4-{[(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl]oxy}-4-oxobutyric acid (Click)
IUPAC Name: 4-{[(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl]oxy}-4-oxobutyric acid
Std.InChI: InChI=1S/C14H24O4/c1-9(2)11-5-4-10(3)8-12(11)18-14(17)7-6-13(15)16/h9-12H,4-8H2,1-3H3,(H,15,16)/t10-,11+,12-/m1/s1
InChI: InChI=1/C14H24O4/c1-9(2)11-5-4-10(3)8-12(11)18-14(17)7-6-13(15)16/h9-12H,4-8H2,1-3H3,(H,15,16)/t10-,11+,12-/m1/s1
Std.InChIKey: BLILOGGUTRWFNI-GRYCIOLGSA-N
InChIKey: BLILOGGUTRWFNI-GRYCIOLGBZ
SMILES: C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCC(=O)O)C(C)C
|
CAS Number: | 77341-67-4 |
|
ECHA ELINCS - REACH Pre-Reg: | 426-890-4 |
FDA UNII: | 85MHF9Y3DI |
Nikkaji Web: | J2.067.185H |
MDL: | MFCD23135646 |
XlogP3-AA: | 3.00 (est) |
Molecular Weight: | 256.34208000 |
Formula: | C14 H24 O4 |
NMR Predictor: | Predict (works with chrome or firefox) |
Category: flavoring agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | white to pale yellow crystalline solid (est) |
Assay: | 95.00 to 100.00 %
|
Food Chemicals Codex Listed: | No |
Boiling Point: | 374.35 °C. @ 760.00 mm Hg (est)
|
Flash Point: | 270.00 °F. TCC ( 132.30 °C. ) (est)
|
logP (o/w): | 4.348 (est) |
Soluble in: |
| alcohol | | water, 16.03 mg/L @ 25 °C (est) |
Organoleptic Properties:
Odor Type: | odorless |
Odor Strength: | none |
Odor Description: at 100.00 %. | odorless |
Odor Description: at 5.00 %. | Little or no odor, a slight coolness Mosciano, Gerard P&F 23, No. 5, 49, (1998) |
| cooling |
Taste Description: at 100.00 ppm. | Lingering coolness, good mouthfeel Mosciano, Gerard P&F 23, No. 5, 49, (1998) |
| |
Cosmetic Information:
Suppliers:
Safety Information:
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
Not determined
|
Dermal Toxicity: |
Not determined
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavoring agents |
Recommendation for monomenthyl succinate usage levels up to: | | not for fragrance use.
|
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 17. Update in publication number(s): 22 |
Click here to view publication 17 |
| average usual ppm | average maximum ppm |
baked goods: | 300.00000 | 900.00000 |
beverages(nonalcoholic): | 50.00000 | 150.00000 |
beverages(alcoholic): | 50.00000 | 150.00000 |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | 1250.00000 | 4000.00000 |
condiments / relishes: | - | - |
confectionery froastings: | 200.00000 | 600.00000 |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | 70.00000 | 210.00000 |
fruit ices: | 70.00000 | 210.00000 |
gelatins / puddings: | 150.00000 | 450.00000 |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | 300.00000 | 1000.00000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | 150.00000 | 450.00000 |
meat products: | - | - |
milk products: | 60.00000 | 180.00000 |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | 200.00000 | 600.00000 |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
balsamic |
balsamic |
iso | bornyl formate | FL/FR |
dextro- | fenchone | FL/FR |
camphoreous |
beta-homo | cyclocitral | FL/FR |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
citrus |
| ocimene quintoxide | FL/FR |
earthy |
(-)-alpha- | fenchol | FL/FR |
ethereal |
| cyclohexyl formate | FL/FR |
floral |
iso | butyl salicylate | FL/FR |
| dihydrocarvyl acetate | FL/FR |
fruity |
| cyclohexyl acetate | FL/FR |
| pineapple pentenoate | FL/FR |
| tropical trithiane | FL/FR |
| vanilla carboxylate | FL/FR |
green |
| manzanate (Givaudan) | FL/FR |
3,5,5- | trimethyl hexanol | FL/FR |
herbal |
1,4- | cineole | FL/FR |
1,8- | cineole | FL/FR |
| geranic oxide | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| hyssop oil | FL/FR |
| jambu oleoresin | FL/FR |
spike | lavender oil | FL/FR |
| myrtenol | FL/FR |
| sabinene hydrate | FL/FR |
| theaspirane | FL/FR |
medicinal |
meta- | dimethyl hydroquinone | FL/FR |
mentholic |
| cornmint oil china | FL/FR |
| cornmint oil terpeneless | FL/FR |
dextro,laevo- | menthol | FL/FR |
dextro-neo | menthol | FL/FR |
laevo- | menthol | FL/FR |
(±)- | menthol | FL/FR |
(±)-iso | menthone | FL/FR |
| menthyl acetate | FL/FR |
laevo- | menthyl acetate | FL/FR |
| peppermint cyclohexanone | FL/FR |
minty |
| betula lenta bark oil america | FL/FR |
| cornmint oil japan | FL/FR |
(-)- | menthone | FL/FR |
(±)- | menthone | FL/FR |
homo | menthyl acetate | FL/FR |
laevo- | menthyl lactate | FL/FR |
| pennyroyal oil fractions | FL/FR |
| peppermint absolute | FL/FR |
| peppermint oil america | FL/FR |
| peppermint oil idaho | FL/FR |
iso | pulegol | FL/FR |
| spearmint oil america | FL/FR |
| WS-23 | FL/FR |
naphthyl |
para- | methyl anisole | FL/FR |
dextro,laevo- | menthone glycerine acetal | FL/FR |
spicy |
4- | carvomenthenol | FL/FR |
| myrtenal | FL/FR |
sulfurous |
| mango thiol | FL/FR |
woody |
(+)- | camphene | FL/FR |
| camphene | FL/FR |
|
For Flavor |
|
No flavor group found for these |
(+)- | camphene | FL/FR |
camphoreous |
| camphene | FL/FR |
(-)-alpha- | fenchol | FL/FR |
| fenchol | FL/FR |
laevo- | fenchone | FL/FR |
| geranic oxide | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
chemical |
meta- | dimethyl hydroquinone | FL/FR |
cooling |
(2S,5R)-N-[4-(2- | amino-2-oxoethyl)phenyl]-5-methyl-2-(propan-2-yl)cyclohexanecarboxamide | FL |
iso | butyl salicylate | FL/FR |
4- | carvomenthenol | FL/FR |
1,4- | cineole | FL/FR |
beta-homo | cyclocitral | FL/FR |
1,3- | dihydroxyacetone (dimer) | FL |
dextro- | fenchone | FL/FR |
1-(2- | hydroxy-4-methyl cyclohexyl) ethanone | FL |
| jambu oleoresin | FL/FR |
spike | lavender oil | FL/FR |
| manzanate (Givaudan) | FL/FR |
iso | menthol | FL |
dextro,laevo- | menthol | FL/FR |
laevo- | menthol | FL/FR |
laevo- | menthone 1,2-glycerol ketal | FL |
dextro,laevo- | menthone glycerine acetal | FL/FR |
homo | menthyl acetate | FL/FR |
| menthyl acetate | FL/FR |
laevo- | menthyl lactate | FL/FR |
2-(4- | methylphenoxy)-N-(1H-pyrazol-3-yl)-N-(thiophen-2-ylmethyl)acetamide | FL |
| peppermint oil america | FL/FR |
N-(2-( | pyridin-2-yl)ethyl)-3-para-menthane carboxamide | FL |
| sabinene hydrate | FL/FR |
| theaspirane | FL/FR |
| WS-12 | FL |
| WS-3 | FL |
| WS-5 | FL |
earthy |
| panax quinquefolius root extract | FL |
floral |
| dihydrocarvyl acetate | FL/FR |
fruity |
| pineapple pentenoate | FL/FR |
| tropical trithiane | FL/FR |
| vanilla carboxylate | FL/FR |
green |
| cyclohexyl formate | FL/FR |
| ocimene quintoxide | FL/FR |
iso | phorone | FL |
3,5,5- | trimethyl hexanol | FL/FR |
herbal |
| hyssop oil | FL/FR |
mentholic |
| cornmint oil terpeneless | FL/FR |
(±)- | menthol | FL/FR |
dextro-neo | menthol | FL/FR |
| peppermint cyclohexanone | FL/FR |
minty |
| betula lenta bark oil america | FL/FR |
1,8- | cineole | FL/FR |
| cornmint oil china | FL/FR |
| cornmint oil japan | FL/FR |
| limonene glycol | FL |
(-)- | menthone | FL/FR |
(±)-iso | menthone | FL/FR |
(±)- | menthone | FL/FR |
laevo- | menthyl acetate | FL/FR |
| myrtenal | FL/FR |
| myrtenol | FL/FR |
| pennyroyal oil fractions | FL/FR |
| peppermint absolute | FL/FR |
| peppermint oil idaho | FL/FR |
iso | pulegol | FL/FR |
| spearmint oil america | FL/FR |
| WS-23 | FL/FR |
naphthyl |
para- | methyl anisole | FL/FR |
solvent |
| cyclohexyl acetate | FL/FR |
sulfurous |
| mango thiol | FL/FR |
woody |
iso | bornyl formate | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
(1R- (1alpha,2beta,5alpha))- | butane dioic acid mono(5-methyl-2-(1-methyl ethyl) cyclohexyl) ester | | butane dioic acid monomenthyl ester | | butanedioic acid, mono[5-methyl-2-(1-methylethyl)cyclohexyl] ester | mono- | menth-3-yl succinate | mono- | menthyl succinate | 4-[(1R,2S,5R)-5- | methyl-2-propan-2-ylcyclohexyl]oxy-4-oxobutanoic acid | 4-{[(1R,2S,5R)-2-iso | propyl-5-methylcyclohexyl]oxy}-4-oxobutyric acid | | succinic acid (1R,2S,5R)-2-isopropyl-5-methylcyclohexyl ester |
Articles:
|