinoki | |
| hyssop | |
| iris blossom | |
| juniper | |
| juniperberry | |
| labdanum | |
| mace | |
| maja | |
| mimosa wattle | |
| oakwood | |
| olibanum frankincense | |
| opoponax | |
| orange bitter orange | |
| oregano | |
| orris iris | |
| osmanthus | |
| patchouli | |
| pine dwarf pine | |
| pine needle | |
| pine scotch pine | |
| pinon cone | |
| redwood | |
| sandalwood | |
| spikenard | |
| spruce | |
| tansy tanaisie | |
| tarragon | |
| timber | |
| tolu balsam | |
| valerian | |
| vetiver | |
| woody | |
| wormseed chenopodium | |
natural occurrence in : | |
| data page | kewda oil @ trace-0.21% |
| data page | osmanthus absolute @ 0.03% |
| data page | sage oil england @ 0.30% |