|
Category:information only not used for fragrances or flavors
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
| Assay: | 95.00 to 100.00
|
| Food Chemicals Codex Listed: | No |
Organoleptic Properties:
| Odor and/or flavor descriptions from others (if found). |
Cosmetic Information:
Suppliers:
Safety Information:
| |
| Hazards identification |
| |
| Classification of the substance or mixture |
| GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
| None found. |
| GHS Label elements, including precautionary statements |
| |
| Pictogram | |
| |
| Hazard statement(s) |
| None found. |
| Precautionary statement(s) |
| None found. |
| Oral/Parenteral Toxicity: |
|
Not determined
|
| Dermal Toxicity: |
|
Not determined
|
| Inhalation Toxicity: |
|
Not determined
|
Safety in Use Information:
| Category: | | information only not used for fragrances or flavors |
| Recommendation for 4,4,8-trimethyl-9-methylene-bicyclo[3.3.1]nonan-6-one usage levels up to: | | | not for fragrance use.
|
| |
| Recommendation for 4,4,8-trimethyl-9-methylene-bicyclo[3.3.1]nonan-6-one flavor usage levels up to: |
| | not for flavor use.
|
Safety References:
References:
Other Information:
Potential Blenders and core components note
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| 4,4,8- | trimethyl-9-methylene bicyclo(3.3.1)nonan-6-one | | 4,4,8- | trimethyl-9-methylene bicyclo[3.3.1]nonan-6-one | | 4,4,8- | trimethyl-9-methylenebicyclo(3.3.1)nonan-6-one | | 4,4,8- | trimethyl-9-methylenebicyclo[3.3.1]nonan-6-one |
Articles:
|