| halazuchrome B | |
| CAS: 18296-44-1 EC: 242-174-2 Use(s): natural substances and extractives | |
| hamamelitannin | |
| CAS: 469-32-9 EC: 207-416-3 Use(s): natural substances and extractives | |
| harmaline | |
| CAS: 304-21-2 EC: 206-152-6 Use(s): natural substances and extractives | |
| harmaline hydrochloride dihydrate | |
| CAS: 6027-98-1 Use(s): natural substances and extractives | |
| harmalol | |
| CAS: 525-57-5 Use(s): natural substances and extractives | |
| harmalol hydrochloride | |
| CAS: 6028-07-5 EC: 227-898-9 Use(s): information only not used for fragrances or flavors | |
| nor | harman |
| CAS: 244-63-3 EC: 205-959-0 Use(s): information only not used for fragrances or flavors | |
| harmine | |
| CAS: 442-51-3 EC: 207-131-4 Use(s): natural substances and extractives | |
| harmol | |
| CAS: 487-03-6 Use(s): natural substances and extractives | |
| harpagide | |
| CAS: 6926-08-5 EC: 230-050-0 Use(s): natural substances and extractives | |
| harpagoside | |
| CAS: 19210-12-9 EC: 242-881-6 Use(s): natural substances and extractives | |
| hastatoside | |
| CAS: 50816-24-5 Use(s): natural substances and extractives | |
| hawthorn acetate | |
| CAS: 7306-12-9 EC: 230-755-3 Use(s): fragrance agents | |
| hawthorn carbinol | |
| CAS: 536-50-5 EC: 208-637-8 FEMA: 3139 JECFA: 805 FLAVIS: 02.080 Use(s): flavor and fragrance agents | |
| (R)- | hawthorn carbinol |
| CAS: 42070-92-8 Use(s): information only not used for fragrances or flavors | |
| (S)- | hawthorn carbinol |
| CAS: 51154-54-2 Use(s): information only not used for fragrances or flavors | |
| hawthorn ethanol | |
| CAS: 1875-89-4 EC: 217-508-5 Use(s): fragrance agents | |
| hazelnut pyrazine | |
| CAS: 18138-04-0 EC: 242-024-6 FEMA: 3336 JECFA: 777 FLAVIS: 14.056 Use(s): flavor and fragrance agents | |
| alpha- | hederin hydrate |
| CAS: 27013-91-8 EC: 248-166-5 Use(s): natural substances and extractives | |
| hedycaryol | |
| CAS: 21657-90-9 Use(s): natural substances and extractives | |
| helenalin | |
| CAS: 6754-13-8 Use(s): natural substances and extractives | |
| heleniamarin | |
| CAS: 66607-74-7 Use(s): natural substances and extractives | |
| heliangin | |
| CAS: 13323-48-3 Use(s): natural substances and extractives | |
| heliangolide | |
| CAS: 65556-51-6 Use(s): natural substances and extractives | |
| heliannone A | |
| CAS: 193411-10-8 Use(s): natural substances and extractives | |
| heliannuol A | |
| CAS: 148054-17-5 Use(s): natural substances and extractives | |
| heliannuol B | |
| CAS: 161730-07-0 Use(s): natural substances and extractives | |
| heliannuol C | |
| CAS: 161730-08-1 Use(s): natural substances and extractives | |
| heliannuol D | |
| CAS: 161730-09-2 Use(s): natural substances and extractives | |
| heliannuol E | |
| CAS: 241139-49-1 Use(s): natural substances and extractives | |
| helianol | |
| CAS: 178330-51-3 Use(s): natural substances and extractives | |
| iso | helianol |
| CAS: 203570-12-1 Use(s): natural substances and extractives | |
| helianthoside A | |
| CAS: 139164-70-8 Use(s): natural substances and extractives | |
| helianthoside B | |
| CAS: 29108-67-6 Use(s): natural substances and extractives | |
| helianthoside C | |
| CAS: 25503-42-8 Use(s): natural substances and extractives | |
| heliantriol A1 | |
| CAS: 26540-64-7 Use(s): natural substances and extractives | |
| heliantriol B1 | |
| CAS: 74715-48-3 Use(s): natural substances and extractives | |
| heliantriol B2 | |
| CAS: 61229-18-3 Use(s): natural substances and extractives | |
| heliantriol C | |
| CAS: 71876-60-3 Use(s): natural substances and extractives | |
| heliantriol F | |
| CAS: 71876-59-0 Use(s): natural substances and extractives | |
| helianyl octanoate | |
| CAS: 290305-83-8 Use(s): natural substances and extractives | |
| helichrysetin | |
| CAS: 62014-87-3 Use(s): natural substances and extractives | |
| helichrysoside | |
| CAS: 56343-26-1 Use(s): natural substances and extractives | |
| helicin | |
| CAS: 618-65-5 EC: 210-558-9 Use(s): natural substances and extractives | |
| heliespirone A | |
| CAS: 202533-71-9 Use(s): natural substances and extractives | |
| heliotric acid | |
| CAS: 25039-18-3 Use(s): natural substances and extractives | |
| heliotrine | |
| CAS: 303-33-3 Use(s): natural substances and extractives | |
| heliotrine-N-oxide | |
| CAS: 6209-65-0 Use(s): natural substances and extractives | |
| heliotropic acid | |
| CAS: 94-53-1 EC: 202-342-8 Use(s): natural substances and extractives | |
| heliotropin | |
| CAS: 120-57-0 EC: 204-409-7 FEMA: 2911 JECFA: 896 FLAVIS: 05.016 Use(s): cosmetic, flavor and fragrance agents | |
| heliotropin replacer | |
| Use(s): fragrance agents | |
| heliotropyl acetate | |
| CAS: 326-61-4 EC: 206-312-5 FEMA: 2912 JECFA: 894 FLAVIS: 09.220 Use(s): flavor and fragrance agents | |
| heliotropyl acetone | |
| CAS: 55418-52-5 EC: 259-630-1 FEMA: 2701 JECFA: 2048 FLAVIS: 07.031 Use(s): flavor and fragrance agents | |
| heliotropyl alcohol | |
| CAS: 495-76-1 EC: 207-808-4 FLAVIS: 02.205 Use(s): flavor and fragrance agents | |
| heliotropyl butane-2,3-diol acetal | |
| CAS: 6412-69-7 Use(s): information only not used for fragrances or flavors | |
| heliotropyl butyrate | |
| CAS: 6890-27-3 EC: 229-993-0 Use(s): information only not used for fragrances or flavors | |
| heliotropyl isobutyrate | |
| CAS: 5461-08-5 EC: 226-745-3 FEMA: 2913 JECFA: 895 FLAVIS: 09.430 Use(s): flavor and fragrance agents | |
| heliotropyl diethyl acetal | |
| CAS: 40527-42-2 EC: 254-956-0 Use(s): fragrance agents | |
| heliotropyl dimethyl acetal | |
| CAS: 59259-90-4 EC: 261-679-9 Use(s): fragrance agents | |
| heliotropyl formate | |
| CAS: 85262-96-0 Use(s): information only not used for fragrances or flavors | |
| heliotropyl 2-methyl butyrate | |
| CAS: 84604-43-3 EC: 283-323-1 Use(s): information only not used for fragrances or flavors | |
| heliotropyl phenyl acetate | |
| CAS: 5457-86-3 EC: 226-719-1 Use(s): information only not used for fragrances or flavors | |
| heliotropyl pivalate | |
| CAS: 6471-96-1 EC: 229-320-0 Use(s): information only not used for fragrances or flavors | |
| heliotropyl propionate | |
| CAS: 6890-26-2 EC: 229-992-5 Use(s): information only not used for fragrances or flavors | |
| heliotropyl propylene glycol acetal | |
| CAS: 61683-99-6 EC: 262-897-7 FEMA: 4622 Use(s): flavor and fragrance agents | |
| heliotropyl isovalerate | |
| CAS: 84604-42-2 EC: 283-322-6 Use(s): information only not used for fragrances or flavors | |
| helipyrone | |
| CAS: 29902-01-0 Use(s): natural substances and extractives | |
| helminthogermacrene | |
| CAS: 75023-40-4 Use(s): natural substances and extractives | |
| helveticoside | |
| CAS: 630-64-8 EC: 211-140-9 Use(s): natural substances and extractives | |
| hematein | |
| CAS: 475-25-2 EC: 207-492-8 Use(s): coloring agents | |
| hemiariensin | |
| CAS: 112448-60-9 Use(s): natural substances and extractives | |
| hemimellitene | |
| CAS: 526-73-8 EC: 208-394-8 Use(s): natural substances and extractives | |
| iso | heneicosane |
| CAS: 52845-08-6 Use(s): information only not used for fragrances or flavors | |
| heneicosanol | |
| CAS: 51227-32-8 Use(s): natural substances and extractives | |
| 11- | heneicosanol |
| CAS: 3381-26-8 EC: 222-184-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-6- | heneicosen-11-one |
| CAS: 54844-65-4 Use(s): information only not used for fragrances or flavors | |
| (Z)-9- | heneicosene |
| CAS: 39836-21-0 Use(s): natural substances and extractives | |
| heneicosyl cyclopentane | |
| CAS: 6703-82-8 Use(s): natural substances and extractives | |
| 5- | heneicosyl-1,3-benzenediol |
| CAS: 70110-59-7 Use(s): natural substances and extractives | |
| henicosane | |
| CAS: 629-94-7 EC: 211-118-9 Use(s): fragrance agents | |
| henicosanoic acid | |
| CAS: 2363-71-5 EC: 219-113-3 Use(s): natural substances and extractives | |
| henicosene | |
| CAS: 27400-79-9 EC: 248-443-0 Use(s): natural substances and extractives | |
| hentriacontane | |
| CAS: 630-04-6 Use(s): natural substances and extractives | |
| hentriacontane-14,16-dione | |
| CAS: 24724-84-3 Use(s): natural substances and extractives | |
| 16- | hentriacontanol |
| CAS: 1070-54-8 Use(s): natural substances and extractives | |
| 15- | hentriacontanol |
| CAS: 27759-56-4 Use(s): natural substances and extractives | |
| 9- | hentriacontanone |
| CAS: 34136-52-2 Use(s): natural substances and extractives | |
| 1- | hentriacontene |
| CAS: 18435-54-6 Use(s): natural substances and extractives | |
| heptacosane | |
| CAS: 593-49-7 EC: 209-792-4 Use(s): natural substances and extractives | |
| heptacosane dioic acid | |
| CAS: 5638-06-2 Use(s): natural substances and extractives | |
| 10,12- | heptacosanedione |
| CAS: 95605-27-9 Use(s): natural substances and extractives | |
| 1- | heptacosanol |
| CAS: 2004-39-9 EC: 217-906-9 Use(s): natural substances and extractives | |
| 14- | heptacosanol |
| CAS: 32116-10-2 EC: 250-926-6 Use(s): natural substances and extractives | |
| 2- | heptacosanone |
| CAS: 7796-19-2 Use(s): natural substances and extractives | |
| 1- | heptacosene |
| CAS: 15306-27-1 Use(s): natural substances and extractives | |
| (Z,Z)- | heptadeca-1,8,11-triene |
| CAS: 56134-03-3 EC: 260-005-0 Use(s): natural substances and extractives | |
| (Z,Z)-8,11- | heptadecadienal |
| CAS: 56797-42-3 Use(s): natural substances and extractives | |
| heptadecadiene | |
| CAS: 54264-04-9 Use(s): natural substances and extractives | |
| 1,8- | heptadecadiene-4,6-diyne-3,10-diol |
| CAS: 63910-76-9 Use(s): natural substances and extractives | |
| heptadecanal | |
| CAS: 629-90-3 EC: 211-115-2 Use(s): natural substances and extractives | |
| heptadecane | |
| CAS: 629-78-7 EC: 211-108-4 FLAVIS: 01.075 Use(s): fragrance agents | |
| 1,17- | heptadecanediol |
| CAS: 66577-59-1 Use(s): natural substances and extractives | |
| 2,4- | heptadecanedione |
| CAS: 64042-18-8 Use(s): natural substances and extractives | |
| heptadecanoic acid | |
| CAS: 506-12-7 EC: 208-027-1 Use(s): natural substances and extractives | |
| 1- | heptadecanol |
| CAS: 1454-85-9 EC: 215-932-5 FLAVIS: 02.154 Use(s): natural substances and extractives | |
| 2- | heptadecanol |
| CAS: 16813-18-6 Use(s): natural substances and extractives | |
| 3- | heptadecanol |
| CAS: 84534-30-5 Use(s): natural substances and extractives | |
| 4- | heptadecanol |
| CAS: 103385-34-8 Use(s): information only not used for fragrances or flavors | |
| 6- | heptadecanol |
| CAS: 112283-13-3 Use(s): information only not used for fragrances or flavors | |
| 7- | heptadecanol |
| CAS: 93658-33-4 Use(s): information only not used for fragrances or flavors | |
| 8- | heptadecanol |
| CAS: 2541-75-5 Use(s): natural substances and extractives | |
| 9- | heptadecanol |
| CAS: 624-08-8 Use(s): natural substances and extractives | |
| heptadecanolide | |
| CAS: 5637-97-8 Use(s): natural substances and extractives | |
| 2- | heptadecanone |
| CAS: 2922-51-2 FLAVIS: 07.160 Use(s): natural substances and extractives | |
| 3- | heptadecanone |
| CAS: 84534-29-2 Use(s): natural substances and extractives | |
| 4- | heptadecanone |
| CAS: 53685-77-1 EC: 258-705-6 Use(s): information only not used for fragrances or flavors | |
| 6- | heptadecanone |
| CAS: 22026-13-7 EC: 244-729-4 Use(s): information only not used for fragrances or flavors | |
| 7- | heptadecanone |
| CAS: 6064-42-2 Use(s): information only not used for fragrances or flavors | |
| 8- | heptadecanone |
| CAS: 14476-38-1 Use(s): information only not used for fragrances or flavors | |
| 9- | heptadecanone |
| CAS: 540-08-9 EC: 208-734-5 Use(s): natural substances and extractives | |
| (Z,Z,Z)-8,11,14- | heptadecatrienal |
| CAS: 56797-44-5 Use(s): natural substances and extractives | |
| (all-E)-1,7,9- | heptadecatriene-11,13,15-triyne |
| CAS: 41688-30-6 Use(s): natural substances and extractives | |
| (Z)-8- | heptadecenal |
| CAS: 56797-41-2 Use(s): natural substances and extractives | |
| 1- | heptadecene |
| CAS: 6765-39-5 EC: 229-825-6 Use(s): natural substances and extractives | |
| 5- | heptadecene |
| CAS: 138472-85-2 Use(s): natural substances and extractives | |
| 7- | heptadecene |
| CAS: 54290-12-9 Use(s): natural substances and extractives | |
| 8- | heptadecene |
| CAS: 2579-04-6 Use(s): natural substances and extractives | |
| (Z)-8- | heptadecene |
| CAS: 16369-12-3 Use(s): natural substances and extractives | |
| (Z)-8- | heptadecene dioic acid |
| CAS: 253687-28-4 Use(s): information only not used for fragrances or flavors | |
| 1- | heptadecene-4,6-diyne-3,9-diol |
| CAS: 77084-19-6 Use(s): natural substances and extractives | |
| (Z)-9- | heptadecenoic acid |
| CAS: 1981-50-6 Use(s): natural substances and extractives | |
| 5-(12- | heptadecenyl)-1,3-benzenediol |
| CAS: 103462-06-2 Use(s): natural substances and extractives | |
| 3-(10- | heptadecenyl)phenol |
| CAS: 111047-33-7 Use(s): natural substances and extractives | |
| heptadecyl acetate | |
| CAS: 822-20-8 EC: 212-492-6 Use(s): natural substances and extractives | |
| heptadecyl cyclohexane | |
| CAS: 19781-73-8 EC: 243-308-2 Use(s): natural substances and extractives | |
| 2- | heptadecylfuran |
| CAS: 208329-97-9 Use(s): natural substances and extractives | |
| 1- | heptadecyne |
| CAS: 26186-00-5 Use(s): natural substances and extractives | |
| 2,5- | heptadien-1-ol |
| CAS: 62237-90-5 Use(s): natural substances and extractives | |
| (E,E)-3,5- | heptadien-2-one |
| CAS: 18402-90-9 Use(s): natural substances and extractives | |
| 2,4- | heptadienal |
| CAS: 5910-85-0 EC: 227-627-4 Use(s): flavoring agents | |
| (E,E)-2,4- | heptadienal |
| CAS: 4313-03-5 EC: 224-328-0 FEMA: 3164 JECFA: 1179 FLAVIS: 05.084 Use(s): flavoring agents | |
| (E,Z)-2,4- | heptadienal |
| CAS: 4313-02-4 Use(s): natural substances and extractives | |
| (Z,E)-2,4- | heptadienal |
| CAS: 59121-26-5 Use(s): natural substances and extractives | |
| 1,5- | heptadiene |
| CAS: 1541-23-7 Use(s): natural substances and extractives | |
| (E,E)-2,4- | heptadiene |
| CAS: 628-72-8 Use(s): natural substances and extractives | |
| 1,5- | heptadiene-3,4-diol |
| CAS: 51945-98-3 Use(s): natural substances and extractives | |
| 2,4- | heptadienoic acid |
| CAS: 17175-86-9 Use(s): information only not used for fragrances or flavors | |
| (E,E)-2,4- | heptadienoic acid |
| CAS: 65518-46-9 Use(s): natural substances and extractives | |
| (E,Z)-2,4- | heptadienoic acid |
| CAS: 50915-66-7 Use(s): information only not used for fragrances or flavors | |
| (Z,E)-2,4- | heptadienoic acid |
| CAS: 600716-76-5 Use(s): information only not used for fragrances or flavors | |
| 2,6- | heptadienoic acid |
| CAS: 38867-17-3 Use(s): natural substances and extractives | |
| 1,6- | heptadien-4-ol |
| CAS: 2883-45-6 EC: 220-742-0 Use(s): natural substances and extractives | |
| 2,4- | heptadien-1-ol |
| CAS: 62488-55-5 Use(s): flavoring agents | |
| (E,E)-2,4- | heptadien-1-ol |
| CAS: 33467-79-7 EC: 251-535-3 FEMA: 4127 JECFA: 1784 FLAVIS: 02.153 Use(s): flavoring agents | |
| (E,Z)-2,4- | heptadien-1-ol |
| CAS: 70979-88-3 Use(s): natural substances and extractives | |
| (E,E)-2,5- | heptadien-1-ol |
| CAS: 66618-63-1 Use(s): information only not used for fragrances or flavors | |
| 3,5- | heptadienone |
| CAS: 3916-64-1 Use(s): information only not used for fragrances or flavors | |
| 2,3,3,4,4,5,5- | heptafluoro-1-pentene |
| CAS: 1547-26-8 Use(s): indirect food additives: adhesives and components of coatings | |
| delta- | heptalactone |
| CAS: 3301-90-4 EC: 221-972-4 FLAVIS: 10.045 Use(s): flavor and fragrance agents | |
| gamma- | heptalactone |
| CAS: 105-21-5 EC: 203-279-9 FEMA: 2539 JECFA: 225 FLAVIS: 10.020 Use(s): flavor and fragrance agents | |
| (R)-gamma- | heptalactone |
| CAS: 88270-38-6 Use(s): information only not used for fragrances or flavors | |
| (S)-gamma- | heptalactone |
| CAS: 31323-51-0 Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,7- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
| Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,8- | heptamethyl bicyclo(2.2.2)-5-octen-2-one |
| Use(s): information only not used for fragrances or flavors | |
| 1,2,3,3,4,5,6- | heptamethyl bicyclo(2.2.2)oct-5-en-2-ol |
| CAS: 60362-71-2 Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,7- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6,8- | heptamethyl(2.2.2)bicyclooct-5-en-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| heptanal (aldehyde C-7) | |
| CAS: 111-71-7 EC: 203-898-4 FEMA: 2540 JECFA: 95 FLAVIS: 05.031 Use(s): flavor and fragrance agents | |
| heptanal 2,3-butane diol acetal | |
| CAS: 6454-22-4 EC: 229-261-0 FEMA: 4048 JECFA: 1712 FLAVIS: 06.089 Use(s): flavoring agents | |
| heptanal butene-1,4-glycol acetal | |
| CAS: 61732-96-5 EC: 262-939-4 Use(s): information only not used for fragrances or flavors | |
| heptanal cyclic acetal with glycerol | |
| CAS: 72854-42-3 EC: 276-947-0 FEMA: 2542 FLAVIS: 06.029 Use(s): flavor and fragrance agents | |
| heptanal cyclic ethylene acetal | |
| CAS: 1708-34-5 EC: 216-959-5 Use(s): fragrance agents | |
| heptanal cyclic propylene acetal | |
| CAS: 4351-10-4 EC: 224-413-2 FEMA: 4368 JECFA: 1739 Use(s): flavor and fragrance agents | |
| heptanal cyclic trimethylene acetal | |
| CAS: 3080-69-1 EC: 221-371-7 Use(s): information only not used for fragrances or flavors | |
| heptanal diethyl acetal | |
| CAS: 688-82-4 EC: 211-707-0 FLAVIS: 06.021 Use(s): flavor and fragrance agents | |
| heptanal dimethyl acetal | |
| CAS: 10032-05-0 EC: 233-103-6 FEMA: 2541 JECFA: 947 FLAVIS: 06.028 Use(s): flavor and fragrance agents | |
| heptanal glyceryl acetal | |
| CAS: 1708-35-6 EC: 216-960-0 FEMA: 2542 JECFA: 912 Use(s): flavor and fragrance agents | |
| heptane | |
| CAS: 142-82-5 EC: 205-563-8 Use(s): extraction solvents | |
| 1,2- | heptane diol |
| CAS: 3710-31-4 Use(s): natural substances and extractives | |
| 2,3- | heptane dione |
| CAS: 96-04-8 EC: 202-472-5 FEMA: 2543 JECFA: 415 FLAVIS: 07.064 Use(s): flavor and fragrance agents | |
| 3,4- | heptane dione |
| CAS: 13706-89-3 EC: 237-242-3 Use(s): information only not used for fragrances or flavors | |
| heptane nitrile | |
| CAS: 629-08-3 EC: 211-071-4 Use(s): natural substances and extractives | |
| 2- | heptane thiol |
| CAS: 628-00-2 FEMA: 4128 JECFA: 1664 FLAVIS: 12.288 Use(s): flavoring agents | |
| heptanoic acid | |
| CAS: 111-14-8 EC: 203-838-7 FEMA: 3348 JECFA: 96 FLAVIS: 08.028 Use(s): flavor and fragrance agents | |
| heptanol | |
| CAS: 53535-33-4 EC: 258-615-7 Use(s): flavor and fragrance agents | |
| 1- | heptanol |
| CAS: 111-70-6 EC: 203-897-9 FEMA: 2548 JECFA: 94 FLAVIS: 02.021 Use(s): flavor and fragrance agents | |
| 2- | heptanol |
| CAS: 543-49-7 EC: 208-844-3 FEMA: 3288 JECFA: 284 FLAVIS: 02.045 Use(s): flavor and fragrance agents | |
| (R)-(-)-2- | heptanol |
| CAS: 6033-24-5 Use(s): flavor and fragrance agents | |
| (S)-(+)-2- | heptanol |
| CAS: 6033-23-4 Use(s): flavor and fragrance agents | |
| 3- | heptanol |
| CAS: 589-82-2 EC: 209-661-1 FEMA: 3547 JECFA: 286 FLAVIS: 02.044 Use(s): flavor and fragrance agents | |
| (R)-3- | heptanol |
| CAS: 62701-49-9 Use(s): information only not used for fragrances or flavors | |
| (S)-3- | heptanol |
| CAS: 26549-25-7 Use(s): information only not used for fragrances or flavors | |
| 4- | heptanol |
| CAS: 589-55-9 EC: 209-651-7 Use(s): information only not used for fragrances or flavors | |
| 2- | heptanone |
| CAS: 110-43-0 EC: 203-767-1 FEMA: 2544 JECFA: 283 FLAVIS: 07.002 Use(s): flavor and fragrance agents | |
| 3- | heptanone |
| CAS: 106-35-4 EC: 203-388-1 FEMA: 2545 JECFA: 285 FLAVIS: 07.003 Use(s): flavor and fragrance agents | |
| 4- | heptanone |
| CAS: 123-19-3 EC: 204-608-9 FEMA: 2546 JECFA: 287 FLAVIS: 07.058 Use(s): flavor and fragrance agents | |
| 2- | heptanoyl thiophene |
| CAS: 30711-40-1 Use(s): natural substances and extractives | |
| N-( | heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide |
| CAS: 745047-51-2 FEMA: 4232 JECFA: 1767 FLAVIS: 16.098 Use(s): flavoring agents | |
| heptaphylline | |
| CAS: 17750-35-5 Use(s): natural substances and extractives | |
| heptatriacontane | |
| CAS: 7194-84-5 EC: 230-559-8 Use(s): natural substances and extractives | |
| heptelidic acid | |
| CAS: 57710-57-3 Use(s): natural substances and extractives | |
| (Z)-2- | hepten-1-yl acetate |
| CAS: 83540-70-9 Use(s): natural substances and extractives | |
| (E)-4- | hepten-2-yl salicylate |
| CAS: 873888-85-8 Use(s): fragrance agents | |
| (Z)-4- | hepten-2-yl salicylate |
| CAS: 873888-84-7 Use(s): fragrance agents | |
| 2- | heptenal |
| CAS: 2463-63-0 EC: 219-563-0 FLAVIS: 05.070 Use(s): flavor and fragrance agents | |
| (E)-2- | heptenal |
| CAS: 18829-55-5 EC: 242-608-0 FEMA: 3165 JECFA: 1360 FLAVIS: 05.150 Use(s): flavoring agents | |
| (Z)-2- | heptenal |
| CAS: 57266-86-1 Use(s): natural substances and extractives | |
| 3- | heptenal |
| CAS: 89896-73-1 Use(s): natural substances and extractives | |
| (E)-3- | heptenal |
| CAS: 21662-20-4 Use(s): natural substances and extractives | |
| (Z)-3- | heptenal |
| CAS: 21662-18-0 Use(s): natural substances and extractives | |
| 4- | heptenal |
| CAS: 62238-34-0 FEMA: 3289 Use(s): natural substances and extractives | |
| (E)-4- | heptenal |
| CAS: 929-22-6 EC: 213-198-0 FEMA: 3289 Use(s): natural substances and extractives | |
| (Z)-4- | heptenal diethyl acetal |
| CAS: 18492-65-4 EC: 242-376-0 FEMA: 3349 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
| (Z)-4- | heptenal |
| CAS: 6728-31-0 EC: 229-779-7 FEMA: 3289 JECFA: 320 FLAVIS: 05.085 Use(s): flavor and fragrance agents | |
| 4-oxo-2- | heptenal |
| CAS: 55764-42-6 Use(s): information only not used for fragrances or flavors | |
| 4- | heptenal diethyl acetal |
| CAS: 1192738-48-9 FEMA: 3349 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
| (E)-4- | heptenal diethyl acetal |
| CAS: 18492-66-5 JECFA: 949 FLAVIS: 06.037 Use(s): flavor and fragrance agents | |
| (E)- | heptene |
| CAS: 14686-14-7 EC: 238-728-8 Use(s): natural substances and extractives | |
| 2- | heptene |
| CAS: 592-77-8 Use(s): natural substances and extractives | |
| (E)-2- | heptene |
| CAS: 14686-13-6 EC: 238-727-2 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | heptene |
| CAS: 6443-92-1 EC: 229-242-7 Use(s): information only not used for fragrances or flavors | |
| 3- | heptene |
| CAS: 592-78-9 EC: 209-769-9 Use(s): natural substances and extractives | |
| 2- | heptenoic acid |
| CAS: 18999-28-5 EC: 242-738-8 FEMA: 3920 FLAVIS: 08.083 Use(s): flavoring agents | |
| (E)-2- | heptenoic acid |
| CAS: 10352-88-2 EC: 233-769-8 FEMA: 3920 JECFA: 1373 FLAVIS: 08.123 Use(s): flavoring agents | |
| (Z)-2- | heptenoic acid |
| CAS: 1577-31-7 Use(s): natural substances and extractives | |
| 3- | heptenoic acid |
| CAS: 29901-85-7 EC: 249-943-1 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | heptenoic acid |
| CAS: 28163-84-0 EC: 248-876-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | heptenoic acid |
| CAS: 68676-74-4 Use(s): natural substances and extractives | |
| 4- | heptenoic acid |
| CAS: 35194-37-7 Use(s): natural substances and extractives | |
| (E)-4- | heptenoic acid |
| CAS: 51193-78-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-4- | heptenoic acid |
| CAS: 41653-95-6 EC: 255-476-4 Use(s): natural substances and extractives | |
| 6- | heptenoic acid |
| CAS: 1119-60-4 EC: 214-283-5 Use(s): information only not used for fragrances or flavors | |
| 1- | hepten-4-ol |
| CAS: 3521-91-3 EC: 222-535-0 Use(s): flavor and fragrance agents | |
| 2- | hepten-1-ol |
| CAS: 22104-77-4 Use(s): flavor and fragrance agents | |
| 2- | hepten-4-ol |
| CAS: 4798-59-8 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hepten-1-ol |
| CAS: 33467-76-4 EC: 251-534-8 FLAVIS: 02.151 Use(s): flavor and fragrance agents | |
| (Z)-2- | hepten-1-ol |
| CAS: 55454-22-3 Use(s): flavor and fragrance agents | |
| 3- | hepten-1-ol |
| CAS: 10606-47-0 FLAVIS: 02.152 Use(s): flavoring agents | |
| (E)-3- | hepten-1-ol |
| CAS: 2108-05-6 EC: 218-292-5 Use(s): flavoring agents | |
| (Z)-3- | hepten-1-ol |
| CAS: 1708-81-2 EC: 216-964-2 Use(s): flavor and fragrance agents | |
| 4- | hepten-1-ol |
| CAS: 20851-55-2 Use(s): natural substances and extractives | |
| 4- | hepten-2-ol |
| CAS: 66642-85-1 Use(s): flavoring agents | |
| (E)-4- | hepten-1-ol |
| CAS: 24469-79-2 Use(s): flavor and fragrance agents | |
| (E)-4- | hepten-2-ol |
| CAS: 58927-81-4 EC: 261-500-4 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-1-ol |
| CAS: 6191-71-5 EC: 228-238-2 FEMA: 3841 JECFA: 1280 FLAVIS: 02.249 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-2-ol |
| CAS: 34146-55-9 EC: 251-851-1 FLAVIS: 02.255 Use(s): flavoring agents | |
| 6- | hepten-3-ol |
| CAS: 19781-77-2 Use(s): natural substances and extractives | |
| 1- | hepten-3-ol |
| CAS: 4938-52-7 EC: 225-579-9 FEMA: 4129 JECFA: 1842 FLAVIS: 02.155 Use(s): flavor and fragrance agents | |
| 1- | hepten-3-one |
| CAS: 2918-13-0 Use(s): natural substances and extractives | |
| 2- | hepten-4-one |
| CAS: 4643-25-8 EC: 225-070-1 FEMA: 3399 JECFA: 1126 FLAVIS: 07.104 Use(s): flavoring agents | |
| (E)-2- | hepten-4-one |
| CAS: 32397-56-1 Use(s): information only not used for fragrances or flavors | |
| 3- | hepten-2-one |
| CAS: 1119-44-4 EC: 214-278-8 FEMA: 3400 JECFA: 1127 FLAVIS: 07.105 Use(s): flavor and fragrance agents | |
| (E)-3- | hepten-2-one |
| CAS: 5609-09-6 Use(s): natural substances and extractives | |
| 4- | hepten-3-one |
| CAS: 762-40-3 Use(s): information only not used for fragrances or flavors | |
| (E)-4- | hepten-2-one |
| CAS: 24332-22-7 Use(s): natural substances and extractives | |
| (E)-4- | hepten-3-one |
| CAS: 65113-42-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-4- | hepten-2-one |
| CAS: 38397-37-4 Use(s): natural substances and extractives | |
| 5- | hepten-2-one |
| CAS: 6714-00-7 EC: 229-768-7 Use(s): natural substances and extractives | |
| (Z)-5- | hepten-2-one |
| CAS: 4535-61-9 Use(s): information only not used for fragrances or flavors | |
| 6- | hepten-1-yl 2-butenoate |
| Use(s): information only not used for fragrances or flavors | |
| 1- | heptenyl acetate |
| CAS: 35468-97-4 EC: 252-583-8 Use(s): natural substances and extractives | |
| 1- | hepten-3-yl acetate |
| CAS: 35926-06-8 Use(s): natural substances and extractives | |
| 2- | hepten-1-yl acetate |
| CAS: 1576-79-0 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hepten-1-yl acetate |
| CAS: 16939-73-4 EC: 241-002-3 FEMA: 4125 JECFA: 1798 FLAVIS: 09.385 Use(s): flavor and fragrance agents | |
| 3- | heptenyl acetate |
| CAS: 34942-91-1 Use(s): natural substances and extractives | |
| (E)-3- | hepten-1-yl acetate |
| CAS: 1576-77-8 EC: 216-411-5 FEMA: 3493 JECFA: 135 FLAVIS: 09.275 Use(s): flavor and fragrance agents | |
| (Z)-3- | hepten-1-yl acetate |
| CAS: 1576-78-9 EC: 216-412-0 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-2-yl acetate |
| CAS: 94088-33-2 EC: 302-032-3 FLAVIS: 09.386 Use(s): flavoring agents | |
| (E)-3- | hepten-1-yl isobutyrate |
| CAS: 207801-32-9 FEMA: 3494 JECFA: 191 FLAVIS: 09.528 Use(s): flavor and fragrance agents | |
| 3- | heptenyl isobutyrate |
| CAS: 67801-45-0 EC: 267-166-6 FEMA: 3494 Use(s): flavor and fragrance agents | |
| (Z)-4- | hepten-2-yl butyrate |
| CAS: 94088-12-7 EC: 302-009-8 FLAVIS: 09.880 Use(s): flavoring agents | |
| 5-(6- | hepten-1-yl)dihydro-2(3H)-furanone |
| CAS: 854737-08-9 Use(s): fragrance agents | |
| 6- | heptenyl isothiocyanate |
| CAS: 49776-82-1 Use(s): natural substances and extractives | |
| (E)-2- | hepten-1-yl isovalerate |
| CAS: 94109-97-4 EC: 302-537-9 FEMA: 4126 Use(s): flavor and fragrance agents | |
| 2- | hepten-1-yl isovalerate |
| CAS: 253596-70-2 FEMA: 4126 JECFA: 1799 FLAVIS: 09.303 Use(s): flavor and fragrance agents | |
| heptyl acetate | |
| CAS: 112-06-1 EC: 203-932-8 FEMA: 2547 JECFA: 129 FLAVIS: 09.022 Use(s): flavor and fragrance agents | |
| 3- | heptyl acetate |
| CAS: 5921-83-5 FEMA: 3980 JECFA: 1143 FLAVIS: 09.924 Use(s): flavoring agents | |
| iso | heptyl acetate |
| CAS: 180348-60-1 FEMA: 4346 Use(s): flavoring agents | |
| sec- | heptyl acetate |
| CAS: 5921-82-4 EC: 227-647-3 FLAVIS: 09.388 Use(s): flavor and fragrance agents | |
| heptyl acetoacetate | |
| CAS: 42598-96-9 EC: 255-906-0 Use(s): information only not used for fragrances or flavors | |
| heptyl amine | |
| CAS: 111-68-2 EC: 203-895-8 Use(s): information only not used for fragrances or flavors | |
| heptyl benzoate | |
| CAS: 7155-12-6 EC: 230-511-6 Use(s): flavor and fragrance agents | |
| 2- | heptyl benzothiazole |
| CAS: 69938-51-8 Use(s): natural substances and extractives | |
| heptyl butyrate | |
| CAS: 5870-93-9 EC: 227-526-5 FEMA: 2549 JECFA: 154 FLAVIS: 09.166 Use(s): flavor and fragrance agents | |
| 2- | heptyl butyrate |
| CAS: 39026-94-3 FEMA: 3981 JECFA: 1144 FLAVIS: 09.923 Use(s): flavor and fragrance agents | |
| heptyl isobutyrate | |
| CAS: 2349-13-5 EC: 219-076-3 FEMA: 2550 JECFA: 190 FLAVIS: 09.420 Use(s): flavor and fragrance agents | |
| alpha- | heptyl cinnamaldehyde |
| CAS: 20175-19-3 Use(s): information only not used for fragrances or flavors | |
| heptyl cinnamate | |
| CAS: 10032-08-3 FEMA: 2551 JECFA: 666 FLAVIS: 09.782 Use(s): flavor and fragrance agents | |
| heptyl crotonate | |
| CAS: 16930-99-7 EC: 240-999-2 Use(s): flavoring agents | |
| heptyl (E)-crotonate | |
| CAS: 83783-78-2 EC: 280-812-1 Use(s): flavoring agents | |
| (E)-2- | heptyl cyclopropane carboxylic acid |
| CAS: 697290-77-0 FEMA: 4130 Use(s): flavoring agents | |
| 2- | heptyl cyclopropane carboxylic acid |
| CAS: 1225070-56-3 FEMA: 4130 JECFA: 1907 Use(s): flavoring agents | |
| (Z)-2- | heptyl cyclopropane carboxylic acid |
| CAS: 697290-76-9 FLAVIS: 08.131 Use(s): flavoring agents | |
| heptyl decanoate | |
| CAS: 60160-17-0 EC: 262-089-4 Use(s): flavor and fragrance agents | |
| 3- | heptyl dihydro-5-methyl-2(3H)-furanone |
| CAS: 40923-64-6 EC: 255-141-2 FEMA: 3350 JECFA: 244 FLAVIS: 10.026 Use(s): flavor and fragrance agents | |
| 2- | heptyl-4,5-dimethyl thiazole |
| CAS: 87262-50-8 Use(s): natural substances and extractives | |
| heptyl formate | |
| CAS: 112-23-2 EC: 203-949-0 FEMA: 2552 JECFA: 121 FLAVIS: 09.074 Use(s): flavor and fragrance agents | |
| 2- | heptyl furan |
| CAS: 3777-71-7 EC: 223-236-8 FEMA: 3401 JECFA: 1492 FLAVIS: 13.069 Use(s): flavor and fragrance agents | |
| heptyl heptanoate | |
| CAS: 624-09-9 EC: 210-828-6 FEMA: 4341 JECFA: 1875 Use(s): flavor and fragrance agents | |
| heptyl hexanoate | |
| CAS: 6976-72-3 EC: 230-239-8 FLAVIS: 09.390 Use(s): flavor and fragrance agents | |
| sec- | heptyl hexanoate |
| CAS: 6624-58-4 EC: 229-582-6 FLAVIS: 09.391 Use(s): flavoring agents | |
| sec- | heptyl isovalerate |
| CAS: 238757-71-6 FLAVIS: 09.304 Use(s): flavoring agents | |
| heptyl mercaptan | |
| CAS: 1639-09-4 EC: 216-678-8 FEMA: 4259 JECFA: 1663 FLAVIS: 12.130 Use(s): flavoring agents | |
| heptyl 2-methyl butyrate | |
| CAS: 50862-12-9 EC: 256-811-7 FLAVIS: 09.387 Use(s): flavoring agents | |
| heptyl 2-methyl pentanoate | |
| CAS: 6640-74-0 Use(s): natural substances and extractives | |
| heptyl 4-methyl pentanoate | |
| CAS: 35852-52-9 Use(s): natural substances and extractives | |
| heptyl methyl sulfide | |
| CAS: 20291-61-6 Use(s): information only not used for fragrances or flavors | |
| heptyl nonanoate | |
| CAS: 71605-85-1 EC: 275-665-5 Use(s): flavor and fragrance agents | |
| heptyl octanoate | |
| CAS: 4265-97-8 EC: 224-252-8 FEMA: 2553 JECFA: 176 FLAVIS: 09.118 Use(s): flavor and fragrance agents | |
| heptyl oleate | |
| CAS: 42254-63-7 EC: 255-738-8 Use(s): information only not used for fragrances or flavors | |
| heptyl palmitate | |
| CAS: 26718-83-2 EC: 247-915-3 Use(s): information only not used for fragrances or flavors | |
| heptyl paraben | |
| CAS: 1085-12-7 EC: 214-115-0 Use(s): inhibit microbiological spoilage | |
| 2- | heptyl phenol |
| CAS: 5284-22-0 Use(s): information only not used for fragrances or flavors | |
| 4- | heptyl phenol |
| CAS: 1987-50-4 EC: 217-862-0 Use(s): information only not used for fragrances or flavors | |
| heptyl phenyl acetate | |
| CAS: 39736-25-9 EC: 254-609-3 Use(s): information only not used for fragrances or flavors | |
| heptyl propionate | |
| CAS: 2216-81-1 EC: 218-698-2 Use(s): flavor and fragrance agents | |
| 2- | heptyl pyridine |
| CAS: 20815-27-4 EC: 244-056-6 Use(s): information only not used for fragrances or flavors | |
| 6- | heptyl-alpha-pyrone |
| Use(s): natural substances and extractives | |
| heptyl resorcinol | |
| CAS: 18979-65-2 Use(s): information only not used for fragrances or flavors | |
| heptyl salicylate | |
| CAS: 6259-77-4 EC: 228-409-1 Use(s): flavor and fragrance agents | |
| heptyl stearate | |
| CAS: 24466-84-0 EC: 246-277-3 Use(s): information only not used for fragrances or flavors | |
| 2- | heptyl tetrahydrofuran |
| CAS: 2435-16-7 EC: 219-423-9 Use(s): fragrance agents | |
| 2- | heptyl thiazolidine |
| CAS: 706-19-4 Use(s): natural substances and extractives | |
| heptyl isothiocyanate | |
| CAS: 4426-83-9 EC: 224-610-3 Use(s): flavoring agents | |
| 2- | heptyl thiophene |
| CAS: 18794-78-0 EC: 242-581-5 Use(s): natural substances and extractives | |
| 3- | heptyl thiophene |
| CAS: 65016-61-7 Use(s): flavoring agents | |
| heptyl undecylenate | |
| CAS: 68141-27-5 EC: 268-850-7 Use(s): cosmetic and fragrance agents | |
| heptyl valerate | |
| CAS: 5451-80-9 EC: 226-686-3 Use(s): fragrance agents | |
| heptyl isovalerate | |
| CAS: 56423-43-9 EC: 260-170-9 FLAVIS: 09.392 Use(s): flavor and fragrance agents | |
| N- | heptylaminoundecanoic acid |
| CAS: 68564-88-5 EC: 271-487-7 Use(s): indirect food additives: adhesives and components of coatings | |
| heptylene oxide | |
| CAS: 5063-65-0 Use(s): information only not used for fragrances or flavors | |
| 2- | heptylidene cyclopentanone |
| CAS: 39189-74-7 EC: 254-339-6 Use(s): fragrance agents | |
| heptylidene diacetate | |
| CAS: 56438-09-6 EC: 260-182-4 Use(s): fragrance agents | |
| 1- | heptyne |
| CAS: 628-71-7 EC: 211-051-5 Use(s): natural substances and extractives | |
| heraclenin | |
| CAS: 2880-49-1 Use(s): natural substances and extractives | |
| heraclenol | |
| CAS: 31575-93-6 Use(s): natural substances and extractives | |
| herbacetin | |
| CAS: 527-95-7 Use(s): natural food | |
| herbal acetal | |
| CAS: 54546-26-8 EC: 259-210-8 Use(s): fragrance agents | |
| herbal carbonate | |
| CAS: 61699-38-5 EC: 262-912-7 Use(s): fragrance agents | |
| herbal carene | |
| CAS: 3608-11-5 EC: 222-771-4 Use(s): fragrance agents | |
| herbal cyclohexane | |
| CAS: 67583-77-1 EC: 266-722-5 Use(s): fragrance agents | |
| cis- | herbal cyclohexane |
| CAS: 24691-15-4 EC: 246-415-2 Use(s): fragrance agents | |
| trans- | herbal cyclohexane |
| CAS: 24691-17-6 EC: 246-417-3 Use(s): fragrance agents | |
| herbal cyclohexane acetyl anthranilate | |
| CAS: 73486-91-6 EC: 277-478-4 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane butyrate | |
| CAS: 94200-12-1 EC: 303-489-1 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane dipropylene glycol | |
| CAS: 73987-16-3 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane formate | |
| CAS: 24442-68-0 EC: 246-250-6 Use(s): information only not used for fragrances or flavors | |
| herbal cyclohexane phenyl acetate | |
| CAS: 67859-97-6 EC: 267-431-6 Use(s): information only not used for fragrances or flavors | |
| herbal dioxane | |
| CAS: 3583-00-4 EC: 222-709-6 Use(s): fragrance agents | |
| herbal ethanone | |
| CAS: 42370-07-0 EC: 255-779-1 Use(s): fragrance agents | |
| herbal heptane | |
| CAS: 122795-41-9 EC: 403-610-9 Use(s): fragrance agents | |
| herbal ketone | |
| CAS: 67801-33-6 EC: 267-154-0 Use(s): fragrance agents | |
| herbal norbornane | |
| CAS: 66062-78-0 EC: 266-095-8 Use(s): fragrance agents | |
| herbal pyran | |
| CAS: 18871-14-2 EC: 242-640-5 Use(s): fragrance agents | |
| herbal undecane | |
| CAS: 6413-26-9 EC: 229-115-6 Use(s): fragrance agents | |
| herbal undecanol | |
| CAS: 68228-06-8 EC: 269-401-8 Use(s): fragrance agents | |
| herbal undecanone | |
| CAS: 41724-19-0 EC: 255-517-6 Use(s): fragrance agents | |
| herbanate (Givaudan) | |
| CAS: 116126-82-0 Use(s): fragrance agents | |
| herbane | |
| CAS: 5421-99-8 EC: 226-544-0 Use(s): information only not used for fragrances or flavors | |
| herbarin | |
| CAS: 36379-67-6 Use(s): natural substances and extractives | |
| herboxidiene | |
| CAS: 142861-00-5 Use(s): information only not used for fragrances or flavors | |
| (E)- | herclavine |
| CAS: 539-18-4 Use(s): natural substances and extractives | |
| hericene A | |
| CAS: 157207-54-0 Use(s): natural substances and extractives | |
| hericene B | |
| CAS: 157207-55-1 Use(s): natural substances and extractives | |
| hericene C | |
| CAS: 157207-56-2 Use(s): natural substances and extractives | |
| hericenone A | |
| CAS: 126654-52-2 Use(s): natural substances and extractives | |
| hericenone B | |
| CAS: 126654-53-3 Use(s): natural substances and extractives | |
| hericenone C | |
| CAS: 137592-03-1 Use(s): natural substances and extractives | |
| hericenone D | |
| CAS: 137592-04-2 Use(s): natural substances and extractives | |
| hericenone E | |
| CAS: 137592-05-3 Use(s): natural substances and extractives | |
| hericenone F | |
| CAS: 141996-36-3 Use(s): natural substances and extractives | |
| hericenone G | |
| CAS: 141973-36-6 Use(s): natural substances and extractives | |
| hericenone H | |
| CAS: 141973-37-7 Use(s): natural substances and extractives | |
| hericerin | |
| CAS: 140381-53-9 Use(s): natural substances and extractives | |
| herierin III | |
| CAS: 131123-56-3 Use(s): natural substances and extractives | |
| heritonin | |
| CAS: 123914-48-7 Use(s): natural substances and extractives | |
| hernandulcin | |
| CAS: 95602-94-1 Use(s): natural substances and extractives | |
| (±)-epi | hernandulcin |
| CAS: 95672-95-0 Use(s): natural substances and extractives | |
| hesperaline | |
| CAS: 15797-38-3 Use(s): natural substances and extractives | |
| hesperetin | |
| CAS: 520-33-2 EC: 208-290-2 JECFA: 2024 FLAVIS: 16.097 Use(s): cosmetic and flavor agents | |
| (R,S)- | hesperetin |
| CAS: 69097-99-0 FEMA: 4313 Use(s): flavoring agents | |
| hesperetin dihydrochalcone | |
| CAS: 35400-60-3 FEMA: 4872 Use(s): flavoring agents | |
| hesperidin | |
| CAS: 520-26-3 EC: 208-288-1 Use(s): cosmetic and flavor agents | |
| (R)- | hesperidin |
| CAS: 369593-42-0 Use(s): natural substances and extractives | |
| neo | hesperidin |
| CAS: 13241-33-3 EC: 236-216-9 Use(s): natural substances and extractives | |
| neo | hesperidin dihydrochalcone |
| CAS: 20702-77-6 EC: 243-978-6 FEMA: 3811 FLAVIS: 16.061 Use(s): cosmetic and flavor agents | |
| neo | hesperidose |
| CAS: 17074-02-1 EC: 241-133-6 Use(s): information only not used for fragrances or flavors | |
| neo | hesperidose heptaacetate |
| CAS: 19949-47-4 Use(s): information only not used for fragrances or flavors | |
| heteroartonin A | |
| CAS: 170894-23-2 Use(s): natural substances and extractives | |
| heterobetulin | |
| CAS: 74715-49-4 Use(s): natural substances and extractives | |
| heterodendrin | |
| CAS: 66465-22-3 Use(s): natural substances and extractives | |
| epi | heterodendrin |
| CAS: 57103-47-6 Use(s): natural substances and extractives | |
| heteroflavanone A | |
| CAS: 151171-28-7 Use(s): natural substances and extractives | |
| heteroflavanone B | |
| CAS: 151171-29-8 Use(s): natural substances and extractives | |
| heteroflavanone C | |
| CAS: 156127-36-5 Use(s): natural substances and extractives | |
| heteronemin | |
| CAS: 62008-04-2 Use(s): natural substances and extractives | |
| heterophylliin A | |
| CAS: 87687-52-3 Use(s): natural substances and extractives | |
| heterophylol | |
| CAS: 152841-81-1 Use(s): natural substances and extractives | |
| hexacosanal | |
| CAS: 26627-85-0 Use(s): natural substances and extractives | |
| hexacosane | |
| CAS: 630-01-3 EC: 211-124-1 Use(s): natural substances and extractives | |
| 1,26- | hexacosanediol |
| CAS: 15541-01-2 Use(s): natural substances and extractives | |
| 1- | hexacosanol |
| CAS: 506-52-5 EC: 208-044-4 Use(s): flavor and fragrance agents | |
| 1- | hexacosene |
| CAS: 18835-33-1 EC: 242-615-9 Use(s): natural substances and extractives | |
| (Z,Z)-11,13- | hexadecadienal |
| CAS: 71317-73-2 Use(s): natural substances and extractives | |
| 7,10- | hexadecadienoic acid |
| CAS: 2936-83-6 Use(s): natural substances and extractives | |
| (E,E)-10,12- | hexadecadien-1-ol |
| CAS: 765-19-5 Use(s): natural substances and extractives | |
| (E,Z)-10,12- | hexadecadien-1-ol |
| CAS: 1002-94-4 Use(s): natural substances and extractives | |
| (Z,E)-10,12- | hexadecadien-1-ol |
| CAS: 765-17-3 Use(s): natural substances and extractives | |
| (Z,Z)-11,13- | hexadecadien-1-ol |
| CAS: 71720-83-7 Use(s): natural substances and extractives | |
| (Z,Z)/(Z,E)-7-11- | hexadecadien-1-yl acetate |
| CAS: 50933-33-0 EC: 256-857-8 Use(s): natural substances and extractives | |
| hexadecanal | |
| CAS: 629-80-1 EC: 211-111-0 FLAVIS: 05.152 Use(s): natural substances and extractives | |
| iso | hexadecanal |
| CAS: 62028-96-0 EC: 263-377-2 Use(s): natural substances and extractives | |
| hexadecanal diethyl acetal | |
| CAS: 761-60-4 Use(s): information only not used for fragrances or flavors | |
| hexadecanal dimethyl acetal | |
| CAS: 2791-29-9 Use(s): information only not used for fragrances or flavors | |
| hexadecane | |
| CAS: 544-76-3 EC: 208-878-9 FLAVIS: 01.072 Use(s): fragrance agents | |
| hexadecane dioic acid | |
| CAS: 505-54-4 EC: 208-013-5 Use(s): natural substances and extractives | |
| iso | hexadecanoic acid |
| CAS: 32844-67-0 EC: 251-256-7 Use(s): information only not used for fragrances or flavors | |
| 3-oxo | hexadecanoic acid glyceride (palm oil glycerides mono- and di- hydrogenated) |
| CAS: 91052-71-0 EC: 293-233-4 FEMA: 3769 JECFA: 917 FLAVIS: 09.554 Use(s): emulsifiers, flavoring agents | |
| 3-oxo | hexadecanoic acid glyceride |
| CAS: 128331-46-4 Use(s): emulsifiers, flavoring agents | |
| hexadecanol | |
| CAS: 36653-82-4 EC: 253-149-0 FEMA: 2554 JECFA: 114 FLAVIS: 02.009 Use(s): cosmetic, flavor and fragrance agents | |
| 2- | hexadecanol |
| CAS: 14852-31-4 EC: 238-917-5 Use(s): flavor and fragrance agents | |
| 15- | hexadecanolide |
| CAS: 69297-56-9 Use(s): natural substances and extractives | |
| 2- | hexadecanone |
| CAS: 18787-63-8 EC: 242-571-0 Use(s): natural substances and extractives | |
| 3- | hexadecanone |
| CAS: 18787-64-9 EC: 242-572-6 Use(s): natural substances and extractives | |
| 4- | hexadecanone |
| CAS: 18787-65-0 Use(s): information only not used for fragrances or flavors | |
| 5- | hexadecanone |
| CAS: 41903-81-5 EC: 255-583-6 Use(s): information only not used for fragrances or flavors | |
| 6- | hexadecanone |
| CAS: 57661-23-1 EC: 260-885-6 Use(s): information only not used for fragrances or flavors | |
| 7- | hexadecanone |
| CAS: 45206-91-5 EC: 256-205-2 Use(s): information only not used for fragrances or flavors | |
| 8- | hexadecanone |
| CAS: 18277-02-6 Use(s): information only not used for fragrances or flavors | |
| hexadecanophenone | |
| CAS: 6697-12-7 Use(s): information only not used for fragrances or flavors | |
| N- | hexadecanoylpyrrolidine |
| CAS: 70974-48-0 Use(s): natural substances and extractives | |
| (Z,Z,Z)-7,10,13- | hexadecatrienal |
| CAS: 56797-43-4 Use(s): natural substances and extractives | |
| (E)-11- | hexadecenal |
| CAS: 57491-33-5 EC: 260-765-3 Use(s): natural substances and extractives | |
| (E)-2- | hexadecenal |
| CAS: 22644-96-8 Use(s): natural substances and extractives | |
| (Z)-7- | hexadecenal |
| CAS: 56797-40-1 Use(s): natural substances and extractives | |
| (Z)-9- | hexadecenal |
| CAS: 56219-04-6 EC: 260-064-2 Use(s): natural substances and extractives | |
| (Z)-11- | hexadecenal |
| CAS: 53939-28-9 EC: 258-876-7 Use(s): natural substances and extractives | |
| hexadecene | |
| CAS: 26952-14-7 EC: 248-131-4 Use(s): solvents | |
| 1- | hexadecene |
| CAS: 629-73-2 EC: 211-105-8 Use(s): natural substances and extractives | |
| 2- | hexadecene |
| CAS: 26741-29-7 Use(s): natural substances and extractives | |
| 5- | hexadecene |
| CAS: 53137-47-6 Use(s): natural substances and extractives | |
| 7- | hexadecene |
| CAS: 18899-19-9 Use(s): natural substances and extractives | |
| iso | hexadecene |
| CAS: 85909-49-5 EC: 288-853-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-7- | hexadecene dioic acid |
| CAS: 253687-18-2 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexadecenoic acid |
| CAS: 629-56-1 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexadecenoic acid |
| CAS: 28039-99-8 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexadecenoic acid |
| CAS: 2457-70-7 Use(s): information only not used for fragrances or flavors | |
| cis-6- | hexadecenoic acid |
| CAS: 17004-51-2 Use(s): emollients, skin conditioning | |
| trans-6- | hexadecenoic acid |
| CAS: 28290-76-8 Use(s): natural substances and extractives | |
| (Z)-7- | hexadecenoic acid |
| CAS: 2416-19-5 Use(s): natural substances and extractives | |
| (E)-9- | hexadecenoic acid |
| CAS: 10030-73-6 Use(s): information only not used for fragrances or flavors | |
| (Z)-9- | hexadecenoic acid |
| CAS: 373-49-9 EC: 206-765-9 Use(s): indirect food additives: adhesives and components of coatings | |
| (E)-11- | hexadecenoic acid |
| CAS: 2271-34-3 Use(s): natural substances and extractives | |
| (Z)-11- | hexadecenoic acid |
| CAS: 2416-20-8 Use(s): natural substances and extractives | |
| 15- | hexadecenoic acid |
| CAS: 4675-57-4 Use(s): information only not used for fragrances or flavors | |
| (E)-11- | hexadecen-1-ol |
| CAS: 61301-56-2 EC: 262-704-6 Use(s): information only not used for fragrances or flavors | |
| (Z)-11- | hexadecen-1-ol |
| CAS: 56683-54-6 EC: 260-337-6 Use(s): natural substances and extractives | |
| (E)-11- | hexadecen-1-yl acetate |
| CAS: 56218-72-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-11- | hexadecen-1-yl acetate |
| CAS: 34010-21-4 EC: 251-791-6 Use(s): natural substances and extractives | |
| hexadecyl 5-methyl-2-furoate | |
| CAS: 1687726-81-3 Use(s): information only not used for fragrances or flavors | |
| hexadecyl ferulate | |
| CAS: 64190-80-3 Use(s): natural substances and extractives | |
| hexadecyl hexadecenoate | |
| CAS: 71788-99-3 EC: 276-019-5 Use(s): natural substances and extractives | |
| hexadecyl neodecanoate | |
| CAS: 67749-11-5 Use(s): information only not used for fragrances or flavors | |
| 1- | hexadecyne |
| CAS: 629-74-3 EC: 211-106-3 Use(s): natural substances and extractives | |
| 1,5- | hexadien-3-ol |
| CAS: 924-41-4 EC: 213-102-7 Use(s): natural substances and extractives | |
| 2,4- | hexadienal |
| CAS: 80466-34-8 Use(s): flavoring agents | |
| (E,E)-2,4- | hexadienal |
| CAS: 142-83-6 EC: 205-564-3 FEMA: 3429 JECFA: 1175 FLAVIS: 05.057 Use(s): cosmetic and flavor agents | |
| (E,Z)-2,4- | hexadienal |
| CAS: 53398-76-8 Use(s): natural substances and extractives | |
| hexadienal diethyl acetal | |
| CAS: 27310-22-1 EC: 248-392-4 Use(s): fragrance agents | |
| (E)-1,3- | hexadiene |
| CAS: 20237-34-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-1,3- | hexadiene |
| CAS: 14596-92-0 Use(s): natural substances and extractives | |
| (E)-1,4- | hexadiene |
| CAS: 7319-00-8 Use(s): natural substances and extractives | |
| (Z)-1,4- | hexadiene |
| CAS: 7318-67-4 EC: 230-783-6 Use(s): information only not used for fragrances or flavors | |
| 2,4- | hexadien-1-ol |
| CAS: 111-28-4 EC: 203-853-9 FEMA: 3922 JECFA: 1174 FLAVIS: 02.162 Use(s): flavoring agents and cosmetic fragrance agents | |
| (E,E)-2,4- | hexadien-1-ol |
| CAS: 17102-64-6 EC: 241-173-4 Use(s): flavoring agents | |
| (E)-2-(3,5- | hexadienyl)-5-methyl furan |
| CAS: 5159-44-4 EC: 225-934-8 Use(s): information only not used for fragrances or flavors | |
| hexadienylidene acetone | |
| CAS: 17609-32-4 Use(s): information only not used for fragrances or flavors | |
| 1,5- | hexadiyne |
| CAS: 628-16-0 EC: 211-029-5 Use(s): natural substances and extractives | |
| 2-(2,4- | hexadiynylidene)-1,6-dioxaspiro(4.4)non-3-ene |
| CAS: 16863-61-9 EC: 240-885-2 Use(s): natural substances and extractives | |
| (E)-2-(2,4- | hexadiynylidene)-1,6-dioxaspiro[4.5]dec-3-ene |
| CAS: 3306-40-9 Use(s): natural substances and extractives | |
| hexafluoropropene | |
| CAS: 116-15-4 EC: 204-127-4 Use(s): indirect food additives: adhesives and components of coatings | |
| 2,3,5,6,8,8a- | hexahydro-2,5,5,8a-tetramethyl-7H-1-benzopyran-7-one |
| CAS: 20194-67-6 Use(s): natural substances and extractives | |
| hexahydro-2',4-dimethylspiro[1,3-dithiolo[4,5-c]furan-2,3'(2'H)-furan] | |
| CAS: 38325-26-7 EC: 253-885-2 Use(s): information only not used for fragrances or flavors | |
| 4,4a,5,6,7,8- | hexahydro-4a,8-dimethyl naphthalen-2(3H)-one |
| CAS: 4071-63-0 EC: 223-782-7 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-5-methyl-7H-cyclopenta[b]pyridin-7-one |
| CAS: 104704-29-2 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-6-methyl-7H-cyclopenta[b]pyridin-7-one |
| CAS: 104704-38-3 Use(s): information only not used for fragrances or flavors | |
| hexahydro-6,7-dihydroxy-5-(hydroxymethyl)-3-(2-hydroxyphenyl)-2H-pyrano[2,3-d]oxazol-2-one | |
| CAS: 396714-67-3 Use(s): natural substances and extractives | |
| 2,3,4,5,6,7- | hexahydro-7-methylcyclopent[b]azepin-8(1H)-one |
| CAS: 97826-66-9 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-7H-cyclopenta[b]pyridin-7-one |
| CAS: 104704-30-5 Use(s): information only not used for fragrances or flavors | |
| hexahydrobenzofuranone | |
| CAS: 6051-03-2 EC: 227-955-8 Use(s): flavor and fragrance agents | |
| hexahydrocoumarin | |
| CAS: 700-82-3 EC: 211-851-4 Use(s): information only not used for fragrances or flavors | |
| 2,3,4,5,6,7- | hexahydrocyclopent[b]azepin-8(1H)-one |
| CAS: 81978-77-0 Use(s): information only not used for fragrances or flavors | |
| 3a,4,5,6,7,7a- | hexahydrodimethyl-4,7-methano-1H-inden-5-ol |
| CAS: 79771-15-6 Use(s): fragrance agents | |
| 3',6- | hexahydrodimethyl spiromethanonaphthalene oxirane |
| CAS: 41723-98-2 EC: 255-515-5 Use(s): fragrance agents | |
| hexahydrofarnesol | |
| CAS: 6750-34-1 Use(s): flavor and fragrance agents | |
| hexahydrofarnesyl acetone | |
| CAS: 502-69-2 EC: 207-950-7 FLAVIS: 07.205 Use(s): flavor and fragrance agents | |
| 3a,5,6,7,8,8b- | hexahydro-2,2,6,6,7,8,8-heptamethyl-4H-indeno(4,5-d)-1,3-dioxole |
| CAS: 823178-41-2 Use(s): fragrance agents | |
| 3a,3b,5,6,7,8a- | hexahydro-2,2,3a,3b,7,7-hexamethyl-4H-indeno[1,2-D]-1,3-dioxole |
| Use(s): fragrance agents | |
| hexahydro-beta-ionone methyl derivative | |
| CAS: 69834-09-9 EC: 274-138-7 Use(s): information only not used for fragrances or flavors | |
| (15Z,9'Z)-7,7',8,8',11,12- | hexahydrolycopene |
| CAS: 72746-34-0 Use(s): natural substances and extractives | |
| hexahydromethanoinden-5-yl pivalate | |
| CAS: 68039-45-2 EC: 268-261-5 Use(s): fragrance agents | |
| hexahydromethanoinden-5-yl propionate | |
| CAS: 67634-24-6 EC: 266-829-7 Use(s): fragrance agents | |
| ((3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-5(or 6)-yl)oxy) acetaldehyde |
| CAS: 94248-38-1 EC: 304-309-4 Use(s): fragrance agents | |
| hexahydromethanoinden-6-ol | |
| CAS: 3385-61-3 EC: 222-197-4 Use(s): fragrance agents | |
| hexahydromethanoinden-6-yl isopentenol | |
| CAS: 126646-06-8 Use(s): fragrance agents | |
| ((3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-6-yl)oxy) acetaldehyde |
| CAS: 72927-85-6 Use(s): fragrance agents | |
| hexahydromethanoindene | |
| CAS: 4488-57-7 EC: 224-778-8 Use(s): fragrance agents | |
| 3a,4,5,6,7,7a- | hexahydro-,4,7-methano-1H-indenecarboxaldehyde reaction products with Me Et ketone, acid-isomerized, reduced |
| CAS: 727414-17-7 Use(s): fragrance agents | |
| hexahydromethanoindene-5-ylidene-2-butanol | |
| CAS: 105304-56-1 Use(s): fragrance agents | |
| hexahydromethanoindenyl formate | |
| CAS: 68683-22-7 EC: 272-067-6 Use(s): fragrance agents | |
| hexahydromethanoindenyl isobutyrate | |
| CAS: 93941-73-2 EC: 300-522-1 Use(s): fragrance agents | |
| 4,4a,6,7,8,8a- | hexahydro-1,4-methanonaphthalen-5(1H)-one |
| CAS: 51519-65-4 EC: 257-251-6 Use(s): fragrance agents | |
| hexahydromethoxymethanoindenes | |
| CAS: 27135-90-6 EC: 248-247-5 Use(s): fragrance agents | |
| 3- | hexahydromethyl methylene methanohinden-6-yl acetate |
| CAS: 81836-13-7 EC: 279-836-5 Use(s): fragrance agents | |
| 1,2,3,4,5,8- | hexahydronaphthalene |
| CAS: 36231-13-7 Use(s): information only not used for fragrances or flavors | |
| 2,3,4,5,6,7- | hexahydro-1,1,2,3,3-pentamethyl-1H-indene |
| CAS: 33704-59-5 EC: 251-647-2 Use(s): information only not used for fragrances or flavors | |
| 5,5a,6,7,8,8a- | hexahydro-6,6,7,8,8-pentamethyl-4H-indeno[5,4-D]isoxazole |
| Use(s): information only not used for fragrances or flavors | |
| (cis+trans)-6,6a,7,8,9,9a- | hexahydro-7,7,8,9,9-pentamethyl-5H-cyclopenta[H]quinazoline |
| Use(s): fragrance agents | |
| hexahydrophthalic anhydride | |
| CAS: 85-42-7 EC: 201-622-7 Use(s): information only not used for fragrances or flavors | |
| hexahydrotetramethyl epoxymethanoazulene | |
| CAS: 67710-71-8 EC: 266-961-5 Use(s): fragrance agents | |
| hexahydrotetramethyl methanoazulen-5-yl methyl ketone | |
| CAS: 68039-35-0 EC: 268-253-1 Use(s): fragrance agents | |
| hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-6(5H)-one | |
| CAS: 67952-58-3 EC: 267-912-0 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexahydro-1,1,5,5-tetramethyl-7H-2,4a-methanonaphthalen-7-one |
| CAS: 23747-14-0 EC: 245-859-4 Use(s): information only not used for fragrances or flavors | |
| 1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl acetate |
| CAS: 32213-88-0 EC: 250-955-4 Use(s): information only not used for fragrances or flavors | |
| 1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-7-yl formate |
| CAS: 67874-82-2 EC: 267-511-0 Use(s): information only not used for fragrances or flavors | |
| hexahydrotetramethyl methanonaphthalen-8-one | |
| CAS: 29461-13-0 EC: 249-648-8 Use(s): fragrance agents | |
| (2S)-1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalene-8-carbaldehyde |
| CAS: 61826-54-8 EC: 263-252-2 Use(s): information only not used for fragrances or flavors | |
| hexahydrotetramethyl methanonaphthalene-8-methanol | |
| CAS: 61826-53-7 EC: 263-251-7 Use(s): fragrance agents | |
| hexahydrotetramethyl methanonaphthalene-8-methyl acetate | |
| CAS: 61826-56-0 EC: 263-253-8 Use(s): fragrance agents | |
| hexahydrotetramethyl methanonaphthalene-8-methyl formate | |
| CAS: 61826-52-6 EC: 263-250-1 Use(s): fragrance agents | |
| hexahydro-1',1',5',5'-tetramethyl-spiro(1,3-dioxolane-2,8'(5'H)-(2H-2,4a)methanonaphthalene) | |
| CAS: 154171-76-3 EC: 415-460-1 Use(s): fragrance agents | |
| 1-(1,3,4,5,6,7- | hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalen-8-yl) ethan-1-one |
| CAS: 59056-71-2 EC: 261-583-7 Use(s): information only not used for fragrances or flavors | |
| hexahydrotrimethyl ethanonaphthalen-8-yl methyl ketone | |
| CAS: 32388-56-0 EC: 251-021-9 Use(s): fragrance agents | |
| 1-(2,3,3a,4,5,6- | hexahydro-1,1,3-trimethyl-1H-inden-5-yl) ethan-1-one |
| CAS: 77628-62-7 EC: 278-734-8 Use(s): information only not used for fragrances or flavors | |
| 3,4- | hexahydroxydiphenoylarabinose |
| CAS: 19833-16-0 Use(s): natural substances and extractives | |
| 3,3',4',5,5',8- | hexahydroxyflavone |
| CAS: 90332-28-8 Use(s): natural substances and extractives | |
| delta- | hexalactone |
| CAS: 823-22-3 EC: 212-511-8 FEMA: 3167 JECFA: 224 FLAVIS: 10.010 Use(s): flavor and fragrance agents | |
| (R)-delta- | hexalactone |
| CAS: 43112-32-9 Use(s): information only not used for fragrances or flavors | |
| (S)-delta- | hexalactone |
| CAS: 16320-13-1 Use(s): information only not used for fragrances or flavors | |
| gamma- | hexalactone |
| CAS: 695-06-7 EC: 211-778-8 FEMA: 2556 JECFA: 223 FLAVIS: 10.021 Use(s): flavor and fragrance agents | |
| (R)-gamma- | hexalactone |
| CAS: 63357-95-9 Use(s): information only not used for fragrances or flavors | |
| (S)-gamma- | hexalactone |
| CAS: 41035-07-8 Use(s): information only not used for fragrances or flavors | |
| 5,6,7,3',4',5'- | hexamethoxyflavone |
| CAS: 29043-07-0 Use(s): natural substances and extractives | |
| 1,3,3,4,5,6- | hexamethyl bicyclo(2.2.2)oct-5-en-2-one |
| Use(s): information only not used for fragrances or flavors | |
| 2,3,4,5,6,6- | hexamethyl-2,4-cyclohexadien-1-one |
| CAS: 3854-96-4 Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6- | hexamethyl-2-ethyl bicyclo(2.2.2)-5-octen-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| 1,1,2,3,3,5- | hexamethyl-2,3,3a,4,5,9b-hexahydro-1H-7,9-diazacyclopenta[a]naphthalene |
| Use(s): information only not used for fragrances or flavors | |
| 6-oxa-1,1,2,3,3,8- | hexamethyl-2,3,5,6,7,8-hexahydro-1H-benz(f)indene |
| Use(s): information only not used for fragrances or flavors | |
| 2,6,6,7,8,8- | hexamethyl-5,5a,6,7,8,8a-hexahydro-4H-3-thia-1-aza-as-indacene |
| Use(s): information only not used for fragrances or flavors | |
| 5,7,7,8,10,10- | hexamethyl-5,6,7,8,9,10-hexahydrobenzo[h]quinazoline |
| Use(s): information only not used for fragrances or flavors | |
| 6-oxa-1,1,2,3,3,8- | hexamethyl-2,3,5,6,7,8-hexamethyl-2,3,5,6,7,8-hexahydro-1H-benz[f]indene |
| Use(s): information only not used for fragrances or flavors | |
| beta,1,1,2,3,3- | hexamethyl indan-5-ethanol |
| CAS: 1217-08-9 EC: 214-934-3 Use(s): fragrance agents | |
| 5,7,7,8,10,10- | hexamethyl-5,6,6a,7,8,9,10,10a-octahydrobenzo[h]quinazoline |
| Use(s): information only not used for fragrances or flavors | |
| (1aR,4S,7aS)-1a,3,3,4,6,6- | hexamethyl-1a,2,3,4,5,6,7,7a-octahydronaphtho[2,3-b]oxirene |
| CAS: NF0127 Use(s): fragrance agents | |
| 1,1,2,3,3,5- | hexamethyl-2,3,4,5-tetrahydro-1H-7,9-diazacyclopenta[a]naphthalene |
| Use(s): information only not used for fragrances or flavors | |
| 2,6,6,7,8,8- | hexamethyl-5,6,7,8-tetrahydro-4H-3-thia-1-aza-as-indacene |
| Use(s): information only not used for fragrances or flavors | |
| 1,3,3,4,5,6- | hexamethyl(2.2.2)bicyclooct-5-en-2-ol |
| Use(s): information only not used for fragrances or flavors | |
| 1,4,5,5,8,9- | hexamethylbicyclo[4.3.0]non-8-en-7-one |
| Use(s): information only not used for fragrances or flavors | |
| hexamethyldisilazane | |
| CAS: 999-97-3 EC: 213-668-5 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylene bis(3,5-di-tert-butyl-4-hydroxyhydrocinnamate) | |
| CAS: 35074-77-2 EC: 252-346-9 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylene diamine | |
| CAS: 124-09-4 EC: 204-679-6 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylene tetramine | |
| CAS: 100-97-0 EC: 202-905-8 Use(s): antimicrobial agents | |
| 1,6- | hexamethylene-bis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionamide) |
| CAS: 23128-74-7 EC: 245-442-7 Use(s): indirect food additives: adhesives and components of coatings | |
| hexamethylgossypetin | |
| CAS: 7741-47-1 Use(s): natural substances and extractives | |
| hexanal (aldehyde C-6) | |
| CAS: 66-25-1 EC: 200-624-5 FEMA: 2557 JECFA: 92 FLAVIS: 05.008 Use(s): flavor and fragrance agents | |
| iso | hexanal |
| CAS: 1119-16-0 EC: 214-273-0 FLAVIS: 05.166 Use(s): flavoring agents | |
| hexanal butane-2,3-diol acetal | |
| CAS: 155639-75-1 FEMA: 4384 JECFA: 1737 Use(s): flavoring agents | |
| hexanal 1,3-butylene glycol acetal | |
| CAS: 5455-66-3 Use(s): information only not used for fragrances or flavors | |
| hexanal dibutyl acetal | |
| CAS: 93892-07-0 EC: 299-487-2 Use(s): fragrance agents | |
| hexanal diethyl acetal | |
| CAS: 3658-93-3 EC: 222-911-4 FLAVIS: 06.023 Use(s): flavor and fragrance agents | |
| hexanal dihexyl acetal | |
| CAS: 33673-65-3 EC: 251-631-5 FEMA: 4370 JECFA: 1738 Use(s): flavor and fragrance agents | |
| hexanal diisoamyl acetal | |
| CAS: 93892-09-2 EC: 299-489-3 Use(s): information only not used for fragrances or flavors | |
| hexanal dimethyl acetal | |
| CAS: 1599-47-9 EC: 216-488-5 FLAVIS: 06.073 Use(s): flavor and fragrance agents | |
| hexanal 1,3-dithiane | |
| CAS: 21777-32-2 Use(s): information only not used for fragrances or flavors | |
| hexanal hexyl isoamyl acetal | |
| CAS: 896447-13-5 FEMA: 4369 JECFA: 1735 Use(s): flavor and fragrance agents | |
| hexanal octane-1,3-diol acetal | |
| CAS: 202188-46-3 FEMA: 4377 JECFA: 1736 Use(s): flavoring agents | |
| hexanal propylene glycol acetal | |
| CAS: 1599-49-1 EC: 216-489-0 FEMA: 3630 JECFA: 928 FLAVIS: 06.094 Use(s): flavor and fragrance agents | |
| cis- | hexanal propylene glycol acetal |
| CAS: 26563-74-6 EC: 247-807-6 FEMA: 3630 Use(s): flavor and fragrance agents | |
| trans- | hexanal propylene glycol acetal |
| CAS: 26563-75-7 EC: 247-808-1 Use(s): natural substances and extractives | |
| hexanal sulfided | |
| Use(s): flavoring agents | |
| hexane | |
| CAS: 110-54-3 EC: 203-777-6 Use(s): extraction solvents | |
| hexane branched and linear | |
| CAS: 92112-69-1 EC: 295-570-2 Use(s): information only not used for fragrances or flavors | |
| (S,S)-2,5- | hexane diol |
| CAS: 34338-96-0 Use(s): information only not used for fragrances or flavors | |
| 1,6- | hexane diol |
| CAS: 629-11-8 EC: 211-074-0 Use(s): solvents | |
| 2,5- | hexane diol |
| CAS: 2935-44-6 EC: 220-910-3 Use(s): solvents | |
| 2,4- | hexane dione |
| CAS: 3002-24-2 Use(s): information only not used for fragrances or flavors | |
| 3,4- | hexane dione |
| CAS: 4437-51-8 EC: 224-651-7 FEMA: 3168 JECFA: 413 FLAVIS: 07.077 Use(s): flavor and fragrance agents | |
| 1,6- | hexane dithiol |
| CAS: 1191-43-1 EC: 214-735-1 FEMA: 3495 JECFA: 540 FLAVIS: 12.067 Use(s): flavoring agents | |
| 3,4- | hexane dithiol |
| CAS: NF0083 Use(s): information only not used for fragrances or flavors | |
| hexane nitrile | |
| CAS: 628-73-9 EC: 211-052-0 Use(s): fragrance agents | |
| 1,2,6- | hexane triol |
| CAS: 106-69-4 EC: 203-424-6 Use(s): cosmetic agents | |
| hexanedioic acid, polymer with 1,3-butanediol and 1,2-propanediol, 2-ethylhexyl ester | |
| CAS: 73018-26-5 Use(s): indirect food additives: adhesives and components of coatings | |
| 2(3)- | hexanethiol |
| CAS: 1679-06-7 FEMA: 4782 Use(s): flavoring agents | |
| hexanoic acid | |
| CAS: 142-62-1 EC: 205-550-7 FEMA: 2559 JECFA: 93 FLAVIS: 08.009 Use(s): flavor and fragrance agents | |
| 2-oxo | hexanoic acid |
| CAS: 2492-75-3 Use(s): information only not used for fragrances or flavors | |
| 3-oxo | hexanoic acid glyceride |
| CAS: 91052-72-1 EC: 293-235-5 FEMA: 3770 JECFA: 910 FLAVIS: 09.555 Use(s): emulsifiers, flavoring agents | |
| hexanoic anhydride | |
| CAS: 2051-49-2 EC: 218-121-4 Use(s): natural substances and extractives | |
| hexanol | |
| CAS: 111-27-3 EC: 203-852-3 FEMA: 2567 JECFA: 91 FLAVIS: 02.005 Use(s): cosmetic, flavor and fragrance agents | |
| 2- | hexanol |
| CAS: 626-93-7 EC: 210-971-4 FLAVIS: 02.163 Use(s): flavor and fragrance agents | |
| (R)-(-)-2- | hexanol |
| CAS: 26549-24-6 Use(s): flavoring agents | |
| (S)-(+)-2- | hexanol |
| CAS: 52019-78-0 Use(s): flavoring agents | |
| 3- | hexanol |
| CAS: 623-37-0 EC: 210-790-0 FEMA: 3351 JECFA: 282 FLAVIS: 02.089 Use(s): flavor and fragrance agents | |
| (R)-3- | hexanol |
| CAS: 13471-42-6 Use(s): information only not used for fragrances or flavors | |
| (S)-3- | hexanol |
| CAS: 6210-51-1 Use(s): information only not used for fragrances or flavors | |
| 3- | hexanone |
| CAS: 589-38-8 EC: 209-645-4 FEMA: 3290 JECFA: 281 FLAVIS: 07.096 Use(s): flavor and fragrance agents | |
| hexanophenone | |
| CAS: 942-92-7 EC: 213-394-6 Use(s): information only not used for fragrances or flavors | |
| hexatetracontane | |
| CAS: 7098-24-0 Use(s): information only not used for fragrances or flavors | |
| 1,2,3,4,5,6- | hexathiepane |
| CAS: 17233-71-5 Use(s): natural substances and extractives | |
| 1,2,3,5,6,8- | hexathionane |
| CAS: 103439-80-1 Use(s): natural substances and extractives | |
| 1,2,4,5,7,8- | hexathionane |
| CAS: 81531-38-6 Use(s): natural substances and extractives | |
| hexatriacontane | |
| CAS: 630-06-8 EC: 211-127-8 Use(s): natural substances and extractives | |
| 2- | hexenal |
| CAS: 505-57-7 EC: 208-014-0 FEMA: 2560 FLAVIS: 05.189 Use(s): flavoring agents | |
| (E)-2- | hexenal |
| CAS: 85761-70-2 Use(s): flavoring agents | |
| (E)-2- | hexenal |
| CAS: 6728-26-3 EC: 229-778-1 FEMA: 2560 JECFA: 1353 FLAVIS: 05.073 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexenal |
| CAS: 16635-54-4 Use(s): flavoring agents | |
| 3- | hexenal |
| CAS: 4440-65-7 EC: 224-659-0 JECFA: 1271 FLAVIS: 05.192 Use(s): flavor and fragrance agents | |
| (E)-3- | hexenal |
| CAS: 69112-21-6 EC: 273-874-6 Use(s): flavoring agents | |
| (Z)-3- | hexenal |
| CAS: 6789-80-6 EC: 229-854-4 FEMA: 2561 JECFA: 316 FLAVIS: 05.075 Use(s): flavor and fragrance agents | |
| 4- | hexenal |
| CAS: 2100-19-8 Use(s): natural substances and extractives | |
| (E)-4- | hexenal |
| CAS: 25166-87-4 FEMA: 4046 JECFA: 1622 FLAVIS: 05.224 Use(s): flavoring agents | |
| (E)-4-oxo-2- | hexenal |
| CAS: 2492-43-5 Use(s): natural substances and extractives | |
| (Z)-4- | hexenal |
| CAS: 4634-89-3 EC: 225-058-6 FEMA: 3496 JECFA: 319 FLAVIS: 05.113 Use(s): flavoring agents | |
| 5- | hexenal |
| CAS: 764-59-0 EC: 212-127-0 Use(s): natural substances and extractives | |
| 2- | hexenal diethyl acetal |
| CAS: 54306-00-2 EC: 259-086-5 FLAVIS: 06.031 Use(s): flavoring agents | |
| (E)-2- | hexenal diethyl acetal |
| CAS: 67746-30-9 EC: 266-989-8 FEMA: 4047 JECFA: 1383 Use(s): flavoring agents | |
| (Z)-2- | hexenal diethyl acetal |
| CAS: NF0177 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexenal diethyl acetal |
| CAS: NF0178 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexenal diethyl acetal |
| CAS: 73545-18-3 EC: 277-532-7 FLAVIS: 06.063 Use(s): flavor and fragrance agents | |
| (E)-2- | hexenal dimethyl acetal |
| CAS: 18318-83-7 EC: 242-204-4 FEMA: 4098 JECFA: 1728 FLAVIS: 06.072 Use(s): flavoring agents | |
| (Z)-3- | hexenal dimethyl acetal |
| CAS: 55444-65-0 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexenal glyceryl acetal |
| CAS: 214220-85-6 FEMA: 4273 JECFA: 1800 Use(s): flavoring agents | |
| (Z)-2- | hexenal glyceryl acetal |
| CAS: 897630-96-5 FEMA: 4273 Use(s): flavoring agents | |
| (E)-2- | hexenal propylene glycol acetal |
| CAS: 94089-21-1 EC: 302-121-7 FEMA: 4272 JECFA: 1801 Use(s): flavor and fragrance agents | |
| 1- | hexene |
| CAS: 592-41-6 EC: 209-753-1 Use(s): solvents | |
| (E)-2- | hexene |
| CAS: 4050-45-7 EC: 223-752-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexene |
| CAS: 7688-21-3 EC: 231-697-1 Use(s): information only not used for fragrances or flavors | |
| (Z+E)-2- | hexene |
| CAS: 592-43-8 EC: 209-755-2 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexene |
| CAS: 13269-52-8 EC: 236-261-4 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexene |
| CAS: 7642-09-3 Use(s): information only not used for fragrances or flavors | |
| (Z+E)-3- | hexene |
| CAS: 592-47-2 EC: 209-758-9 Use(s): information only not used for fragrances or flavors | |
| 2- | hexene dioic acid |
| CAS: 4440-68-0 Use(s): information only not used for fragrances or flavors | |
| 3- | hexene-2,5-dione |
| CAS: 4436-75-3 Use(s): information only not used for fragrances or flavors | |
| cis-3- | hexene-2,5-dione |
| CAS: 17559-81-8 Use(s): information only not used for fragrances or flavors | |
| trans-3- | hexene-2,5-dione |
| CAS: 820-69-9 Use(s): information only not used for fragrances or flavors | |
| 5- | hexene nitrile |
| CAS: 5048-19-1 Use(s): natural substances and extractives | |
| 3- | hexene, 1,1',1''-(ethylidyne tris(oxy)) tris-, (3Z,3'Z,3''Z)- |
| CAS: 215305-10-5 Use(s): fragrance agents | |
| hexenoic acid | |
| CAS: 1289-40-3 Use(s): information only not used for fragrances or flavors | |
| 2- | hexenoic acid |
| CAS: 1191-04-4 EC: 214-727-8 FLAVIS: 08.119 Use(s): flavoring agents | |
| (E)-2- | hexenoic acid |
| CAS: 13419-69-7 EC: 236-528-5 FEMA: 3169 JECFA: 1361 FLAVIS: 08.054 Use(s): flavoring agents | |
| (Z)-2- | hexenoic acid |
| CAS: 1577-28-2 Use(s): natural substances and extractives | |
| 3- | hexenoic acid |
| CAS: 4219-24-3 EC: 224-157-1 FEMA: 3170 JECFA: 317 FLAVIS: 08.050 Use(s): flavoring agents | |
| (E)-3- | hexenoic acid |
| CAS: 1577-18-0 EC: 216-417-8 FEMA: 3170 Use(s): flavoring agents | |
| (Z)-3- | hexenoic acid |
| CAS: 1775-43-5 EC: 217-205-8 FEMA: 4493 JECFA: 2181 Use(s): flavoring agents | |
| 4- | hexenoic acid |
| CAS: 35194-36-6 Use(s): natural substances and extractives | |
| (E)-4- | hexenoic acid |
| CAS: 1577-20-4 Use(s): natural substances and extractives | |
| (Z)-4- | hexenoic acid |
| CAS: 13855-41-9 Use(s): natural substances and extractives | |
| 5- | hexenoic acid |
| CAS: 1577-22-6 Use(s): natural substances and extractives | |
| (R)-1- | hexen-3-ol |
| CAS: 139164-92-4 Use(s): information only not used for fragrances or flavors | |
| (S)-1- | hexen-3-ol |
| CAS: 4798-44-1 Use(s): natural substances and extractives | |
| 2- | hexen-1-ol |
| CAS: 2305-21-7 EC: 218-972-1 FEMA: 2562 JECFA: 1354 FLAVIS: 02.020 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-ol |
| CAS: 928-95-0 EC: 213-191-2 FEMA: 2562 FLAVIS: 02.157 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-ol |
| CAS: 928-94-9 EC: 213-190-7 FEMA: 3924 JECFA: 1374 FLAVIS: 02.156 Use(s): flavor and fragrance agents | |
| 3- | hexen-1-ol |
| CAS: 544-12-7 EC: 208-860-0 FLAVIS: 02.159 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-ol |
| CAS: 928-97-2 EC: 213-193-3 FEMA: 4356 JECFA: 1621 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-ol |
| CAS: 928-96-1 EC: 213-192-8 FEMA: 2563 JECFA: 315 FLAVIS: 02.056 Use(s): flavor and fragrance agents | |
| 4- | hexenol |
| CAS: 6126-50-7 FEMA: 3430 JECFA: 318 FLAVIS: 02.074 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-ol |
| CAS: 928-92-7 EC: 213-188-6 FLAVIS: 02.161 Use(s): natural substances and extractives | |
| (Z)-4- | hexen-1-ol |
| CAS: 928-91-6 EC: 213-187-0 FEMA: 3430 FLAVIS: 02.160 Use(s): flavor and fragrance agents | |
| 5- | hexenol |
| CAS: 821-41-0 EC: 212-477-4 FEMA: 4351 JECFA: 1623 Use(s): flavoring agents | |
| 5- | hexen-2-ol |
| CAS: 626-94-8 Use(s): natural substances and extractives | |
| 5- | hexen-3-ol |
| CAS: 688-99-3 Use(s): information only not used for fragrances or flavors | |
| (R)-5- | hexen-2-ol |
| CAS: 17397-29-4 Use(s): information only not used for fragrances or flavors | |
| (S)-5- | hexen-2-ol |
| CAS: 17397-24-9 Use(s): information only not used for fragrances or flavors | |
| 1- | hexen-3-ol |
| CAS: 4798-44-1 EC: 225-355-0 FEMA: 3608 JECFA: 1151 FLAVIS: 02.104 Use(s): flavor and fragrance agents | |
| 2- | hexen-4-olide |
| CAS: 2407-43-4 EC: 219-304-1 FLAVIS: 10.046 Use(s): flavoring agents | |
| 1- | hexen-3-one |
| CAS: 1629-60-3 EC: 216-625-9 FLAVIS: 07.161 Use(s): flavoring agents | |
| 3- | hexen-2-one |
| CAS: 763-93-9 Use(s): natural substances and extractives | |
| (E)-3- | hexen-2-one |
| CAS: 4376-23-2 Use(s): natural substances and extractives | |
| 4- | hexen-3-one |
| CAS: 2497-21-4 EC: 219-681-2 FEMA: 3352 JECFA: 1125 FLAVIS: 07.048 Use(s): flavoring agents | |
| 4- | hexen-2-one |
| CAS: 25659-22-7 Use(s): information only not used for fragrances or flavors | |
| (E)-4- | hexen-3-one |
| CAS: 50396-87-7 Use(s): flavoring agents | |
| (Z)-4- | hexen-3-one |
| CAS: 50396-96-8 Use(s): flavoring agents | |
| 5- | hexen-3-one |
| CAS: 24253-30-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexenyl 3-hydroxybutanoate |
| CAS: 85762-21-6 Use(s): natural substances and extractives | |
| 1- | hexenyl acetate |
| CAS: 32797-50-5 EC: 251-225-8 Use(s): fragrance agents | |
| 2- | hexenyl acetate |
| CAS: 10094-40-3 EC: 233-223-9 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl acetate |
| CAS: 2497-18-9 EC: 219-680-7 FEMA: 2564 JECFA: 1355 FLAVIS: 09.394 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl acetate |
| CAS: 56922-75-9 EC: 260-440-6 Use(s): natural substances and extractives | |
| 3- | hexenyl acetate |
| CAS: 1708-82-3 EC: 216-965-8 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl acetate |
| CAS: 3681-82-1 EC: 222-962-2 FEMA: 4413 JECFA: 2180 FLAVIS: 09.928 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl acetate |
| CAS: 3681-71-8 EC: 222-960-1 FEMA: 3171 JECFA: 134 FLAVIS: 09.197 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl acetate |
| CAS: 42125-17-7 FLAVIS: 09.572 Use(s): flavoring agents | |
| (Z)-4- | hexen-1-yl acetate |
| CAS: 42125-34-8 FLAVIS: 09.572 Use(s): flavoring agents | |
| 5- | hexenyl acetate |
| CAS: 5048-26-0 Use(s): natural substances and extractives | |
| 1- | hexen-3-yl acetate |
| CAS: 35926-04-6 EC: 252-794-5 Use(s): flavoring agents | |
| 3- | hexenyl acetoacetate |
| CAS: 72928-36-0 EC: 277-070-6 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl acetoacetate |
| CAS: 84434-20-8 EC: 282-820-0 FEMA: 4489 JECFA: 1974 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl acetyl anthranilate |
| CAS: 94333-66-1 EC: 305-046-8 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl angelate |
| CAS: 84060-80-0 EC: 281-904-4 Use(s): fragrance agents | |
| (Z)-3- | hexen-1-yl anisate |
| CAS: 121432-33-5 FLAVIS: 09.560 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl anthranilate |
| CAS: NF0173 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl anthranilate |
| CAS: 65405-76-7 EC: 265-744-2 FEMA: 3925 JECFA: 1538 FLAVIS: 09.561 Use(s): flavor and fragrance agents | |
| 3- | hexenyl benzoate |
| CAS: 72200-74-9 EC: 276-454-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl benzoate |
| CAS: 76841-70-8 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl benzoate |
| CAS: 25152-85-6 EC: 246-669-4 FEMA: 3688 JECFA: 858 FLAVIS: 09.806 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl butyrate |
| CAS: 53398-83-7 EC: 258-515-3 FEMA: 3926 JECFA: 1375 FLAVIS: 09.396 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl isobutyrate |
| CAS: NF007 Use(s): flavoring agents | |
| (Z)-2- | hexen-1-yl butyrate |
| CAS: 56922-77-1 Use(s): natural substances and extractives | |
| 3- | hexenyl butyrate |
| CAS: 2142-93-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl butyrate |
| CAS: 53398-84-8 EC: 258-516-9 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl isobutyrate |
| CAS: 84682-20-2 EC: 283-582-0 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl butyrate |
| CAS: 16491-36-4 EC: 240-553-7 FEMA: 3402 JECFA: 157 FLAVIS: 09.270 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl isobutyrate |
| CAS: 41519-23-7 EC: 255-424-0 FEMA: 3929 JECFA: 1275 FLAVIS: 09.563 Use(s): flavor and fragrance agents | |
| 3- | hexenyl isobutyrate |
| CAS: 57859-47-9 EC: 260-993-3 Use(s): natural substances and extractives | |
| (E)-4- | hexen-1-yl butyrate |
| CAS: 809271-90-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-4- | hexen-1-yl butyrate |
| CAS: 69727-41-9 Use(s): natural substances and extractives | |
| 5- | hexenyl butyrate |
| CAS: 108058-75-9 Use(s): natural substances and extractives | |
| (Z)-3- | hexen-1-yl cinnamate |
| CAS: 68133-75-5 EC: 268-702-1 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl crotonate |
| CAS: 68938-58-9 EC: 273-131-6 Use(s): flavoring agents | |
| (Z)-3- | hexen-1-yl (E)-crotonate |
| CAS: 65405-80-3 EC: 265-746-3 FEMA: 3982 JECFA: 1276 FLAVIS: 09.566 Use(s): flavor and fragrance agents | |
| (Z)-1-(3- | hexen-1-yl) cyclohexan-1-ol |
| CAS: 93963-11-2 EC: 300-751-7 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-oxocyclopentane carboxylate |
| CAS: 94087-84-0 EC: 301-978-4 Use(s): information only not used for fragrances or flavors | |
| hexenyl cyclopentanone | |
| CAS: 34687-46-2 Use(s): fragrance agents | |
| 3- | hexenyl cyclopentanone |
| CAS: 68133-74-4 EC: 268-701-6 Use(s): fragrance agents | |
| 2- | hexenyl cyclopentanyl acetate |
| CAS: 149982-46-7 Use(s): fragrance agents | |
| (Z)-3- | hexen-1-yl-2-cyclopenten-1-one |
| CAS: 53253-09-1 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl (Z,Z)-2,4-decadienoate |
| CAS: 94109-96-3 EC: 302-536-3 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl decanoate |
| CAS: NF0172 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl decanoate |
| CAS: 85554-69-4 EC: 287-601-3 FLAVIS: 09.567 Use(s): flavor and fragrance agents | |
| (E)-5-(3- | hexen-1-yl) dihydrofuran-2(3H)-one |
| CAS: 97416-87-0 EC: 306-836-5 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl dihydro-5-methyl furan-2(3H)-one |
| CAS: 14252-84-7 EC: 238-127-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl 2-ethyl butyrate |
| CAS: NF0176 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-ethyl butyrate |
| CAS: 94071-12-2 EC: 301-813-6 Use(s): flavor and fragrance agents | |
| 3- | hexenyl 2-ethyl butyrate |
| CAS: 233666-04-1 FLAVIS: 09.884 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl formate |
| CAS: 53398-78-0 EC: 258-512-7 FEMA: 3927 JECFA: 1376 FLAVIS: 09.397 Use(s): flavor and fragrance agents | |
| 3- | hexenyl formate |
| CAS: 2315-09-5 EC: 219-017-1 JECFA: 1272 FLAVIS: 09.846 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl formate |
| CAS: 56922-80-6 EC: 260-442-7 FLAVIS: 09.562 Use(s): flavoring agents | |
| (Z)-3- | hexen-1-yl formate |
| CAS: 33467-73-1 EC: 251-532-7 FEMA: 3353 JECFA: 123 FLAVIS: 09.240 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl heptanoate |
| CAS: 125680-98-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl heptanoate |
| CAS: NF0171 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl heptanoate |
| CAS: 61444-39-1 EC: 262-798-9 FLAVIS: 09.575 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl heptine carbonate |
| CAS: 68698-58-8 EC: 272-087-5 Use(s): information only not used for fragrances or flavors | |
| 2- | hexenyl hexanoate |
| CAS: 10448-24-5 Use(s): natural substances and extractives | |
| (E)-2- | hexen-1-yl hexanoate |
| CAS: 53398-86-0 EC: 258-519-5 FEMA: 3983 JECFA: 1381 FLAVIS: 09.398 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl hexanoate |
| CAS: 56922-79-3 EC: 260-441-1 Use(s): natural substances and extractives | |
| 3- | hexenyl hexanoate |
| CAS: 84434-19-5 EC: 282-819-5 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl hexanoate |
| CAS: 56922-82-8 EC: 260-444-8 FLAVIS: 09.855 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl hexanoate |
| CAS: 31501-11-8 EC: 250-662-0 FEMA: 3403 JECFA: 165 FLAVIS: 09.271 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl hexanoate |
| CAS: NF0170 Use(s): natural substances and extractives | |
| (Z)-4- | hexen-1-yl hexanoate |
| CAS: 88552-98-1 Use(s): natural substances and extractives | |
| 5- | hexenyl hexanoate |
| CAS: 108058-81-7 Use(s): natural substances and extractives | |
| (E)-3- | hexen-1-yl (E)-3-hexenoate |
| CAS: 61444-37-9 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl (Z)-3-hexenoate |
| CAS: 53398-88-2 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl (E)-2-hexenoate |
| CAS: 53398-87-1 FEMA: 3928 JECFA: 1279 FLAVIS: 09.568 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl (E)-3-hexenoate |
| CAS: 74638-19-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl (Z)-3-hexenoate |
| CAS: 61444-38-0 EC: 262-797-3 FEMA: 3689 JECFA: 336 FLAVIS: 09.291 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl 5-hexenoate |
| CAS: 106917-24-2 Use(s): natural substances and extractives | |
| 5- | hexenyl 5-hexenoate |
| CAS: 77131-17-0 Use(s): natural substances and extractives | |
| (Z)-2- | hexen-1-yl isobutyrate |
| CAS: NF0169 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexen-1-yl isovalerate |
| CAS: 54675-77-3 Use(s): natural substances and extractives | |
| (E)-3- | hexen-1-yl isovalerate |
| CAS: 88296-26-8 Use(s): natural substances and extractives | |
| (E)-2- | hexen-1-yl lactate |
| CAS: 85554-71-8 EC: 287-603-4 Use(s): information only not used for fragrances or flavors | |
| (Z)-2- | hexen-1-yl lactate |
| CAS: 102832-13-3 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl lactate |
| CAS: NF0167 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl lactate |
| CAS: 61931-81-5 EC: 263-337-4 FEMA: 3690 JECFA: 934 FLAVIS: 09.545 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl levulinate |
| CAS: NF0166 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl levulinate |
| CAS: 85554-70-7 EC: 287-602-9 Use(s): flavoring agents | |
| (E)-2- | hexen-1-yl 2-methyl butyrate |
| CAS: 94089-01-7 EC: 302-103-9 FEMA: 4274 JECFA: 1797 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl 2-methyl butyrate |
| CAS: NF0174 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl 2-methyl butyrate |
| CAS: NF0175 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| CAS: 53398-85-9 EC: 258-517-4 FEMA: 3497 FLAVIS: 09.854 Use(s): flavor and fragrance agents | |
| 3- | hexenyl 2-methyl butyrate |
| CAS: 10094-41-4 EC: 233-224-4 FEMA: 3497 JECFA: 211 FLAVIS: 09.506 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl methyl carbonate |
| CAS: 67633-96-9 EC: 266-797-4 FLAVIS: 09.838 Use(s): flavor and fragrance agents | |
| (E)-3- | hexenyl methyl ether |
| CAS: 121441-40-5 Use(s): fragrance agents | |
| (Z)-3- | hexenyl methyl ether |
| CAS: 70220-06-3 EC: 274-449-8 Use(s): fragrance agents | |
| (Z)-2-(3- | hexen-1-yl)-5-methyl furan |
| CAS: 4868-20-6 EC: 225-475-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl 2-methyl-2-pentenoate |
| CAS: 76649-17-7 EC: 278-511-5 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl nicotinate |
| CAS: NF0165 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl nicotinate |
| CAS: 85098-91-5 EC: 285-445-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl nonanoate |
| CAS: 88191-46-2 Use(s): natural substances and extractives | |
| (E)-2- | hexen-1-yl octanoate |
| CAS: 85554-72-9 EC: 287-605-5 FEMA: 4135 JECFA: 1796 FLAVIS: 09.841 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl octanoate |
| CAS: 87619-90-7 EC: 289-329-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl octanoate |
| CAS: 61444-41-5 EC: 262-799-4 FLAVIS: 09.569 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl octine carbonate |
| CAS: 68480-29-5 EC: 270-907-6 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl oxyacetaldehyde |
| CAS: 68133-72-2 EC: 268-699-7 Use(s): fragrance agents | |
| (E)-2-(3- | hexen-1-yl oxy)-1,3-dioxolane |
| CAS: 93919-13-2 EC: 299-997-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-2-(3- | hexen-1-yl oxy) ethanol |
| CAS: 94088-27-4 EC: 302-026-0 Use(s): information only not used for fragrances or flavors | |
| (Z)-2-(3- | hexenyl oxy)-3-methyl pyrazine |
| CAS: 94159-29-2 EC: 303-207-7 Use(s): information only not used for fragrances or flavors | |
| hexen-1-yl oxypropane nitrile | |
| CAS: 142653-61-0 EC: 415-220-6 Use(s): fragrance agents | |
| (Z)-2-(3- | hexen-1-yl oxy) tetrahydro-2H-pyran |
| CAS: 90879-06-4 EC: 292-684-4 Use(s): information only not used for fragrances or flavors | |
| 3- | hexenyl palmitate |
| CAS: 233666-03-0 FLAVIS: 09.885 Use(s): flavoring agents | |
| (Z)-3- | hexen-1-yl palmitate |
| CAS: 117210-57-8 Use(s): natural substances and extractives | |
| 2- | hexenyl phenyl acetate |
| CAS: 71605-86-2 EC: 275-666-0 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexen-1-yl phenyl acetate |
| CAS: 68133-78-8 EC: 268-705-8 FLAVIS: 09.400 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl phenyl acetate |
| CAS: 1824720-88-8 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl phenyl acetate |
| CAS: 42436-07-7 EC: 255-826-6 FEMA: 3633 JECFA: 1016 FLAVIS: 09.805 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl pivalate |
| CAS: 653002-72-3 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl pivalate |
| CAS: 84604-59-1 EC: 283-340-4 Use(s): information only not used for fragrances or flavors | |
| (E)-2- | hexen-1-yl propionate |
| CAS: 53398-80-4 EC: 258-513-2 FEMA: 3932 JECFA: 1378 FLAVIS: 09.395 Use(s): flavor and fragrance agents | |
| (Z)-2- | hexen-1-yl propionate |
| CAS: 56922-76-0 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl propionate |
| CAS: 53398-81-5 EC: 258-514-8 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl propionate |
| CAS: 33467-74-2 EC: 251-533-2 FEMA: 3933 JECFA: 1274 FLAVIS: 09.564 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl propionate |
| CAS: 33467-75-3 Use(s): information only not used for fragrances or flavors | |
| (E)-3- | hexen-1-yl pyruvate |
| CAS: NF031 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl pyruvate |
| CAS: 68133-76-6 EC: 268-703-7 FEMA: 3934 JECFA: 1846 FLAVIS: 09.565 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl salicylate |
| CAS: 68133-77-7 EC: 268-704-2 Use(s): fragrance agents | |
| (E)-3- | hexen-1-yl salicylate |
| CAS: 68141-22-0 EC: 268-844-4 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl salicylate |
| CAS: 65405-77-8 EC: 265-745-8 FEMA: 4750 FLAVIS: 09.570 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl senecioate |
| CAS: 65416-28-6 EC: 265-766-2 Use(s): flavoring agents | |
| N- | hexenyl succinic anhydride |
| CAS: 10500-34-2 Use(s): information only not used for fragrances or flavors | |
| 5- | hexenyl isothiocyanate |
| CAS: 49776-81-0 FEMA: 4421 JECFA: 1894 Use(s): flavoring agents | |
| 2-(5- | hexenyl thio) ethanol |
| CAS: 82010-85-3 EC: 279-880-5 Use(s): information only not used for fragrances or flavors | |
| (Z)-3- | hexen-1-yl tiglate |
| CAS: 67883-79-8 EC: 267-554-5 FEMA: 3931 JECFA: 1277 FLAVIS: 09.559 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl valerate |
| CAS: 56922-74-8 EC: 260-439-0 FEMA: 3935 JECFA: 1379 Use(s): flavor and fragrance agents | |
| (E)-2- | hexen-1-yl isovalerate |
| CAS: 68698-59-9 EC: 272-088-0 FEMA: 3930 JECFA: 1377 FLAVIS: 09.399 Use(s): flavor and fragrance agents | |
| (E)-3- | hexen-1-yl valerate |
| CAS: 56922-81-7 EC: 260-443-2 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl valerate |
| CAS: 35852-46-1 EC: 252-761-5 FEMA: 3936 JECFA: 1278 FLAVIS: 09.571 Use(s): flavor and fragrance agents | |
| (Z)-3- | hexen-1-yl isovalerate |
| CAS: 35154-45-1 EC: 252-404-3 FEMA: 3498 Use(s): flavor and fragrance agents | |
| (E)-4- | hexen-1-yl valerate |
| CAS: 903552-55-6 Use(s): information only not used for fragrances or flavors | |
| 3- | hexenyl isovalerate |
| CAS: 10032-11-8 EC: 233-104-1 FEMA: 3498 JECFA: 202 FLAVIS: 09.505 Use(s): flavor and fragrance agents | |
| hexoxyacetaldehyde dimethyl acetal | |
| CAS: 17597-95-4 EC: 241-563-4 Use(s): fragrance agents | |
| 2- | hexoxyacetaldehyde dipropylene glycol acetal |
| CAS: 71832-77-4 Use(s): information only not used for fragrances or flavors | |
| hexoxyethyl pivalate | |
| CAS: 68757-58-4 EC: 272-144-4 Use(s): information only not used for fragrances or flavors | |
| 2- | hexoxy-5-pentyl tetrahydrofuran |
| CAS: 78054-02-1 Use(s): natural substances and extractives | |
| N- | hexyl acetamide |
| CAS: 7501-79-3 Use(s): natural substances and extractives | |
| hexyl acetate | |
| CAS: 142-92-7 EC: 205-572-7 FEMA: 2565 JECFA: 128 FLAVIS: 09.006 Use(s): flavor and fragrance agents | |
| 2- | hexyl acetate |
| CAS: 5953-49-1 EC: 227-716-8 Use(s): flavoring agents | |
| hexyl acetoacetate | |
| CAS: 13562-84-0 EC: 236-953-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-4-acetoxytetrahydrofuran |
| CAS: 10039-39-1 FEMA: 2566 JECFA: 1440 Use(s): flavoring agents | |
| hexyl acrylate | |
| CAS: 2499-95-8 EC: 219-698-5 Use(s): information only not used for fragrances or flavors | |
| sec- | hexyl alcohol |
| CAS: 97-95-0 EC: 202-621-4 FLAVIS: 02.043 Use(s): flavor and fragrance agents | |
| 1- | hexyl allyl formate |
| CAS: 84681-89-0 EC: 283-550-6 Use(s): information only not used for fragrances or flavors | |
| hexyl amine | |
| CAS: 111-26-2 EC: 203-851-8 FEMA: 4243 JECFA: 1588 FLAVIS: 11.016 Use(s): flavoring agents | |
| hexyl ortho-anisate | |
| CAS: 71605-88-4 EC: 275-668-1 Use(s): information only not used for fragrances or flavors | |
| hexyl para-anisate | |
| CAS: 71607-26-6 EC: 275-670-2 Use(s): information only not used for fragrances or flavors | |
| hexyl anthranilate | |
| CAS: 18189-05-4 EC: 242-075-4 Use(s): flavor and fragrance agents | |
| 4- | hexyl benzaldehyde |
| CAS: 49763-69-1 EC: 256-479-3 Use(s): information only not used for fragrances or flavors | |
| hexyl benzoate | |
| CAS: 6789-88-4 EC: 229-856-5 FEMA: 3691 JECFA: 854 FLAVIS: 09.768 Use(s): flavor and fragrance agents | |
| 4- | hexyl benzoic acid |
| CAS: 21643-38-9 EC: 244-490-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl benzothiazole |
| CAS: 65718-88-9 Use(s): natural substances and extractives | |
| hexyl butyrate | |
| CAS: 2639-63-6 EC: 220-136-6 FEMA: 2568 JECFA: 153 FLAVIS: 09.045 Use(s): flavor and fragrance agents | |
| 2- | hexyl butyrate |
| CAS: 6963-52-6 Use(s): natural substances and extractives | |
| hexyl isobutyrate | |
| CAS: 2349-07-7 EC: 219-075-8 FEMA: 3172 JECFA: 189 FLAVIS: 09.478 Use(s): flavor and fragrance agents | |
| hexyl carbitol | |
| CAS: 112-59-4 EC: 203-988-3 Use(s): information only not used for fragrances or flavors | |
| hexyl carbonate tetrahydrofurfuryl lactate | |
| CAS: 64058-40-8 Use(s): information only not used for fragrances or flavors | |
| (E)-alpha- | hexyl cinnamaldehyde |
| CAS: 165184-98-5 FEMA: 2569 Use(s): flavor and fragrance agents | |
| (Z)-alpha- | hexyl cinnamaldehyde |
| CAS: 101-86-0 Use(s): flavor and fragrance agents | |
| alpha- | hexyl cinnamaldehyde |
| CAS: 101-86-0 EC: 202-983-3 FEMA: 2569 JECFA: 686 FLAVIS: 05.041 Use(s): flavor and fragrance agents | |
| alpha- | hexyl cinnamaldehyde diethyl acetal |
| CAS: 67845-59-4 EC: 267-331-2 Use(s): fragrance agents | |
| alpha- | hexyl cinnamaldehyde dimethyl acetal |
| CAS: 29896-45-5 EC: 249-935-8 Use(s): fragrance agents | |
| hexyl cinnamate | |
| CAS: 3488-00-4 EC: 222-479-7 Use(s): fragrance agents | |
| 6- | hexyl-meta-cresol |
| CAS: 39236-85-6 Use(s): information only not used for fragrances or flavors | |
| (E)- | hexyl crotonate |
| CAS: 1617-25-0 FLAVIS: 09.578 Use(s): flavoring agents | |
| hexyl cyclohexane | |
| CAS: 4292-75-5 EC: 224-294-7 Use(s): natural substances and extractives | |
| hexyl cyclohexane carboxylate | |
| CAS: 27948-10-3 EC: 248-744-7 Use(s): information only not used for fragrances or flavors | |
| hexyl cyclopentane | |
| CAS: 4457-00-5 Use(s): natural substances and extractives | |
| 1- | hexyl cyclopentene |
| CAS: 4291-99-0 Use(s): natural substances and extractives | |
| hexyl (E,Z)-2,4-decadienoate | |
| CAS: 28380-11-2 EC: 248-998-9 Use(s): natural substances and extractives | |
| hexyl decanoate | |
| CAS: 10448-26-7 EC: 233-932-3 FEMA: 4342 JECFA: 1874 Use(s): flavor and fragrance agents | |
| 2- | hexyl decan-1-ol |
| CAS: 2425-77-6 EC: 219-370-1 Use(s): cosmetic agents | |
| 2- | hexyl-2-decenal |
| CAS: 13893-39-5 FEMA: 4786 Use(s): flavoring agents | |
| 2- | hexyl decyl isononanoate |
| CAS: 93843-29-9 EC: 299-109-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl decyl octanoate |
| CAS: 93777-70-9 EC: 298-104-6 Use(s): information only not used for fragrances or flavors | |
| hexyl dihydrocinnamate | |
| CAS: 220766-75-6 Use(s): natural substances and extractives | |
| 5- | hexyl dihydromethyl furan-2(3H)-one |
| CAS: 93980-90-6 EC: 301-070-8 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-4,5-dimethyl oxazole |
| CAS: 20662-87-7 Use(s): natural substances and extractives | |
| 4- | hexyl-2,5-dimethyl oxazole |
| CAS: 20662-86-6 Use(s): natural substances and extractives | |
| 5- | hexyl-2,4-dimethyl oxazole |
| CAS: 20662-85-5 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-4,5-dimethyl thiazole |
| CAS: 87262-49-5 Use(s): natural substances and extractives | |
| 2- | hexyl-1,3-dioxane |
| CAS: 6290-20-6 EC: 228-537-8 Use(s): information only not used for fragrances or flavors | |
| 4- | hexyl-1,3-dioxane |
| CAS: 2244-85-1 EC: 218-830-9 Use(s): information only not used for fragrances or flavors | |
| hexyl docosanoate | |
| CAS: 26720-37-6 EC: 247-942-0 Use(s): natural substances and extractives | |
| hexyl (Z)-13-docosenoate | |
| CAS: 19773-56-9 EC: 243-291-1 Use(s): information only not used for fragrances or flavors | |
| hexyl 2-ethyl hexanoate | |
| CAS: 20748-87-2 EC: 244-006-3 Use(s): information only not used for fragrances or flavors | |
| hexyl ethylidene aminobenzoate | |
| CAS: 72968-69-5 EC: 277-145-3 Use(s): fragrance agents | |
| hexyl formate | |
| CAS: 629-33-4 EC: 211-087-1 FEMA: 2570 JECFA: 120 FLAVIS: 09.161 Use(s): flavor and fragrance agents | |
| 2- | hexyl furan |
| CAS: 3777-70-6 EC: 223-235-2 Use(s): natural substances and extractives | |
| hexyl 2-furoate | |
| CAS: 39251-86-0 EC: 254-377-3 FEMA: 2571 JECFA: 749 FLAVIS: 13.005 Use(s): flavor and fragrance agents | |
| hexyl heptanoate | |
| CAS: 1119-06-8 FEMA: 4337 JECFA: 1872 Use(s): flavor and fragrance agents | |
| hexyl hexanoate | |
| CAS: 6378-65-0 EC: 228-952-4 FEMA: 2572 JECFA: 164 FLAVIS: 09.066 Use(s): flavor and fragrance agents | |
| hexyl 2-hexenoate | |
| CAS: 16930-97-5 EC: 240-998-7 Use(s): information only not used for fragrances or flavors | |
| hexyl 3-hexenoate | |
| CAS: 41599-57-9 Use(s): information only not used for fragrances or flavors | |
| hexyl 5-hexenoate | |
| CAS: 106917-23-1 Use(s): natural substances and extractives | |
| hexyl (E)-2-hexenoate | |
| CAS: 33855-57-1 FEMA: 3692 JECFA: 1810 FLAVIS: 09.292 Use(s): flavoring agents | |
| hexyl (Z)-3-hexenoate | |
| CAS: 89352-68-1 Use(s): natural substances and extractives | |
| hexyl 4-hydroxybenzoate | |
| CAS: 1083-27-8 Use(s): information only not used for fragrances or flavors | |
| hexyl 3-hydroxybutanoate | |
| CAS: 87128-51-6 Use(s): natural substances and extractives | |
| 2- | hexyl-5-hydroxy-1,3-dioxane |
| CAS: 1708-36-7 EC: 216-961-6 FLAVIS: 06.102 Use(s): flavor and fragrance agents | |
| cis-2- | hexyl-5-hydroxy-1,3-dioxane |
| CAS: 18445-22-2 Use(s): information only not used for fragrances or flavors | |
| trans-2- | hexyl-5-hydroxy-1,3-dioxane |
| CAS: 18550-94-2 Use(s): information only not used for fragrances or flavors | |
| hexyl (R)-12-hydroxyoleate | |
| CAS: 6030-14-4 EC: 227-905-5 Use(s): information only not used for fragrances or flavors | |
| hexyl isononanoate | |
| CAS: 84878-29-5 EC: 284-420-1 Use(s): information only not used for fragrances or flavors | |
| hexyl isooctanoate | |
| CAS: 84878-24-0 EC: 284-414-9 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-5 or 6-keto-1,4-dioxane |
| CAS: 65504-97-4 FEMA: 2574 JECFA: 1486 Use(s): flavoring agents | |
| hexyl lactate | |
| CAS: 20279-51-0 EC: 243-676-4 FLAVIS: 09.580 Use(s): flavor and fragrance agents | |
| hexyl laurate | |
| CAS: 34316-64-8 EC: 251-932-1 FLAVIS: 09.579 Use(s): flavor and fragrance agents | |
| hexyl levulinate | |
| CAS: 24431-34-3 Use(s): information only not used for fragrances or flavors | |
| hexyl mandelate | |
| CAS: 5431-31-2 Use(s): information only not used for fragrances or flavors | |
| hexyl mercaptan | |
| CAS: 111-31-9 EC: 203-857-0 FEMA: 3842 JECFA: 518 FLAVIS: 12.132 Use(s): flavoring agents | |
| hexyl 3-mercaptobutanoate | |
| CAS: 796857-79-9 FEMA: 4136 JECFA: 1704 FLAVIS: 12.292 Use(s): flavoring agents | |
| hexyl methanesulfinate | |
| Use(s): information only not used for fragrances or flavors | |
| 2-iso | hexyl-3-methoxypyrazine |
| CAS: 68844-95-1 EC: 272-442-4 Use(s): fragrance agents | |
| hexyl 2-methyl butyrate | |
| CAS: 10032-15-2 EC: 233-106-2 FEMA: 3499 JECFA: 208 FLAVIS: 09.507 Use(s): flavor and fragrance agents | |
| 2- | hexyl-5-methyl furan |
| CAS: 5312-82-3 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl-5-methyl-3(2H)-furanone |
| CAS: 33922-66-6 Use(s): natural substances and extractives | |
| hexyl 2-methyl-3-pentenoate | |
| CAS: 85508-08-3 EC: 287-432-5 FEMA: 3693 Use(s): flavor and fragrance agents | |
| hexyl (E)-2-methyl-3-pentenoate | |
| CAS: 58625-95-9 FEMA: 3693 JECFA: 352 FLAVIS: 09.546 Use(s): flavor and fragrance agents | |
| hexyl 2-methyl-4-pentenoate | |
| CAS: 58031-03-1 FEMA: 3693 Use(s): flavor and fragrance agents | |
| 5- | hexyl-2-methyl pyridine |
| CAS: 710-40-7 Use(s): fragrance agents | |
| 2- | hexyl-2-methyl thiazolidine |
| CAS: 702-87-4 Use(s): natural substances and extractives | |
| 2- | hexyl-2-methyl-1,3-dioxolane |
| CAS: 937-94-0 EC: 213-335-4 Use(s): information only not used for fragrances or flavors | |
| hexyl 2-methyl-2-pentenoate | |
| Use(s): information only not used for fragrances or flavors | |
| hexyl myristate | |
| CAS: 42231-99-2 EC: 255-722-0 FLAVIS: 09.582 Use(s): flavor and fragrance agents | |
| hexyl nicotinate | |
| CAS: 23597-82-2 EC: 245-767-4 Use(s): cosmetic agents | |
| hexyl nonanoate | |
| CAS: 6561-39-3 EC: 229-488-5 FEMA: 4339 JECFA: 1873 Use(s): flavor and fragrance agents | |
| 2- | hexyl nonanoic acid |
| CAS: 37165-63-2 Use(s): information only not used for fragrances or flavors | |
| hexyl octanoate | |
| CAS: 1117-55-1 EC: 214-247-9 FEMA: 2575 JECFA: 175 FLAVIS: 09.113 Use(s): flavor and fragrance agents | |
| 2- | hexyl octanoic acid |
| CAS: 60948-91-6 EC: 262-534-2 Use(s): cosmetic agents | |
| hexyl 7-octenoate | |
| CAS: 108058-84-0 Use(s): natural substances and extractives | |
| hexyl (E)-2-octenoate | |
| CAS: 85554-64-9 EC: 287-596-8 Use(s): flavor and fragrance agents | |
| 2- | hexyl octyl cyclopentane |
| CAS: 55044-77-4 Use(s): natural substances and extractives | |
| hexyl (Z)-oleate | |
| CAS: 20290-84-0 EC: 243-692-1 FLAVIS: 09.865 Use(s): cosmetic and fragrance agents | |
| hexyl oxyacetonitrile | |
| CAS: 66912-24-1 Use(s): information only not used for fragrances or flavors | |
| 3' | hexyl oxyacetophenone |
| CAS: 37062-71-8 Use(s): natural substances and extractives | |
| hexyl palmitate | |
| CAS: 42232-25-7 EC: 255-723-6 Use(s): information only not used for fragrances or flavors | |
| 8- | hexyl pentadecane |
| CAS: 13475-75-7 Use(s): natural substances and extractives | |
| hexyl phenyl acetate | |
| CAS: 5421-17-0 EC: 226-537-2 FEMA: 3457 JECFA: 1015 FLAVIS: 09.804 Use(s): flavor and fragrance agents | |
| hexyl pivalate | |
| CAS: 5434-57-1 EC: 226-602-5 Use(s): fragrance agents | |
| hexyl propionate | |
| CAS: 2445-76-3 EC: 219-495-1 FEMA: 2576 JECFA: 144 FLAVIS: 09.139 Use(s): flavor and fragrance agents | |
| 2- | hexyl pyrazine |
| CAS: 28217-91-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl pyridine |
| CAS: 1129-69-7 EC: 214-454-4 FLAVIS: 14.117 Use(s): flavoring agents | |
| 3- | hexyl pyridine |
| CAS: 6311-92-8 Use(s): flavoring agents | |
| 4- | hexyl pyridine |
| CAS: 27876-24-0 EC: 248-707-5 Use(s): information only not used for fragrances or flavors | |
| 4- | hexyl resorcinol |
| CAS: 136-77-6 EC: 205-257-4 Use(s): antioxidants | |
| hexyl salicylate | |
| CAS: 6259-76-3 EC: 228-408-6 FLAVIS: 09.581 Use(s): flavor and fragrance agents | |
| hexyl senecioate | |
| CAS: 17627-41-7 EC: 241-608-8 Use(s): natural substances and extractives | |
| 1- | hexyl senecioate |
| CAS: 16931-10-5 Use(s): natural substances and extractives | |
| hexyl stearate | |
| CAS: 3460-37-5 EC: 222-406-9 Use(s): information only not used for fragrances or flavors | |
| hexyl sulfide | |
| CAS: 6294-31-1 EC: 228-556-1 Use(s): information only not used for fragrances or flavors | |
| hexyl thiocyanate | |
| CAS: 6803-40-3 Use(s): information only not used for fragrances or flavors | |
| hexyl isothiocyanate | |
| CAS: 4404-45-9 EC: 224-549-2 FEMA: 4422 JECFA: 1895 Use(s): flavoring agents | |
| 2-( | hexyl thio)-3-methyl pyrazine |
| CAS: 73972-65-3 Use(s): information only not used for fragrances or flavors | |
| 2- | hexyl thiophene |
| CAS: 18794-77-9 EC: 242-579-4 FEMA: 4137 JECFA: 1764 FLAVIS: 15.076 Use(s): flavoring agents | |
| hexyl tiglate | |
| CAS: 16930-96-4 EC: 240-997-1 Use(s): flavor and fragrance agents | |
| hexyl (E)-tiglate | |
| CAS: 19089-92-0 EC: 242-808-8 FEMA: 3354 JECFA: 1807 FLAVIS: 09.266 Use(s): flavor and fragrance agents | |
| hexyl (Z)-tiglate | |
| CAS: 65652-33-7 EC: 265-857-7 Use(s): flavor and fragrance agents | |
| 2- | hexyl-2-undecenal |
| CAS: 24823-56-1 Use(s): information only not used for fragrances or flavors | |
| hexyl valerate | |
| CAS: 1117-59-5 EC: 214-248-4 FLAVIS: 09.583 Use(s): flavor and fragrance agents | |
| hexyl isovalerate | |
| CAS: 10032-13-0 EC: 233-105-7 FEMA: 3500 JECFA: 199 FLAVIS: 09.529 Use(s): flavor and fragrance agents | |
| hexyl vanillate | |
| CAS: 84375-71-3 Use(s): information only not used for fragrances or flavors | |
| hexyl vanillate-2-ethoxybenzoic acid | |
| CAS: 126294-32-4 Use(s): information only not used for fragrances or flavors | |
| hexyl vinyl carbinyl acetate | |
| CAS: 31795-37-6 EC: 250-808-4 Use(s): fragrance agents | |
| 2- | hexyl-5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]furan |
| CAS: 143114-91-4 Use(s): natural substances and extractives | |
| hexyldecyl laurate | |
| CAS: 34362-27-1 EC: 251-959-9 Use(s): emollients, skin conditioning | |
| hexyldecyl palmitate | |
| CAS: 69275-02-1 EC: 273-942-5 Use(s): cosmetic ingredient for skin conditioning | |
| hexylene glycol | |
| CAS: 107-41-5 EC: 203-489-0 Use(s): cosmetic ingredient for skin and hair care | |
| (R)- | hexylene glycol |
| CAS: 99210-90-9 Use(s): information only not used for fragrances or flavors | |
| (S)- | hexylene glycol |
| CAS: 99113-75-4 Use(s): information only not used for fragrances or flavors | |
| hexylene glycol diacetate | |
| CAS: 1637-24-7 EC: 216-667-8 Use(s): information only not used for fragrances or flavors | |
| hexylene oxide | |
| CAS: 1436-34-6 EC: 215-864-6 Use(s): information only not used for fragrances or flavors | |
| 2- | hexylidene cyclohexan-1-one |
| CAS: 16429-07-5 EC: 240-481-6 Use(s): fragrance agents | |
| 2- | hexylidene cyclopentanone |
| CAS: 17373-89-6 EC: 241-411-7 FEMA: 2573 JECFA: 1106 FLAVIS: 07.034 Use(s): flavor and fragrance agents | |
| 5- | hexyltetrahydro-2-furanoctanoic acid |
| CAS: 61781-98-4 Use(s): information only not used for fragrances or flavors | |
| heyderiol | |
| CAS: 96447-67-5 Use(s): natural substances and extractives | |
| hibaene | |
| CAS: 2359-73-1 Use(s): natural substances and extractives | |
| iso | hibaene |
| CAS: 5975-53-1 Use(s): natural substances and extractives | |
| 2,4- | himachaladiene |
| CAS: NF0181 Use(s): natural substances and extractives | |
| alpha- | himachalene |
| CAS: 3853-83-6 Use(s): natural substances and extractives | |
| ar- | himachalene |
| CAS: 76739-27-0 Use(s): natural substances and extractives | |
| beta- | himachalene |
| CAS: 1461-03-6 Use(s): natural substances and extractives | |
| gamma- | himachalene |
| CAS: 53111-25-4 Use(s): natural substances and extractives | |
| oxido | himachalene |
| CAS: 64825-84-9 Use(s): natural substances and extractives | |
| beta- | himachalene oxide |
| CAS: NF0468 Use(s): natural substances and extractives | |
| himachalol | |
| CAS: 1891-45-8 Use(s): natural substances and extractives | |
| allo- | himachalol |
| CAS: 19435-77-9 Use(s): natural substances and extractives | |
| beta- | himachalol |
| CAS: NF0183 Use(s): natural substances and extractives | |
| hinesene | |
| CAS: NF0126 Use(s): natural substances and extractives | |
| hinokiflavone | |
| CAS: 19202-36-9 EC: 242-877-4 Use(s): natural substances and extractives | |
| hinokiol | |
| CAS: 564-73-8 Use(s): natural substances and extractives | |
| hinokione | |
| CAS: 472-37-7 Use(s): natural substances and extractives | |
| hinokiresinol | |
| CAS: 17676-24-3 Use(s): natural substances and extractives | |
| (Z)- | hinokiresinol |
| CAS: 79056-22-7 Use(s): natural substances and extractives | |
| hirudin | |
| CAS: 113274-56-9 Use(s): natural substances and extractives | |
| (R)- | hispaglabridin A |
| CAS: 68978-03-0 Use(s): natural substances and extractives | |
| (R)- | hispaglabridin B |
| CAS: 68978-02-9 Use(s): natural substances and extractives | |
| hispolone | |
| CAS: 173933-40-9 Use(s): natural substances and extractives | |
| histamine | |
| CAS: 51-45-6 EC: 200-100-6 Use(s): natural substances and extractives | |
| dextro- | histidine |
| CAS: 351-50-8 EC: 206-513-8 Use(s): natural substances and extractives | |
| laevo- | histidine |
| CAS: 71-00-1 EC: 200-745-3 FEMA: 3694 JECFA: 1431 FLAVIS: 17.008 Use(s): special dietary and nutritional additives | |
| laevo- | histidine hydrochloride monohydrate |
| CAS: 5934-29-2 Use(s): flavoring agents | |
| hoduloside III | |
| CAS: 146503-30-2 Use(s): natural substances and extractives | |
| hoduloside IV | |
| CAS: 146445-91-2 Use(s): natural substances and extractives | |
| hoduloside IX | |
| CAS: 154971-13-8 Use(s): natural substances and extractives | |
| hoduloside V | |
| CAS: 146445-92-3 Use(s): natural substances and extractives | |
| hoduloside VI | |
| CAS: 154971-10-5 Use(s): natural substances and extractives | |
| hoduloside VII | |
| CAS: 154971-11-6 Use(s): natural substances and extractives | |
| hoduloside VIII | |
| CAS: 154971-12-7 Use(s): natural substances and extractives | |
| hoduloside X | |
| CAS: 154971-14-9 Use(s): natural substances and extractives | |
| holocalin | |
| CAS: 41753-54-2 EC: 255-533-3 Use(s): natural substances and extractives | |
| honokiol | |
| CAS: 35354-74-6 Use(s): natural substances and extractives | |
| honyucitrin | |
| CAS: 114542-44-8 Use(s): natural substances and extractives | |
| honyudisin | |
| CAS: 114542-45-9 Use(s): natural substances and extractives | |
| honyumine | |
| CAS: 100595-86-6 Use(s): natural substances and extractives | |
| hop ether | |
| CAS: 19901-95-2 Use(s): natural substances and extractives | |
| hops beta acids | |
| Use(s): antimicrobial agents | |
| hordatine A | |
| CAS: 7073-64-5 Use(s): natural substances and extractives | |
| hordatine B | |
| CAS: 10502-21-3 Use(s): natural substances and extractives | |
| hordenine | |
| CAS: 539-15-1 Use(s): cosmetic ingredient for skin protecting | |
| hotrienol | |
| CAS: 20053-88-7 JECFA: 1154 Use(s): flavor and fragrance agents | |
| hovenidulcigenin A | |
| CAS: 171499-81-3 Use(s): natural substances and extractives | |
| hovenidulcigenin B | |
| CAS: 182173-50-8 Use(s): natural substances and extractives | |
| hovenidulcioside A1 | |
| CAS: 171499-79-9 Use(s): natural substances and extractives | |
| hovenidulcioside A2 | |
| CAS: 171499-80-2 Use(s): natural substances and extractives | |
| hovenidulcioside B1 | |
| CAS: 174902-16-0 Use(s): natural substances and extractives | |
| hovenidulcioside B2 | |
| CAS: 174902-17-1 Use(s): natural substances and extractives | |
| hovenine A | |
| CAS: 52309-78-1 Use(s): natural substances and extractives | |
| hovenitin I | |
| CAS: 71106-82-6 Use(s): natural substances and extractives | |
| hovenolactone | |
| CAS: 85206-97-9 Use(s): natural substances and extractives | |
| hovenoside D | |
| CAS: 68144-22-9 Use(s): natural substances and extractives | |
| huajiaosimuline | |
| CAS: 155416-21-0 Use(s): natural substances and extractives | |
| hulupone | |
| CAS: 468-62-2 Use(s): natural substances and extractives | |
| iso | humbertiol A |
| CAS: NF0186 Use(s): natural substances and extractives | |
| iso | humbertiol B |
| CAS: NF0184 Use(s): natural substances and extractives | |
| iso | humbertiol C |
| CAS: NF0187 Use(s): natural substances and extractives | |
| iso | humbertiol D |
| CAS: NF0185 Use(s): natural substances and extractives | |
| huminol M | |
| CAS: 84681-92-5 EC: 283-553-2 Use(s): fragrance agents | |
| humuladienone | |
| CAS: 24405-90-1 Use(s): natural substances and extractives | |
| (1E,6E)-gamma- | humulene |
| CAS: 26259-79-0 Use(s): natural substances and extractives | |
| alpha- | humulene |
| CAS: 6753-98-6 EC: 229-816-7 FLAVIS: 01.043 Use(s): flavoring agents | |
| beta- | humulene |
| CAS: 116-04-1 Use(s): natural substances and extractives | |
| iso | humulene |
| CAS: NF0188 Use(s): natural substances and extractives | |
| humulene diepoxide | |
| CAS: 11066-50-5 Use(s): natural substances and extractives | |
| humulene diepoxide A | |
| CAS: 118899-63-1 Use(s): natural substances and extractives | |
| humulene epoxide III | |
| CAS: 21624-36-2 Use(s): natural substances and extractives | |
| humulene oxide I | |
| CAS: 19888-33-6 Use(s): natural substances and extractives | |
| humulene oxide II | |
| CAS: 19888-34-7 Use(s): natural substances and extractives | |
| humulene-1,2-epoxide | |
| CAS: NF0331 Use(s): natural substances and extractives | |
| humulene-8-hydroperoxide | |
| CAS: 228565-88-6 Use(s): natural substances and extractives | |
| humulenol | |
| CAS: 19888-01-8 Use(s): natural substances and extractives | |
| humulenol II | |
| CAS: 19888-00-7 Use(s): natural substances and extractives | |
| humulenone II | |
| CAS: 19888-05-2 Use(s): natural substances and extractives | |
| humulinic acid | |
| CAS: 520-40-1 Use(s): natural substances and extractives | |
| humulinic acid A | |
| CAS: 24184-12-1 Use(s): natural substances and extractives | |
| humulinic acid B | |
| CAS: 26892-78-4 Use(s): natural substances and extractives | |
| humulinone | |
| CAS: 981-03-3 Use(s): natural substances and extractives | |
| iso | humulinone A |
| CAS: 83680-60-8 Use(s): natural substances and extractives | |
| humulol | |
| CAS: 24405-58-1 Use(s): natural substances and extractives | |
| (R)- | humulon |
| CAS: 26472-41-3 EC: 247-725-0 Use(s): natural substances and extractives | |
| alpha- | humulone |
| CAS: 23510-81-8 Use(s): natural substances and extractives | |
| iso | humulone |
| CAS: 25522-96-7 EC: 247-072-1 Use(s): natural substances and extractives | |
| huntite | |
| CAS: 19569-21-2 Use(s): indirect food additives: adhesives and components of coatings | |
| hyacinth acetals | |
| CAS: 29895-73-6 EC: 249-934-2 FEMA: 2877 JECFA: 1004 FLAVIS: 06.007 Use(s): flavor and fragrance agents | |
| 1,3- | hyacinth acetal |
| CAS: 4740-79-8 EC: 225-249-4 Use(s): fragrance agents | |
| 1,2- | hyacinth acetal |
| CAS: 5694-72-4 EC: 227-164-8 Use(s): fragrance agents | |
| hyacinth butanal | |
| CAS: 16251-77-7 EC: 240-362-9 Use(s): fragrance agents | |
| hyacinth ether | |
| CAS: 80858-47-5 EC: 279-576-2 Use(s): fragrance agents | |
| hyaluronic acid | |
| CAS: 9004-61-9 EC: 232-678-0 Use(s): nutrient adjuncts, dietary supplements, nutrient agents | |
| hydnocarpin | |
| CAS: 51419-48-8 Use(s): natural substances and extractives | |
| neo | hydnocarpin |
| CAS: 71417-57-7 Use(s): natural substances and extractives | |
| hydnowightin | |
| CAS: 71392-06-8 Use(s): natural substances and extractives | |
| hydrangenol | |
| CAS: 480-47-7 Use(s): natural substances and extractives | |
| hydratopyrrhoxanthinol | |
| CAS: 120416-68-4 Use(s): natural substances and extractives | |
| alpha- | hydro-omega-hydroxy poly(ocyethylene) poly(oxypropylene) poly(oxyethylene) (15 mole minimum) blocked copolymer, low erucic acid rapeseed oil |
| CAS: 977174-28-9 Use(s): antifoaming (or defoaming) agents | |
| hydroabietyl alcohol | |
| CAS: 26266-77-3 EC: 247-574-0 Use(s): information only not used for fragrances or flavors | |
| meso- | hydrobenzoin |
| CAS: 579-43-1 Use(s): information only not used for fragrances or flavors | |
| hydrocarbon oils | |
| CAS: 8020-83-5 Use(s): solvents | |
| hydrocellulose | |
| CAS: 9034-34-8 Use(s): information only not used for fragrances or flavors | |
| hydrochlorofluorocarbon 22 | |
| CAS: 75-45-6 EC: 200-871-9 Use(s): propellants, aerating agents, and gas | |
| hydrocinnamoin | |
| CAS: 4403-20-7 EC: 224-541-9 Use(s): information only not used for fragrances or flavors | |
| hydrocotarnine hydrobromide | |
| CAS: 5985-00-2 Use(s): information only not used for fragrances or flavors | |
| hydrocyanic acid | |
| CAS: 74-90-8 EC: 200-821-6 Use(s): natural substances and extractives | |
| hydrofluorocarbon 152A | |
| CAS: 75-37-6 EC: 200-866-1 Use(s): propellants, aerating agents, and gas | |
| hydrogen pentyl disulfide | |
| CAS: 86849-52-7 Use(s): natural substances and extractives | |
| hydrogen sulfide | |
| CAS: 7783-06-4 EC: 231-977-3 FEMA: 3779 FLAVIS: 16.007 Use(s): sanitizing agents for food processing equipment | |
| hydrojasmal | |
| CAS: 68411-59-6 EC: 270-133-9 Use(s): fragrance agents | |
| hydroquinine | |
| CAS: 522-66-7 EC: 208-334-0 Use(s): natural substances and extractives | |
| para- | hydroquinone |
| CAS: 123-31-9 EC: 204-617-8 FLAVIS: 04.083 Use(s): stabilizing agents | |
| hydroquinone diacetate | |
| CAS: 1205-91-0 EC: 214-887-9 Use(s): information only not used for fragrances or flavors | |
| hydrorobinetin | |
| CAS: 4382-33-6 EC: 224-486-0 Use(s): natural substances and extractives | |
| 7- | hydroxcoumarin |
| CAS: 93-35-6 EC: 202-240-3 Use(s): natural substances and extractives | |
| hydroxocobalamin | |
| CAS: 13422-51-0 EC: 236-533-2 Use(s): special dietary and nutritional additives | |
| 3- | hydroxy-1-(4-hydroxyphenyl)-1-propanone |
| CAS: 53170-93-7 Use(s): natural substances and extractives | |
| 8- | hydroxy-1-methoxy-3-methylanthraquinone |
| CAS: 67116-22-7 Use(s): natural substances and extractives | |
| (E)-13- | hydroxy-10-oxo-11-octadecenoic acid |
| CAS: 28979-44-4 Use(s): natural substances and extractives | |
| 16- | hydroxy-10-oxohexadecanoic acid |
| CAS: 53833-25-3 Use(s): natural substances and extractives | |
| 8alpha-8- | hydroxy-12-oxo-13-abieten-18-oic acid |
| CAS: 130252-62-9 Use(s): natural substances and extractives | |
| 18- | hydroxy-16-tritriacontanone |
| CAS: 97191-42-9 Use(s): natural substances and extractives | |
| ent-17- | hydroxy-16b-kauran-19-al |
| CAS: 41756-43-8 Use(s): natural substances and extractives | |
| 4'- | hydroxy-2-biphenylcarboxylic acid |
| CAS: 67526-82-3 Use(s): natural substances and extractives | |
| (E)-9- | hydroxy-2-decenoic acid |
| CAS: 1422-28-2 Use(s): natural substances and extractives | |
| 7- | hydroxy-2-methylisoflavone |
| CAS: 2859-88-3 Use(s): natural substances and extractives | |
| 6- | hydroxy-2-naphthalenecarboxylic acid |
| CAS: 16712-64-4 EC: 240-759-7 Use(s): indirect food additives: adhesives and components of coatings | |
| cis-4- | hydroxy-2-nonenal |
| CAS: 18286-49-2 Use(s): natural substances and extractives | |
| (±)-3- | hydroxy-2-pentanone |
| CAS: 118712-30-4 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-2-pentenal |
| CAS: 16931-17-2 Use(s): information only not used for fragrances or flavors | |
| L-cis-5- | hydroxy-2-piperidinecarboxylic acid |
| CAS: 63088-78-8 Use(s): natural substances and extractives | |
| L-trans-5- | hydroxy-2-piperidinecarboxylic acid |
| CAS: 50439-45-7 Use(s): natural substances and extractives | |
| 5- | hydroxy-2,3-dimethyl-1,4-naphthoquinone |
| CAS: 80596-51-6 Use(s): natural substances and extractives | |
| 1alpha-1- | hydroxy-2,4(18),11(13)-eudesmatrien-12-oic acid |
| CAS: 135594-81-9 Use(s): natural substances and extractives | |
| 7- | hydroxy-2,5-dimethyl-4H-1-benzopyran-4-one |
| CAS: 38412-47-4 Use(s): natural substances and extractives | |
| 7- | hydroxy-2',3',4'-trimethoxyisoflavan |
| CAS: 136027-12-8 Use(s): natural substances and extractives | |
| 2- | hydroxy-22-methyltetracosanoic acid |
| CAS: 52900-16-0 Use(s): natural substances and extractives | |
| 4- | hydroxy-2H-1-benzopyran-2-one |
| CAS: 3690-05-9 Use(s): natural substances and extractives | |
| ax-4''- | hydroxy-3-'-methoxymaysin |
| CAS: 169132-06-3 Use(s): natural substances and extractives | |
| 4- | hydroxy-3-(16-methylheptadecyl)-2H-pyran-2-one |
| CAS: 203300-23-6 Use(s): natural substances and extractives | |
| 7- | hydroxy-3-(3-hydroxy-4-methoxybenzyl)-5-methoxy-4-chromanone |
| CAS: 107585-73-9 Use(s): natural substances and extractives | |
| 5- | hydroxy-3-(4-hydroxybenzyl)-7,8-dimethoxy-4-chromanone |
| CAS: 93078-82-1 Use(s): natural substances and extractives | |
| 2- | hydroxy-3-(4-methoxyphenyl)propanoic acid |
| CAS: 28030-15-1 Use(s): natural substances and extractives | |
| 8- | hydroxy-3-methoxy-1-methylanthraquinone-2-carboxylic acid |
| CAS: 176327-86-9 Use(s): natural substances and extractives | |
| 10- | hydroxy-3-methoxy-1,3,5,7-cadinatetraen-9-one |
| CAS: 72843-51-7 Use(s): natural substances and extractives | |
| 3-(4- | hydroxy-3-methoxyphenyl)-1,2-propanediol |
| CAS: 220006-74-6 Use(s): natural substances and extractives | |
| 7-(4- | hydroxy-3-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone |
| CAS: 83161-95-9 Use(s): natural substances and extractives | |
| 1-(4- | hydroxy-3-methoxyphenyl)-7-phenyl-3,5-heptanedione |
| CAS: 83161-94-8 Use(s): natural substances and extractives | |
| 2-[2-(4- | hydroxy-3-methoxyphenyl)ethyl]-5-octylfuran |
| CAS: 143114-92-5 Use(s): natural substances and extractives | |
| 3- | methyl salicylaldehyde |
| CAS: 824-42-0 Use(s): natural substances and extractives | |
| 1- | hydroxy-3-octanone |
| CAS: 7786-52-9 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-3-phenyl coumarin |
| CAS: 1786-05-6 Use(s): natural substances and extractives | |
| 7- | hydroxy-3,3',4',5,6,8-hexamethoxyflavone |
| CAS: 185678-89-1 Use(s): natural substances and extractives | |
| 5- | hydroxy-3,3',4',6,7,8-hexamethoxyflavone |
| CAS: 1176-88-1 Use(s): natural substances and extractives | |
| 2-[2- | hydroxy-3,5-bis(1,1-dimethylbenzyl)phenyl]benzotriazole |
| CAS: 70321-86-7 EC: 274-570-6 Use(s): indirect food additives: adhesives and components of coatings | |
| 2-(1-(2- | hydroxy-3,5-di-tert-pentyl phenyl)ethyl)-4,6-di-tert-pentyl phenyl acrylate |
| CAS: 123968-25-2 EC: 413-850-6 Use(s): indirect food additives: adhesives and components of coatings | |
| (S-(R*,R*))-1-(4- | hydroxy-3,5-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)-3,5-heptanediol |
| CAS: 145888-84-2 Use(s): natural substances and extractives | |
| 2-(2'- | hydroxy-3,5'-di-tert-butylphenyl)-5-chlorobenzotriazole |
| CAS: 3864-99-1 EC: 223-383-8 Use(s): indirect food additives: adhesives and components of coatings | |
| 4- | hydroxy-3,6-dimethyl-2H-pyran-2-one |
| CAS: 5192-62-1 Use(s): natural substances and extractives | |
| 1- | hydroxy-3,6,7-trimethoxy-2,8-diprenylxanthone |
| CAS: 15404-76-9 Use(s): natural substances and extractives | |
| 5-(6- | hydroxy-3,7-dimethyl-2,7-octadienyloxy)-7-methoxycoumarin |
| CAS: 40520-59-0 Use(s): natural substances and extractives | |
| 7- | hydroxy-3',4',5,6-tetramethoxyflavone |
| CAS: 40983-99-1 Use(s): natural substances and extractives | |
| 7- | hydroxy-3',4',5,6,8-pentamethoxyflavone |
| CAS: 149402-88-0 Use(s): natural substances and extractives | |
| 2'- | hydroxy-3',4',5',7,8-pentamethoxyflavan |
| CAS: 133342-92-4 Use(s): natural substances and extractives | |
| 5- | hydroxy-3',4',7,8-tetramethoxyflavone |
| CAS: 13003-74-2 Use(s): natural substances and extractives | |
| 4'- | hydroxy-3',5,6,7,8-pentamethoxyflavone |
| CAS: 34810-62-3 Use(s): natural substances and extractives | |
| (R)-5- | hydroxy-4-(4´-hydroxy-3´-methoxyphenyl)-7-methylchroman-2-one |
| CAS: 1793064-68-2 FEMA: 4834 Use(s): flavoring agents | |
| 6- | hydroxy-4-methoxy-3-(3-methyl-2-butenyl)-2-(2-phenylethenyl)benzoic acid |
| CAS: 87402-83-3 Use(s): natural substances and extractives | |
| 1-(3- | hydroxy-4-methoxyphenyl)-1,2-ethanediol |
| CAS: 213466-88-7 Use(s): natural substances and extractives | |
| 2- | hydroxy-4-n-hexyloxybenzophenone |
| CAS: 3293-97-8 Use(s): indirect food additives: adhesives and components of coatings | |
| 6- | hydroxy-4,6-dimethyl-3-hepten-2-one |
| CAS: 83348-17-8 Use(s): natural substances and extractives | |
| 3'- | hydroxy-4',5,6,7,8-pentamethoxyflavone |
| CAS: 112448-39-2 Use(s): natural substances and extractives | |
| 3'- | hydroxy-4',5',7,8-tetramethoxyflavone |
| CAS: 133342-98-0 Use(s): natural substances and extractives | |
| 2- | hydroxy-5-methyl benzaldehyde |
| CAS: 613-84-3 EC: 210-357-6 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-5-methyl-3(2H)-thiophenone |
| CAS: 26494-09-7 Use(s): information only not used for fragrances or flavors | |
| 4'- | Hydroxy-5,6,7,8-tetramethoxyflavone |
| CAS: 36950-98-8 Use(s): natural substances and extractives | |
| 2- | hydroxy-6-(8,11,14-pentadecatrienyl)benzoic acid |
| CAS: 103904-73-0 Use(s): natural substances and extractives | |
| 7- | hydroxy-6-methoxy-alpha-pyrufuran |
| CAS: 167278-45-7 Use(s): natural substances and extractives | |
| 4- | hydroxy-6-methyl-3-(1-oxobutyl)-2H-pyran-2-one |
| CAS: 22073-85-4 Use(s): natural substances and extractives | |
| 28- | hydroxy-6-methyl-5-tritriacontanone |
| CAS: 239091-54-4 Use(s): natural substances and extractives | |
| 5- | hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenyl-3-heptanone |
| CAS: 79559-61-8 Use(s): natural substances and extractives | |
| 5- | hydroxy-7-(4-hydroxyphenyl)-1-phenyl-3-heptanone |
| CAS: 83161-96-0 Use(s): natural substances and extractives | |
| 5- | hydroxy-7-methoxy-2-tritriacontyl-4H-1-benzopyran-4-one |
| CAS: 144049-68-3 Use(s): natural substances and extractives | |
| 5- | hydroxy-7-methoxy-6-methylflavone |
| CAS: 55969-57-8 Use(s): natural substances and extractives | |
| 28- | hydroxy-7-octacosanone |
| CAS: 138416-85-0 Use(s): natural substances and extractives | |
| 4-(3- | hydroxy-7-phenyl-6-heptenyl)-1,2-benzenediol |
| CAS: 158697-56-4 Use(s): natural substances and extractives | |
| 5- | hydroxy-7,8-dimethoxyflavonol |
| CAS: 22399-73-1 Use(s): natural substances and extractives | |
| (E)-10- | hydroxy-8-decenoic acid |
| CAS: 106541-97-3 Use(s): natural substances and extractives | |
| 4- | hydroxy-8-methoxy-2H-furo[2,3-h]-1-benzopyran-2-one |
| CAS: 196503-96-5 Use(s): natural substances and extractives | |
| 13- | hydroxy-9-methoxy-10-oxo-11-octadecenoic acid |
| CAS: 150147-08-3 Use(s): natural substances and extractives | |
| 11- | hydroxy-9-tridecenoic acid |
| CAS: 105798-56-9 Use(s): natural substances and extractives | |
| 6- | hydroxy-alpha-pyrufuran |
| CAS: 167278-43-5 Use(s): natural substances and extractives | |
| hydroxy-alpha-sanshool | |
| CAS: 83883-10-7 Use(s): natural substances and extractives | |
| 4- | hydroxy-beta-ionol |
| CAS: 27185-80-4 Use(s): natural substances and extractives | |
| 9-[1- | hydroxy-ethyl]-4-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene |
| Use(s): information only not used for fragrances or flavors | |
| hydroxy-gamma-sanshool | |
| CAS: 78886-66-5 Use(s): natural substances and extractives | |
| 2- | hydroxyacetaldehyde |
| CAS: 141-46-8 EC: 205-484-9 Use(s): natural substances and extractives | |
| 2'- | hydroxyacetophenone |
| CAS: 118-93-4 EC: 204-288-0 FEMA: 3548 JECFA: 727 FLAVIS: 07.124 Use(s): flavor and fragrance agents | |
| 3'- | hydroxyacetophenone |
| CAS: 121-71-1 EC: 204-494-0 Use(s): natural substances and extractives | |
| 4'- | hydroxyacetophenone |
| CAS: 99-93-4 EC: 202-802-8 FEMA: 4330 JECFA: 2040 FLAVIS: 07.243 Use(s): cosmetic and flavor agents | |
| omega- | hydroxyacetophenone |
| CAS: 582-24-1 EC: 209-480-8 Use(s): natural substances and extractives | |
| hydroxyachillin | |
| CAS: 10180-88-8 Use(s): natural substances and extractives | |
| 1- | hydroxyacorenone |
| CAS: 185154-98-7 Use(s): natural substances and extractives | |
| 2- | hydroxyacorenone |
| CAS: 185154-94-3 Use(s): natural substances and extractives | |
| 2- | hydroxyalantolactone |
| CAS: 68776-45-4 Use(s): natural substances and extractives | |
| 1beta- | hydroxyalantolactone |
| CAS: 68776-47-6 Use(s): natural substances and extractives | |
| hydroxyambran | |
| CAS: 118562-73-5 EC: 411-410-8 Use(s): fragrance agents | |
| 11-beta- | hydroxyandrosterone |
| CAS: 57-61-4 Use(s): information only not used for fragrances or flavors | |
| hydroxyanigorufone | |
| CAS: 56252-02-9 Use(s): natural substances and extractives | |
| butylated | hydroxyanisole |
| CAS: 25013-16-5 EC: 246-563-8 FEMA: 2183 Use(s): antioxidants and preservatives for fragrance and flavor | |
| 3- | hydroxyanthranilic acid |
| CAS: 548-93-6 EC: 208-962-5 Use(s): natural substances and extractives | |
| 1alpha- | hydroxyarbusculin A |
| CAS: 50301-94-5 Use(s): natural substances and extractives | |
| 9- | hydroxyasimicinone |
| CAS: 255900-36-8 Use(s): natural substances and extractives | |
| 3- | hydroxyaspartic acid |
| CAS: 1860-87-3 Use(s): natural substances and extractives | |
| 2- | hydroxybenzaldehyde |
| CAS: 90-02-8 EC: 201-961-0 FEMA: 3004 JECFA: 897 FLAVIS: 05.055 Use(s): flavor and fragrance agents | |
| 3- | hydroxybenzaldehyde |
| CAS: 100-83-4 EC: 202-892-9 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxybenzaldehyde |
| CAS: 123-08-0 EC: 204-599-1 FEMA: 3984 JECFA: 956 FLAVIS: 05.047 Use(s): flavor and fragrance agents | |
| 2- | hydroxybenzenepropanoic acid |
| CAS: 495-78-3 Use(s): natural substances and extractives | |
| 2- | hydroxybenzothiazole |
| CAS: 934-34-9 EC: 213-281-1 Use(s): natural substances and extractives | |
| 2- | hydroxybenzyl alcohol |
| CAS: 90-01-7 EC: 201-960-5 Use(s): natural substances and extractives | |
| 3- | hydroxybenzyl alcohol |
| CAS: 620-24-6 EC: 210-633-6 Use(s): natural substances and extractives | |
| 4- | hydroxybenzyl alcohol |
| CAS: 623-05-2 EC: 210-768-0 FEMA: 3987 JECFA: 955 FLAVIS: 02.165 Use(s): flavor and fragrance agents | |
| 4- | hydroxybenzyl amine |
| CAS: 696-60-6 Use(s): natural substances and extractives | |
| 4- | hydroxybenzyl cyanide |
| CAS: 14191-95-8 EC: 238-046-0 Use(s): natural substances and extractives | |
| 4- | hydroxybenzyl ethyl ether |
| CAS: 57726-26-8 EC: 260-918-4 FLAVIS: 04.091 Use(s): flavoring agents | |
| 4- | hydroxybenzyl isothiocyanate |
| CAS: 2086-86-4 Use(s): natural substances and extractives | |
| 12- | hydroxy-E-gamma-bisabolene |
| CAS: 99112-26-2 Use(s): natural substances and extractives | |
| 3- | hydroxy-2-oxobutanoic acid |
| CAS: 1944-42-9 Use(s): information only not used for fragrances or flavors | |
| 1- | hydroxy-2-butanone |
| CAS: 5077-67-8 EC: 225-790-6 FEMA: 3173 JECFA: 1717 FLAVIS: 07.090 Use(s): flavor and fragrance agents | |
| 4- | hydroxy-2-butanone |
| CAS: 590-90-9 EC: 209-693-6 Use(s): natural substances and extractives | |
| 1-(2- | hydroxy-4-isobutoxyphenyl)-3-(pyridin-2-yl)propan-1-one |
| CAS: 1190230-47-7 FEMA: 4722 JECFA: 2159 Use(s): flavoring agents | |
| (R)-3- | hydroxybutyl (R)-3-hydroxybutyrate |
| Use(s): food additive | |
| 2- | hydroxybutyric acid |
| CAS: 565-70-8 Use(s): natural substances and extractives | |
| 3- | hydroxybutyric acid |
| CAS: 300-85-6 EC: 206-099-9 Use(s): natural substances and extractives | |
| 14- | hydroxy-delta-cadinene |
| CAS: 153408-92-5 Use(s): natural substances and extractives | |
| 10- | hydroxycalamene-8,9-epoxide |
| CAS: NF0469 Use(s): natural substances and extractives | |
| 5- | hydroxycalamenene |
| CAS: 95908-33-1 Use(s): natural substances and extractives | |
| hydroxycapric acid | |
| CAS: 5393-81-7 Use(s): cosmetic agents | |
| 3- | hydroxycarbofuran angelate |
| CAS: 79189-81-4 Use(s): information only not used for fragrances or flavors | |
| 5- | hydroxycarvone |
| CAS: 56423-48-4 Use(s): natural substances and extractives | |
| 6- | hydroxycarvone |
| CAS: 51200-86-3 FEMA: 4523 JECFA: 2244 Use(s): flavor and fragrance agents | |
| (R)-6- | hydroxycarvone |
| CAS: NF0091 Use(s): information only not used for fragrances or flavors | |
| 9- | hydroxycarvone |
| CAS: 151910-94-0 Use(s): information only not used for fragrances or flavors | |
| 6- | hydroxycarvotanacetone |
| CAS: 131486-99-2 Use(s): natural substances and extractives | |
| 8- | hydroxycarvotanacetone |
| CAS: 7712-46-1 Use(s): natural substances and extractives | |
| 14- | hydroxy-9-epi-(E)-caryophyllene |
| CAS: 79768-25-5 Use(s): natural substances and extractives | |
| 14- | hydroxy-9-epi-beta-caryophyllene |
| CAS: NF0192 Use(s): natural substances and extractives | |
| 14- | hydroxy-beta-caryophyllene |
| CAS: NF0193 Use(s): natural substances and extractives | |
| 14- | hydroxycaryophyllene oxide |
| CAS: 73510-14-2 Use(s): natural substances and extractives | |
| 5'- | hydroxycastavinol |
| CAS: 183607-17-2 Use(s): natural substances and extractives | |
| 2- | hydroxychalcone |
| CAS: 644-78-0 EC: 211-422-1 Use(s): natural substances and extractives | |
| 2'- | hydroxychalcone |
| CAS: 1214-47-7 EC: 214-928-0 Use(s): natural substances and extractives | |
| 4- | hydroxychalcone |
| CAS: 20426-12-4 Use(s): natural substances and extractives | |
| 4'- | hydroxychalcone |
| CAS: 2657-25-2 Use(s): natural substances and extractives | |
| 2- | hydroxychavicol |
| CAS: 1126-61-0 Use(s): natural substances and extractives | |
| 1'- | hydroxychavicol acetate |
| CAS: 101135-02-8 Use(s): natural substances and extractives | |
| exo-2- | hydroxycineole |
| CAS: 18679-48-6 Use(s): natural substances and extractives | |
| 2- | hydroxycinnamaldehyde |
| CAS: 3541-42-2 Use(s): natural substances and extractives | |
| 2- | hydroxycinnamaldehyde acetate |
| CAS: 33538-94-2 Use(s): information only not used for fragrances or flavors | |
| (E)-meta- | hydroxycinnamic acid |
| CAS: 14755-02-3 Use(s): natural substances and extractives | |
| (Z)-ortho- | hydroxycinnamic acid |
| CAS: 495-79-4 Use(s): natural substances and extractives | |
| (E)-para- | hydroxycinnamic acid |
| CAS: 501-98-4 Use(s): natural substances and extractives | |
| (Z)-para- | hydroxycinnamic acid |
| CAS: 4501-31-9 EC: 224-813-7 Use(s): natural substances and extractives | |
| hydroxycitronellal | |
| CAS: 107-75-5 EC: 203-518-7 FEMA: 2583 JECFA: 611 FLAVIS: 05.012 Use(s): flavor and fragrance agents | |
| (R)- | hydroxycitronellal |
| CAS: 34212-48-1 Use(s): flavor and fragrance agents | |
| (S)- | hydroxycitronellal |
| CAS: 34212-53-8 Use(s): flavor and fragrance agents | |
| hydroxycitronellal / skatole schiff's base | |
| CAS: 68585-09-1 EC: 271-550-9 Use(s): fragrance agents | |
| hydroxycitronellal diethyl acetal | |
| CAS: 7779-94-4 EC: 231-945-9 FEMA: 2584 JECFA: 613 FLAVIS: 06.010 Use(s): flavor and fragrance agents | |
| hydroxycitronellal diisotridecyl acetal | |
| CAS: 67923-85-7 EC: 267-789-3 Use(s): fragrance agents | |
| hydroxycitronellal dimethyl acetal | |
| CAS: 141-92-4 EC: 205-510-9 FEMA: 2585 JECFA: 612 FLAVIS: 06.011 Use(s): flavor and fragrance agents | |
| hydroxycitronellal distillation residue distillates | |
| CAS: 68909-04-6 EC: 272-689-8 Use(s): fragrance agents | |
| hydroxycitronellal / indole schiff's base | |
| CAS: 68527-79-7 EC: 271-284-3 Use(s): fragrance agents | |
| hydroxycitronellal / methyl anthranilate schiff's base | |
| CAS: 89-43-0 EC: 201-908-1 Use(s): flavor and fragrance agents | |
| hydroxycitronellal nitrile | |
| CAS: 68797-68-2 EC: 272-309-0 Use(s): fragrance agents | |
| hydroxycitronellal propylene glycol acetal | |
| CAS: 93804-64-9 EC: 298-441-9 FEMA: 4485 JECFA: 1975 Use(s): flavor and fragrance agents | |
| hydroxycitronellal replacer | |
| Use(s): fragrance agents | |
| hydroxycitronellal residue | |
| CAS: 72968-30-0 EC: 277-134-3 Use(s): fragrance agents | |
| hydroxycitronellol | |
| CAS: 107-74-4 EC: 203-517-1 FEMA: 2586 JECFA: 610 FLAVIS: 02.047 Use(s): flavor and fragrance agents | |
| 3- | hydroxycoumarin |
| CAS: 939-19-5 EC: 213-355-3 Use(s): natural substances and extractives | |
| 4- | hydroxycoumarin |
| CAS: 1076-38-6 EC: 214-060-2 Use(s): natural substances and extractives | |
| 6- | hydroxycoumarin |
| CAS: 6093-68-1 Use(s): natural substances and extractives | |
| 7- | hydroxy-6,11-cyclofarnes-3(15)-en-2-one |
| CAS: 145631-62-5 Use(s): natural substances and extractives | |
| 2- | hydroxy-1-cyclohexanone |
| CAS: 533-60-8 EC: 208-570-4 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxycyclohexanone |
| CAS: 823-19-8 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxy-2-cyclohexenone |
| CAS: 10316-66-2 FEMA: 3458 JECFA: 424 FLAVIS: 07.119 Use(s): flavoring agents | |
| hydroxycyclohexyl methyl ketone | |
| CAS: 1123-27-9 EC: 214-372-9 Use(s): fragrance agents | |
| 2- | hydroxycyclohexyl octanoate |
| CAS: 70092-44-3 EC: 274-311-7 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxy-2-cyclopenten-1-one |
| CAS: 10493-98-8 EC: 234-020-8 Use(s): natural substances and extractives | |
| 3- | hydroxy-2-cyclopentenone |
| CAS: 5870-62-2 Use(s): natural substances and extractives | |
| 4- | hydroxy-2-cyclopentenone |
| CAS: 59995-49-2 Use(s): natural substances and extractives | |
| 3- | hydroxy-beta-damascone |
| CAS: 56915-02-7 EC: 260-430-1 Use(s): natural substances and extractives | |
| trans- | hydroxydavanone |
| CAS: 73395-08-1 Use(s): natural substances and extractives | |
| 3- | hydroxydecane dioic acid |
| CAS: 68812-93-1 Use(s): natural substances and extractives | |
| 3- | hydroxydecanoic acid |
| CAS: 14292-26-3 Use(s): natural substances and extractives | |
| 4- | hydroxydecanoic acid |
| CAS: 17369-51-6 Use(s): natural substances and extractives | |
| 5- | hydroxydecanoic acid |
| CAS: 624-00-0 Use(s): information only not used for fragrances or flavors | |
| 9- | hydroxydecanoic acid |
| CAS: 1422-27-1 Use(s): natural substances and extractives | |
| 6- | hydroxy-5-decanone |
| CAS: 6540-98-3 EC: 229-455-5 Use(s): information only not used for fragrances or flavors | |
| 10- | hydroxydecenoic acid |
| CAS: 765-01-5 Use(s): cosmetic agents | |
| (E)-10- | hydroxy-2-decenoic acid |
| CAS: 14113-05-4 Use(s): natural substances and extractives | |
| 5- | hydroxy-7-decenoic acid lactone |
| CAS: 100428-67-9 Use(s): natural substances and extractives | |
| 4'- | hydroxydehydrokawain |
| CAS: 39986-86-2 Use(s): natural substances and extractives | |
| 4- | hydroxyderricin |
| CAS: 55912-03-3 Use(s): natural substances and extractives | |
| 18- | hydroxydesoxycorticosterone |
| CAS: 379-68-0 EC: 206-834-3 Use(s): information only not used for fragrances or flavors | |
| hydroxydestruxin B | |
| CAS: 250250-96-5 Use(s): natural substances and extractives | |
| 3- | hydroxydihydro-2(3H)-furanone |
| CAS: 19444-84-9 Use(s): information only not used for fragrances or flavors | |
| 4alpha- | hydroxydihydroagarofuran |
| CAS: NF0470 Use(s): natural substances and extractives | |
| hydroxydihydrobovolide | |
| CAS: 6067-11-4 Use(s): natural substances and extractives | |
| 3- | hydroxy-2,3-dihydrofarnesal |
| CAS: 152040-72-7 Use(s): information only not used for fragrances or flavors | |
| 3'- | hydroxydihydroformononetin |
| CAS: 67492-31-3 Use(s): natural substances and extractives | |
| 4- | hydroxy-7,8-dihydro-beta-ionone |
| Use(s): natural substances and extractives | |
| hydroxydihydromaltol | |
| CAS: 28564-83-2 Use(s): natural substances and extractives | |
| 13- | hydroxydihydromelleolide |
| CAS: 130396-92-8 Use(s): natural substances and extractives | |
| (2R,5S,6S)-6- | hydroxydihydrotheaspirane |
| CAS: 57967-68-7 EC: 261-044-6 FEMA: 3549 FLAVIS: 13.076 Use(s): flavor and fragrance agents | |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) |
| CAS: 65620-50-0 FEMA: 3549 JECFA: 1648 FLAVIS: 13.076 Use(s): flavor and fragrance agents | |
| 6- | hydroxydihydrotheaspirane |
| CAS: 53398-90-6 Use(s): flavoring agents | |
| (2R,5R,6R)-6- | hydroxydihydrotheaspirane |
| CAS: 57967-70-1 EC: 261-046-7 Use(s): information only not used for fragrances or flavors | |
| (2R,5R,6S)-6- | hydroxydihydrotheaspirane |
| CAS: 57967-71-2 EC: 261-047-2 Use(s): information only not used for fragrances or flavors | |
| (2R,5S,6R)-6- | hydroxydihydrotheaspirane |
| CAS: 57967-69-8 EC: 261-045-1 Use(s): information only not used for fragrances or flavors | |
| hydroxydimethyl cyclopentenone | |
| CAS: 21835-00-7 EC: 244-604-4 Use(s): fragrance agents | |
| 2- | hydroxy-3,5-dimethyl-2-cyclopenten-1-one |
| CAS: 21834-98-0 EC: 244-603-9 Use(s): information only not used for fragrances or flavors | |
| 6- | hydroxy-2,6-dimethyl-2,7-octadien-4-one |
| CAS: 64661-54-7 Use(s): natural substances and extractives | |
| (1R,4S)-1- | hydroxy-1,4-dimethyl spiro(4.6)undecan-2-one |
| CAS: NF0139 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-2,5-dimethyl thiophen-3(2H)-one |
| CAS: 26494-10-0 EC: 247-742-3 FLAVIS: 15.077 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxydodecanoic acid |
| CAS: 1883-13-2 Use(s): information only not used for fragrances or flavors | |
| 11- | hydroxydodecanoic acid |
| CAS: 32459-66-8 Use(s): natural substances and extractives | |
| 12- | hydroxydodecanoic acid |
| CAS: 505-95-3 EC: 208-025-0 Use(s): natural substances and extractives | |
| cis-12a- | hydroxydolineone |
| CAS: 28617-71-2 Use(s): natural substances and extractives | |
| omega- | hydroxyemodin |
| CAS: 481-73-2 Use(s): natural substances and extractives | |
| 1- | hydroxyepiacorone |
| CAS: 185154-96-5 Use(s): natural substances and extractives | |
| 12alpha- | hydroxyerosone |
| CAS: 66322-32-5 Use(s): natural substances and extractives | |
| 22alpha- | hydroxyerythrodiol |
| CAS: 20475-26-7 Use(s): natural substances and extractives | |
| 1'- | hydroxyestragole |
| CAS: 51410-44-7 Use(s): natural substances and extractives | |
| 1,3-bis(2- | hydroxyethoxy)benzene |
| CAS: 102-40-9 EC: 203-028-3 Use(s): indirect food additives: adhesives and components of coatings | |
| 2- | hydroxyethyl acrylate |
| CAS: 818-61-1 EC: 212-454-9 Use(s): indirect food additives: adhesives and components of coatings | |
| 2- | hydroxyethyl-beta-cyclodextrin |
| CAS: 98513-20-3 Use(s): information only not used for fragrances or flavors | |
| N-(2- | hydroxyethyl)-2,3-dimethyl-2-isopropyl butanamide |
| CAS: 883215-02-9 FEMA: 4602 JECFA: 2010 Use(s): flavor enhancers | |
| N-(2- | hydroxyethyl) (E,Z)-2,6-dodecadienamide |
| Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxyethyl methacrylate |
| CAS: 868-77-9 EC: 212-782-2 Use(s): film forming agents | |
| 5-(1- | hydroxyethyl)-4-methyl thiazole |
| CAS: 45657-12-3 Use(s): information only not used for fragrances or flavors | |
| 9-[1- | hydroxy-ethyl]-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene |
| Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxyethyl phenoxyacetate |
| CAS: 1984-60-7 EC: 217-854-7 Use(s): fragrance agents | |
| 2- | hydroxyethyl thioacetate |
| CAS: 5512-65-2 Use(s): information only not used for fragrances or flavors | |
| hydroxyethyl urea | |
| CAS: 2078-71-9 Use(s): information only not used for fragrances or flavors | |
| 2-(2- | hydroxyethyl) pyridine |
| CAS: 103-74-2 EC: 203-140-2 Use(s): information only not used for fragrances or flavors | |
| bis(2- | hydroxyethyl)-2-hydroxypropyl-3-(dodecyloxy)methylammonium chloride |
| CAS: 6200-40-4 EC: 228-253-4 Use(s): indirect food additives: adhesives and components of coatings | |
| 6-(1- | hydroxyethyl)-2,2-dimethyl-2H-1-benzopyran |
| CAS: 71822-00-9 Use(s): natural substances and extractives | |
| 1-(2- | hydroxyethyl)-4-hydroxy-2,2,6,6-tetramethyl piperidine-succinic acid, dimethyl ester, copolymer |
| CAS: 65447-77-0 Use(s): indirect food additives: adhesives and components of coatings | |
| 2- | hydroxyflavanone |
| CAS: 17348-76-4 Use(s): natural substances and extractives | |
| 4- | hydroxyflavanone |
| CAS: 6515-37-3 Use(s): natural substances and extractives | |
| (±)-6- | hydroxyflavanone |
| CAS: 4250-77-5 Use(s): natural substances and extractives | |
| 7- | hydroxyflavanone |
| CAS: 6515-36-2 Use(s): natural substances and extractives | |
| 3- | hydroxyflavone |
| CAS: 577-85-5 EC: 209-416-9 Use(s): information only not used for fragrances or flavors | |
| 5- | hydroxyflavone |
| CAS: 491-78-1 EC: 207-743-1 Use(s): natural substances and extractives | |
| 6- | hydroxyflavone |
| CAS: 6665-83-4 EC: 229-704-8 Use(s): natural substances and extractives | |
| 7- | hydroxyflavone |
| CAS: 6665-86-7 EC: 229-705-3 Use(s): natural substances and extractives | |
| 7- | hydroxyflavonol |
| CAS: 492-00-2 Use(s): natural substances and extractives | |
| 4- | hydroxy-9-fluorenone |
| CAS: 1986-00-1 Use(s): natural substances and extractives | |
| 8- | hydroxygalangin |
| CAS: 74693-69-9 Use(s): information only not used for fragrances or flavors | |
| 8- | hydroxygenistein |
| CAS: 13539-27-0 Use(s): natural substances and extractives | |
| 3- | hydroxyglabrol |
| CAS: 74148-41-7 Use(s): natural substances and extractives | |
| 24- | hydroxyglabrolide |
| CAS: 98063-18-4 Use(s): natural substances and extractives | |
| 18alpha- | hydroxyglycyrrhetic acid |
| CAS: 17991-67-2 Use(s): natural substances and extractives | |
| 14- | hydroxyguai-1,3,5,9,11-pentaene stearate |
| CAS: 52898-98-3 Use(s): natural substances and extractives | |
| 2- | hydroxyguaia-1(10),11-dien-15-oic acid |
| CAS: NF0471 Use(s): natural substances and extractives | |
| 2- | hydroxyheptanoic acid |
| CAS: 636-69-1 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxyheptanoic acid |
| CAS: 17587-29-0 Use(s): natural substances and extractives | |
| 1- | hydroxy-2-heptanone |
| CAS: 17046-01-4 Use(s): information only not used for fragrances or flavors | |
| 7- | hydroxyheptaphylline |
| CAS: 170663-15-7 Use(s): natural substances and extractives | |
| 2- | hydroxyhexacosanoic acid |
| CAS: 14176-13-7 EC: 238-029-8 Use(s): natural substances and extractives | |
| (R)-2- | hydroxyhexadecanoic acid |
| CAS: 16452-51-0 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxyhexadecanoic acid |
| CAS: 764-67-0 EC: 212-129-1 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxyhexadecanoic acid |
| CAS: 2398-34-7 Use(s): natural substances and extractives | |
| 16- | hydroxyhexadecanoic acid |
| CAS: 506-13-8 EC: 208-028-7 Use(s): natural substances and extractives | |
| (1R,4R)-1- | hydroxy-1,4,7,7,9,9-hexamethyl spiro(4.5)decan-2-one |
| CAS: NF0140 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxyhexanal |
| CAS: 41472-84-8 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxyhexanal |
| CAS: 96013-98-8 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxyhexanal |
| CAS: 109710-36-3 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxyhexanoic acid |
| CAS: 10191-24-9 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxyhexanoic acid |
| CAS: 13532-38-2 Use(s): information only not used for fragrances or flavors | |
| 5- | hydroxyhexanoic acid |
| CAS: 185956-02-9 Use(s): information only not used for fragrances or flavors | |
| 6- | hydroxyhexanoic acid |
| CAS: 1191-25-9 Use(s): natural substances and extractives | |
| 4- | hydroxy-3-hexanone |
| CAS: 4984-85-4 EC: 225-637-3 FLAVIS: 07.167 Use(s): flavoring agents | |
| 4- | hydroxyhexenal |
| CAS: 17427-08-6 Use(s): natural substances and extractives | |
| 2- | hydroxyhippuric acid |
| CAS: 487-54-7 EC: 207-661-6 Use(s): natural substances and extractives | |
| 14- | hydroxy-alpha-humulene |
| CAS: 75678-90-9 Use(s): natural substances and extractives | |
| 7- | hydroxy-6-hydromelodienone |
| CAS: 135626-21-0 Use(s): natural substances and extractives | |
| 4- | hydroxy-2-(hydroxymethyl)-5-methyl furan-3-one |
| CAS: 17678-20-5 Use(s): information only not used for fragrances or flavors | |
| 8- | hydroxyhyperforin 8,1-hemiacetal |
| CAS: 262857-89-6 Use(s): natural substances and extractives | |
| 3- | hydroxy-beta-ionone |
| CAS: NF0194 Use(s): natural substances and extractives | |
| 3- | hydroxy-gamma-ionone |
| CAS: 116296-75-4 Use(s): natural substances and extractives | |
| 2- | hydroxyisobutyric acid |
| CAS: 594-61-6 EC: 209-848-8 Use(s): cosmetic agents | |
| 1- | hydroxyisocarvomenthol |
| CAS: 33669-76-0 Use(s): natural substances and extractives | |
| 7- | hydroxyisoflavone |
| CAS: 13057-72-2 Use(s): natural substances and extractives | |
| 21- | hydroxyisoglabrolide |
| CAS: 18184-25-3 Use(s): natural substances and extractives | |
| hydroxyisolongifolaldehyde | |
| CAS: 83454-04-0 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxyisophorone |
| CAS: 4883-60-7 FEMA: 3459 JECFA: 426 FLAVIS: 07.120 Use(s): flavoring agents | |
| 2- | hydroxyisovaleric acid |
| CAS: 4026-18-0 EC: 223-697-5 Use(s): natural substances and extractives | |
| 4- | hydroxyisovaleric acid |
| CAS: 77220-86-1 Use(s): information only not used for fragrances or flavors | |
| beta- | hydroxyisovaleryl shikonin |
| CAS: 7415-78-3 Use(s): natural substances and extractives | |
| 9- | hydroxyladanifer-10-one(9(10(1))-abeo-9-hydroxyaromadendran-10-one) |
| CAS: NF0472 Use(s): natural substances and extractives | |
| 15- | hydroxyleptocarpin |
| CAS: 121541-07-9 Use(s): natural substances and extractives | |
| 8- | hydroxylinalool |
| CAS: 64142-78-5 Use(s): flavor and fragrance agents | |
| (E)-8- | hydroxylinalool |
| CAS: 75991-61-6 Use(s): natural substances and extractives | |
| (Z)-8- | hydroxylinalool |
| CAS: 103619-06-3 Use(s): natural substances and extractives | |
| 5- | hydroxymaltol |
| CAS: 1073-96-7 Use(s): natural substances and extractives | |
| 16- | hydroxy-13-manoyl oxide |
| CAS: 122757-60-2 Use(s): natural substances and extractives | |
| 10- | hydroxy-1,8-para-menthadiene |
| CAS: 15766-66-2 EC: 239-857-2 Use(s): cosmetic fragrance agents and aromatic raw materials | |
| 8- | hydroxy-para-menthan-3-one |
| CAS: 3304-24-3 Use(s): natural substances and extractives | |
| 2- | hydroxy-5-methoxyacetophenone |
| CAS: 705-15-7 EC: 211-882-3 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxy-6-methoxyacetophenone |
| CAS: 703-23-1 EC: 211-872-9 Use(s): natural substances and extractives | |
| 4- | hydroxy-2-methoxybenzaldehyde |
| CAS: 18278-34-7 Use(s): natural substances and extractives | |
| 4- | hydroxy-3-methoxybenzene propanol |
| CAS: 2305-13-7 Use(s): natural substances and extractives | |
| 7- | hydroxy-8-methoxycoumarin |
| CAS: 485-90-5 Use(s): natural substances and extractives | |
| 4-(4- | hydroxy-3-methoxyphenyl) butan-2-ol |
| CAS: 39728-80-8 EC: 254-607-2 Use(s): natural substances and extractives | |
| 3-(4- | hydroxy-3-methoxyphenyl) propionaldehyde |
| CAS: 80638-48-8 EC: 279-524-9 FLAVIS: 05.156 Use(s): flavoring agents | |
| 1-(2- | hydroxy-4-methoxyphenyl)-3-(pyridin-2-yl)propan-1-one |
| CAS: 1190229-37-8 FEMA: 4723 JECFA: 2160 Use(s): flavoring agents | |
| 4- | hydroxy-2-methyl acetophenone |
| CAS: 875-59-2 EC: 212-874-2 Use(s): natural substances and extractives | |
| 4- | hydroxy-3-methyl acetophenone |
| CAS: 876-02-8 EC: 212-880-5 Use(s): natural substances and extractives | |
| 2-( | hydroxymethyl) anthraquinone |
| CAS: 17241-59-7 EC: 241-274-3 Use(s): natural substances and extractives | |
| 4- | hydroxy-3-methyl benzaldehyde |
| CAS: 15174-69-3 Use(s): flavoring agents | |
| 4-( | hydroxymethyl) benzoic acid |
| CAS: 3006-96-0 Use(s): natural substances and extractives | |
| 4- | hydroxy-3-methyl-2-butanone |
| CAS: 3393-64-4 EC: 222-238-6 Use(s): natural substances and extractives | |
| 2- | hydroxy-4-methyl-2-buten-4,1-olide |
| Use(s): information only not used for fragrances or flavors | |
| (±)-2- | hydroxy-3-methyl butyric acid |
| CAS: 600-37-3 EC: 209-994-2 Use(s): natural substances and extractives | |
| hydroxymethyl cellulose | |
| CAS: 37353-59-6 Use(s): indirect food additives: adhesives and components of coatings | |
| 4- | hydroxy-6-methyl coumarin |
| CAS: 13252-83-0 Use(s): natural substances and extractives | |
| 7- | hydroxy-4-methyl coumarin |
| CAS: 90-33-5 EC: 201-986-7 Use(s): natural substances and extractives | |
| 4- | hydroxy-4-methyl-2-cyclohexen-1-one |
| CAS: 70150-56-0 Use(s): natural substances and extractives | |
| 3-(4- | hydroxy-4-methyl cyclohexyl) butanal |
| CAS: NF0042 Use(s): fragrance agents | |
| 1-(2- | hydroxy-4-methyl cyclohexyl) ethanone |
| CAS: 917750-72-2 FEMA: 4742 Use(s): flavoring agents | |
| 2- | hydroxy-5-methyl-2-cyclopenten-1-one |
| CAS: 3250-08-6 Use(s): natural substances and extractives | |
| 3- | hydroxy-2-methyl-2-cyclopentenone |
| CAS: 5870-63-3 Use(s): natural substances and extractives | |
| cis-5- | hydroxy-2-methyl-1,3-dioxane |
| CAS: 3674-23-5 Use(s): natural substances and extractives | |
| trans-5- | hydroxy-2-methyl-1,3-dioxane |
| CAS: 3674-24-6 Use(s): natural substances and extractives | |
| 2- | hydroxy-3-methyl-4-ethyl-2-buten-4,1-olide |
| Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxy-3-methyl-4-ethyl-4-carboxy-2-buten-4,1-olide |
| Use(s): information only not used for fragrances or flavors | |
| 1'- | hydroxymethyl eugenol |
| CAS: 31706-95-3 Use(s): natural substances and extractives | |
| 7- | hydroxy-5-methyl flavone |
| CAS: 15235-99-1 Use(s): natural substances and extractives | |
| 5- | hydroxymethyl furfural |
| CAS: 67-47-0 EC: 200-654-9 FLAVIS: 13.139 Use(s): flavoring agents | |
| 2- | hydroxy-5-methyl-3-hexanone |
| CAS: 246511-74-0 FEMA: 3989 Use(s): flavoring agents | |
| 3- | hydroxy-5-methyl-2-hexanone |
| CAS: 163038-04-8 FEMA: 3989 FLAVIS: 07.260 Use(s): flavoring agents | |
| 3(2)- | hydroxy-5-methyl-2(3)-hexanone |
| CAS: 163038-04-8 FEMA: 3989 JECFA: 2034 Use(s): flavoring agents | |
| 4- | hydroxy-5-methyl-2-hexanone |
| CAS: 38836-21-4 Use(s): natural substances and extractives | |
| hydroxymethyl hexyl ethyl ketone | |
| CAS: 59191-78-5 EC: 261-652-1 FEMA: 3292 JECFA: 1839 FLAVIS: 07.097 Use(s): flavor and fragrance agents | |
| hydroxymethyl longifolene | |
| CAS: 5989-05-9 EC: 227-811-4 Use(s): fragrance agents | |
| hydroxymethyl isolongifolene 50% in dpg | |
| CAS: 59056-64-3 EC: 261-580-0 Use(s): fragrance agents | |
| 2-( | hydroxymethyl) menthol |
| CAS: 51210-01-6 EC: 257-059-2 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxymethyl-6-methyl-pyridine |
| CAS: 1122-71-0 Use(s): information only not used for fragrances or flavors | |
| 1- | hydroxy-4-methyl-2-pentanone |
| CAS: 68113-55-3 FEMA: 4463 JECFA: 1952 Use(s): flavoring agents | |
| butylated | hydroxymethyl phenol |
| CAS: 88-26-6 EC: 201-815-6 Use(s): antioxidants and stabilizers | |
| 3-(2- | hydroxy-4-methylphenyl)-2-butanone |
| CAS: 83810-64-4 Use(s): natural substances and extractives | |
| 2-(2- | hydroxy-4-methyl phenyl)-3-pentanone |
| CAS: 86843-15-4 Use(s): natural substances and extractives | |
| 2- | hydroxy-2-methyl propionaldehyde |
| CAS: 20818-81-9 EC: 244-059-2 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxymethyl pyrazine |
| CAS: 6705-33-5 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxy-5-methyl pyrazine |
| CAS: 20721-17-9 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxy-2-methyl pyridine |
| CAS: 1121-25-1 EC: 214-327-3 Use(s): natural substances and extractives | |
| 5- | hydroxy-2-methyl pyridine |
| CAS: 1121-78-4 EC: 214-337-8 Use(s): natural substances and extractives | |
| 2- | hydroxy-3-methyl quinoline |
| CAS: 2721-59-7 Use(s): natural substances and extractives | |
| hydroxymethyl reductic acid | |
| CAS: 123529-38-4 Use(s): information only not used for fragrances or flavors | |
| 1-(3- | hydroxy-5-methyl-2-thienyl) ethanone |
| CAS: 133860-42-1 FEMA: 4142 JECFA: 1750 Use(s): flavoring agents | |
| 4- | hydroxy-3-(methylthio)butanoic acid lactone |
| CAS: 40587-54-0 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxy-2-methyl valeric acid |
| CAS: 28892-73-1 Use(s): information only not used for fragrances or flavors | |
| (±)-4- | hydroxy-6-methyl-2-heptanone |
| CAS: 57548-36-4 FEMA: 4784 Use(s): flavoring agents | |
| 4- | hydroxy-6-methyl-2-pyrone |
| CAS: 675-10-5 EC: 211-619-2 Use(s): information only not used for fragrances or flavors | |
| (S)-5- | hydroxymethyl-2(5H)-furanone |
| CAS: 78508-96-0 Use(s): natural substances and extractives | |
| 4- | hydroxymethyl-pyridine |
| CAS: 586-95-8 EC: 209-590-6 Use(s): information only not used for fragrances or flavors | |
| N-( | hydroxymethyl) acryl amide |
| CAS: 924-42-5 EC: 213-103-2 Use(s): indirect food additives: adhesives and components of coatings | |
| 2,2-bis( | hydroxymethyl) propionic acid |
| CAS: 4767-03-7 EC: 225-306-3 Use(s): indirect food additives: adhesives and components of coatings | |
| 2-( | hydroxymethyl)benzoic acid |
| CAS: 612-20-4 Use(s): natural substances and extractives | |
| hydroxymethylene tanshinquinone | |
| CAS: 83145-47-5 Use(s): natural substances and extractives | |
| 3- | hydroxymugineic acid |
| CAS: 74235-23-7 Use(s): natural substances and extractives | |
| 14- | hydroxy-alpha-muurolene |
| CAS: 135118-51-3 Use(s): natural substances and extractives | |
| alpha- | hydroxymyristic acid |
| CAS: 2507-55-3 EC: 219-714-0 Use(s): natural substances and extractives | |
| beta- | hydroxymyristic acid |
| CAS: 1961-72-4 Use(s): natural substances and extractives | |
| 2- | hydroxynaringenin |
| CAS: 58124-18-8 Use(s): natural substances and extractives | |
| 3- | hydroxynonanoic acid |
| CAS: 40165-87-5 Use(s): information only not used for fragrances or flavors | |
| (R)-3- | hydroxynonanoic acid |
| CAS: 33796-87-1 Use(s): information only not used for fragrances or flavors | |
| (S)-3- | hydroxynonanoic acid |
| CAS: 45023-83-4 Use(s): information only not used for fragrances or flavors | |
| hydroxynonanone | |
| CAS: 67801-46-1 EC: 267-167-1 Use(s): fragrance agents | |
| p- | hydroxynonanophenone |
| CAS: 14392-69-9 Use(s): natural substances and extractives | |
| 4- | hydroxynonenal |
| CAS: 29343-52-0 Use(s): natural substances and extractives | |
| 7- | hydroxynorbornadiene |
| CAS: 822-80-0 Use(s): natural substances and extractives | |
| 12- | hydroxy-9-octadecanoic acid |
| CAS: 7431-95-0 Use(s): natural substances and extractives | |
| (E)-12- | hydroxy-9-octadecenoic acid |
| CAS: 82188-83-8 Use(s): information only not used for fragrances or flavors | |
| 18- | hydroxy-9-octadecenoic acid |
| CAS: 3329-38-2 Use(s): natural substances and extractives | |
| 3- | hydroxyoctanoic acid |
| CAS: 14292-27-4 Use(s): natural substances and extractives | |
| 4- | hydroxyoctanoic acid |
| CAS: NF0195 Use(s): information only not used for fragrances or flavors | |
| 5- | hydroxyoctanoic acid |
| CAS: 29671-57-6 Use(s): information only not used for fragrances or flavors | |
| 6- | hydroxyoctanoic acid |
| CAS: 64165-18-0 Use(s): information only not used for fragrances or flavors | |
| 7- | hydroxyoctanoic acid |
| CAS: 17173-14-7 Use(s): information only not used for fragrances or flavors | |
| 8- | hydroxyoctanoic acid |
| CAS: 764-89-6 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxy-2-octanone |
| CAS: 37160-77-3 FEMA: 4139 JECFA: 2035 FLAVIS: 07.238 Use(s): flavoring agents | |
| 3- | hydroxyoctyl propionate |
| CAS: 53554-42-0 Use(s): information only not used for fragrances or flavors | |
| (+)-12a- | hydroxypachyrrhizone |
| CAS: 28768-44-7 Use(s): natural substances and extractives | |
| hydroxypelenolide | |
| CAS: 17909-94-3 Use(s): natural substances and extractives | |
| (1R,4S,5S,9R)-1- | hydroxy-1,4,7,7,9-pentamethyl spiro(4.5)decan-2-one |
| CAS: NF0138 Use(s): information only not used for fragrances or flavors | |
| 5- | hydroxypentan-2-one |
| CAS: 1071-73-4 EC: 213-994-8 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxypentanal |
| CAS: 44601-24-3 Use(s): information only not used for fragrances or flavors | |
| 5- | hydroxypentanal |
| CAS: 4221-03-8 EC: 224-165-5 Use(s): information only not used for fragrances or flavors | |
| (R)-3- | hydroxypentane nitrile |
| CAS: 198561-27-2 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxypentanoic acid |
| CAS: 617-31-2 EC: 210-509-1 Use(s): natural substances and extractives | |
| (S)-2- | hydroxypentanoic acid |
| CAS: 41014-93-1 EC: 255-175-8 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxypentanoic acid |
| CAS: 10237-77-1 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxypentanoic acid |
| CAS: 13532-37-1 EC: 236-884-1 Use(s): information only not used for fragrances or flavors | |
| 5- | hydroxypentanoic acid |
| CAS: 13392-69-3 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-2-pentanone |
| CAS: 4161-60-8 EC: 224-003-3 Use(s): natural substances and extractives | |
| 3- | hydroxy-3-penten-2-one |
| CAS: 52704-36-6 Use(s): natural substances and extractives | |
| 3- | hydroxy-4-pentene nitrile |
| CAS: 27451-36-1 Use(s): natural substances and extractives | |
| 2- | hydroxy-5-pentyl tetrahydrofuran |
| CAS: 78053-99-3 Use(s): natural substances and extractives | |
| hydroxypeucedanin | |
| CAS: 2643-85-8 Use(s): natural substances and extractives | |
| 2- | hydroxyphenethyl alcohol |
| CAS: 7768-28-7 EC: 231-863-3 Use(s): natural substances and extractives | |
| 3- | hydroxyphenethyl alcohol |
| CAS: 13398-94-2 EC: 236-485-2 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxyphenethyl alcohol |
| CAS: 501-94-0 EC: 207-930-8 FLAVIS: 02.166 Use(s): flavoring agents | |
| p- | hydroxyphenethyl trans-ferulate |
| CAS: 84873-15-4 Use(s): natural substances and extractives | |
| 2- | hydroxyphenyl acetic acid |
| CAS: 614-75-5 EC: 210-393-2 Use(s): natural substances and extractives | |
| 3- | hydroxyphenyl acetic acid |
| CAS: 621-37-4 EC: 210-684-4 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxy-4-phenyl-2-butanone |
| CAS: 5355-63-5 FEMA: 4052 JECFA: 2041 FLAVIS: 07.242 Use(s): flavoring agents | |
| 2-(4- | hydroxyphenyl) ethyl acetate |
| CAS: 58556-55-1 Use(s): natural substances and extractives | |
| 2- | hydroxy-6-oxo-6-phenyl hexa-2,4-dienoate |
| CAS: 50480-67-6 Use(s): natural substances and extractives | |
| 4- | hydroxyphenyl lactic acid |
| CAS: 306-23-0 Use(s): information only not used for fragrances or flavors | |
| 3-(4- | hydroxyphenyl)-1-propanol |
| CAS: 10210-17-0 EC: 233-511-4 Use(s): natural substances and extractives | |
| 3-(4- | hydroxyphenyl) propyl acetate |
| CAS: 80373-18-8 Use(s): natural substances and extractives | |
| 1-(2- | hydroxyphenyl)-3-(pyridin-4-yl)propan-1-one |
| CAS: 1186004-10-3 FEMA: 4721 JECFA: 2158 Use(s): sweeteners, flavor enhancers | |
| bis(4- | hydroxyphenyl) methane |
| CAS: 620-92-8 EC: 210-658-2 Use(s): indirect food additives: adhesives and components of coatings | |
| 7-(4- | hydroxyphenyl)-1-phenyl-4-hepten-3-one |
| CAS: 100667-52-5 Use(s): natural substances and extractives | |
| (E)-3-(4- | hydroxyphenyl)-2-propenal |
| CAS: 2538-87-6 Use(s): natural substances and extractives | |
| (-)-(E)-1-(4- | hydroxyphenyl)-7-phenyl-6-hepten-3-ol |
| CAS: 158697-54-2 Use(s): natural substances and extractives | |
| 1,1,1-tris(4- | hydroxyphenyl)ethane |
| CAS: 27955-94-8 EC: 405-800-7 Use(s): indirect food additives: adhesives and components of coatings | |
| 2,2' bis( | hydroxyphenyl)methane |
| CAS: 2467-02-9 EC: 219-578-2 Use(s): indirect food additives: adhesives and components of coatings | |
| 2,4' bis( | hydroxyphenyl)methane |
| CAS: 1333-03-0 EC: 219-578-2 Use(s): indirect food additives: adhesives and components of coatings | |
| bis( | hydroxyphenyl)methane |
| CAS: 1333-16-0 Use(s): indirect food additives: adhesives and components of coatings | |
| 2,2-bis(4- | hydroxyphenyl)propane bis(phthalic anhydride) |
| CAS: 38103-06-9 EC: 253-781-7 Use(s): indirect food additives: adhesives and components of coatings | |
| 4- | hydroxyphthalide |
| CAS: 13161-32-5 Use(s): natural substances and extractives | |
| 23- | hydroxyphysalolactone |
| CAS: 118194-16-4 Use(s): natural substances and extractives | |
| 8- | hydroxypinoresinol |
| CAS: 81426-17-7 Use(s): natural substances and extractives | |
| 4- | hydroxypiperitone |
| CAS: 41853-05-8 Use(s): natural substances and extractives | |
| hydroxyproline | |
| CAS: 51-35-4 EC: 200-091-9 Use(s): special dietary and nutritional additives | |
| 4- | hydroxyproline |
| CAS: 6912-67-0 Use(s): information only not used for fragrances or flavors | |
| (±)-4- | hydroxyproline |
| CAS: 36901-87-8 Use(s): flavoring agents | |
| (R)-4- | hydroxyproline |
| CAS: 36901-86-7 Use(s): information only not used for fragrances or flavors | |
| (S)-4- | hydroxyproline |
| CAS: 18610-59-8 Use(s): information only not used for fragrances or flavors | |
| cis-4- | hydroxy-dextro-proline |
| CAS: 2584-71-6 EC: 219-963-5 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxypropanal acetate |
| CAS: 22094-23-1 EC: 244-775-5 Use(s): natural substances and extractives | |
| 2- | hydroxypropiophenone |
| CAS: 610-99-1 EC: 210-244-1 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxypropiophenone |
| CAS: 70-70-2 EC: 200-743-2 Use(s): information only not used for fragrances or flavors | |
| beta- | hydroxypropiovanillone |
| CAS: 2196-18-1 Use(s): natural substances and extractives | |
| 2- | hydroxypropyl acrylate |
| CAS: 999-61-1 EC: 213-663-8 Use(s): indirect food additives: adhesives and components of coatings | |
| hydroxypropyl cellulose | |
| CAS: 9004-64-2 Use(s): multipurpose additives, foam promoter, mouthfeel, stabilizer | |
| starch food modified: | hydroxypropyl distarch glycerol |
| CAS: 59419-60-2 Use(s): food starch-modified | |
| starch food modified: | hydroxypropyl distarch phosphate |
| CAS: 53124-00-8 Use(s): food starch-modified | |
| 2- | hydroxypropyl 2-ethyl hexanoate |
| CAS: 58921-10-1 EC: 261-499-0 Use(s): natural substances and extractives | |
| 2- | hydroxypropyl heptanoate |
| CAS: 7249-54-9 EC: 230-658-6 Use(s): cosmetic agents | |
| 4- | hydroxy-3-propyl-2-hexanone |
| CAS: 134332-15-3 Use(s): natural substances and extractives | |
| hydroxypropyl methyl cellulose | |
| CAS: 9004-65-3 Use(s): multipurpose additives | |
| 2- | hydroxy-3-(isopropyl)-6-methyl-2-cyclohexen-1-one |
| CAS: 54783-36-7 EC: 259-345-2 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-6-isopropyl-3-methyl-2-cyclohexen-1-one |
| CAS: 141978-04-3 Use(s): information only not used for fragrances or flavors | |
| 8- | hydroxy-5-isopropyl-8-methyl-non-6-en-2-one |
| Use(s): information only not used for fragrances or flavors | |
| 8- | hydroxy-5-isopropyl-nonan-2-one |
| CAS: NF0242 Use(s): information only not used for fragrances or flavors | |
| 8- | hydroxy-5-isopropyl-non-6-en-2-one |
| Use(s): information only not used for fragrances or flavors | |
| starch food modified: | hydroxypropyl starch |
| CAS: 9049-76-7 Use(s): food starch-modified | |
| starch food modified: oxidized | hydroxypropyl starch |
| CAS: 68412-86-2 Use(s): food starch-modified | |
| 5- | hydroxypyrazinoic acid |
| CAS: 34604-60-9 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxypyridine |
| CAS: 109-00-2 EC: 203-637-4 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxypyridine |
| CAS: 626-64-2 EC: 210-958-3 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxy-2-pyrone |
| CAS: 496-64-0 Use(s): natural substances and extractives | |
| hydroxypyruvaldehyde | |
| CAS: 997-10-4 Use(s): natural substances and extractives | |
| 3- | hydroxypyruvic acid |
| CAS: 1113-60-6 FEMA: 3843 JECFA: 635 FLAVIS: 08.086 Use(s): flavoring agents | |
| 4- | hydroxyquinoline |
| CAS: 611-36-9 EC: 210-268-2 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxyresveratrol |
| CAS: 331443-00-6 Use(s): cosmetic agents | |
| 4- | hydroxysafranal |
| CAS: 35692-94-5 Use(s): natural substances and extractives | |
| 1'- | hydroxysafrole |
| CAS: 5208-87-7 Use(s): natural substances and extractives | |
| 3'- | hydroxysafrole |
| CAS: 63785-57-9 Use(s): natural substances and extractives | |
| 6- | hydroxysandoricin |
| CAS: 133585-56-5 Use(s): natural substances and extractives | |
| 3- | hydroxysclareol |
| CAS: 132796-57-7 Use(s): natural substances and extractives | |
| 18- | hydroxysclareol |
| CAS: 86248-66-0 Use(s): information only not used for fragrances or flavors | |
| 12- | hydroxysecophenol |
| CAS: 79683-94-6 Use(s): natural substances and extractives | |
| 9- | hydroxyselina-4,11-dien-14-oic acid |
| CAS: 92911-82-5 Use(s): natural substances and extractives | |
| 6- | hydroxyshogaol |
| CAS: 143114-93-6 Use(s): natural substances and extractives | |
| hydroxyspheroidene | |
| CAS: 1191-20-4 Use(s): natural substances and extractives | |
| 12- | hydroxystearic acid |
| CAS: 106-14-9 EC: 203-366-1 Use(s): cosmetic agents | |
| 8- | hydroxysubspinosin |
| CAS: 80557-10-4 Use(s): natural substances and extractives | |
| hydroxytanshinone | |
| CAS: 18887-18-8 Use(s): natural substances and extractives | |
| 9- | hydroxy-gamma-tetradecalactone |
| CAS: 122629-53-2 Use(s): natural substances and extractives | |
| 11- | hydroxytetradecanoic acid |
| CAS: 2034-56-2 Use(s): natural substances and extractives | |
| 3- | hydroxytetrahydrofuran |
| CAS: 453-20-3 EC: 207-219-2 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxythiophenol |
| CAS: 1121-24-0 EC: 214-326-8 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxythiophenol |
| CAS: 40248-84-8 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxythiophenol |
| CAS: 637-89-8 EC: 211-307-6 Use(s): information only not used for fragrances or flavors | |
| butylated | hydroxytoluene |
| CAS: 128-37-0 EC: 204-881-4 FEMA: 2184 Use(s): antioxidants and preservatives for fragrance and flavor | |
| 4- | hydroxy-3,5,6-trimethyl-4-(3-oxo-1-butenyl)-2-cyclohexen-1-one |
| CAS: 77846-84-5 Use(s): natural substances and extractives | |
| 4- | hydroxy-3,5,5-trimethyl-4-(3-oxo-1-butynyl)-2-cyclohexen-1-one |
| CAS: 120853-12-5 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-2,6,6-trimethyl cyclohex-2-en-1-one |
| CAS: 19620-37-2 EC: 243-192-3 Use(s): information only not used for fragrances or flavors | |
| 4- | hydroxy-2,6,6-trimethyl-3-oxo-1,4-cyclohexadiene carbaldehyde |
| CAS: 35692-95-6 Use(s): natural substances and extractives | |
| 2- | hydroxy-4,4,6-trimethyl-2,5-cyclohexadien-1-one |
| CAS: 28750-52-9 Use(s): natural substances and extractives | |
| 4- | hydroxy-2,2,6-trimethyl cyclohexanone |
| CAS: 20548-02-1 Use(s): information only not used for fragrances or flavors | |
| 3- | hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexene carbaldehyde |
| CAS: 33399-08-5 Use(s): natural substances and extractives | |
| 2- | hydroxy-3,5,5-trimethyl-2-cyclohexene-1,4-dione |
| CAS: 35692-98-9 Use(s): natural substances and extractives | |
| 2- | hydroxy-3,4,4-trimethyl-2-cyclopentenone |
| CAS: 86702-81-0 Use(s): information only not used for fragrances or flavors | |
| 2- | hydroxy-3,4,5-trimethyl-2-cyclopenten-1-one |
| CAS: 109682-87-3 Use(s): flavor and fragrance agents | |
| 2- | hydroxy-3,5,5-trimethyl-2-cyclopenten-1-one |
| CAS: 53263-56-2 Use(s): natural substances and extractives | |
| cis-2- | hydroxy-3,4,5-trimethyl-2-cyclopenten-1-one |
| CAS: 125476-24-6 Use(s): information only not used for fragrances or flavors | |
| trans-2- | hydroxy-3,4,5-trimethyl-2-cyclopenten-1-one |
| CAS: 125476-23-5 Use(s): information only not used for fragrances or flavors | |
| hydroxy-2,2,4-trimethyl pentyl isobutyrate | |
| CAS: 93951-35-0 EC: 300-653-4 Use(s): information only not used for fragrances or flavors | |
| 10- | hydroxy-3,6,10-trimethyl-3-undecen-2-one |
| CAS: 68141-19-5 EC: 268-841-8 Use(s): fragrance agents | |
| 6- | hydroxytropinone |
| CAS: 5932-53-6 EC: 227-677-7 Use(s): natural substances and extractives | |
| 5- | hydroxytryptophan |
| CAS: 56-69-9 EC: 204-039-6 Use(s): food additive | |
| hydroxytyrosol | |
| CAS: 10597-60-1 Use(s): cosmetic ingredient for skin conditioning | |
| 11- | hydroxyundecanoic acid |
| CAS: 3669-80-5 EC: 222-932-9 Use(s): information only not used for fragrances or flavors | |
| hydroxyvalerenic acid | |
| CAS: 1619-16-5 Use(s): natural substances and extractives | |
| 5- | hydroxyvanillin |
| CAS: 3934-87-0 EC: 223-513-3 Use(s): information only not used for fragrances or flavors | |
| 1- | hydroxyxanthone |
| CAS: 719-41-5 Use(s): natural substances and extractives | |
| hyenanchin | |
| CAS: 3484-46-6 Use(s): natural substances and extractives | |
| hymenolane | |
| CAS: 62121-29-3 Use(s): natural substances and extractives | |
| alpha- | hymentherene |
| CAS: 6876-07-9 Use(s): natural substances and extractives | |
| hyperoside | |
| CAS: 482-36-0 EC: 207-580-6 Use(s): food additive | |
| hypophyllanthin | |
| CAS: 33676-00-5 Use(s): information only not used for fragrances or flavors | |
| hypoxanthine | |
| CAS: 68-94-0 EC: 200-697-3 Use(s): natural substances and extractives |